Mercurial > altnet-hispano
changeset 10:c62b77fc33f4
website inicial
line wrap: on
line diff
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Domain/AgendaFactory.cs Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,12 @@ +namespace AltNetHispano.Agendas.Domain +{ + public static class AgendaFactory + { + private static readonly Agenda Agenda = new Agenda(null, null, null); + + public static Agenda GetAgenda() + { + return Agenda; + } + } +} \ No newline at end of file
--- a/Agendas/trunk/src/Agendas.Domain/Agendas.Domain.csproj Sat Feb 12 12:22:36 2011 -0300 +++ b/Agendas/trunk/src/Agendas.Domain/Agendas.Domain.csproj Sun Mar 13 18:51:06 2011 -0300 @@ -41,6 +41,7 @@ </ItemGroup> <ItemGroup> <Compile Include="Agenda.cs" /> + <Compile Include="AgendaFactory.cs" /> <Compile Include="Cafe.cs" /> <Compile Include="CompositePublicador.cs" /> <Compile Include="Evento.cs" />
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Agendas.Web.csproj Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,169 @@ +<?xml version="1.0" encoding="utf-8"?> +<Project ToolsVersion="4.0" DefaultTargets="Build" xmlns="http://schemas.microsoft.com/developer/msbuild/2003"> + <PropertyGroup> + <Configuration Condition=" '$(Configuration)' == '' ">Debug</Configuration> + <Platform Condition=" '$(Platform)' == '' ">AnyCPU</Platform> + <ProductVersion> + </ProductVersion> + <SchemaVersion>2.0</SchemaVersion> + <ProjectGuid>{319A8E3D-C61E-455F-A1BF-A6B1B1636BAB}</ProjectGuid> + <ProjectTypeGuids>{E53F8FEA-EAE0-44A6-8774-FFD645390401};{349c5851-65df-11da-9384-00065b846f21};{fae04ec0-301f-11d3-bf4b-00c04f79efbc}</ProjectTypeGuids> + <OutputType>Library</OutputType> + <AppDesignerFolder>Properties</AppDesignerFolder> + <RootNamespace>Agendas.Web</RootNamespace> + <AssemblyName>Agendas.Web</AssemblyName> + <TargetFrameworkVersion>v4.0</TargetFrameworkVersion> + <MvcBuildViews>false</MvcBuildViews> + </PropertyGroup> + <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' "> + <DebugSymbols>true</DebugSymbols> + <DebugType>full</DebugType> + <Optimize>false</Optimize> + <OutputPath>bin\</OutputPath> + <DefineConstants>DEBUG;TRACE</DefineConstants> + <ErrorReport>prompt</ErrorReport> + <WarningLevel>4</WarningLevel> + </PropertyGroup> + <PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' "> + <DebugType>pdbonly</DebugType> + <Optimize>true</Optimize> + <OutputPath>bin\</OutputPath> + <DefineConstants>TRACE</DefineConstants> + <ErrorReport>prompt</ErrorReport> + <WarningLevel>4</WarningLevel> + </PropertyGroup> + <ItemGroup> + <Reference Include="Microsoft.CSharp" /> + <Reference Include="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31bf3856ad364e35, processorArchitecture=MSIL" /> + <Reference Include="System.Web.WebPages" /> + <Reference Include="System.Web.Helpers" /> + <Reference Include="System" /> + <Reference Include="System.Data" /> + <Reference Include="System.Drawing" /> + <Reference Include="System.Web.DynamicData" /> + <Reference Include="System.Web.Entity" /> + <Reference Include="System.Web.ApplicationServices" /> + <Reference Include="System.ComponentModel.DataAnnotations" /> + <Reference Include="System.Core" /> + <Reference Include="System.Data.DataSetExtensions" /> + <Reference Include="System.Xml.Linq" /> + <Reference Include="System.Web" /> + <Reference Include="System.Web.Extensions" /> + <Reference Include="System.Web.Abstractions" /> + <Reference Include="System.Web.Routing" /> + <Reference Include="System.Xml" /> + <Reference Include="System.Configuration" /> + <Reference Include="System.Web.Services" /> + <Reference Include="System.EnterpriseServices" /> + </ItemGroup> + <ItemGroup> + <Compile Include="Controllers\AccountController.cs" /> + <Compile Include="Controllers\AgendaController.cs" /> + <Compile Include="Controllers\HomeController.cs" /> + <Compile Include="Global.asax.cs"> + <DependentUpon>Global.asax</DependentUpon> + </Compile> + <Compile Include="Models\AccountModels.cs" /> + <Compile Include="Models\AgendaModel.cs" /> + <Compile Include="Properties\AssemblyInfo.cs" /> + </ItemGroup> + <ItemGroup> + <Content Include="Global.asax" /> + <Content Include="Web.config" /> + <Content Include="Web.Debug.config"> + <DependentUpon>Web.config</DependentUpon> + </Content> + <Content Include="Web.Release.config"> + <DependentUpon>Web.config</DependentUpon> + </Content> + <Content Include="Content\Site.css" /> + <Content Include="Content\themes\base\jquery-ui.css" /> + <Content Include="Content\themes\base\images\ui-bg_flat_0_aaaaaa_40x100.png" /> + <Content Include="Content\themes\base\images\ui-bg_flat_75_ffffff_40x100.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_55_fbf9ee_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_65_ffffff_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_75_dadada_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_75_e6e6e6_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_glass_95_fef1ec_1x400.png" /> + <Content Include="Content\themes\base\images\ui-bg_highlight-soft_75_cccccc_1x100.png" /> + <Content Include="Content\themes\base\images\ui-icons_222222_256x240.png" /> + <Content Include="Content\themes\base\images\ui-icons_2e83ff_256x240.png" /> + <Content Include="Content\themes\base\images\ui-icons_454545_256x240.png" /> + <Content Include="Content\themes\base\images\ui-icons_888888_256x240.png" /> + <Content Include="Content\themes\base\images\ui-icons_cd0a0a_256x240.png" /> + <Content Include="Scripts\jquery-1.4.4.js" /> + <Content Include="Scripts\jquery-1.4.4.min.js" /> + <Content Include="Scripts\jquery-1.4.4-vsdoc.js" /> + <Content Include="Scripts\jquery.unobtrusive-ajax.js" /> + <Content Include="Scripts\jquery.unobtrusive-ajax.min.js" /> + <Content Include="Scripts\jquery.validate.js" /> + <Content Include="Scripts\jquery.validate.min.js" /> + <Content Include="Scripts\jquery.validate.unobtrusive.js" /> + <Content Include="Scripts\jquery.validate.unobtrusive.min.js" /> + <Content Include="Scripts\jquery.validate-vsdoc.js" /> + <Content Include="Scripts\jquery-ui.js" /> + <Content Include="Scripts\jquery-ui.min.js" /> + <Content Include="Scripts\MicrosoftAjax.js" /> + <Content Include="Scripts\MicrosoftAjax.debug.js" /> + <Content Include="Scripts\MicrosoftMvcAjax.js" /> + <Content Include="Scripts\MicrosoftMvcAjax.debug.js" /> + <Content Include="Scripts\MicrosoftMvcValidation.js" /> + <Content Include="Scripts\MicrosoftMvcValidation.debug.js" /> + <Content Include="Views\_ViewStart.cshtml" /> + <Content Include="Views\Account\ChangePassword.cshtml" /> + <Content Include="Views\Account\ChangePasswordSuccess.cshtml" /> + <Content Include="Views\Account\LogOn.cshtml" /> + <Content Include="Views\Account\Register.cshtml" /> + <Content Include="Views\Home\About.cshtml" /> + <Content Include="Views\Home\Index.cshtml" /> + <Content Include="Views\Shared\Error.cshtml" /> + <Content Include="Views\Shared\_LogOnPartial.cshtml" /> + <Content Include="Views\Shared\_Layout.cshtml" /> + <Content Include="Views\Web.config" /> + </ItemGroup> + <ItemGroup> + <Folder Include="App_Data\" /> + </ItemGroup> + <ItemGroup> + <Content Include="Views\Agenda\Index.cshtml" /> + </ItemGroup> + <ItemGroup> + <Content Include="Views\Agenda\New.cshtml" /> + </ItemGroup> + <ItemGroup> + <ProjectReference Include="..\Agendas.Domain\Agendas.Domain.csproj"> + <Project>{A14907DF-02E4-4FA7-BE27-4292AF50AA22}</Project> + <Name>Agendas.Domain</Name> + </ProjectReference> + </ItemGroup> + <Import Project="$(MSBuildBinPath)\Microsoft.CSharp.targets" /> + <Import Project="$(MSBuildExtensionsPath32)\Microsoft\VisualStudio\v10.0\WebApplications\Microsoft.WebApplication.targets" /> + <!-- To modify your build process, add your task inside one of the targets below and uncomment it. + Other similar extension points exist, see Microsoft.Common.targets. + <Target Name="BeforeBuild"> + </Target> + <Target Name="AfterBuild"> + </Target> --> + <Target Name="MvcBuildViews" AfterTargets="AfterBuild" Condition="'$(MvcBuildViews)'=='true'"> + <AspNetCompiler VirtualPath="temp" PhysicalPath="$(WebProjectOutputDir)" /> + </Target> + <ProjectExtensions> + <VisualStudio> + <FlavorProperties GUID="{349c5851-65df-11da-9384-00065b846f21}"> + <WebProjectProperties> + <UseIIS>False</UseIIS> + <AutoAssignPort>True</AutoAssignPort> + <DevelopmentServerPort>1424</DevelopmentServerPort> + <DevelopmentServerVPath>/</DevelopmentServerVPath> + <IISUrl> + </IISUrl> + <NTLMAuthentication>False</NTLMAuthentication> + <UseCustomServer>False</UseCustomServer> + <CustomServerUrl> + </CustomServerUrl> + <SaveServerSettingsInUserFile>False</SaveServerSettingsInUserFile> + </WebProjectProperties> + </FlavorProperties> + </VisualStudio> + </ProjectExtensions> +</Project> \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Content/Site.css Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,345 @@ +/*---------------------------------------------------------- +The base color for this template is #5c87b2. If you'd like +to use a different color start by replacing all instances of +#5c87b2 with your new color. +----------------------------------------------------------*/ +body +{ + background-color: #5c87b2; + font-size: 75%; + font-family: Verdana, Tahoma, Arial, "Helvetica Neue", Helvetica, Sans-Serif; + margin: 0; + padding: 0; + color: #696969; +} + +a:link +{ + color: #034af3; + text-decoration: underline; +} +a:visited +{ + color: #505abc; +} +a:hover +{ + color: #1d60ff; + text-decoration: none; +} +a:active +{ + color: #12eb87; +} + +p, ul +{ + margin-bottom: 20px; + line-height: 1.6em; +} + +/* HEADINGS +----------------------------------------------------------*/ +h1, h2, h3, h4, h5, h6 +{ + font-size: 1.5em; + color: #000; +} + +h1 +{ + font-size: 2em; + padding-bottom: 0; + margin-bottom: 0; +} +h2 +{ + padding: 0 0 10px 0; +} +h3 +{ + font-size: 1.2em; +} +h4 +{ + font-size: 1.1em; +} +h5, h6 +{ + font-size: 1em; +} + +/* this rule styles <h2> tags that are the +first child of the left and right table columns */ +.rightColumn > h1, .rightColumn > h2, .leftColumn > h1, .leftColumn > h2 +{ + margin-top: 0; +} + +/* PRIMARY LAYOUT ELEMENTS +----------------------------------------------------------*/ + +/* you can specify a greater or lesser percentage for the +page width. Or, you can specify an exact pixel width. */ +.page +{ + width: 90%; + margin-left: auto; + margin-right: auto; +} + +#header +{ + position: relative; + margin-bottom: 0px; + color: #000; + padding: 0; +} + +#header h1 +{ + font-weight: bold; + padding: 5px 0; + margin: 0; + color: #fff; + border: none; + line-height: 2em; + font-size: 32px !important; +} + +#main +{ + padding: 30px 30px 15px 30px; + background-color: #fff; + margin-bottom: 30px; + _height: 1px; /* only IE6 applies CSS properties starting with an underscore */ +} + +#footer +{ + color: #999; + padding: 10px 0; + text-align: center; + line-height: normal; + margin: 0; + font-size: .9em; +} + +/* TAB MENU +----------------------------------------------------------*/ +ul#menu +{ + border-bottom: 1px #5C87B2 solid; + padding: 0 0 2px; + position: relative; + margin: 0; + text-align: right; +} + +ul#menu li +{ + display: inline; + list-style: none; +} + +ul#menu li#greeting +{ + padding: 10px 20px; + font-weight: bold; + text-decoration: none; + line-height: 2.8em; + color: #fff; +} + +ul#menu li a +{ + padding: 10px 20px; + font-weight: bold; + text-decoration: none; + line-height: 2.8em; + background-color: #e8eef4; + color: #034af3; +} + +ul#menu li a:hover +{ + background-color: #fff; + text-decoration: none; +} + +ul#menu li a:active +{ + background-color: #a6e2a6; + text-decoration: none; +} + +ul#menu li.selected a +{ + background-color: #fff; + color: #000; +} + +/* FORM LAYOUT ELEMENTS +----------------------------------------------------------*/ + +fieldset +{ + border:1px solid #ddd; + padding:0 1.4em 1.4em 1.4em; + margin:0 0 1.5em 0; +} + +legend +{ + font-size:1.2em; + font-weight: bold; +} + +textarea +{ + min-height: 75px; +} + +input[type="text"] +{ + width: 200px; + border: 1px solid #CCC; +} + +input[type="password"] +{ + width: 200px; + border: 1px solid #CCC; +} + +/* TABLE +----------------------------------------------------------*/ + +table +{ + border: solid 1px #e8eef4; + border-collapse: collapse; +} + +table td +{ + padding: 5px; + border: solid 1px #e8eef4; +} + +table th +{ + padding: 6px 5px; + text-align: left; + background-color: #e8eef4; + border: solid 1px #e8eef4; +} + +/* MISC +----------------------------------------------------------*/ +.clear +{ + clear: both; +} + +.error +{ + color:Red; +} + +#menucontainer +{ + margin-top:40px; +} + +div#title +{ + display:block; + float:left; + text-align:left; +} + +#logindisplay +{ + font-size:1.1em; + display:block; + text-align:right; + margin:10px; + color:White; +} + +#logindisplay a:link +{ + color: white; + text-decoration: underline; +} + +#logindisplay a:visited +{ + color: white; + text-decoration: underline; +} + +#logindisplay a:hover +{ + color: white; + text-decoration: none; +} + +/* Styles for validation helpers +-----------------------------------------------------------*/ +.field-validation-error +{ + color: #ff0000; +} + +.field-validation-valid +{ + display: none; +} + +.input-validation-error +{ + border: 1px solid #ff0000; + background-color: #ffeeee; +} + +.validation-summary-errors +{ + font-weight: bold; + color: #ff0000; +} + +.validation-summary-valid +{ + display: none; +} + +/* Styles for editor and display helpers +----------------------------------------------------------*/ +.display-label, +.editor-label +{ + margin: 1em 0 0 0; +} + +.display-field, +.editor-field +{ + margin:0.5em 0 0 0; +} + +.text-box +{ + width: 30em; +} + +.text-box.multi-line +{ + height: 6.5em; +} + +.tri-state +{ + width: 6em; +}
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-bg_flat_75_ffffff_40x100.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-bg_glass_65_ffffff_1x400.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-bg_glass_75_dadada_1x400.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-icons_222222_256x240.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-icons_2e83ff_256x240.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-icons_454545_256x240.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-icons_888888_256x240.png has changed
Binary file Agendas/trunk/src/Agendas.Web/Content/themes/base/images/ui-icons_cd0a0a_256x240.png has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Content/themes/base/jquery-ui.css Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,635 @@ +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI CSS Framework 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Accordion 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; }/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Autocomplete 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Menu 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Button 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Datepicker 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Dialog 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Progressbar 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Resizable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Selectable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Slider 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Tabs 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI CSS Framework 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/ + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; border-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; } \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Controllers/AccountController.cs Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,151 @@ +using System; +using System.Collections.Generic; +using System.Diagnostics.CodeAnalysis; +using System.Linq; +using System.Security.Principal; +using System.Web; +using System.Web.Mvc; +using System.Web.Routing; +using System.Web.Security; +using Agendas.Web.Models; + +namespace Agendas.Web.Controllers +{ + public class AccountController : Controller + { + + public IFormsAuthenticationService FormsService { get; set; } + public IMembershipService MembershipService { get; set; } + + protected override void Initialize(RequestContext requestContext) + { + if (FormsService == null) { FormsService = new FormsAuthenticationService(); } + if (MembershipService == null) { MembershipService = new AccountMembershipService(); } + + base.Initialize(requestContext); + } + + // ************************************** + // URL: /Account/LogOn + // ************************************** + + public ActionResult LogOn() + { + return View(); + } + + [HttpPost] + public ActionResult LogOn(LogOnModel model, string returnUrl) + { + if (ModelState.IsValid) + { + if (MembershipService.ValidateUser(model.UserName, model.Password)) + { + FormsService.SignIn(model.UserName, model.RememberMe); + if (Url.IsLocalUrl(returnUrl)) + { + return Redirect(returnUrl); + } + else + { + return RedirectToAction("Index", "Home"); + } + } + else + { + ModelState.AddModelError("", "The user name or password provided is incorrect."); + } + } + + // If we got this far, something failed, redisplay form + return View(model); + } + + // ************************************** + // URL: /Account/LogOff + // ************************************** + + public ActionResult LogOff() + { + FormsService.SignOut(); + + return RedirectToAction("Index", "Home"); + } + + // ************************************** + // URL: /Account/Register + // ************************************** + + public ActionResult Register() + { + ViewBag.PasswordLength = MembershipService.MinPasswordLength; + return View(); + } + + [HttpPost] + public ActionResult Register(RegisterModel model) + { + if (ModelState.IsValid) + { + // Attempt to register the user + MembershipCreateStatus createStatus = MembershipService.CreateUser(model.UserName, model.Password, model.Email); + + if (createStatus == MembershipCreateStatus.Success) + { + FormsService.SignIn(model.UserName, false /* createPersistentCookie */); + return RedirectToAction("Index", "Home"); + } + else + { + ModelState.AddModelError("", AccountValidation.ErrorCodeToString(createStatus)); + } + } + + // If we got this far, something failed, redisplay form + ViewBag.PasswordLength = MembershipService.MinPasswordLength; + return View(model); + } + + // ************************************** + // URL: /Account/ChangePassword + // ************************************** + + [Authorize] + public ActionResult ChangePassword() + { + ViewBag.PasswordLength = MembershipService.MinPasswordLength; + return View(); + } + + [Authorize] + [HttpPost] + public ActionResult ChangePassword(ChangePasswordModel model) + { + if (ModelState.IsValid) + { + if (MembershipService.ChangePassword(User.Identity.Name, model.OldPassword, model.NewPassword)) + { + return RedirectToAction("ChangePasswordSuccess"); + } + else + { + ModelState.AddModelError("", "The current password is incorrect or the new password is invalid."); + } + } + + // If we got this far, something failed, redisplay form + ViewBag.PasswordLength = MembershipService.MinPasswordLength; + return View(model); + } + + // ************************************** + // URL: /Account/ChangePasswordSuccess + // ************************************** + + public ActionResult ChangePasswordSuccess() + { + return View(); + } + + } +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Controllers/AgendaController.cs Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,58 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Web.Mvc; +using Agendas.Web.Models; +using AltNetHispano.Agendas.Domain; +using AltNetHispano.Agendas.Domain.Exceptions; + +namespace Agendas.Web.Controllers +{ + public class AgendaController : Controller + { + public ActionResult Index() + { + var model = GetIndexModel(); + return View(model); + } + + private static AgendaIndexModel GetIndexModel() + { + var agenda = AgendaFactory.GetAgenda(); + + return new AgendaIndexModel + { + ProximosEventos = from e in agenda.GetEventosPublicados() + select new EventoDto {Id = e.Id.ToString(), Titulo = e.Titulo} + }; + } + + public ActionResult New() + { + return View(); + } + + [HttpPost] + public ActionResult New(AgendaNewModel model) + { + if (ModelState.IsValid) + { + var agenda = AgendaFactory.GetAgenda(); + + try + { + agenda.Publicar(new Van {Titulo = model.Titulo, Ponente = model.Ponente, Fecha = model.Fecha}); + + return View("Index", GetIndexModel()); + } + catch (ValidationException ex) + { + ModelState.AddModelError("error", ex.ToString()); + } + } + return View(model); + } + + + } +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Controllers/HomeController.cs Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,21 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Web; +using System.Web.Mvc; + +namespace Agendas.Web.Controllers +{ + public class HomeController : Controller + { + public ActionResult Index() + { + return View(); + } + + public ActionResult About() + { + return View(); + } + } +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Global.asax Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,1 @@ +<%@ Application Codebehind="Global.asax.cs" Inherits="Agendas.Web.MvcApplication" Language="C#" %>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Global.asax.cs Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,40 @@ +using System; +using System.Collections.Generic; +using System.Linq; +using System.Web; +using System.Web.Mvc; +using System.Web.Routing; + +namespace Agendas.Web +{ + // Note: For instructions on enabling IIS6 or IIS7 classic mode, + // visit http://go.microsoft.com/?LinkId=9394801 + + public class MvcApplication : System.Web.HttpApplication + { + public static void RegisterGlobalFilters(GlobalFilterCollection filters) + { + filters.Add(new HandleErrorAttribute()); + } + + public static void RegisterRoutes(RouteCollection routes) + { + routes.IgnoreRoute("{resource}.axd/{*pathInfo}"); + + routes.MapRoute( + "Default", // Route name + "{controller}/{action}/{id}", // URL with parameters + new { controller = "Home", action = "Index", id = UrlParameter.Optional } // Parameter defaults + ); + + } + + protected void Application_Start() + { + AreaRegistration.RegisterAllAreas(); + + RegisterGlobalFilters(GlobalFilters.Filters); + RegisterRoutes(RouteTable.Routes); + } + } +} \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Models/AccountModels.cs Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,250 @@ +using System; +using System.Collections.Generic; +using System.ComponentModel; +using System.ComponentModel.DataAnnotations; +using System.Globalization; +using System.Linq; +using System.Web; +using System.Web.Mvc; +using System.Web.Security; + +namespace Agendas.Web.Models +{ + + #region Models + + public class ChangePasswordModel + { + [Required] + [DataType(DataType.Password)] + [Display(Name = "Current password")] + public string OldPassword { get; set; } + + [Required] + [ValidatePasswordLength] + [DataType(DataType.Password)] + [Display(Name = "New password")] + public string NewPassword { get; set; } + + [DataType(DataType.Password)] + [Display(Name = "Confirm new password")] + [Compare("NewPassword", ErrorMessage = "The new password and confirmation password do not match.")] + public string ConfirmPassword { get; set; } + } + + public class LogOnModel + { + [Required] + [Display(Name = "User name")] + public string UserName { get; set; } + + [Required] + [DataType(DataType.Password)] + [Display(Name = "Password")] + public string Password { get; set; } + + [Display(Name = "Remember me?")] + public bool RememberMe { get; set; } + } + + + public class RegisterModel + { + [Required] + [Display(Name = "User name")] + public string UserName { get; set; } + + [Required] + [DataType(DataType.EmailAddress)] + [Display(Name = "Email address")] + public string Email { get; set; } + + [Required] + [ValidatePasswordLength] + [DataType(DataType.Password)] + [Display(Name = "Password")] + public string Password { get; set; } + + [DataType(DataType.Password)] + [Display(Name = "Confirm password")] + [Compare("Password", ErrorMessage = "The password and confirmation password do not match.")] + public string ConfirmPassword { get; set; } + } + #endregion + + #region Services + // The FormsAuthentication type is sealed and contains static members, so it is difficult to + // unit test code that calls its members. The interface and helper class below demonstrate + // how to create an abstract wrapper around such a type in order to make the AccountController + // code unit testable. + + public interface IMembershipService + { + int MinPasswordLength { get; } + + bool ValidateUser(string userName, string password); + MembershipCreateStatus CreateUser(string userName, string password, string email); + bool ChangePassword(string userName, string oldPassword, string newPassword); + } + + public class AccountMembershipService : IMembershipService + { + private readonly MembershipProvider _provider; + + public AccountMembershipService() + : this(null) + { + } + + public AccountMembershipService(MembershipProvider provider) + { + _provider = provider ?? Membership.Provider; + } + + public int MinPasswordLength + { + get + { + return _provider.MinRequiredPasswordLength; + } + } + + public bool ValidateUser(string userName, string password) + { + if (String.IsNullOrEmpty(userName)) throw new ArgumentException("Value cannot be null or empty.", "userName"); + if (String.IsNullOrEmpty(password)) throw new ArgumentException("Value cannot be null or empty.", "password"); + + return _provider.ValidateUser(userName, password); + } + + public MembershipCreateStatus CreateUser(string userName, string password, string email) + { + if (String.IsNullOrEmpty(userName)) throw new ArgumentException("Value cannot be null or empty.", "userName"); + if (String.IsNullOrEmpty(password)) throw new ArgumentException("Value cannot be null or empty.", "password"); + if (String.IsNullOrEmpty(email)) throw new ArgumentException("Value cannot be null or empty.", "email"); + + MembershipCreateStatus status; + _provider.CreateUser(userName, password, email, null, null, true, null, out status); + return status; + } + + public bool ChangePassword(string userName, string oldPassword, string newPassword) + { + if (String.IsNullOrEmpty(userName)) throw new ArgumentException("Value cannot be null or empty.", "userName"); + if (String.IsNullOrEmpty(oldPassword)) throw new ArgumentException("Value cannot be null or empty.", "oldPassword"); + if (String.IsNullOrEmpty(newPassword)) throw new ArgumentException("Value cannot be null or empty.", "newPassword"); + + // The underlying ChangePassword() will throw an exception rather + // than return false in certain failure scenarios. + try + { + MembershipUser currentUser = _provider.GetUser(userName, true /* userIsOnline */); + return currentUser.ChangePassword(oldPassword, newPassword); + } + catch (ArgumentException) + { + return false; + } + catch (MembershipPasswordException) + { + return false; + } + } + } + + public interface IFormsAuthenticationService + { + void SignIn(string userName, bool createPersistentCookie); + void SignOut(); + } + + public class FormsAuthenticationService : IFormsAuthenticationService + { + public void SignIn(string userName, bool createPersistentCookie) + { + if (String.IsNullOrEmpty(userName)) throw new ArgumentException("Value cannot be null or empty.", "userName"); + + FormsAuthentication.SetAuthCookie(userName, createPersistentCookie); + } + + public void SignOut() + { + FormsAuthentication.SignOut(); + } + } + #endregion + + #region Validation + public static class AccountValidation + { + public static string ErrorCodeToString(MembershipCreateStatus createStatus) + { + // See http://go.microsoft.com/fwlink/?LinkID=177550 for + // a full list of status codes. + switch (createStatus) + { + case MembershipCreateStatus.DuplicateUserName: + return "Username already exists. Please enter a different user name."; + + case MembershipCreateStatus.DuplicateEmail: + return "A username for that e-mail address already exists. Please enter a different e-mail address."; + + case MembershipCreateStatus.InvalidPassword: + return "The password provided is invalid. Please enter a valid password value."; + + case MembershipCreateStatus.InvalidEmail: + return "The e-mail address provided is invalid. Please check the value and try again."; + + case MembershipCreateStatus.InvalidAnswer: + return "The password retrieval answer provided is invalid. Please check the value and try again."; + + case MembershipCreateStatus.InvalidQuestion: + return "The password retrieval question provided is invalid. Please check the value and try again."; + + case MembershipCreateStatus.InvalidUserName: + return "The user name provided is invalid. Please check the value and try again."; + + case MembershipCreateStatus.ProviderError: + return "The authentication provider returned an error. Please verify your entry and try again. If the problem persists, please contact your system administrator."; + + case MembershipCreateStatus.UserRejected: + return "The user creation request has been canceled. Please verify your entry and try again. If the problem persists, please contact your system administrator."; + + default: + return "An unknown error occurred. Please verify your entry and try again. If the problem persists, please contact your system administrator."; + } + } + } + + [AttributeUsage(AttributeTargets.Field | AttributeTargets.Property, AllowMultiple = false, Inherited = true)] + public sealed class ValidatePasswordLengthAttribute : ValidationAttribute, IClientValidatable + { + private const string _defaultErrorMessage = "'{0}' must be at least {1} characters long."; + private readonly int _minCharacters = Membership.Provider.MinRequiredPasswordLength; + + public ValidatePasswordLengthAttribute() + : base(_defaultErrorMessage) + { + } + + public override string FormatErrorMessage(string name) + { + return String.Format(CultureInfo.CurrentCulture, ErrorMessageString, + name, _minCharacters); + } + + public override bool IsValid(object value) + { + string valueAsString = value as string; + return (valueAsString != null && valueAsString.Length >= _minCharacters); + } + + public IEnumerable<ModelClientValidationRule> GetClientValidationRules(ModelMetadata metadata, ControllerContext context) + { + return new[]{ + new ModelClientValidationStringLengthRule(FormatErrorMessage(metadata.GetDisplayName()), _minCharacters, int.MaxValue) + }; + } + } + #endregion +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Models/AgendaModel.cs Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,46 @@ +using System; +using System.Collections.Generic; +using System.ComponentModel.DataAnnotations; +using System.Web.Mvc; + +namespace Agendas.Web.Models +{ + public class AgendaIndexModel + { + public IEnumerable<EventoDto> ProximosEventos { get; set; } + } + + public class AgendaNewModel + { + [Required(ErrorMessage = "debe ingresar el título")] + public string Titulo { get; set; } + + [Required(ErrorMessage = "debe ingresar el nombre del ponente")] + public string Ponente { get; set; } + + [Required(ErrorMessage = "debe ingresar la fecha del evento")] + public DateTime Fecha { get; set; } + } + + public class AgendaEditModel + { + [HiddenInput(DisplayValue = false)] + public string Id { get; set; } + + [Required(ErrorMessage = "debe ingresar el título")] + public string Titulo { get; set; } + + [Required(ErrorMessage = "debe ingresar el nombre del ponente")] + public string Ponente { get; set; } + + [Required(ErrorMessage = "debe ingresar la fecha del evento")] + public DateTime Fecha { get; set; } + } + + + public class EventoDto + { + public string Id { get; set; } + public string Titulo { get; set; } + } +} \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Properties/AssemblyInfo.cs Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,35 @@ +using System.Reflection; +using System.Runtime.CompilerServices; +using System.Runtime.InteropServices; + +// General Information about an assembly is controlled through the following +// set of attributes. Change these attribute values to modify the information +// associated with an assembly. +[assembly: AssemblyTitle("Agendas.Web")] +[assembly: AssemblyDescription("")] +[assembly: AssemblyConfiguration("")] +[assembly: AssemblyCompany("Microsoft")] +[assembly: AssemblyProduct("Agendas.Web")] +[assembly: AssemblyCopyright("Copyright © Microsoft 2011")] +[assembly: AssemblyTrademark("")] +[assembly: AssemblyCulture("")] + +// Setting ComVisible to false makes the types in this assembly not visible +// to COM components. If you need to access a type in this assembly from +// COM, set the ComVisible attribute to true on that type. +[assembly: ComVisible(false)] + +// The following GUID is for the ID of the typelib if this project is exposed to COM +[assembly: Guid("d279aad8-1c4d-4695-b773-30258332ba87")] + +// Version information for an assembly consists of the following four values: +// +// Major Version +// Minor Version +// Build Number +// Revision +// +// You can specify all the values or you can default the Revision and Build Numbers +// by using the '*' as shown below: +[assembly: AssemblyVersion("1.0.0.0")] +[assembly: AssemblyFileVersion("1.0.0.0")]
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/MicrosoftAjax.debug.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,7117 @@ +// Name: MicrosoftAjax.debug.js +// Assembly: System.Web.Extensions +// Version: 4.0.0.0 +// FileVersion: 4.0.20526.0 +//----------------------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//----------------------------------------------------------------------- +// MicrosoftAjax.js +// Microsoft AJAX Framework. + +Function.__typeName = 'Function'; +Function.__class = true; +Function.createCallback = function Function$createCallback(method, context) { + /// <summary locid="M:J#Function.createCallback" /> + /// <param name="method" type="Function"></param> + /// <param name="context" mayBeNull="true"></param> + /// <returns type="Function"></returns> + var e = Function._validateParams(arguments, [ + {name: "method", type: Function}, + {name: "context", mayBeNull: true} + ]); + if (e) throw e; + return function() { + var l = arguments.length; + if (l > 0) { + var args = []; + for (var i = 0; i < l; i++) { + args[i] = arguments[i]; + } + args[l] = context; + return method.apply(this, args); + } + return method.call(this, context); + } +} +Function.createDelegate = function Function$createDelegate(instance, method) { + /// <summary locid="M:J#Function.createDelegate" /> + /// <param name="instance" mayBeNull="true"></param> + /// <param name="method" type="Function"></param> + /// <returns type="Function"></returns> + var e = Function._validateParams(arguments, [ + {name: "instance", mayBeNull: true}, + {name: "method", type: Function} + ]); + if (e) throw e; + return function() { + return method.apply(instance, arguments); + } +} +Function.emptyFunction = Function.emptyMethod = function Function$emptyMethod() { + /// <summary locid="M:J#Function.emptyMethod" /> +} +Function.validateParameters = function Function$validateParameters(parameters, expectedParameters, validateParameterCount) { + /// <summary locid="M:J#Function.validateParameters" /> + /// <param name="parameters"></param> + /// <param name="expectedParameters"></param> + /// <param name="validateParameterCount" type="Boolean" optional="true"></param> + /// <returns type="Error" mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "parameters"}, + {name: "expectedParameters"}, + {name: "validateParameterCount", type: Boolean, optional: true} + ]); + if (e) throw e; + return Function._validateParams(parameters, expectedParameters, validateParameterCount); +} +Function._validateParams = function Function$_validateParams(params, expectedParams, validateParameterCount) { + var e, expectedLength = expectedParams.length; + validateParameterCount = validateParameterCount || (typeof(validateParameterCount) === "undefined"); + e = Function._validateParameterCount(params, expectedParams, validateParameterCount); + if (e) { + e.popStackFrame(); + return e; + } + for (var i = 0, l = params.length; i < l; i++) { + var expectedParam = expectedParams[Math.min(i, expectedLength - 1)], + paramName = expectedParam.name; + if (expectedParam.parameterArray) { + paramName += "[" + (i - expectedLength + 1) + "]"; + } + else if (!validateParameterCount && (i >= expectedLength)) { + break; + } + e = Function._validateParameter(params[i], expectedParam, paramName); + if (e) { + e.popStackFrame(); + return e; + } + } + return null; +} +Function._validateParameterCount = function Function$_validateParameterCount(params, expectedParams, validateParameterCount) { + var i, error, + expectedLen = expectedParams.length, + actualLen = params.length; + if (actualLen < expectedLen) { + var minParams = expectedLen; + for (i = 0; i < expectedLen; i++) { + var param = expectedParams[i]; + if (param.optional || param.parameterArray) { + minParams--; + } + } + if (actualLen < minParams) { + error = true; + } + } + else if (validateParameterCount && (actualLen > expectedLen)) { + error = true; + for (i = 0; i < expectedLen; i++) { + if (expectedParams[i].parameterArray) { + error = false; + break; + } + } + } + if (error) { + var e = Error.parameterCount(); + e.popStackFrame(); + return e; + } + return null; +} +Function._validateParameter = function Function$_validateParameter(param, expectedParam, paramName) { + var e, + expectedType = expectedParam.type, + expectedInteger = !!expectedParam.integer, + expectedDomElement = !!expectedParam.domElement, + mayBeNull = !!expectedParam.mayBeNull; + e = Function._validateParameterType(param, expectedType, expectedInteger, expectedDomElement, mayBeNull, paramName); + if (e) { + e.popStackFrame(); + return e; + } + var expectedElementType = expectedParam.elementType, + elementMayBeNull = !!expectedParam.elementMayBeNull; + if (expectedType === Array && typeof(param) !== "undefined" && param !== null && + (expectedElementType || !elementMayBeNull)) { + var expectedElementInteger = !!expectedParam.elementInteger, + expectedElementDomElement = !!expectedParam.elementDomElement; + for (var i=0; i < param.length; i++) { + var elem = param[i]; + e = Function._validateParameterType(elem, expectedElementType, + expectedElementInteger, expectedElementDomElement, elementMayBeNull, + paramName + "[" + i + "]"); + if (e) { + e.popStackFrame(); + return e; + } + } + } + return null; +} +Function._validateParameterType = function Function$_validateParameterType(param, expectedType, expectedInteger, expectedDomElement, mayBeNull, paramName) { + var e, i; + if (typeof(param) === "undefined") { + if (mayBeNull) { + return null; + } + else { + e = Error.argumentUndefined(paramName); + e.popStackFrame(); + return e; + } + } + if (param === null) { + if (mayBeNull) { + return null; + } + else { + e = Error.argumentNull(paramName); + e.popStackFrame(); + return e; + } + } + if (expectedType && expectedType.__enum) { + if (typeof(param) !== 'number') { + e = Error.argumentType(paramName, Object.getType(param), expectedType); + e.popStackFrame(); + return e; + } + if ((param % 1) === 0) { + var values = expectedType.prototype; + if (!expectedType.__flags || (param === 0)) { + for (i in values) { + if (values[i] === param) return null; + } + } + else { + var v = param; + for (i in values) { + var vali = values[i]; + if (vali === 0) continue; + if ((vali & param) === vali) { + v -= vali; + } + if (v === 0) return null; + } + } + } + e = Error.argumentOutOfRange(paramName, param, String.format(Sys.Res.enumInvalidValue, param, expectedType.getName())); + e.popStackFrame(); + return e; + } + if (expectedDomElement && (!Sys._isDomElement(param) || (param.nodeType === 3))) { + e = Error.argument(paramName, Sys.Res.argumentDomElement); + e.popStackFrame(); + return e; + } + if (expectedType && !Sys._isInstanceOfType(expectedType, param)) { + e = Error.argumentType(paramName, Object.getType(param), expectedType); + e.popStackFrame(); + return e; + } + if (expectedType === Number && expectedInteger) { + if ((param % 1) !== 0) { + e = Error.argumentOutOfRange(paramName, param, Sys.Res.argumentInteger); + e.popStackFrame(); + return e; + } + } + return null; +} + +Error.__typeName = 'Error'; +Error.__class = true; +Error.create = function Error$create(message, errorInfo) { + /// <summary locid="M:J#Error.create" /> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <param name="errorInfo" optional="true" mayBeNull="true"></param> + /// <returns type="Error"></returns> + var e = Function._validateParams(arguments, [ + {name: "message", type: String, mayBeNull: true, optional: true}, + {name: "errorInfo", mayBeNull: true, optional: true} + ]); + if (e) throw e; + var err = new Error(message); + err.message = message; + if (errorInfo) { + for (var v in errorInfo) { + err[v] = errorInfo[v]; + } + } + err.popStackFrame(); + return err; +} +Error.argument = function Error$argument(paramName, message) { + /// <summary locid="M:J#Error.argument" /> + /// <param name="paramName" type="String" optional="true" mayBeNull="true"></param> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "paramName", type: String, mayBeNull: true, optional: true}, + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.ArgumentException: " + (message ? message : Sys.Res.argument); + if (paramName) { + displayMessage += "\n" + String.format(Sys.Res.paramName, paramName); + } + var err = Error.create(displayMessage, { name: "Sys.ArgumentException", paramName: paramName }); + err.popStackFrame(); + return err; +} +Error.argumentNull = function Error$argumentNull(paramName, message) { + /// <summary locid="M:J#Error.argumentNull" /> + /// <param name="paramName" type="String" optional="true" mayBeNull="true"></param> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "paramName", type: String, mayBeNull: true, optional: true}, + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.ArgumentNullException: " + (message ? message : Sys.Res.argumentNull); + if (paramName) { + displayMessage += "\n" + String.format(Sys.Res.paramName, paramName); + } + var err = Error.create(displayMessage, { name: "Sys.ArgumentNullException", paramName: paramName }); + err.popStackFrame(); + return err; +} +Error.argumentOutOfRange = function Error$argumentOutOfRange(paramName, actualValue, message) { + /// <summary locid="M:J#Error.argumentOutOfRange" /> + /// <param name="paramName" type="String" optional="true" mayBeNull="true"></param> + /// <param name="actualValue" optional="true" mayBeNull="true"></param> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "paramName", type: String, mayBeNull: true, optional: true}, + {name: "actualValue", mayBeNull: true, optional: true}, + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.ArgumentOutOfRangeException: " + (message ? message : Sys.Res.argumentOutOfRange); + if (paramName) { + displayMessage += "\n" + String.format(Sys.Res.paramName, paramName); + } + if (typeof(actualValue) !== "undefined" && actualValue !== null) { + displayMessage += "\n" + String.format(Sys.Res.actualValue, actualValue); + } + var err = Error.create(displayMessage, { + name: "Sys.ArgumentOutOfRangeException", + paramName: paramName, + actualValue: actualValue + }); + err.popStackFrame(); + return err; +} +Error.argumentType = function Error$argumentType(paramName, actualType, expectedType, message) { + /// <summary locid="M:J#Error.argumentType" /> + /// <param name="paramName" type="String" optional="true" mayBeNull="true"></param> + /// <param name="actualType" type="Type" optional="true" mayBeNull="true"></param> + /// <param name="expectedType" type="Type" optional="true" mayBeNull="true"></param> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "paramName", type: String, mayBeNull: true, optional: true}, + {name: "actualType", type: Type, mayBeNull: true, optional: true}, + {name: "expectedType", type: Type, mayBeNull: true, optional: true}, + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.ArgumentTypeException: "; + if (message) { + displayMessage += message; + } + else if (actualType && expectedType) { + displayMessage += + String.format(Sys.Res.argumentTypeWithTypes, actualType.getName(), expectedType.getName()); + } + else { + displayMessage += Sys.Res.argumentType; + } + if (paramName) { + displayMessage += "\n" + String.format(Sys.Res.paramName, paramName); + } + var err = Error.create(displayMessage, { + name: "Sys.ArgumentTypeException", + paramName: paramName, + actualType: actualType, + expectedType: expectedType + }); + err.popStackFrame(); + return err; +} +Error.argumentUndefined = function Error$argumentUndefined(paramName, message) { + /// <summary locid="M:J#Error.argumentUndefined" /> + /// <param name="paramName" type="String" optional="true" mayBeNull="true"></param> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "paramName", type: String, mayBeNull: true, optional: true}, + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.ArgumentUndefinedException: " + (message ? message : Sys.Res.argumentUndefined); + if (paramName) { + displayMessage += "\n" + String.format(Sys.Res.paramName, paramName); + } + var err = Error.create(displayMessage, { name: "Sys.ArgumentUndefinedException", paramName: paramName }); + err.popStackFrame(); + return err; +} +Error.format = function Error$format(message) { + /// <summary locid="M:J#Error.format" /> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.FormatException: " + (message ? message : Sys.Res.format); + var err = Error.create(displayMessage, {name: 'Sys.FormatException'}); + err.popStackFrame(); + return err; +} +Error.invalidOperation = function Error$invalidOperation(message) { + /// <summary locid="M:J#Error.invalidOperation" /> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.InvalidOperationException: " + (message ? message : Sys.Res.invalidOperation); + var err = Error.create(displayMessage, {name: 'Sys.InvalidOperationException'}); + err.popStackFrame(); + return err; +} +Error.notImplemented = function Error$notImplemented(message) { + /// <summary locid="M:J#Error.notImplemented" /> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.NotImplementedException: " + (message ? message : Sys.Res.notImplemented); + var err = Error.create(displayMessage, {name: 'Sys.NotImplementedException'}); + err.popStackFrame(); + return err; +} +Error.parameterCount = function Error$parameterCount(message) { + /// <summary locid="M:J#Error.parameterCount" /> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "message", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var displayMessage = "Sys.ParameterCountException: " + (message ? message : Sys.Res.parameterCount); + var err = Error.create(displayMessage, {name: 'Sys.ParameterCountException'}); + err.popStackFrame(); + return err; +} +Error.prototype.popStackFrame = function Error$popStackFrame() { + /// <summary locid="M:J#checkParam" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if (typeof(this.stack) === "undefined" || this.stack === null || + typeof(this.fileName) === "undefined" || this.fileName === null || + typeof(this.lineNumber) === "undefined" || this.lineNumber === null) { + return; + } + var stackFrames = this.stack.split("\n"); + var currentFrame = stackFrames[0]; + var pattern = this.fileName + ":" + this.lineNumber; + while(typeof(currentFrame) !== "undefined" && + currentFrame !== null && + currentFrame.indexOf(pattern) === -1) { + stackFrames.shift(); + currentFrame = stackFrames[0]; + } + var nextFrame = stackFrames[1]; + if (typeof(nextFrame) === "undefined" || nextFrame === null) { + return; + } + var nextFrameParts = nextFrame.match(/@(.*):(\d+)$/); + if (typeof(nextFrameParts) === "undefined" || nextFrameParts === null) { + return; + } + this.fileName = nextFrameParts[1]; + this.lineNumber = parseInt(nextFrameParts[2]); + stackFrames.shift(); + this.stack = stackFrames.join("\n"); +} + +Object.__typeName = 'Object'; +Object.__class = true; +Object.getType = function Object$getType(instance) { + /// <summary locid="M:J#Object.getType" /> + /// <param name="instance"></param> + /// <returns type="Type"></returns> + var e = Function._validateParams(arguments, [ + {name: "instance"} + ]); + if (e) throw e; + var ctor = instance.constructor; + if (!ctor || (typeof(ctor) !== "function") || !ctor.__typeName || (ctor.__typeName === 'Object')) { + return Object; + } + return ctor; +} +Object.getTypeName = function Object$getTypeName(instance) { + /// <summary locid="M:J#Object.getTypeName" /> + /// <param name="instance"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "instance"} + ]); + if (e) throw e; + return Object.getType(instance).getName(); +} + +String.__typeName = 'String'; +String.__class = true; +String.prototype.endsWith = function String$endsWith(suffix) { + /// <summary locid="M:J#String.endsWith" /> + /// <param name="suffix" type="String"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "suffix", type: String} + ]); + if (e) throw e; + return (this.substr(this.length - suffix.length) === suffix); +} +String.prototype.startsWith = function String$startsWith(prefix) { + /// <summary locid="M:J#String.startsWith" /> + /// <param name="prefix" type="String"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "prefix", type: String} + ]); + if (e) throw e; + return (this.substr(0, prefix.length) === prefix); +} +String.prototype.trim = function String$trim() { + /// <summary locid="M:J#String.trim" /> + /// <returns type="String"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + return this.replace(/^\s+|\s+$/g, ''); +} +String.prototype.trimEnd = function String$trimEnd() { + /// <summary locid="M:J#String.trimEnd" /> + /// <returns type="String"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + return this.replace(/\s+$/, ''); +} +String.prototype.trimStart = function String$trimStart() { + /// <summary locid="M:J#String.trimStart" /> + /// <returns type="String"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + return this.replace(/^\s+/, ''); +} +String.format = function String$format(format, args) { + /// <summary locid="M:J#String.format" /> + /// <param name="format" type="String"></param> + /// <param name="args" parameterArray="true" mayBeNull="true"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "format", type: String}, + {name: "args", mayBeNull: true, parameterArray: true} + ]); + if (e) throw e; + return String._toFormattedString(false, arguments); +} +String._toFormattedString = function String$_toFormattedString(useLocale, args) { + var result = ''; + var format = args[0]; + for (var i=0;;) { + var open = format.indexOf('{', i); + var close = format.indexOf('}', i); + if ((open < 0) && (close < 0)) { + result += format.slice(i); + break; + } + if ((close > 0) && ((close < open) || (open < 0))) { + if (format.charAt(close + 1) !== '}') { + throw Error.argument('format', Sys.Res.stringFormatBraceMismatch); + } + result += format.slice(i, close + 1); + i = close + 2; + continue; + } + result += format.slice(i, open); + i = open + 1; + if (format.charAt(i) === '{') { + result += '{'; + i++; + continue; + } + if (close < 0) throw Error.argument('format', Sys.Res.stringFormatBraceMismatch); + var brace = format.substring(i, close); + var colonIndex = brace.indexOf(':'); + var argNumber = parseInt((colonIndex < 0)? brace : brace.substring(0, colonIndex), 10) + 1; + if (isNaN(argNumber)) throw Error.argument('format', Sys.Res.stringFormatInvalid); + var argFormat = (colonIndex < 0)? '' : brace.substring(colonIndex + 1); + var arg = args[argNumber]; + if (typeof(arg) === "undefined" || arg === null) { + arg = ''; + } + if (arg.toFormattedString) { + result += arg.toFormattedString(argFormat); + } + else if (useLocale && arg.localeFormat) { + result += arg.localeFormat(argFormat); + } + else if (arg.format) { + result += arg.format(argFormat); + } + else + result += arg.toString(); + i = close + 1; + } + return result; +} + +Boolean.__typeName = 'Boolean'; +Boolean.__class = true; +Boolean.parse = function Boolean$parse(value) { + /// <summary locid="M:J#Boolean.parse" /> + /// <param name="value" type="String"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "value", type: String} + ], false); + if (e) throw e; + var v = value.trim().toLowerCase(); + if (v === 'false') return false; + if (v === 'true') return true; + throw Error.argumentOutOfRange('value', value, Sys.Res.boolTrueOrFalse); +} + +Date.__typeName = 'Date'; +Date.__class = true; + +Number.__typeName = 'Number'; +Number.__class = true; + +RegExp.__typeName = 'RegExp'; +RegExp.__class = true; + +if (!window) this.window = this; +window.Type = Function; +Type.__fullyQualifiedIdentifierRegExp = new RegExp("^[^.0-9 \\s|,;:&*=+\\-()\\[\\]{}^%#@!~\\n\\r\\t\\f\\\\]([^ \\s|,;:&*=+\\-()\\[\\]{}^%#@!~\\n\\r\\t\\f\\\\]*[^. \\s|,;:&*=+\\-()\\[\\]{}^%#@!~\\n\\r\\t\\f\\\\])?$", "i"); +Type.__identifierRegExp = new RegExp("^[^.0-9 \\s|,;:&*=+\\-()\\[\\]{}^%#@!~\\n\\r\\t\\f\\\\][^. \\s|,;:&*=+\\-()\\[\\]{}^%#@!~\\n\\r\\t\\f\\\\]*$", "i"); +Type.prototype.callBaseMethod = function Type$callBaseMethod(instance, name, baseArguments) { + /// <summary locid="M:J#Type.callBaseMethod" /> + /// <param name="instance"></param> + /// <param name="name" type="String"></param> + /// <param name="baseArguments" type="Array" optional="true" mayBeNull="true" elementMayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "instance"}, + {name: "name", type: String}, + {name: "baseArguments", type: Array, mayBeNull: true, optional: true, elementMayBeNull: true} + ]); + if (e) throw e; + var baseMethod = Sys._getBaseMethod(this, instance, name); + if (!baseMethod) throw Error.invalidOperation(String.format(Sys.Res.methodNotFound, name)); + if (!baseArguments) { + return baseMethod.apply(instance); + } + else { + return baseMethod.apply(instance, baseArguments); + } +} +Type.prototype.getBaseMethod = function Type$getBaseMethod(instance, name) { + /// <summary locid="M:J#Type.getBaseMethod" /> + /// <param name="instance"></param> + /// <param name="name" type="String"></param> + /// <returns type="Function" mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "instance"}, + {name: "name", type: String} + ]); + if (e) throw e; + return Sys._getBaseMethod(this, instance, name); +} +Type.prototype.getBaseType = function Type$getBaseType() { + /// <summary locid="M:J#Type.getBaseType" /> + /// <returns type="Type" mayBeNull="true"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + return (typeof(this.__baseType) === "undefined") ? null : this.__baseType; +} +Type.prototype.getInterfaces = function Type$getInterfaces() { + /// <summary locid="M:J#Type.getInterfaces" /> + /// <returns type="Array" elementType="Type" mayBeNull="false" elementMayBeNull="false"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + var result = []; + var type = this; + while(type) { + var interfaces = type.__interfaces; + if (interfaces) { + for (var i = 0, l = interfaces.length; i < l; i++) { + var interfaceType = interfaces[i]; + if (!Array.contains(result, interfaceType)) { + result[result.length] = interfaceType; + } + } + } + type = type.__baseType; + } + return result; +} +Type.prototype.getName = function Type$getName() { + /// <summary locid="M:J#Type.getName" /> + /// <returns type="String"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + return (typeof(this.__typeName) === "undefined") ? "" : this.__typeName; +} +Type.prototype.implementsInterface = function Type$implementsInterface(interfaceType) { + /// <summary locid="M:J#Type.implementsInterface" /> + /// <param name="interfaceType" type="Type"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "interfaceType", type: Type} + ]); + if (e) throw e; + this.resolveInheritance(); + var interfaceName = interfaceType.getName(); + var cache = this.__interfaceCache; + if (cache) { + var cacheEntry = cache[interfaceName]; + if (typeof(cacheEntry) !== 'undefined') return cacheEntry; + } + else { + cache = this.__interfaceCache = {}; + } + var baseType = this; + while (baseType) { + var interfaces = baseType.__interfaces; + if (interfaces) { + if (Array.indexOf(interfaces, interfaceType) !== -1) { + return cache[interfaceName] = true; + } + } + baseType = baseType.__baseType; + } + return cache[interfaceName] = false; +} +Type.prototype.inheritsFrom = function Type$inheritsFrom(parentType) { + /// <summary locid="M:J#Type.inheritsFrom" /> + /// <param name="parentType" type="Type"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "parentType", type: Type} + ]); + if (e) throw e; + this.resolveInheritance(); + var baseType = this.__baseType; + while (baseType) { + if (baseType === parentType) { + return true; + } + baseType = baseType.__baseType; + } + return false; +} +Type.prototype.initializeBase = function Type$initializeBase(instance, baseArguments) { + /// <summary locid="M:J#Type.initializeBase" /> + /// <param name="instance"></param> + /// <param name="baseArguments" type="Array" optional="true" mayBeNull="true" elementMayBeNull="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "instance"}, + {name: "baseArguments", type: Array, mayBeNull: true, optional: true, elementMayBeNull: true} + ]); + if (e) throw e; + if (!Sys._isInstanceOfType(this, instance)) throw Error.argumentType('instance', Object.getType(instance), this); + this.resolveInheritance(); + if (this.__baseType) { + if (!baseArguments) { + this.__baseType.apply(instance); + } + else { + this.__baseType.apply(instance, baseArguments); + } + } + return instance; +} +Type.prototype.isImplementedBy = function Type$isImplementedBy(instance) { + /// <summary locid="M:J#Type.isImplementedBy" /> + /// <param name="instance" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "instance", mayBeNull: true} + ]); + if (e) throw e; + if (typeof(instance) === "undefined" || instance === null) return false; + var instanceType = Object.getType(instance); + return !!(instanceType.implementsInterface && instanceType.implementsInterface(this)); +} +Type.prototype.isInstanceOfType = function Type$isInstanceOfType(instance) { + /// <summary locid="M:J#Type.isInstanceOfType" /> + /// <param name="instance" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "instance", mayBeNull: true} + ]); + if (e) throw e; + return Sys._isInstanceOfType(this, instance); +} +Type.prototype.registerClass = function Type$registerClass(typeName, baseType, interfaceTypes) { + /// <summary locid="M:J#Type.registerClass" /> + /// <param name="typeName" type="String"></param> + /// <param name="baseType" type="Type" optional="true" mayBeNull="true"></param> + /// <param name="interfaceTypes" parameterArray="true" type="Type"></param> + /// <returns type="Type"></returns> + var e = Function._validateParams(arguments, [ + {name: "typeName", type: String}, + {name: "baseType", type: Type, mayBeNull: true, optional: true}, + {name: "interfaceTypes", type: Type, parameterArray: true} + ]); + if (e) throw e; + if (!Type.__fullyQualifiedIdentifierRegExp.test(typeName)) throw Error.argument('typeName', Sys.Res.notATypeName); + var parsedName; + try { + parsedName = eval(typeName); + } + catch(e) { + throw Error.argument('typeName', Sys.Res.argumentTypeName); + } + if (parsedName !== this) throw Error.argument('typeName', Sys.Res.badTypeName); + if (Sys.__registeredTypes[typeName]) throw Error.invalidOperation(String.format(Sys.Res.typeRegisteredTwice, typeName)); + if ((arguments.length > 1) && (typeof(baseType) === 'undefined')) throw Error.argumentUndefined('baseType'); + if (baseType && !baseType.__class) throw Error.argument('baseType', Sys.Res.baseNotAClass); + this.prototype.constructor = this; + this.__typeName = typeName; + this.__class = true; + if (baseType) { + this.__baseType = baseType; + this.__basePrototypePending = true; + } + Sys.__upperCaseTypes[typeName.toUpperCase()] = this; + if (interfaceTypes) { + this.__interfaces = []; + this.resolveInheritance(); + for (var i = 2, l = arguments.length; i < l; i++) { + var interfaceType = arguments[i]; + if (!interfaceType.__interface) throw Error.argument('interfaceTypes[' + (i - 2) + ']', Sys.Res.notAnInterface); + for (var methodName in interfaceType.prototype) { + var method = interfaceType.prototype[methodName]; + if (!this.prototype[methodName]) { + this.prototype[methodName] = method; + } + } + this.__interfaces.push(interfaceType); + } + } + Sys.__registeredTypes[typeName] = true; + return this; +} +Type.prototype.registerInterface = function Type$registerInterface(typeName) { + /// <summary locid="M:J#Type.registerInterface" /> + /// <param name="typeName" type="String"></param> + /// <returns type="Type"></returns> + var e = Function._validateParams(arguments, [ + {name: "typeName", type: String} + ]); + if (e) throw e; + if (!Type.__fullyQualifiedIdentifierRegExp.test(typeName)) throw Error.argument('typeName', Sys.Res.notATypeName); + var parsedName; + try { + parsedName = eval(typeName); + } + catch(e) { + throw Error.argument('typeName', Sys.Res.argumentTypeName); + } + if (parsedName !== this) throw Error.argument('typeName', Sys.Res.badTypeName); + if (Sys.__registeredTypes[typeName]) throw Error.invalidOperation(String.format(Sys.Res.typeRegisteredTwice, typeName)); + Sys.__upperCaseTypes[typeName.toUpperCase()] = this; + this.prototype.constructor = this; + this.__typeName = typeName; + this.__interface = true; + Sys.__registeredTypes[typeName] = true; + return this; +} +Type.prototype.resolveInheritance = function Type$resolveInheritance() { + /// <summary locid="M:J#Type.resolveInheritance" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this.__basePrototypePending) { + var baseType = this.__baseType; + baseType.resolveInheritance(); + for (var memberName in baseType.prototype) { + var memberValue = baseType.prototype[memberName]; + if (!this.prototype[memberName]) { + this.prototype[memberName] = memberValue; + } + } + delete this.__basePrototypePending; + } +} +Type.getRootNamespaces = function Type$getRootNamespaces() { + /// <summary locid="M:J#Type.getRootNamespaces" /> + /// <returns type="Array"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + return Array.clone(Sys.__rootNamespaces); +} +Type.isClass = function Type$isClass(type) { + /// <summary locid="M:J#Type.isClass" /> + /// <param name="type" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "type", mayBeNull: true} + ]); + if (e) throw e; + if ((typeof(type) === 'undefined') || (type === null)) return false; + return !!type.__class; +} +Type.isInterface = function Type$isInterface(type) { + /// <summary locid="M:J#Type.isInterface" /> + /// <param name="type" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "type", mayBeNull: true} + ]); + if (e) throw e; + if ((typeof(type) === 'undefined') || (type === null)) return false; + return !!type.__interface; +} +Type.isNamespace = function Type$isNamespace(object) { + /// <summary locid="M:J#Type.isNamespace" /> + /// <param name="object" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "object", mayBeNull: true} + ]); + if (e) throw e; + if ((typeof(object) === 'undefined') || (object === null)) return false; + return !!object.__namespace; +} +Type.parse = function Type$parse(typeName, ns) { + /// <summary locid="M:J#Type.parse" /> + /// <param name="typeName" type="String" mayBeNull="true"></param> + /// <param name="ns" optional="true" mayBeNull="true"></param> + /// <returns type="Type" mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "typeName", type: String, mayBeNull: true}, + {name: "ns", mayBeNull: true, optional: true} + ]); + if (e) throw e; + var fn; + if (ns) { + fn = Sys.__upperCaseTypes[ns.getName().toUpperCase() + '.' + typeName.toUpperCase()]; + return fn || null; + } + if (!typeName) return null; + if (!Type.__htClasses) { + Type.__htClasses = {}; + } + fn = Type.__htClasses[typeName]; + if (!fn) { + fn = eval(typeName); + if (typeof(fn) !== 'function') throw Error.argument('typeName', Sys.Res.notATypeName); + Type.__htClasses[typeName] = fn; + } + return fn; +} +Type.registerNamespace = function Type$registerNamespace(namespacePath) { + /// <summary locid="M:J#Type.registerNamespace" /> + /// <param name="namespacePath" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "namespacePath", type: String} + ]); + if (e) throw e; + Type._registerNamespace(namespacePath); +} +Type._registerNamespace = function Type$_registerNamespace(namespacePath) { + if (!Type.__fullyQualifiedIdentifierRegExp.test(namespacePath)) throw Error.argument('namespacePath', Sys.Res.invalidNameSpace); + var rootObject = window; + var namespaceParts = namespacePath.split('.'); + for (var i = 0; i < namespaceParts.length; i++) { + var currentPart = namespaceParts[i]; + var ns = rootObject[currentPart]; + var nsType = typeof(ns); + if ((nsType !== "undefined") && (ns !== null)) { + if (nsType === "function") { + throw Error.invalidOperation(String.format(Sys.Res.namespaceContainsClass, namespaceParts.splice(0, i + 1).join('.'))); + } + if ((typeof(ns) !== "object") || (ns instanceof Array)) { + throw Error.invalidOperation(String.format(Sys.Res.namespaceContainsNonObject, namespaceParts.splice(0, i + 1).join('.'))); + } + } + if (!ns) { + ns = rootObject[currentPart] = {}; + } + if (!ns.__namespace) { + if ((i === 0) && (namespacePath !== "Sys")) { + Sys.__rootNamespaces[Sys.__rootNamespaces.length] = ns; + } + ns.__namespace = true; + ns.__typeName = namespaceParts.slice(0, i + 1).join('.'); + var parsedName; + try { + parsedName = eval(ns.__typeName); + } + catch(e) { + parsedName = null; + } + if (parsedName !== ns) { + delete rootObject[currentPart]; + throw Error.argument('namespacePath', Sys.Res.invalidNameSpace); + } + ns.getName = function ns$getName() {return this.__typeName;} + } + rootObject = ns; + } +} +Type._checkDependency = function Type$_checkDependency(dependency, featureName) { + var scripts = Type._registerScript._scripts, isDependent = (scripts ? (!!scripts[dependency]) : false); + if ((typeof(featureName) !== 'undefined') && !isDependent) { + throw Error.invalidOperation(String.format(Sys.Res.requiredScriptReferenceNotIncluded, + featureName, dependency)); + } + return isDependent; +} +Type._registerScript = function Type$_registerScript(scriptName, dependencies) { + var scripts = Type._registerScript._scripts; + if (!scripts) { + Type._registerScript._scripts = scripts = {}; + } + if (scripts[scriptName]) { + throw Error.invalidOperation(String.format(Sys.Res.scriptAlreadyLoaded, scriptName)); + } + scripts[scriptName] = true; + if (dependencies) { + for (var i = 0, l = dependencies.length; i < l; i++) { + var dependency = dependencies[i]; + if (!Type._checkDependency(dependency)) { + throw Error.invalidOperation(String.format(Sys.Res.scriptDependencyNotFound, scriptName, dependency)); + } + } + } +} +Type._registerNamespace("Sys"); +Sys.__upperCaseTypes = {}; +Sys.__rootNamespaces = [Sys]; +Sys.__registeredTypes = {}; +Sys._isInstanceOfType = function Sys$_isInstanceOfType(type, instance) { + if (typeof(instance) === "undefined" || instance === null) return false; + if (instance instanceof type) return true; + var instanceType = Object.getType(instance); + return !!(instanceType === type) || + (instanceType.inheritsFrom && instanceType.inheritsFrom(type)) || + (instanceType.implementsInterface && instanceType.implementsInterface(type)); +} +Sys._getBaseMethod = function Sys$_getBaseMethod(type, instance, name) { + if (!Sys._isInstanceOfType(type, instance)) throw Error.argumentType('instance', Object.getType(instance), type); + var baseType = type.getBaseType(); + if (baseType) { + var baseMethod = baseType.prototype[name]; + return (baseMethod instanceof Function) ? baseMethod : null; + } + return null; +} +Sys._isDomElement = function Sys$_isDomElement(obj) { + var val = false; + if (typeof (obj.nodeType) !== 'number') { + var doc = obj.ownerDocument || obj.document || obj; + if (doc != obj) { + var w = doc.defaultView || doc.parentWindow; + val = (w != obj); + } + else { + val = (typeof (doc.body) === 'undefined'); + } + } + return !val; +} + +Array.__typeName = 'Array'; +Array.__class = true; +Array.add = Array.enqueue = function Array$enqueue(array, item) { + /// <summary locid="M:J#Array.enqueue" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <param name="item" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true}, + {name: "item", mayBeNull: true} + ]); + if (e) throw e; + array[array.length] = item; +} +Array.addRange = function Array$addRange(array, items) { + /// <summary locid="M:J#Array.addRange" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <param name="items" type="Array" elementMayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true}, + {name: "items", type: Array, elementMayBeNull: true} + ]); + if (e) throw e; + array.push.apply(array, items); +} +Array.clear = function Array$clear(array) { + /// <summary locid="M:J#Array.clear" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true} + ]); + if (e) throw e; + array.length = 0; +} +Array.clone = function Array$clone(array) { + /// <summary locid="M:J#Array.clone" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <returns type="Array" elementMayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true} + ]); + if (e) throw e; + if (array.length === 1) { + return [array[0]]; + } + else { + return Array.apply(null, array); + } +} +Array.contains = function Array$contains(array, item) { + /// <summary locid="M:J#Array.contains" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <param name="item" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true}, + {name: "item", mayBeNull: true} + ]); + if (e) throw e; + return (Sys._indexOf(array, item) >= 0); +} +Array.dequeue = function Array$dequeue(array) { + /// <summary locid="M:J#Array.dequeue" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <returns mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true} + ]); + if (e) throw e; + return array.shift(); +} +Array.forEach = function Array$forEach(array, method, instance) { + /// <summary locid="M:J#Array.forEach" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <param name="method" type="Function"></param> + /// <param name="instance" optional="true" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true}, + {name: "method", type: Function}, + {name: "instance", mayBeNull: true, optional: true} + ]); + if (e) throw e; + for (var i = 0, l = array.length; i < l; i++) { + var elt = array[i]; + if (typeof(elt) !== 'undefined') method.call(instance, elt, i, array); + } +} +Array.indexOf = function Array$indexOf(array, item, start) { + /// <summary locid="M:J#Array.indexOf" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <param name="item" optional="true" mayBeNull="true"></param> + /// <param name="start" optional="true" mayBeNull="true"></param> + /// <returns type="Number"></returns> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true}, + {name: "item", mayBeNull: true, optional: true}, + {name: "start", mayBeNull: true, optional: true} + ]); + if (e) throw e; + return Sys._indexOf(array, item, start); +} +Array.insert = function Array$insert(array, index, item) { + /// <summary locid="M:J#Array.insert" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <param name="index" mayBeNull="true"></param> + /// <param name="item" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true}, + {name: "index", mayBeNull: true}, + {name: "item", mayBeNull: true} + ]); + if (e) throw e; + array.splice(index, 0, item); +} +Array.parse = function Array$parse(value) { + /// <summary locid="M:J#Array.parse" /> + /// <param name="value" type="String" mayBeNull="true"></param> + /// <returns type="Array" elementMayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "value", type: String, mayBeNull: true} + ]); + if (e) throw e; + if (!value) return []; + var v = eval(value); + if (!Array.isInstanceOfType(v)) throw Error.argument('value', Sys.Res.arrayParseBadFormat); + return v; +} +Array.remove = function Array$remove(array, item) { + /// <summary locid="M:J#Array.remove" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <param name="item" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true}, + {name: "item", mayBeNull: true} + ]); + if (e) throw e; + var index = Sys._indexOf(array, item); + if (index >= 0) { + array.splice(index, 1); + } + return (index >= 0); +} +Array.removeAt = function Array$removeAt(array, index) { + /// <summary locid="M:J#Array.removeAt" /> + /// <param name="array" type="Array" elementMayBeNull="true"></param> + /// <param name="index" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "array", type: Array, elementMayBeNull: true}, + {name: "index", mayBeNull: true} + ]); + if (e) throw e; + array.splice(index, 1); +} +Sys._indexOf = function Sys$_indexOf(array, item, start) { + if (typeof(item) === "undefined") return -1; + var length = array.length; + if (length !== 0) { + start = start - 0; + if (isNaN(start)) { + start = 0; + } + else { + if (isFinite(start)) { + start = start - (start % 1); + } + if (start < 0) { + start = Math.max(0, length + start); + } + } + for (var i = start; i < length; i++) { + if ((typeof(array[i]) !== "undefined") && (array[i] === item)) { + return i; + } + } + } + return -1; +} +Type._registerScript._scripts = { + "MicrosoftAjaxCore.js": true, + "MicrosoftAjaxGlobalization.js": true, + "MicrosoftAjaxSerialization.js": true, + "MicrosoftAjaxComponentModel.js": true, + "MicrosoftAjaxHistory.js": true, + "MicrosoftAjaxNetwork.js" : true, + "MicrosoftAjaxWebServices.js": true }; + +Sys.IDisposable = function Sys$IDisposable() { + throw Error.notImplemented(); +} + function Sys$IDisposable$dispose() { + throw Error.notImplemented(); + } +Sys.IDisposable.prototype = { + dispose: Sys$IDisposable$dispose +} +Sys.IDisposable.registerInterface('Sys.IDisposable'); + +Sys.StringBuilder = function Sys$StringBuilder(initialText) { + /// <summary locid="M:J#Sys.StringBuilder.#ctor" /> + /// <param name="initialText" optional="true" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "initialText", mayBeNull: true, optional: true} + ]); + if (e) throw e; + this._parts = (typeof(initialText) !== 'undefined' && initialText !== null && initialText !== '') ? + [initialText.toString()] : []; + this._value = {}; + this._len = 0; +} + function Sys$StringBuilder$append(text) { + /// <summary locid="M:J#Sys.StringBuilder.append" /> + /// <param name="text" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "text", mayBeNull: true} + ]); + if (e) throw e; + this._parts[this._parts.length] = text; + } + function Sys$StringBuilder$appendLine(text) { + /// <summary locid="M:J#Sys.StringBuilder.appendLine" /> + /// <param name="text" optional="true" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "text", mayBeNull: true, optional: true} + ]); + if (e) throw e; + this._parts[this._parts.length] = + ((typeof(text) === 'undefined') || (text === null) || (text === '')) ? + '\r\n' : text + '\r\n'; + } + function Sys$StringBuilder$clear() { + /// <summary locid="M:J#Sys.StringBuilder.clear" /> + if (arguments.length !== 0) throw Error.parameterCount(); + this._parts = []; + this._value = {}; + this._len = 0; + } + function Sys$StringBuilder$isEmpty() { + /// <summary locid="M:J#Sys.StringBuilder.isEmpty" /> + /// <returns type="Boolean"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this._parts.length === 0) return true; + return this.toString() === ''; + } + function Sys$StringBuilder$toString(separator) { + /// <summary locid="M:J#Sys.StringBuilder.toString" /> + /// <param name="separator" type="String" optional="true" mayBeNull="true"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "separator", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + separator = separator || ''; + var parts = this._parts; + if (this._len !== parts.length) { + this._value = {}; + this._len = parts.length; + } + var val = this._value; + if (typeof(val[separator]) === 'undefined') { + if (separator !== '') { + for (var i = 0; i < parts.length;) { + if ((typeof(parts[i]) === 'undefined') || (parts[i] === '') || (parts[i] === null)) { + parts.splice(i, 1); + } + else { + i++; + } + } + } + val[separator] = this._parts.join(separator); + } + return val[separator]; + } +Sys.StringBuilder.prototype = { + append: Sys$StringBuilder$append, + appendLine: Sys$StringBuilder$appendLine, + clear: Sys$StringBuilder$clear, + isEmpty: Sys$StringBuilder$isEmpty, + toString: Sys$StringBuilder$toString +} +Sys.StringBuilder.registerClass('Sys.StringBuilder'); + +Sys.Browser = {}; +Sys.Browser.InternetExplorer = {}; +Sys.Browser.Firefox = {}; +Sys.Browser.Safari = {}; +Sys.Browser.Opera = {}; +Sys.Browser.agent = null; +Sys.Browser.hasDebuggerStatement = false; +Sys.Browser.name = navigator.appName; +Sys.Browser.version = parseFloat(navigator.appVersion); +Sys.Browser.documentMode = 0; +if (navigator.userAgent.indexOf(' MSIE ') > -1) { + Sys.Browser.agent = Sys.Browser.InternetExplorer; + Sys.Browser.version = parseFloat(navigator.userAgent.match(/MSIE (\d+\.\d+)/)[1]); + if (Sys.Browser.version >= 8) { + if (document.documentMode >= 7) { + Sys.Browser.documentMode = document.documentMode; + } + } + Sys.Browser.hasDebuggerStatement = true; +} +else if (navigator.userAgent.indexOf(' Firefox/') > -1) { + Sys.Browser.agent = Sys.Browser.Firefox; + Sys.Browser.version = parseFloat(navigator.userAgent.match(/ Firefox\/(\d+\.\d+)/)[1]); + Sys.Browser.name = 'Firefox'; + Sys.Browser.hasDebuggerStatement = true; +} +else if (navigator.userAgent.indexOf(' AppleWebKit/') > -1) { + Sys.Browser.agent = Sys.Browser.Safari; + Sys.Browser.version = parseFloat(navigator.userAgent.match(/ AppleWebKit\/(\d+(\.\d+)?)/)[1]); + Sys.Browser.name = 'Safari'; +} +else if (navigator.userAgent.indexOf('Opera/') > -1) { + Sys.Browser.agent = Sys.Browser.Opera; +} + +Sys.EventArgs = function Sys$EventArgs() { + /// <summary locid="M:J#Sys.EventArgs.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); +} +Sys.EventArgs.registerClass('Sys.EventArgs'); +Sys.EventArgs.Empty = new Sys.EventArgs(); + +Sys.CancelEventArgs = function Sys$CancelEventArgs() { + /// <summary locid="M:J#Sys.CancelEventArgs.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + Sys.CancelEventArgs.initializeBase(this); + this._cancel = false; +} + function Sys$CancelEventArgs$get_cancel() { + /// <value type="Boolean" locid="P:J#Sys.CancelEventArgs.cancel"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._cancel; + } + function Sys$CancelEventArgs$set_cancel(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Boolean}]); + if (e) throw e; + this._cancel = value; + } +Sys.CancelEventArgs.prototype = { + get_cancel: Sys$CancelEventArgs$get_cancel, + set_cancel: Sys$CancelEventArgs$set_cancel +} +Sys.CancelEventArgs.registerClass('Sys.CancelEventArgs', Sys.EventArgs); +Type.registerNamespace('Sys.UI'); + +Sys._Debug = function Sys$_Debug() { + /// <summary locid="M:J#Sys.Debug.#ctor" /> + /// <field name="isDebug" type="Boolean" locid="F:J#Sys.Debug.isDebug"></field> + if (arguments.length !== 0) throw Error.parameterCount(); +} + function Sys$_Debug$_appendConsole(text) { + if ((typeof(Debug) !== 'undefined') && Debug.writeln) { + Debug.writeln(text); + } + if (window.console && window.console.log) { + window.console.log(text); + } + if (window.opera) { + window.opera.postError(text); + } + if (window.debugService) { + window.debugService.trace(text); + } + } + function Sys$_Debug$_appendTrace(text) { + var traceElement = document.getElementById('TraceConsole'); + if (traceElement && (traceElement.tagName.toUpperCase() === 'TEXTAREA')) { + traceElement.value += text + '\n'; + } + } + function Sys$_Debug$assert(condition, message, displayCaller) { + /// <summary locid="M:J#Sys.Debug.assert" /> + /// <param name="condition" type="Boolean"></param> + /// <param name="message" type="String" optional="true" mayBeNull="true"></param> + /// <param name="displayCaller" type="Boolean" optional="true"></param> + var e = Function._validateParams(arguments, [ + {name: "condition", type: Boolean}, + {name: "message", type: String, mayBeNull: true, optional: true}, + {name: "displayCaller", type: Boolean, optional: true} + ]); + if (e) throw e; + if (!condition) { + message = (displayCaller && this.assert.caller) ? + String.format(Sys.Res.assertFailedCaller, message, this.assert.caller) : + String.format(Sys.Res.assertFailed, message); + if (confirm(String.format(Sys.Res.breakIntoDebugger, message))) { + this.fail(message); + } + } + } + function Sys$_Debug$clearTrace() { + /// <summary locid="M:J#Sys.Debug.clearTrace" /> + if (arguments.length !== 0) throw Error.parameterCount(); + var traceElement = document.getElementById('TraceConsole'); + if (traceElement && (traceElement.tagName.toUpperCase() === 'TEXTAREA')) { + traceElement.value = ''; + } + } + function Sys$_Debug$fail(message) { + /// <summary locid="M:J#Sys.Debug.fail" /> + /// <param name="message" type="String" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "message", type: String, mayBeNull: true} + ]); + if (e) throw e; + this._appendConsole(message); + if (Sys.Browser.hasDebuggerStatement) { + eval('debugger'); + } + } + function Sys$_Debug$trace(text) { + /// <summary locid="M:J#Sys.Debug.trace" /> + /// <param name="text"></param> + var e = Function._validateParams(arguments, [ + {name: "text"} + ]); + if (e) throw e; + this._appendConsole(text); + this._appendTrace(text); + } + function Sys$_Debug$traceDump(object, name) { + /// <summary locid="M:J#Sys.Debug.traceDump" /> + /// <param name="object" mayBeNull="true"></param> + /// <param name="name" type="String" mayBeNull="true" optional="true"></param> + var e = Function._validateParams(arguments, [ + {name: "object", mayBeNull: true}, + {name: "name", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var text = this._traceDump(object, name, true); + } + function Sys$_Debug$_traceDump(object, name, recursive, indentationPadding, loopArray) { + name = name? name : 'traceDump'; + indentationPadding = indentationPadding? indentationPadding : ''; + if (object === null) { + this.trace(indentationPadding + name + ': null'); + return; + } + switch(typeof(object)) { + case 'undefined': + this.trace(indentationPadding + name + ': Undefined'); + break; + case 'number': case 'string': case 'boolean': + this.trace(indentationPadding + name + ': ' + object); + break; + default: + if (Date.isInstanceOfType(object) || RegExp.isInstanceOfType(object)) { + this.trace(indentationPadding + name + ': ' + object.toString()); + break; + } + if (!loopArray) { + loopArray = []; + } + else if (Array.contains(loopArray, object)) { + this.trace(indentationPadding + name + ': ...'); + return; + } + Array.add(loopArray, object); + if ((object == window) || (object === document) || + (window.HTMLElement && (object instanceof HTMLElement)) || + (typeof(object.nodeName) === 'string')) { + var tag = object.tagName? object.tagName : 'DomElement'; + if (object.id) { + tag += ' - ' + object.id; + } + this.trace(indentationPadding + name + ' {' + tag + '}'); + } + else { + var typeName = Object.getTypeName(object); + this.trace(indentationPadding + name + (typeof(typeName) === 'string' ? ' {' + typeName + '}' : '')); + if ((indentationPadding === '') || recursive) { + indentationPadding += " "; + var i, length, properties, p, v; + if (Array.isInstanceOfType(object)) { + length = object.length; + for (i = 0; i < length; i++) { + this._traceDump(object[i], '[' + i + ']', recursive, indentationPadding, loopArray); + } + } + else { + for (p in object) { + v = object[p]; + if (!Function.isInstanceOfType(v)) { + this._traceDump(v, p, recursive, indentationPadding, loopArray); + } + } + } + } + } + Array.remove(loopArray, object); + } + } +Sys._Debug.prototype = { + _appendConsole: Sys$_Debug$_appendConsole, + _appendTrace: Sys$_Debug$_appendTrace, + assert: Sys$_Debug$assert, + clearTrace: Sys$_Debug$clearTrace, + fail: Sys$_Debug$fail, + trace: Sys$_Debug$trace, + traceDump: Sys$_Debug$traceDump, + _traceDump: Sys$_Debug$_traceDump +} +Sys._Debug.registerClass('Sys._Debug'); +Sys.Debug = new Sys._Debug(); + Sys.Debug.isDebug = true; + +function Sys$Enum$parse(value, ignoreCase) { + /// <summary locid="M:J#Sys.Enum.parse" /> + /// <param name="value" type="String"></param> + /// <param name="ignoreCase" type="Boolean" optional="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "value", type: String}, + {name: "ignoreCase", type: Boolean, optional: true} + ]); + if (e) throw e; + var values, parsed, val; + if (ignoreCase) { + values = this.__lowerCaseValues; + if (!values) { + this.__lowerCaseValues = values = {}; + var prototype = this.prototype; + for (var name in prototype) { + values[name.toLowerCase()] = prototype[name]; + } + } + } + else { + values = this.prototype; + } + if (!this.__flags) { + val = (ignoreCase ? value.toLowerCase() : value); + parsed = values[val.trim()]; + if (typeof(parsed) !== 'number') throw Error.argument('value', String.format(Sys.Res.enumInvalidValue, value, this.__typeName)); + return parsed; + } + else { + var parts = (ignoreCase ? value.toLowerCase() : value).split(','); + var v = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var part = parts[i].trim(); + parsed = values[part]; + if (typeof(parsed) !== 'number') throw Error.argument('value', String.format(Sys.Res.enumInvalidValue, value.split(',')[i].trim(), this.__typeName)); + v |= parsed; + } + return v; + } +} +function Sys$Enum$toString(value) { + /// <summary locid="M:J#Sys.Enum.toString" /> + /// <param name="value" optional="true" mayBeNull="true"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "value", mayBeNull: true, optional: true} + ]); + if (e) throw e; + if ((typeof(value) === 'undefined') || (value === null)) return this.__string; + if ((typeof(value) != 'number') || ((value % 1) !== 0)) throw Error.argumentType('value', Object.getType(value), this); + var values = this.prototype; + var i; + if (!this.__flags || (value === 0)) { + for (i in values) { + if (values[i] === value) { + return i; + } + } + } + else { + var sorted = this.__sortedValues; + if (!sorted) { + sorted = []; + for (i in values) { + sorted[sorted.length] = {key: i, value: values[i]}; + } + sorted.sort(function(a, b) { + return a.value - b.value; + }); + this.__sortedValues = sorted; + } + var parts = []; + var v = value; + for (i = sorted.length - 1; i >= 0; i--) { + var kvp = sorted[i]; + var vali = kvp.value; + if (vali === 0) continue; + if ((vali & value) === vali) { + parts[parts.length] = kvp.key; + v -= vali; + if (v === 0) break; + } + } + if (parts.length && v === 0) return parts.reverse().join(', '); + } + throw Error.argumentOutOfRange('value', value, String.format(Sys.Res.enumInvalidValue, value, this.__typeName)); +} +Type.prototype.registerEnum = function Type$registerEnum(name, flags) { + /// <summary locid="M:J#Sys.UI.LineType.#ctor" /> + /// <param name="name" type="String"></param> + /// <param name="flags" type="Boolean" optional="true"></param> + var e = Function._validateParams(arguments, [ + {name: "name", type: String}, + {name: "flags", type: Boolean, optional: true} + ]); + if (e) throw e; + if (!Type.__fullyQualifiedIdentifierRegExp.test(name)) throw Error.argument('name', Sys.Res.notATypeName); + var parsedName; + try { + parsedName = eval(name); + } + catch(e) { + throw Error.argument('name', Sys.Res.argumentTypeName); + } + if (parsedName !== this) throw Error.argument('name', Sys.Res.badTypeName); + if (Sys.__registeredTypes[name]) throw Error.invalidOperation(String.format(Sys.Res.typeRegisteredTwice, name)); + for (var j in this.prototype) { + var val = this.prototype[j]; + if (!Type.__identifierRegExp.test(j)) throw Error.invalidOperation(String.format(Sys.Res.enumInvalidValueName, j)); + if (typeof(val) !== 'number' || (val % 1) !== 0) throw Error.invalidOperation(Sys.Res.enumValueNotInteger); + if (typeof(this[j]) !== 'undefined') throw Error.invalidOperation(String.format(Sys.Res.enumReservedName, j)); + } + Sys.__upperCaseTypes[name.toUpperCase()] = this; + for (var i in this.prototype) { + this[i] = this.prototype[i]; + } + this.__typeName = name; + this.parse = Sys$Enum$parse; + this.__string = this.toString(); + this.toString = Sys$Enum$toString; + this.__flags = flags; + this.__enum = true; + Sys.__registeredTypes[name] = true; +} +Type.isEnum = function Type$isEnum(type) { + /// <summary locid="M:J#Type.isEnum" /> + /// <param name="type" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "type", mayBeNull: true} + ]); + if (e) throw e; + if ((typeof(type) === 'undefined') || (type === null)) return false; + return !!type.__enum; +} +Type.isFlags = function Type$isFlags(type) { + /// <summary locid="M:J#Type.isFlags" /> + /// <param name="type" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "type", mayBeNull: true} + ]); + if (e) throw e; + if ((typeof(type) === 'undefined') || (type === null)) return false; + return !!type.__flags; +} +Sys.CollectionChange = function Sys$CollectionChange(action, newItems, newStartingIndex, oldItems, oldStartingIndex) { + /// <summary locid="M:J#Sys.CollectionChange.#ctor" /> + /// <param name="action" type="Sys.NotifyCollectionChangedAction"></param> + /// <param name="newItems" optional="true" mayBeNull="true"></param> + /// <param name="newStartingIndex" type="Number" integer="true" optional="true" mayBeNull="true"></param> + /// <param name="oldItems" optional="true" mayBeNull="true"></param> + /// <param name="oldStartingIndex" type="Number" integer="true" optional="true" mayBeNull="true"></param> + /// <field name="action" type="Sys.NotifyCollectionChangedAction" locid="F:J#Sys.CollectionChange.action"></field> + /// <field name="newItems" type="Array" mayBeNull="true" elementMayBeNull="true" locid="F:J#Sys.CollectionChange.newItems"></field> + /// <field name="newStartingIndex" type="Number" integer="true" locid="F:J#Sys.CollectionChange.newStartingIndex"></field> + /// <field name="oldItems" type="Array" mayBeNull="true" elementMayBeNull="true" locid="F:J#Sys.CollectionChange.oldItems"></field> + /// <field name="oldStartingIndex" type="Number" integer="true" locid="F:J#Sys.CollectionChange.oldStartingIndex"></field> + var e = Function._validateParams(arguments, [ + {name: "action", type: Sys.NotifyCollectionChangedAction}, + {name: "newItems", mayBeNull: true, optional: true}, + {name: "newStartingIndex", type: Number, mayBeNull: true, integer: true, optional: true}, + {name: "oldItems", mayBeNull: true, optional: true}, + {name: "oldStartingIndex", type: Number, mayBeNull: true, integer: true, optional: true} + ]); + if (e) throw e; + this.action = action; + if (newItems) { + if (!(newItems instanceof Array)) { + newItems = [newItems]; + } + } + this.newItems = newItems || null; + if (typeof newStartingIndex !== "number") { + newStartingIndex = -1; + } + this.newStartingIndex = newStartingIndex; + if (oldItems) { + if (!(oldItems instanceof Array)) { + oldItems = [oldItems]; + } + } + this.oldItems = oldItems || null; + if (typeof oldStartingIndex !== "number") { + oldStartingIndex = -1; + } + this.oldStartingIndex = oldStartingIndex; +} +Sys.CollectionChange.registerClass("Sys.CollectionChange"); +Sys.NotifyCollectionChangedAction = function Sys$NotifyCollectionChangedAction() { + /// <summary locid="M:J#Sys.NotifyCollectionChangedAction.#ctor" /> + /// <field name="add" type="Number" integer="true" static="true" locid="F:J#Sys.NotifyCollectionChangedAction.add"></field> + /// <field name="remove" type="Number" integer="true" static="true" locid="F:J#Sys.NotifyCollectionChangedAction.remove"></field> + /// <field name="reset" type="Number" integer="true" static="true" locid="F:J#Sys.NotifyCollectionChangedAction.reset"></field> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); +} +Sys.NotifyCollectionChangedAction.prototype = { + add: 0, + remove: 1, + reset: 2 +} +Sys.NotifyCollectionChangedAction.registerEnum('Sys.NotifyCollectionChangedAction'); +Sys.NotifyCollectionChangedEventArgs = function Sys$NotifyCollectionChangedEventArgs(changes) { + /// <summary locid="M:J#Sys.NotifyCollectionChangedEventArgs.#ctor" /> + /// <param name="changes" type="Array" elementType="Sys.CollectionChange"></param> + var e = Function._validateParams(arguments, [ + {name: "changes", type: Array, elementType: Sys.CollectionChange} + ]); + if (e) throw e; + this._changes = changes; + Sys.NotifyCollectionChangedEventArgs.initializeBase(this); +} + function Sys$NotifyCollectionChangedEventArgs$get_changes() { + /// <value type="Array" elementType="Sys.CollectionChange" locid="P:J#Sys.NotifyCollectionChangedEventArgs.changes"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._changes || []; + } +Sys.NotifyCollectionChangedEventArgs.prototype = { + get_changes: Sys$NotifyCollectionChangedEventArgs$get_changes +} +Sys.NotifyCollectionChangedEventArgs.registerClass("Sys.NotifyCollectionChangedEventArgs", Sys.EventArgs); +Sys.Observer = function Sys$Observer() { + throw Error.invalidOperation(); +} +Sys.Observer.registerClass("Sys.Observer"); +Sys.Observer.makeObservable = function Sys$Observer$makeObservable(target) { + /// <summary locid="M:J#Sys.Observer.makeObservable" /> + /// <param name="target" mayBeNull="false"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "target"} + ]); + if (e) throw e; + var isArray = target instanceof Array, + o = Sys.Observer; + Sys.Observer._ensureObservable(target); + if (target.setValue === o._observeMethods.setValue) return target; + o._addMethods(target, o._observeMethods); + if (isArray) { + o._addMethods(target, o._arrayMethods); + } + return target; +} +Sys.Observer._ensureObservable = function Sys$Observer$_ensureObservable(target) { + var type = typeof target; + if ((type === "string") || (type === "number") || (type === "boolean") || (type === "date")) { + throw Error.invalidOperation(String.format(Sys.Res.notObservable, type)); + } +} +Sys.Observer._addMethods = function Sys$Observer$_addMethods(target, methods) { + for (var m in methods) { + if (target[m] && (target[m] !== methods[m])) { + throw Error.invalidOperation(String.format(Sys.Res.observableConflict, m)); + } + target[m] = methods[m]; + } +} +Sys.Observer._addEventHandler = function Sys$Observer$_addEventHandler(target, eventName, handler) { + Sys.Observer._getContext(target, true).events._addHandler(eventName, handler); +} +Sys.Observer.addEventHandler = function Sys$Observer$addEventHandler(target, eventName, handler) { + /// <summary locid="M:J#Sys.Observer.addEventHandler" /> + /// <param name="target"></param> + /// <param name="eventName" type="String"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "target"}, + {name: "eventName", type: String}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + Sys.Observer._addEventHandler(target, eventName, handler); +} +Sys.Observer._removeEventHandler = function Sys$Observer$_removeEventHandler(target, eventName, handler) { + Sys.Observer._getContext(target, true).events._removeHandler(eventName, handler); +} +Sys.Observer.removeEventHandler = function Sys$Observer$removeEventHandler(target, eventName, handler) { + /// <summary locid="M:J#Sys.Observer.removeEventHandler" /> + /// <param name="target"></param> + /// <param name="eventName" type="String"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "target"}, + {name: "eventName", type: String}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + Sys.Observer._removeEventHandler(target, eventName, handler); +} +Sys.Observer.raiseEvent = function Sys$Observer$raiseEvent(target, eventName, eventArgs) { + /// <summary locid="M:J#Sys.Observer.raiseEvent" /> + /// <param name="target"></param> + /// <param name="eventName" type="String"></param> + /// <param name="eventArgs" type="Sys.EventArgs"></param> + var e = Function._validateParams(arguments, [ + {name: "target"}, + {name: "eventName", type: String}, + {name: "eventArgs", type: Sys.EventArgs} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + var ctx = Sys.Observer._getContext(target); + if (!ctx) return; + var handler = ctx.events.getHandler(eventName); + if (handler) { + handler(target, eventArgs); + } +} +Sys.Observer.addPropertyChanged = function Sys$Observer$addPropertyChanged(target, handler) { + /// <summary locid="M:J#Sys.Observer.addPropertyChanged" /> + /// <param name="target" mayBeNull="false"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "target"}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + Sys.Observer._addEventHandler(target, "propertyChanged", handler); +} +Sys.Observer.removePropertyChanged = function Sys$Observer$removePropertyChanged(target, handler) { + /// <summary locid="M:J#Sys.Observer.removePropertyChanged" /> + /// <param name="target" mayBeNull="false"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "target"}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + Sys.Observer._removeEventHandler(target, "propertyChanged", handler); +} +Sys.Observer.beginUpdate = function Sys$Observer$beginUpdate(target) { + /// <summary locid="M:J#Sys.Observer.beginUpdate" /> + /// <param name="target" mayBeNull="false"></param> + var e = Function._validateParams(arguments, [ + {name: "target"} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + Sys.Observer._getContext(target, true).updating = true; +} +Sys.Observer.endUpdate = function Sys$Observer$endUpdate(target) { + /// <summary locid="M:J#Sys.Observer.endUpdate" /> + /// <param name="target" mayBeNull="false"></param> + var e = Function._validateParams(arguments, [ + {name: "target"} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + var ctx = Sys.Observer._getContext(target); + if (!ctx || !ctx.updating) return; + ctx.updating = false; + var dirty = ctx.dirty; + ctx.dirty = false; + if (dirty) { + if (target instanceof Array) { + var changes = ctx.changes; + ctx.changes = null; + Sys.Observer.raiseCollectionChanged(target, changes); + } + Sys.Observer.raisePropertyChanged(target, ""); + } +} +Sys.Observer.isUpdating = function Sys$Observer$isUpdating(target) { + /// <summary locid="M:J#Sys.Observer.isUpdating" /> + /// <param name="target" mayBeNull="false"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "target"} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + var ctx = Sys.Observer._getContext(target); + return ctx ? ctx.updating : false; +} +Sys.Observer._setValue = function Sys$Observer$_setValue(target, propertyName, value) { + var getter, setter, mainTarget = target, path = propertyName.split('.'); + for (var i = 0, l = (path.length - 1); i < l ; i++) { + var name = path[i]; + getter = target["get_" + name]; + if (typeof (getter) === "function") { + target = getter.call(target); + } + else { + target = target[name]; + } + var type = typeof (target); + if ((target === null) || (type === "undefined")) { + throw Error.invalidOperation(String.format(Sys.Res.nullReferenceInPath, propertyName)); + } + } + var currentValue, lastPath = path[l]; + getter = target["get_" + lastPath]; + setter = target["set_" + lastPath]; + if (typeof(getter) === 'function') { + currentValue = getter.call(target); + } + else { + currentValue = target[lastPath]; + } + if (typeof(setter) === 'function') { + setter.call(target, value); + } + else { + target[lastPath] = value; + } + if (currentValue !== value) { + var ctx = Sys.Observer._getContext(mainTarget); + if (ctx && ctx.updating) { + ctx.dirty = true; + return; + }; + Sys.Observer.raisePropertyChanged(mainTarget, path[0]); + } +} +Sys.Observer.setValue = function Sys$Observer$setValue(target, propertyName, value) { + /// <summary locid="M:J#Sys.Observer.setValue" /> + /// <param name="target" mayBeNull="false"></param> + /// <param name="propertyName" type="String"></param> + /// <param name="value" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "target"}, + {name: "propertyName", type: String}, + {name: "value", mayBeNull: true} + ]); + if (e) throw e; + Sys.Observer._ensureObservable(target); + Sys.Observer._setValue(target, propertyName, value); +} +Sys.Observer.raisePropertyChanged = function Sys$Observer$raisePropertyChanged(target, propertyName) { + /// <summary locid="M:J#Sys.Observer.raisePropertyChanged" /> + /// <param name="target" mayBeNull="false"></param> + /// <param name="propertyName" type="String"></param> + Sys.Observer.raiseEvent(target, "propertyChanged", new Sys.PropertyChangedEventArgs(propertyName)); +} +Sys.Observer.addCollectionChanged = function Sys$Observer$addCollectionChanged(target, handler) { + /// <summary locid="M:J#Sys.Observer.addCollectionChanged" /> + /// <param name="target" type="Array" elementMayBeNull="true"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "target", type: Array, elementMayBeNull: true}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.Observer._addEventHandler(target, "collectionChanged", handler); +} +Sys.Observer.removeCollectionChanged = function Sys$Observer$removeCollectionChanged(target, handler) { + /// <summary locid="M:J#Sys.Observer.removeCollectionChanged" /> + /// <param name="target" type="Array" elementMayBeNull="true"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "target", type: Array, elementMayBeNull: true}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.Observer._removeEventHandler(target, "collectionChanged", handler); +} +Sys.Observer._collectionChange = function Sys$Observer$_collectionChange(target, change) { + var ctx = Sys.Observer._getContext(target); + if (ctx && ctx.updating) { + ctx.dirty = true; + var changes = ctx.changes; + if (!changes) { + ctx.changes = changes = [change]; + } + else { + changes.push(change); + } + } + else { + Sys.Observer.raiseCollectionChanged(target, [change]); + Sys.Observer.raisePropertyChanged(target, 'length'); + } +} +Sys.Observer.add = function Sys$Observer$add(target, item) { + /// <summary locid="M:J#Sys.Observer.add" /> + /// <param name="target" type="Array" elementMayBeNull="true"></param> + /// <param name="item" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "target", type: Array, elementMayBeNull: true}, + {name: "item", mayBeNull: true} + ]); + if (e) throw e; + var change = new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add, [item], target.length); + Array.add(target, item); + Sys.Observer._collectionChange(target, change); +} +Sys.Observer.addRange = function Sys$Observer$addRange(target, items) { + /// <summary locid="M:J#Sys.Observer.addRange" /> + /// <param name="target" type="Array" elementMayBeNull="true"></param> + /// <param name="items" type="Array" elementMayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "target", type: Array, elementMayBeNull: true}, + {name: "items", type: Array, elementMayBeNull: true} + ]); + if (e) throw e; + var change = new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add, items, target.length); + Array.addRange(target, items); + Sys.Observer._collectionChange(target, change); +} +Sys.Observer.clear = function Sys$Observer$clear(target) { + /// <summary locid="M:J#Sys.Observer.clear" /> + /// <param name="target" type="Array" elementMayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "target", type: Array, elementMayBeNull: true} + ]); + if (e) throw e; + var oldItems = Array.clone(target); + Array.clear(target); + Sys.Observer._collectionChange(target, new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.reset, null, -1, oldItems, 0)); +} +Sys.Observer.insert = function Sys$Observer$insert(target, index, item) { + /// <summary locid="M:J#Sys.Observer.insert" /> + /// <param name="target" type="Array" elementMayBeNull="true"></param> + /// <param name="index" type="Number" integer="true"></param> + /// <param name="item" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "target", type: Array, elementMayBeNull: true}, + {name: "index", type: Number, integer: true}, + {name: "item", mayBeNull: true} + ]); + if (e) throw e; + Array.insert(target, index, item); + Sys.Observer._collectionChange(target, new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add, [item], index)); +} +Sys.Observer.remove = function Sys$Observer$remove(target, item) { + /// <summary locid="M:J#Sys.Observer.remove" /> + /// <param name="target" type="Array" elementMayBeNull="true"></param> + /// <param name="item" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "target", type: Array, elementMayBeNull: true}, + {name: "item", mayBeNull: true} + ]); + if (e) throw e; + var index = Array.indexOf(target, item); + if (index !== -1) { + Array.remove(target, item); + Sys.Observer._collectionChange(target, new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.remove, null, -1, [item], index)); + return true; + } + return false; +} +Sys.Observer.removeAt = function Sys$Observer$removeAt(target, index) { + /// <summary locid="M:J#Sys.Observer.removeAt" /> + /// <param name="target" type="Array" elementMayBeNull="true"></param> + /// <param name="index" type="Number" integer="true"></param> + var e = Function._validateParams(arguments, [ + {name: "target", type: Array, elementMayBeNull: true}, + {name: "index", type: Number, integer: true} + ]); + if (e) throw e; + if ((index > -1) && (index < target.length)) { + var item = target[index]; + Array.removeAt(target, index); + Sys.Observer._collectionChange(target, new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.remove, null, -1, [item], index)); + } +} +Sys.Observer.raiseCollectionChanged = function Sys$Observer$raiseCollectionChanged(target, changes) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="target"></param> + /// <param name="changes" type="Array" elementType="Sys.CollectionChange"></param> + Sys.Observer.raiseEvent(target, "collectionChanged", new Sys.NotifyCollectionChangedEventArgs(changes)); +} +Sys.Observer._observeMethods = { + add_propertyChanged: function(handler) { + Sys.Observer._addEventHandler(this, "propertyChanged", handler); + }, + remove_propertyChanged: function(handler) { + Sys.Observer._removeEventHandler(this, "propertyChanged", handler); + }, + addEventHandler: function(eventName, handler) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="eventName" type="String"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "eventName", type: String}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.Observer._addEventHandler(this, eventName, handler); + }, + removeEventHandler: function(eventName, handler) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="eventName" type="String"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "eventName", type: String}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.Observer._removeEventHandler(this, eventName, handler); + }, + get_isUpdating: function() { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <returns type="Boolean"></returns> + return Sys.Observer.isUpdating(this); + }, + beginUpdate: function() { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + Sys.Observer.beginUpdate(this); + }, + endUpdate: function() { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + Sys.Observer.endUpdate(this); + }, + setValue: function(name, value) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="name" type="String"></param> + /// <param name="value" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "name", type: String}, + {name: "value", mayBeNull: true} + ]); + if (e) throw e; + Sys.Observer._setValue(this, name, value); + }, + raiseEvent: function(eventName, eventArgs) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="eventName" type="String"></param> + /// <param name="eventArgs" type="Sys.EventArgs"></param> + Sys.Observer.raiseEvent(this, eventName, eventArgs); + }, + raisePropertyChanged: function(name) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="name" type="String"></param> + Sys.Observer.raiseEvent(this, "propertyChanged", new Sys.PropertyChangedEventArgs(name)); + } +} +Sys.Observer._arrayMethods = { + add_collectionChanged: function(handler) { + Sys.Observer._addEventHandler(this, "collectionChanged", handler); + }, + remove_collectionChanged: function(handler) { + Sys.Observer._removeEventHandler(this, "collectionChanged", handler); + }, + add: function(item) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="item" mayBeNull="true"></param> + Sys.Observer.add(this, item); + }, + addRange: function(items) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="items" type="Array" elementMayBeNull="true"></param> + Sys.Observer.addRange(this, items); + }, + clear: function() { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + Sys.Observer.clear(this); + }, + insert: function(index, item) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="index" type="Number" integer="true"></param> + /// <param name="item" mayBeNull="true"></param> + Sys.Observer.insert(this, index, item); + }, + remove: function(item) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="item" mayBeNull="true"></param> + /// <returns type="Boolean"></returns> + return Sys.Observer.remove(this, item); + }, + removeAt: function(index) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="index" type="Number" integer="true"></param> + Sys.Observer.removeAt(this, index); + }, + raiseCollectionChanged: function(changes) { + /// <summary locid="M:J#Sys.Observer.raiseCollectionChanged" /> + /// <param name="changes" type="Array" elementType="Sys.CollectionChange"></param> + Sys.Observer.raiseEvent(this, "collectionChanged", new Sys.NotifyCollectionChangedEventArgs(changes)); + } +} +Sys.Observer._getContext = function Sys$Observer$_getContext(obj, create) { + var ctx = obj._observerContext; + if (ctx) return ctx(); + if (create) { + return (obj._observerContext = Sys.Observer._createContext())(); + } + return null; +} +Sys.Observer._createContext = function Sys$Observer$_createContext() { + var ctx = { + events: new Sys.EventHandlerList() + }; + return function() { + return ctx; + } +} +Date._appendPreOrPostMatch = function Date$_appendPreOrPostMatch(preMatch, strBuilder) { + var quoteCount = 0; + var escaped = false; + for (var i = 0, il = preMatch.length; i < il; i++) { + var c = preMatch.charAt(i); + switch (c) { + case '\'': + if (escaped) strBuilder.append("'"); + else quoteCount++; + escaped = false; + break; + case '\\': + if (escaped) strBuilder.append("\\"); + escaped = !escaped; + break; + default: + strBuilder.append(c); + escaped = false; + break; + } + } + return quoteCount; +} +Date._expandFormat = function Date$_expandFormat(dtf, format) { + if (!format) { + format = "F"; + } + var len = format.length; + if (len === 1) { + switch (format) { + case "d": + return dtf.ShortDatePattern; + case "D": + return dtf.LongDatePattern; + case "t": + return dtf.ShortTimePattern; + case "T": + return dtf.LongTimePattern; + case "f": + return dtf.LongDatePattern + " " + dtf.ShortTimePattern; + case "F": + return dtf.FullDateTimePattern; + case "M": case "m": + return dtf.MonthDayPattern; + case "s": + return dtf.SortableDateTimePattern; + case "Y": case "y": + return dtf.YearMonthPattern; + default: + throw Error.format(Sys.Res.formatInvalidString); + } + } + else if ((len === 2) && (format.charAt(0) === "%")) { + format = format.charAt(1); + } + return format; +} +Date._expandYear = function Date$_expandYear(dtf, year) { + var now = new Date(), + era = Date._getEra(now); + if (year < 100) { + var curr = Date._getEraYear(now, dtf, era); + year += curr - (curr % 100); + if (year > dtf.Calendar.TwoDigitYearMax) { + year -= 100; + } + } + return year; +} +Date._getEra = function Date$_getEra(date, eras) { + if (!eras) return 0; + var start, ticks = date.getTime(); + for (var i = 0, l = eras.length; i < l; i += 4) { + start = eras[i+2]; + if ((start === null) || (ticks >= start)) { + return i; + } + } + return 0; +} +Date._getEraYear = function Date$_getEraYear(date, dtf, era, sortable) { + var year = date.getFullYear(); + if (!sortable && dtf.eras) { + year -= dtf.eras[era + 3]; + } + return year; +} +Date._getParseRegExp = function Date$_getParseRegExp(dtf, format) { + if (!dtf._parseRegExp) { + dtf._parseRegExp = {}; + } + else if (dtf._parseRegExp[format]) { + return dtf._parseRegExp[format]; + } + var expFormat = Date._expandFormat(dtf, format); + expFormat = expFormat.replace(/([\^\$\.\*\+\?\|\[\]\(\)\{\}])/g, "\\\\$1"); + var regexp = new Sys.StringBuilder("^"); + var groups = []; + var index = 0; + var quoteCount = 0; + var tokenRegExp = Date._getTokenRegExp(); + var match; + while ((match = tokenRegExp.exec(expFormat)) !== null) { + var preMatch = expFormat.slice(index, match.index); + index = tokenRegExp.lastIndex; + quoteCount += Date._appendPreOrPostMatch(preMatch, regexp); + if ((quoteCount%2) === 1) { + regexp.append(match[0]); + continue; + } + switch (match[0]) { + case 'dddd': case 'ddd': + case 'MMMM': case 'MMM': + case 'gg': case 'g': + regexp.append("(\\D+)"); + break; + case 'tt': case 't': + regexp.append("(\\D*)"); + break; + case 'yyyy': + regexp.append("(\\d{4})"); + break; + case 'fff': + regexp.append("(\\d{3})"); + break; + case 'ff': + regexp.append("(\\d{2})"); + break; + case 'f': + regexp.append("(\\d)"); + break; + case 'dd': case 'd': + case 'MM': case 'M': + case 'yy': case 'y': + case 'HH': case 'H': + case 'hh': case 'h': + case 'mm': case 'm': + case 'ss': case 's': + regexp.append("(\\d\\d?)"); + break; + case 'zzz': + regexp.append("([+-]?\\d\\d?:\\d{2})"); + break; + case 'zz': case 'z': + regexp.append("([+-]?\\d\\d?)"); + break; + case '/': + regexp.append("(\\" + dtf.DateSeparator + ")"); + break; + default: + Sys.Debug.fail("Invalid date format pattern"); + } + Array.add(groups, match[0]); + } + Date._appendPreOrPostMatch(expFormat.slice(index), regexp); + regexp.append("$"); + var regexpStr = regexp.toString().replace(/\s+/g, "\\s+"); + var parseRegExp = {'regExp': regexpStr, 'groups': groups}; + dtf._parseRegExp[format] = parseRegExp; + return parseRegExp; +} +Date._getTokenRegExp = function Date$_getTokenRegExp() { + return /\/|dddd|ddd|dd|d|MMMM|MMM|MM|M|yyyy|yy|y|hh|h|HH|H|mm|m|ss|s|tt|t|fff|ff|f|zzz|zz|z|gg|g/g; +} +Date.parseLocale = function Date$parseLocale(value, formats) { + /// <summary locid="M:J#Date.parseLocale" /> + /// <param name="value" type="String"></param> + /// <param name="formats" parameterArray="true" optional="true" mayBeNull="true"></param> + /// <returns type="Date"></returns> + var e = Function._validateParams(arguments, [ + {name: "value", type: String}, + {name: "formats", mayBeNull: true, optional: true, parameterArray: true} + ]); + if (e) throw e; + return Date._parse(value, Sys.CultureInfo.CurrentCulture, arguments); +} +Date.parseInvariant = function Date$parseInvariant(value, formats) { + /// <summary locid="M:J#Date.parseInvariant" /> + /// <param name="value" type="String"></param> + /// <param name="formats" parameterArray="true" optional="true" mayBeNull="true"></param> + /// <returns type="Date"></returns> + var e = Function._validateParams(arguments, [ + {name: "value", type: String}, + {name: "formats", mayBeNull: true, optional: true, parameterArray: true} + ]); + if (e) throw e; + return Date._parse(value, Sys.CultureInfo.InvariantCulture, arguments); +} +Date._parse = function Date$_parse(value, cultureInfo, args) { + var i, l, date, format, formats, custom = false; + for (i = 1, l = args.length; i < l; i++) { + format = args[i]; + if (format) { + custom = true; + date = Date._parseExact(value, format, cultureInfo); + if (date) return date; + } + } + if (! custom) { + formats = cultureInfo._getDateTimeFormats(); + for (i = 0, l = formats.length; i < l; i++) { + date = Date._parseExact(value, formats[i], cultureInfo); + if (date) return date; + } + } + return null; +} +Date._parseExact = function Date$_parseExact(value, format, cultureInfo) { + value = value.trim(); + var dtf = cultureInfo.dateTimeFormat, + parseInfo = Date._getParseRegExp(dtf, format), + match = new RegExp(parseInfo.regExp).exec(value); + if (match === null) return null; + + var groups = parseInfo.groups, + era = null, year = null, month = null, date = null, weekDay = null, + hour = 0, hourOffset, min = 0, sec = 0, msec = 0, tzMinOffset = null, + pmHour = false; + for (var j = 0, jl = groups.length; j < jl; j++) { + var matchGroup = match[j+1]; + if (matchGroup) { + switch (groups[j]) { + case 'dd': case 'd': + date = parseInt(matchGroup, 10); + if ((date < 1) || (date > 31)) return null; + break; + case 'MMMM': + month = cultureInfo._getMonthIndex(matchGroup); + if ((month < 0) || (month > 11)) return null; + break; + case 'MMM': + month = cultureInfo._getAbbrMonthIndex(matchGroup); + if ((month < 0) || (month > 11)) return null; + break; + case 'M': case 'MM': + month = parseInt(matchGroup, 10) - 1; + if ((month < 0) || (month > 11)) return null; + break; + case 'y': case 'yy': + year = Date._expandYear(dtf,parseInt(matchGroup, 10)); + if ((year < 0) || (year > 9999)) return null; + break; + case 'yyyy': + year = parseInt(matchGroup, 10); + if ((year < 0) || (year > 9999)) return null; + break; + case 'h': case 'hh': + hour = parseInt(matchGroup, 10); + if (hour === 12) hour = 0; + if ((hour < 0) || (hour > 11)) return null; + break; + case 'H': case 'HH': + hour = parseInt(matchGroup, 10); + if ((hour < 0) || (hour > 23)) return null; + break; + case 'm': case 'mm': + min = parseInt(matchGroup, 10); + if ((min < 0) || (min > 59)) return null; + break; + case 's': case 'ss': + sec = parseInt(matchGroup, 10); + if ((sec < 0) || (sec > 59)) return null; + break; + case 'tt': case 't': + var upperToken = matchGroup.toUpperCase(); + pmHour = (upperToken === dtf.PMDesignator.toUpperCase()); + if (!pmHour && (upperToken !== dtf.AMDesignator.toUpperCase())) return null; + break; + case 'f': + msec = parseInt(matchGroup, 10) * 100; + if ((msec < 0) || (msec > 999)) return null; + break; + case 'ff': + msec = parseInt(matchGroup, 10) * 10; + if ((msec < 0) || (msec > 999)) return null; + break; + case 'fff': + msec = parseInt(matchGroup, 10); + if ((msec < 0) || (msec > 999)) return null; + break; + case 'dddd': + weekDay = cultureInfo._getDayIndex(matchGroup); + if ((weekDay < 0) || (weekDay > 6)) return null; + break; + case 'ddd': + weekDay = cultureInfo._getAbbrDayIndex(matchGroup); + if ((weekDay < 0) || (weekDay > 6)) return null; + break; + case 'zzz': + var offsets = matchGroup.split(/:/); + if (offsets.length !== 2) return null; + hourOffset = parseInt(offsets[0], 10); + if ((hourOffset < -12) || (hourOffset > 13)) return null; + var minOffset = parseInt(offsets[1], 10); + if ((minOffset < 0) || (minOffset > 59)) return null; + tzMinOffset = (hourOffset * 60) + (matchGroup.startsWith('-')? -minOffset : minOffset); + break; + case 'z': case 'zz': + hourOffset = parseInt(matchGroup, 10); + if ((hourOffset < -12) || (hourOffset > 13)) return null; + tzMinOffset = hourOffset * 60; + break; + case 'g': case 'gg': + var eraName = matchGroup; + if (!eraName || !dtf.eras) return null; + eraName = eraName.toLowerCase().trim(); + for (var i = 0, l = dtf.eras.length; i < l; i += 4) { + if (eraName === dtf.eras[i + 1].toLowerCase()) { + era = i; + break; + } + } + if (era === null) return null; + break; + } + } + } + var result = new Date(), defaults, convert = dtf.Calendar.convert; + if (convert) { + defaults = convert.fromGregorian(result); + } + if (!convert) { + defaults = [result.getFullYear(), result.getMonth(), result.getDate()]; + } + if (year === null) { + year = defaults[0]; + } + else if (dtf.eras) { + year += dtf.eras[(era || 0) + 3]; + } + if (month === null) { + month = defaults[1]; + } + if (date === null) { + date = defaults[2]; + } + if (convert) { + result = convert.toGregorian(year, month, date); + if (result === null) return null; + } + else { + result.setFullYear(year, month, date); + if (result.getDate() !== date) return null; + if ((weekDay !== null) && (result.getDay() !== weekDay)) { + return null; + } + } + if (pmHour && (hour < 12)) { + hour += 12; + } + result.setHours(hour, min, sec, msec); + if (tzMinOffset !== null) { + var adjustedMin = result.getMinutes() - (tzMinOffset + result.getTimezoneOffset()); + result.setHours(result.getHours() + parseInt(adjustedMin/60, 10), adjustedMin%60); + } + return result; +} +Date.prototype.format = function Date$format(format) { + /// <summary locid="M:J#Date.format" /> + /// <param name="format" type="String"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "format", type: String} + ]); + if (e) throw e; + return this._toFormattedString(format, Sys.CultureInfo.InvariantCulture); +} +Date.prototype.localeFormat = function Date$localeFormat(format) { + /// <summary locid="M:J#Date.localeFormat" /> + /// <param name="format" type="String"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "format", type: String} + ]); + if (e) throw e; + return this._toFormattedString(format, Sys.CultureInfo.CurrentCulture); +} +Date.prototype._toFormattedString = function Date$_toFormattedString(format, cultureInfo) { + var dtf = cultureInfo.dateTimeFormat, + convert = dtf.Calendar.convert; + if (!format || !format.length || (format === 'i')) { + if (cultureInfo && cultureInfo.name.length) { + if (convert) { + return this._toFormattedString(dtf.FullDateTimePattern, cultureInfo); + } + else { + var eraDate = new Date(this.getTime()); + var era = Date._getEra(this, dtf.eras); + eraDate.setFullYear(Date._getEraYear(this, dtf, era)); + return eraDate.toLocaleString(); + } + } + else { + return this.toString(); + } + } + var eras = dtf.eras, + sortable = (format === "s"); + format = Date._expandFormat(dtf, format); + var ret = new Sys.StringBuilder(); + var hour; + function addLeadingZero(num) { + if (num < 10) { + return '0' + num; + } + return num.toString(); + } + function addLeadingZeros(num) { + if (num < 10) { + return '00' + num; + } + if (num < 100) { + return '0' + num; + } + return num.toString(); + } + function padYear(year) { + if (year < 10) { + return '000' + year; + } + else if (year < 100) { + return '00' + year; + } + else if (year < 1000) { + return '0' + year; + } + return year.toString(); + } + + var foundDay, checkedDay, dayPartRegExp = /([^d]|^)(d|dd)([^d]|$)/g; + function hasDay() { + if (foundDay || checkedDay) { + return foundDay; + } + foundDay = dayPartRegExp.test(format); + checkedDay = true; + return foundDay; + } + + var quoteCount = 0, + tokenRegExp = Date._getTokenRegExp(), + converted; + if (!sortable && convert) { + converted = convert.fromGregorian(this); + } + for (;;) { + var index = tokenRegExp.lastIndex; + var ar = tokenRegExp.exec(format); + var preMatch = format.slice(index, ar ? ar.index : format.length); + quoteCount += Date._appendPreOrPostMatch(preMatch, ret); + if (!ar) break; + if ((quoteCount%2) === 1) { + ret.append(ar[0]); + continue; + } + + function getPart(date, part) { + if (converted) { + return converted[part]; + } + switch (part) { + case 0: return date.getFullYear(); + case 1: return date.getMonth(); + case 2: return date.getDate(); + } + } + switch (ar[0]) { + case "dddd": + ret.append(dtf.DayNames[this.getDay()]); + break; + case "ddd": + ret.append(dtf.AbbreviatedDayNames[this.getDay()]); + break; + case "dd": + foundDay = true; + ret.append(addLeadingZero(getPart(this, 2))); + break; + case "d": + foundDay = true; + ret.append(getPart(this, 2)); + break; + case "MMMM": + ret.append((dtf.MonthGenitiveNames && hasDay()) + ? dtf.MonthGenitiveNames[getPart(this, 1)] + : dtf.MonthNames[getPart(this, 1)]); + break; + case "MMM": + ret.append((dtf.AbbreviatedMonthGenitiveNames && hasDay()) + ? dtf.AbbreviatedMonthGenitiveNames[getPart(this, 1)] + : dtf.AbbreviatedMonthNames[getPart(this, 1)]); + break; + case "MM": + ret.append(addLeadingZero(getPart(this, 1) + 1)); + break; + case "M": + ret.append(getPart(this, 1) + 1); + break; + case "yyyy": + ret.append(padYear(converted ? converted[0] : Date._getEraYear(this, dtf, Date._getEra(this, eras), sortable))); + break; + case "yy": + ret.append(addLeadingZero((converted ? converted[0] : Date._getEraYear(this, dtf, Date._getEra(this, eras), sortable)) % 100)); + break; + case "y": + ret.append((converted ? converted[0] : Date._getEraYear(this, dtf, Date._getEra(this, eras), sortable)) % 100); + break; + case "hh": + hour = this.getHours() % 12; + if (hour === 0) hour = 12; + ret.append(addLeadingZero(hour)); + break; + case "h": + hour = this.getHours() % 12; + if (hour === 0) hour = 12; + ret.append(hour); + break; + case "HH": + ret.append(addLeadingZero(this.getHours())); + break; + case "H": + ret.append(this.getHours()); + break; + case "mm": + ret.append(addLeadingZero(this.getMinutes())); + break; + case "m": + ret.append(this.getMinutes()); + break; + case "ss": + ret.append(addLeadingZero(this.getSeconds())); + break; + case "s": + ret.append(this.getSeconds()); + break; + case "tt": + ret.append((this.getHours() < 12) ? dtf.AMDesignator : dtf.PMDesignator); + break; + case "t": + ret.append(((this.getHours() < 12) ? dtf.AMDesignator : dtf.PMDesignator).charAt(0)); + break; + case "f": + ret.append(addLeadingZeros(this.getMilliseconds()).charAt(0)); + break; + case "ff": + ret.append(addLeadingZeros(this.getMilliseconds()).substr(0, 2)); + break; + case "fff": + ret.append(addLeadingZeros(this.getMilliseconds())); + break; + case "z": + hour = this.getTimezoneOffset() / 60; + ret.append(((hour <= 0) ? '+' : '-') + Math.floor(Math.abs(hour))); + break; + case "zz": + hour = this.getTimezoneOffset() / 60; + ret.append(((hour <= 0) ? '+' : '-') + addLeadingZero(Math.floor(Math.abs(hour)))); + break; + case "zzz": + hour = this.getTimezoneOffset() / 60; + ret.append(((hour <= 0) ? '+' : '-') + addLeadingZero(Math.floor(Math.abs(hour))) + + ":" + addLeadingZero(Math.abs(this.getTimezoneOffset() % 60))); + break; + case "g": + case "gg": + if (dtf.eras) { + ret.append(dtf.eras[Date._getEra(this, eras) + 1]); + } + break; + case "/": + ret.append(dtf.DateSeparator); + break; + default: + Sys.Debug.fail("Invalid date format pattern"); + } + } + return ret.toString(); +} +String.localeFormat = function String$localeFormat(format, args) { + /// <summary locid="M:J#String.localeFormat" /> + /// <param name="format" type="String"></param> + /// <param name="args" parameterArray="true" mayBeNull="true"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "format", type: String}, + {name: "args", mayBeNull: true, parameterArray: true} + ]); + if (e) throw e; + return String._toFormattedString(true, arguments); +} +Number.parseLocale = function Number$parseLocale(value) { + /// <summary locid="M:J#Number.parseLocale" /> + /// <param name="value" type="String"></param> + /// <returns type="Number"></returns> + var e = Function._validateParams(arguments, [ + {name: "value", type: String} + ], false); + if (e) throw e; + return Number._parse(value, Sys.CultureInfo.CurrentCulture); +} +Number.parseInvariant = function Number$parseInvariant(value) { + /// <summary locid="M:J#Number.parseInvariant" /> + /// <param name="value" type="String"></param> + /// <returns type="Number"></returns> + var e = Function._validateParams(arguments, [ + {name: "value", type: String} + ], false); + if (e) throw e; + return Number._parse(value, Sys.CultureInfo.InvariantCulture); +} +Number._parse = function Number$_parse(value, cultureInfo) { + value = value.trim(); + + if (value.match(/^[+-]?infinity$/i)) { + return parseFloat(value); + } + if (value.match(/^0x[a-f0-9]+$/i)) { + return parseInt(value); + } + var numFormat = cultureInfo.numberFormat; + var signInfo = Number._parseNumberNegativePattern(value, numFormat, numFormat.NumberNegativePattern); + var sign = signInfo[0]; + var num = signInfo[1]; + + if ((sign === '') && (numFormat.NumberNegativePattern !== 1)) { + signInfo = Number._parseNumberNegativePattern(value, numFormat, 1); + sign = signInfo[0]; + num = signInfo[1]; + } + if (sign === '') sign = '+'; + + var exponent; + var intAndFraction; + var exponentPos = num.indexOf('e'); + if (exponentPos < 0) exponentPos = num.indexOf('E'); + if (exponentPos < 0) { + intAndFraction = num; + exponent = null; + } + else { + intAndFraction = num.substr(0, exponentPos); + exponent = num.substr(exponentPos + 1); + } + + var integer; + var fraction; + var decimalPos = intAndFraction.indexOf(numFormat.NumberDecimalSeparator); + if (decimalPos < 0) { + integer = intAndFraction; + fraction = null; + } + else { + integer = intAndFraction.substr(0, decimalPos); + fraction = intAndFraction.substr(decimalPos + numFormat.NumberDecimalSeparator.length); + } + + integer = integer.split(numFormat.NumberGroupSeparator).join(''); + var altNumGroupSeparator = numFormat.NumberGroupSeparator.replace(/\u00A0/g, " "); + if (numFormat.NumberGroupSeparator !== altNumGroupSeparator) { + integer = integer.split(altNumGroupSeparator).join(''); + } + + var p = sign + integer; + if (fraction !== null) { + p += '.' + fraction; + } + if (exponent !== null) { + var expSignInfo = Number._parseNumberNegativePattern(exponent, numFormat, 1); + if (expSignInfo[0] === '') { + expSignInfo[0] = '+'; + } + p += 'e' + expSignInfo[0] + expSignInfo[1]; + } + if (p.match(/^[+-]?\d*\.?\d*(e[+-]?\d+)?$/)) { + return parseFloat(p); + } + return Number.NaN; +} +Number._parseNumberNegativePattern = function Number$_parseNumberNegativePattern(value, numFormat, numberNegativePattern) { + var neg = numFormat.NegativeSign; + var pos = numFormat.PositiveSign; + switch (numberNegativePattern) { + case 4: + neg = ' ' + neg; + pos = ' ' + pos; + case 3: + if (value.endsWith(neg)) { + return ['-', value.substr(0, value.length - neg.length)]; + } + else if (value.endsWith(pos)) { + return ['+', value.substr(0, value.length - pos.length)]; + } + break; + case 2: + neg += ' '; + pos += ' '; + case 1: + if (value.startsWith(neg)) { + return ['-', value.substr(neg.length)]; + } + else if (value.startsWith(pos)) { + return ['+', value.substr(pos.length)]; + } + break; + case 0: + if (value.startsWith('(') && value.endsWith(')')) { + return ['-', value.substr(1, value.length - 2)]; + } + break; + default: + Sys.Debug.fail(""); + } + return ['', value]; +} +Number.prototype.format = function Number$format(format) { + /// <summary locid="M:J#Number.format" /> + /// <param name="format" type="String"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "format", type: String} + ]); + if (e) throw e; + return this._toFormattedString(format, Sys.CultureInfo.InvariantCulture); +} +Number.prototype.localeFormat = function Number$localeFormat(format) { + /// <summary locid="M:J#Number.localeFormat" /> + /// <param name="format" type="String"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "format", type: String} + ]); + if (e) throw e; + return this._toFormattedString(format, Sys.CultureInfo.CurrentCulture); +} +Number.prototype._toFormattedString = function Number$_toFormattedString(format, cultureInfo) { + if (!format || (format.length === 0) || (format === 'i')) { + if (cultureInfo && (cultureInfo.name.length > 0)) { + return this.toLocaleString(); + } + else { + return this.toString(); + } + } + + var _percentPositivePattern = ["n %", "n%", "%n" ]; + var _percentNegativePattern = ["-n %", "-n%", "-%n"]; + var _numberNegativePattern = ["(n)","-n","- n","n-","n -"]; + var _currencyPositivePattern = ["$n","n$","$ n","n $"]; + var _currencyNegativePattern = ["($n)","-$n","$-n","$n-","(n$)","-n$","n-$","n$-","-n $","-$ n","n $-","$ n-","$ -n","n- $","($ n)","(n $)"]; + function zeroPad(str, count, left) { + for (var l=str.length; l < count; l++) { + str = (left ? ('0' + str) : (str + '0')); + } + return str; + } + + function expandNumber(number, precision, groupSizes, sep, decimalChar) { + Sys.Debug.assert(groupSizes.length > 0, "groupSizes must be an array of at least 1"); + var curSize = groupSizes[0]; + var curGroupIndex = 1; + var factor = Math.pow(10, precision); + var rounded = (Math.round(number * factor) / factor); + if (!isFinite(rounded)) { + rounded = number; + } + number = rounded; + + var numberString = number.toString(); + var right = ""; + var exponent; + + + var split = numberString.split(/e/i); + numberString = split[0]; + exponent = (split.length > 1 ? parseInt(split[1]) : 0); + split = numberString.split('.'); + numberString = split[0]; + right = split.length > 1 ? split[1] : ""; + + var l; + if (exponent > 0) { + right = zeroPad(right, exponent, false); + numberString += right.slice(0, exponent); + right = right.substr(exponent); + } + else if (exponent < 0) { + exponent = -exponent; + numberString = zeroPad(numberString, exponent+1, true); + right = numberString.slice(-exponent, numberString.length) + right; + numberString = numberString.slice(0, -exponent); + } + if (precision > 0) { + if (right.length > precision) { + right = right.slice(0, precision); + } + else { + right = zeroPad(right, precision, false); + } + right = decimalChar + right; + } + else { + right = ""; + } + var stringIndex = numberString.length-1; + var ret = ""; + while (stringIndex >= 0) { + if (curSize === 0 || curSize > stringIndex) { + if (ret.length > 0) + return numberString.slice(0, stringIndex + 1) + sep + ret + right; + else + return numberString.slice(0, stringIndex + 1) + right; + } + if (ret.length > 0) + ret = numberString.slice(stringIndex - curSize + 1, stringIndex+1) + sep + ret; + else + ret = numberString.slice(stringIndex - curSize + 1, stringIndex+1); + stringIndex -= curSize; + if (curGroupIndex < groupSizes.length) { + curSize = groupSizes[curGroupIndex]; + curGroupIndex++; + } + } + return numberString.slice(0, stringIndex + 1) + sep + ret + right; + } + var nf = cultureInfo.numberFormat; + var number = Math.abs(this); + if (!format) + format = "D"; + var precision = -1; + if (format.length > 1) precision = parseInt(format.slice(1), 10); + var pattern; + switch (format.charAt(0)) { + case "d": + case "D": + pattern = 'n'; + if (precision !== -1) { + number = zeroPad(""+number, precision, true); + } + if (this < 0) number = -number; + break; + case "c": + case "C": + if (this < 0) pattern = _currencyNegativePattern[nf.CurrencyNegativePattern]; + else pattern = _currencyPositivePattern[nf.CurrencyPositivePattern]; + if (precision === -1) precision = nf.CurrencyDecimalDigits; + number = expandNumber(Math.abs(this), precision, nf.CurrencyGroupSizes, nf.CurrencyGroupSeparator, nf.CurrencyDecimalSeparator); + break; + case "n": + case "N": + if (this < 0) pattern = _numberNegativePattern[nf.NumberNegativePattern]; + else pattern = 'n'; + if (precision === -1) precision = nf.NumberDecimalDigits; + number = expandNumber(Math.abs(this), precision, nf.NumberGroupSizes, nf.NumberGroupSeparator, nf.NumberDecimalSeparator); + break; + case "p": + case "P": + if (this < 0) pattern = _percentNegativePattern[nf.PercentNegativePattern]; + else pattern = _percentPositivePattern[nf.PercentPositivePattern]; + if (precision === -1) precision = nf.PercentDecimalDigits; + number = expandNumber(Math.abs(this) * 100, precision, nf.PercentGroupSizes, nf.PercentGroupSeparator, nf.PercentDecimalSeparator); + break; + default: + throw Error.format(Sys.Res.formatBadFormatSpecifier); + } + var regex = /n|\$|-|%/g; + var ret = ""; + for (;;) { + var index = regex.lastIndex; + var ar = regex.exec(pattern); + ret += pattern.slice(index, ar ? ar.index : pattern.length); + if (!ar) + break; + switch (ar[0]) { + case "n": + ret += number; + break; + case "$": + ret += nf.CurrencySymbol; + break; + case "-": + if (/[1-9]/.test(number)) { + ret += nf.NegativeSign; + } + break; + case "%": + ret += nf.PercentSymbol; + break; + default: + Sys.Debug.fail("Invalid number format pattern"); + } + } + return ret; +} + +Sys.CultureInfo = function Sys$CultureInfo(name, numberFormat, dateTimeFormat) { + /// <summary locid="M:J#Sys.CultureInfo.#ctor" /> + /// <param name="name" type="String"></param> + /// <param name="numberFormat" type="Object"></param> + /// <param name="dateTimeFormat" type="Object"></param> + var e = Function._validateParams(arguments, [ + {name: "name", type: String}, + {name: "numberFormat", type: Object}, + {name: "dateTimeFormat", type: Object} + ]); + if (e) throw e; + this.name = name; + this.numberFormat = numberFormat; + this.dateTimeFormat = dateTimeFormat; +} + function Sys$CultureInfo$_getDateTimeFormats() { + if (! this._dateTimeFormats) { + var dtf = this.dateTimeFormat; + this._dateTimeFormats = + [ dtf.MonthDayPattern, + dtf.YearMonthPattern, + dtf.ShortDatePattern, + dtf.ShortTimePattern, + dtf.LongDatePattern, + dtf.LongTimePattern, + dtf.FullDateTimePattern, + dtf.RFC1123Pattern, + dtf.SortableDateTimePattern, + dtf.UniversalSortableDateTimePattern ]; + } + return this._dateTimeFormats; + } + function Sys$CultureInfo$_getIndex(value, a1, a2) { + var upper = this._toUpper(value), + i = Array.indexOf(a1, upper); + if (i === -1) { + i = Array.indexOf(a2, upper); + } + return i; + } + function Sys$CultureInfo$_getMonthIndex(value) { + if (!this._upperMonths) { + this._upperMonths = this._toUpperArray(this.dateTimeFormat.MonthNames); + this._upperMonthsGenitive = this._toUpperArray(this.dateTimeFormat.MonthGenitiveNames); + } + return this._getIndex(value, this._upperMonths, this._upperMonthsGenitive); + } + function Sys$CultureInfo$_getAbbrMonthIndex(value) { + if (!this._upperAbbrMonths) { + this._upperAbbrMonths = this._toUpperArray(this.dateTimeFormat.AbbreviatedMonthNames); + this._upperAbbrMonthsGenitive = this._toUpperArray(this.dateTimeFormat.AbbreviatedMonthGenitiveNames); + } + return this._getIndex(value, this._upperAbbrMonths, this._upperAbbrMonthsGenitive); + } + function Sys$CultureInfo$_getDayIndex(value) { + if (!this._upperDays) { + this._upperDays = this._toUpperArray(this.dateTimeFormat.DayNames); + } + return Array.indexOf(this._upperDays, this._toUpper(value)); + } + function Sys$CultureInfo$_getAbbrDayIndex(value) { + if (!this._upperAbbrDays) { + this._upperAbbrDays = this._toUpperArray(this.dateTimeFormat.AbbreviatedDayNames); + } + return Array.indexOf(this._upperAbbrDays, this._toUpper(value)); + } + function Sys$CultureInfo$_toUpperArray(arr) { + var result = []; + for (var i = 0, il = arr.length; i < il; i++) { + result[i] = this._toUpper(arr[i]); + } + return result; + } + function Sys$CultureInfo$_toUpper(value) { + return value.split("\u00A0").join(' ').toUpperCase(); + } +Sys.CultureInfo.prototype = { + _getDateTimeFormats: Sys$CultureInfo$_getDateTimeFormats, + _getIndex: Sys$CultureInfo$_getIndex, + _getMonthIndex: Sys$CultureInfo$_getMonthIndex, + _getAbbrMonthIndex: Sys$CultureInfo$_getAbbrMonthIndex, + _getDayIndex: Sys$CultureInfo$_getDayIndex, + _getAbbrDayIndex: Sys$CultureInfo$_getAbbrDayIndex, + _toUpperArray: Sys$CultureInfo$_toUpperArray, + _toUpper: Sys$CultureInfo$_toUpper +} +Sys.CultureInfo.registerClass('Sys.CultureInfo'); +Sys.CultureInfo._parse = function Sys$CultureInfo$_parse(value) { + var dtf = value.dateTimeFormat; + if (dtf && !dtf.eras) { + dtf.eras = value.eras; + } + return new Sys.CultureInfo(value.name, value.numberFormat, dtf); +} +Sys.CultureInfo.InvariantCulture = Sys.CultureInfo._parse({"name":"","numberFormat":{"CurrencyDecimalDigits":2,"CurrencyDecimalSeparator":".","IsReadOnly":true,"CurrencyGroupSizes":[3],"NumberGroupSizes":[3],"PercentGroupSizes":[3],"CurrencyGroupSeparator":",","CurrencySymbol":"\u00A4","NaNSymbol":"NaN","CurrencyNegativePattern":0,"NumberNegativePattern":1,"PercentPositivePattern":0,"PercentNegativePattern":0,"NegativeInfinitySymbol":"-Infinity","NegativeSign":"-","NumberDecimalDigits":2,"NumberDecimalSeparator":".","NumberGroupSeparator":",","CurrencyPositivePattern":0,"PositiveInfinitySymbol":"Infinity","PositiveSign":"+","PercentDecimalDigits":2,"PercentDecimalSeparator":".","PercentGroupSeparator":",","PercentSymbol":"%","PerMilleSymbol":"\u2030","NativeDigits":["0","1","2","3","4","5","6","7","8","9"],"DigitSubstitution":1},"dateTimeFormat":{"AMDesignator":"AM","Calendar":{"MinSupportedDateTime":"@-62135568000000@","MaxSupportedDateTime":"@253402300799999@","AlgorithmType":1,"CalendarType":1,"Eras":[1],"TwoDigitYearMax":2029,"IsReadOnly":true},"DateSeparator":"/","FirstDayOfWeek":0,"CalendarWeekRule":0,"FullDateTimePattern":"dddd, dd MMMM yyyy HH:mm:ss","LongDatePattern":"dddd, dd MMMM yyyy","LongTimePattern":"HH:mm:ss","MonthDayPattern":"MMMM dd","PMDesignator":"PM","RFC1123Pattern":"ddd, dd MMM yyyy HH\':\'mm\':\'ss \'GMT\'","ShortDatePattern":"MM/dd/yyyy","ShortTimePattern":"HH:mm","SortableDateTimePattern":"yyyy\'-\'MM\'-\'dd\'T\'HH\':\'mm\':\'ss","TimeSeparator":":","UniversalSortableDateTimePattern":"yyyy\'-\'MM\'-\'dd HH\':\'mm\':\'ss\'Z\'","YearMonthPattern":"yyyy MMMM","AbbreviatedDayNames":["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],"ShortestDayNames":["Su","Mo","Tu","We","Th","Fr","Sa"],"DayNames":["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],"AbbreviatedMonthNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthNames":["January","February","March","April","May","June","July","August","September","October","November","December",""],"IsReadOnly":true,"NativeCalendarName":"Gregorian Calendar","AbbreviatedMonthGenitiveNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthGenitiveNames":["January","February","March","April","May","June","July","August","September","October","November","December",""]},"eras":[1,"A.D.",null,0]}); +if (typeof(__cultureInfo) === "object") { + Sys.CultureInfo.CurrentCulture = Sys.CultureInfo._parse(__cultureInfo); + delete __cultureInfo; +} +else { + Sys.CultureInfo.CurrentCulture = Sys.CultureInfo._parse({"name":"en-US","numberFormat":{"CurrencyDecimalDigits":2,"CurrencyDecimalSeparator":".","IsReadOnly":false,"CurrencyGroupSizes":[3],"NumberGroupSizes":[3],"PercentGroupSizes":[3],"CurrencyGroupSeparator":",","CurrencySymbol":"$","NaNSymbol":"NaN","CurrencyNegativePattern":0,"NumberNegativePattern":1,"PercentPositivePattern":0,"PercentNegativePattern":0,"NegativeInfinitySymbol":"-Infinity","NegativeSign":"-","NumberDecimalDigits":2,"NumberDecimalSeparator":".","NumberGroupSeparator":",","CurrencyPositivePattern":0,"PositiveInfinitySymbol":"Infinity","PositiveSign":"+","PercentDecimalDigits":2,"PercentDecimalSeparator":".","PercentGroupSeparator":",","PercentSymbol":"%","PerMilleSymbol":"\u2030","NativeDigits":["0","1","2","3","4","5","6","7","8","9"],"DigitSubstitution":1},"dateTimeFormat":{"AMDesignator":"AM","Calendar":{"MinSupportedDateTime":"@-62135568000000@","MaxSupportedDateTime":"@253402300799999@","AlgorithmType":1,"CalendarType":1,"Eras":[1],"TwoDigitYearMax":2029,"IsReadOnly":false},"DateSeparator":"/","FirstDayOfWeek":0,"CalendarWeekRule":0,"FullDateTimePattern":"dddd, MMMM dd, yyyy h:mm:ss tt","LongDatePattern":"dddd, MMMM dd, yyyy","LongTimePattern":"h:mm:ss tt","MonthDayPattern":"MMMM dd","PMDesignator":"PM","RFC1123Pattern":"ddd, dd MMM yyyy HH\':\'mm\':\'ss \'GMT\'","ShortDatePattern":"M/d/yyyy","ShortTimePattern":"h:mm tt","SortableDateTimePattern":"yyyy\'-\'MM\'-\'dd\'T\'HH\':\'mm\':\'ss","TimeSeparator":":","UniversalSortableDateTimePattern":"yyyy\'-\'MM\'-\'dd HH\':\'mm\':\'ss\'Z\'","YearMonthPattern":"MMMM, yyyy","AbbreviatedDayNames":["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],"ShortestDayNames":["Su","Mo","Tu","We","Th","Fr","Sa"],"DayNames":["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],"AbbreviatedMonthNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthNames":["January","February","March","April","May","June","July","August","September","October","November","December",""],"IsReadOnly":false,"NativeCalendarName":"Gregorian Calendar","AbbreviatedMonthGenitiveNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthGenitiveNames":["January","February","March","April","May","June","July","August","September","October","November","December",""]},"eras":[1,"A.D.",null,0]}); +} +Type.registerNamespace('Sys.Serialization'); +Sys.Serialization.JavaScriptSerializer = function Sys$Serialization$JavaScriptSerializer() { + /// <summary locid="M:J#Sys.Serialization.JavaScriptSerializer.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); +} +Sys.Serialization.JavaScriptSerializer.registerClass('Sys.Serialization.JavaScriptSerializer'); +Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs = []; +Sys.Serialization.JavaScriptSerializer._charsToEscape = []; +Sys.Serialization.JavaScriptSerializer._dateRegEx = new RegExp('(^|[^\\\\])\\"\\\\/Date\\((-?[0-9]+)(?:[a-zA-Z]|(?:\\+|-)[0-9]{4})?\\)\\\\/\\"', 'g'); +Sys.Serialization.JavaScriptSerializer._escapeChars = {}; +Sys.Serialization.JavaScriptSerializer._escapeRegEx = new RegExp('["\\\\\\x00-\\x1F]', 'i'); +Sys.Serialization.JavaScriptSerializer._escapeRegExGlobal = new RegExp('["\\\\\\x00-\\x1F]', 'g'); +Sys.Serialization.JavaScriptSerializer._jsonRegEx = new RegExp('[^,:{}\\[\\]0-9.\\-+Eaeflnr-u \\n\\r\\t]', 'g'); +Sys.Serialization.JavaScriptSerializer._jsonStringRegEx = new RegExp('"(\\\\.|[^"\\\\])*"', 'g'); +Sys.Serialization.JavaScriptSerializer._serverTypeFieldName = '__type'; +Sys.Serialization.JavaScriptSerializer._init = function Sys$Serialization$JavaScriptSerializer$_init() { + var replaceChars = ['\\u0000','\\u0001','\\u0002','\\u0003','\\u0004','\\u0005','\\u0006','\\u0007', + '\\b','\\t','\\n','\\u000b','\\f','\\r','\\u000e','\\u000f','\\u0010','\\u0011', + '\\u0012','\\u0013','\\u0014','\\u0015','\\u0016','\\u0017','\\u0018','\\u0019', + '\\u001a','\\u001b','\\u001c','\\u001d','\\u001e','\\u001f']; + Sys.Serialization.JavaScriptSerializer._charsToEscape[0] = '\\'; + Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs['\\'] = new RegExp('\\\\', 'g'); + Sys.Serialization.JavaScriptSerializer._escapeChars['\\'] = '\\\\'; + Sys.Serialization.JavaScriptSerializer._charsToEscape[1] = '"'; + Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs['"'] = new RegExp('"', 'g'); + Sys.Serialization.JavaScriptSerializer._escapeChars['"'] = '\\"'; + for (var i = 0; i < 32; i++) { + var c = String.fromCharCode(i); + Sys.Serialization.JavaScriptSerializer._charsToEscape[i+2] = c; + Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs[c] = new RegExp(c, 'g'); + Sys.Serialization.JavaScriptSerializer._escapeChars[c] = replaceChars[i]; + } +} +Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder = function Sys$Serialization$JavaScriptSerializer$_serializeBooleanWithBuilder(object, stringBuilder) { + stringBuilder.append(object.toString()); +} +Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder = function Sys$Serialization$JavaScriptSerializer$_serializeNumberWithBuilder(object, stringBuilder) { + if (isFinite(object)) { + stringBuilder.append(String(object)); + } + else { + throw Error.invalidOperation(Sys.Res.cannotSerializeNonFiniteNumbers); + } +} +Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder = function Sys$Serialization$JavaScriptSerializer$_serializeStringWithBuilder(string, stringBuilder) { + stringBuilder.append('"'); + if (Sys.Serialization.JavaScriptSerializer._escapeRegEx.test(string)) { + if (Sys.Serialization.JavaScriptSerializer._charsToEscape.length === 0) { + Sys.Serialization.JavaScriptSerializer._init(); + } + if (string.length < 128) { + string = string.replace(Sys.Serialization.JavaScriptSerializer._escapeRegExGlobal, + function(x) { return Sys.Serialization.JavaScriptSerializer._escapeChars[x]; }); + } + else { + for (var i = 0; i < 34; i++) { + var c = Sys.Serialization.JavaScriptSerializer._charsToEscape[i]; + if (string.indexOf(c) !== -1) { + if (Sys.Browser.agent === Sys.Browser.Opera || Sys.Browser.agent === Sys.Browser.FireFox) { + string = string.split(c).join(Sys.Serialization.JavaScriptSerializer._escapeChars[c]); + } + else { + string = string.replace(Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs[c], + Sys.Serialization.JavaScriptSerializer._escapeChars[c]); + } + } + } + } + } + stringBuilder.append(string); + stringBuilder.append('"'); +} +Sys.Serialization.JavaScriptSerializer._serializeWithBuilder = function Sys$Serialization$JavaScriptSerializer$_serializeWithBuilder(object, stringBuilder, sort, prevObjects) { + var i; + switch (typeof object) { + case 'object': + if (object) { + if (prevObjects){ + for( var j = 0; j < prevObjects.length; j++) { + if (prevObjects[j] === object) { + throw Error.invalidOperation(Sys.Res.cannotSerializeObjectWithCycle); + } + } + } + else { + prevObjects = new Array(); + } + try { + Array.add(prevObjects, object); + + if (Number.isInstanceOfType(object)){ + Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder(object, stringBuilder); + } + else if (Boolean.isInstanceOfType(object)){ + Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder(object, stringBuilder); + } + else if (String.isInstanceOfType(object)){ + Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder(object, stringBuilder); + } + + else if (Array.isInstanceOfType(object)) { + stringBuilder.append('['); + + for (i = 0; i < object.length; ++i) { + if (i > 0) { + stringBuilder.append(','); + } + Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(object[i], stringBuilder,false,prevObjects); + } + stringBuilder.append(']'); + } + else { + if (Date.isInstanceOfType(object)) { + stringBuilder.append('"\\/Date('); + stringBuilder.append(object.getTime()); + stringBuilder.append(')\\/"'); + break; + } + var properties = []; + var propertyCount = 0; + for (var name in object) { + if (name.startsWith('$')) { + continue; + } + if (name === Sys.Serialization.JavaScriptSerializer._serverTypeFieldName && propertyCount !== 0){ + properties[propertyCount++] = properties[0]; + properties[0] = name; + } + else{ + properties[propertyCount++] = name; + } + } + if (sort) properties.sort(); + stringBuilder.append('{'); + var needComma = false; + + for (i=0; i<propertyCount; i++) { + var value = object[properties[i]]; + if (typeof value !== 'undefined' && typeof value !== 'function') { + if (needComma) { + stringBuilder.append(','); + } + else { + needComma = true; + } + + Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(properties[i], stringBuilder, sort, prevObjects); + stringBuilder.append(':'); + Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(value, stringBuilder, sort, prevObjects); + + } + } + stringBuilder.append('}'); + } + } + finally { + Array.removeAt(prevObjects, prevObjects.length - 1); + } + } + else { + stringBuilder.append('null'); + } + break; + case 'number': + Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder(object, stringBuilder); + break; + case 'string': + Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder(object, stringBuilder); + break; + case 'boolean': + Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder(object, stringBuilder); + break; + default: + stringBuilder.append('null'); + break; + } +} +Sys.Serialization.JavaScriptSerializer.serialize = function Sys$Serialization$JavaScriptSerializer$serialize(object) { + /// <summary locid="M:J#Sys.Serialization.JavaScriptSerializer.serialize" /> + /// <param name="object" mayBeNull="true"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "object", mayBeNull: true} + ]); + if (e) throw e; + var stringBuilder = new Sys.StringBuilder(); + Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(object, stringBuilder, false); + return stringBuilder.toString(); +} +Sys.Serialization.JavaScriptSerializer.deserialize = function Sys$Serialization$JavaScriptSerializer$deserialize(data, secure) { + /// <summary locid="M:J#Sys.Serialization.JavaScriptSerializer.deserialize" /> + /// <param name="data" type="String"></param> + /// <param name="secure" type="Boolean" optional="true"></param> + /// <returns></returns> + var e = Function._validateParams(arguments, [ + {name: "data", type: String}, + {name: "secure", type: Boolean, optional: true} + ]); + if (e) throw e; + + if (data.length === 0) throw Error.argument('data', Sys.Res.cannotDeserializeEmptyString); + try { + var exp = data.replace(Sys.Serialization.JavaScriptSerializer._dateRegEx, "$1new Date($2)"); + + if (secure && Sys.Serialization.JavaScriptSerializer._jsonRegEx.test( + exp.replace(Sys.Serialization.JavaScriptSerializer._jsonStringRegEx, ''))) throw null; + return eval('(' + exp + ')'); + } + catch (e) { + throw Error.argument('data', Sys.Res.cannotDeserializeInvalidJson); + } +} +Type.registerNamespace('Sys.UI'); + +Sys.EventHandlerList = function Sys$EventHandlerList() { + /// <summary locid="M:J#Sys.EventHandlerList.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + this._list = {}; +} + function Sys$EventHandlerList$_addHandler(id, handler) { + Array.add(this._getEvent(id, true), handler); + } + function Sys$EventHandlerList$addHandler(id, handler) { + /// <summary locid="M:J#Sys.EventHandlerList.addHandler" /> + /// <param name="id" type="String"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "id", type: String}, + {name: "handler", type: Function} + ]); + if (e) throw e; + this._addHandler(id, handler); + } + function Sys$EventHandlerList$_removeHandler(id, handler) { + var evt = this._getEvent(id); + if (!evt) return; + Array.remove(evt, handler); + } + function Sys$EventHandlerList$removeHandler(id, handler) { + /// <summary locid="M:J#Sys.EventHandlerList.removeHandler" /> + /// <param name="id" type="String"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "id", type: String}, + {name: "handler", type: Function} + ]); + if (e) throw e; + this._removeHandler(id, handler); + } + function Sys$EventHandlerList$getHandler(id) { + /// <summary locid="M:J#Sys.EventHandlerList.getHandler" /> + /// <param name="id" type="String"></param> + /// <returns type="Function"></returns> + var e = Function._validateParams(arguments, [ + {name: "id", type: String} + ]); + if (e) throw e; + var evt = this._getEvent(id); + if (!evt || (evt.length === 0)) return null; + evt = Array.clone(evt); + return function(source, args) { + for (var i = 0, l = evt.length; i < l; i++) { + evt[i](source, args); + } + }; + } + function Sys$EventHandlerList$_getEvent(id, create) { + if (!this._list[id]) { + if (!create) return null; + this._list[id] = []; + } + return this._list[id]; + } +Sys.EventHandlerList.prototype = { + _addHandler: Sys$EventHandlerList$_addHandler, + addHandler: Sys$EventHandlerList$addHandler, + _removeHandler: Sys$EventHandlerList$_removeHandler, + removeHandler: Sys$EventHandlerList$removeHandler, + getHandler: Sys$EventHandlerList$getHandler, + _getEvent: Sys$EventHandlerList$_getEvent +} +Sys.EventHandlerList.registerClass('Sys.EventHandlerList'); +Sys.CommandEventArgs = function Sys$CommandEventArgs(commandName, commandArgument, commandSource) { + /// <summary locid="M:J#Sys.CommandEventArgs.#ctor" /> + /// <param name="commandName" type="String"></param> + /// <param name="commandArgument" mayBeNull="true"></param> + /// <param name="commandSource" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "commandName", type: String}, + {name: "commandArgument", mayBeNull: true}, + {name: "commandSource", mayBeNull: true} + ]); + if (e) throw e; + Sys.CommandEventArgs.initializeBase(this); + this._commandName = commandName; + this._commandArgument = commandArgument; + this._commandSource = commandSource; +} + function Sys$CommandEventArgs$get_commandName() { + /// <value type="String" locid="P:J#Sys.CommandEventArgs.commandName"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._commandName; + } + function Sys$CommandEventArgs$get_commandArgument() { + /// <value mayBeNull="true" locid="P:J#Sys.CommandEventArgs.commandArgument"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._commandArgument; + } + function Sys$CommandEventArgs$get_commandSource() { + /// <value mayBeNull="true" locid="P:J#Sys.CommandEventArgs.commandSource"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._commandSource; + } +Sys.CommandEventArgs.prototype = { + _commandName: null, + _commandArgument: null, + _commandSource: null, + get_commandName: Sys$CommandEventArgs$get_commandName, + get_commandArgument: Sys$CommandEventArgs$get_commandArgument, + get_commandSource: Sys$CommandEventArgs$get_commandSource +} +Sys.CommandEventArgs.registerClass("Sys.CommandEventArgs", Sys.CancelEventArgs); + +Sys.INotifyPropertyChange = function Sys$INotifyPropertyChange() { + /// <summary locid="M:J#Sys.INotifyPropertyChange.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); +} + function Sys$INotifyPropertyChange$add_propertyChanged(handler) { + /// <summary locid="E:J#Sys.INotifyPropertyChange.propertyChanged" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + throw Error.notImplemented(); + } + function Sys$INotifyPropertyChange$remove_propertyChanged(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + throw Error.notImplemented(); + } +Sys.INotifyPropertyChange.prototype = { + add_propertyChanged: Sys$INotifyPropertyChange$add_propertyChanged, + remove_propertyChanged: Sys$INotifyPropertyChange$remove_propertyChanged +} +Sys.INotifyPropertyChange.registerInterface('Sys.INotifyPropertyChange'); + +Sys.PropertyChangedEventArgs = function Sys$PropertyChangedEventArgs(propertyName) { + /// <summary locid="M:J#Sys.PropertyChangedEventArgs.#ctor" /> + /// <param name="propertyName" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "propertyName", type: String} + ]); + if (e) throw e; + Sys.PropertyChangedEventArgs.initializeBase(this); + this._propertyName = propertyName; +} + + function Sys$PropertyChangedEventArgs$get_propertyName() { + /// <value type="String" locid="P:J#Sys.PropertyChangedEventArgs.propertyName"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._propertyName; + } +Sys.PropertyChangedEventArgs.prototype = { + get_propertyName: Sys$PropertyChangedEventArgs$get_propertyName +} +Sys.PropertyChangedEventArgs.registerClass('Sys.PropertyChangedEventArgs', Sys.EventArgs); + +Sys.INotifyDisposing = function Sys$INotifyDisposing() { + /// <summary locid="M:J#Sys.INotifyDisposing.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); +} + function Sys$INotifyDisposing$add_disposing(handler) { + /// <summary locid="E:J#Sys.INotifyDisposing.disposing" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + throw Error.notImplemented(); + } + function Sys$INotifyDisposing$remove_disposing(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + throw Error.notImplemented(); + } +Sys.INotifyDisposing.prototype = { + add_disposing: Sys$INotifyDisposing$add_disposing, + remove_disposing: Sys$INotifyDisposing$remove_disposing +} +Sys.INotifyDisposing.registerInterface("Sys.INotifyDisposing"); + +Sys.Component = function Sys$Component() { + /// <summary locid="M:J#Sys.Component.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if (Sys.Application) Sys.Application.registerDisposableObject(this); +} + function Sys$Component$get_events() { + /// <value type="Sys.EventHandlerList" locid="P:J#Sys.Component.events"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._events) { + this._events = new Sys.EventHandlerList(); + } + return this._events; + } + function Sys$Component$get_id() { + /// <value type="String" locid="P:J#Sys.Component.id"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._id; + } + function Sys$Component$set_id(value) { + var e = Function._validateParams(arguments, [{name: "value", type: String}]); + if (e) throw e; + if (this._idSet) throw Error.invalidOperation(Sys.Res.componentCantSetIdTwice); + this._idSet = true; + var oldId = this.get_id(); + if (oldId && Sys.Application.findComponent(oldId)) throw Error.invalidOperation(Sys.Res.componentCantSetIdAfterAddedToApp); + this._id = value; + } + function Sys$Component$get_isInitialized() { + /// <value type="Boolean" locid="P:J#Sys.Component.isInitialized"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._initialized; + } + function Sys$Component$get_isUpdating() { + /// <value type="Boolean" locid="P:J#Sys.Component.isUpdating"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._updating; + } + function Sys$Component$add_disposing(handler) { + /// <summary locid="E:J#Sys.Component.disposing" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().addHandler("disposing", handler); + } + function Sys$Component$remove_disposing(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().removeHandler("disposing", handler); + } + function Sys$Component$add_propertyChanged(handler) { + /// <summary locid="E:J#Sys.Component.propertyChanged" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().addHandler("propertyChanged", handler); + } + function Sys$Component$remove_propertyChanged(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().removeHandler("propertyChanged", handler); + } + function Sys$Component$beginUpdate() { + this._updating = true; + } + function Sys$Component$dispose() { + if (this._events) { + var handler = this._events.getHandler("disposing"); + if (handler) { + handler(this, Sys.EventArgs.Empty); + } + } + delete this._events; + Sys.Application.unregisterDisposableObject(this); + Sys.Application.removeComponent(this); + } + function Sys$Component$endUpdate() { + this._updating = false; + if (!this._initialized) this.initialize(); + this.updated(); + } + function Sys$Component$initialize() { + this._initialized = true; + } + function Sys$Component$raisePropertyChanged(propertyName) { + /// <summary locid="M:J#Sys.Component.raisePropertyChanged" /> + /// <param name="propertyName" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "propertyName", type: String} + ]); + if (e) throw e; + if (!this._events) return; + var handler = this._events.getHandler("propertyChanged"); + if (handler) { + handler(this, new Sys.PropertyChangedEventArgs(propertyName)); + } + } + function Sys$Component$updated() { + } +Sys.Component.prototype = { + _id: null, + _idSet: false, + _initialized: false, + _updating: false, + get_events: Sys$Component$get_events, + get_id: Sys$Component$get_id, + set_id: Sys$Component$set_id, + get_isInitialized: Sys$Component$get_isInitialized, + get_isUpdating: Sys$Component$get_isUpdating, + add_disposing: Sys$Component$add_disposing, + remove_disposing: Sys$Component$remove_disposing, + add_propertyChanged: Sys$Component$add_propertyChanged, + remove_propertyChanged: Sys$Component$remove_propertyChanged, + beginUpdate: Sys$Component$beginUpdate, + dispose: Sys$Component$dispose, + endUpdate: Sys$Component$endUpdate, + initialize: Sys$Component$initialize, + raisePropertyChanged: Sys$Component$raisePropertyChanged, + updated: Sys$Component$updated +} +Sys.Component.registerClass('Sys.Component', null, Sys.IDisposable, Sys.INotifyPropertyChange, Sys.INotifyDisposing); +function Sys$Component$_setProperties(target, properties) { + /// <summary locid="M:J#Sys.Component._setProperties" /> + /// <param name="target"></param> + /// <param name="properties"></param> + var e = Function._validateParams(arguments, [ + {name: "target"}, + {name: "properties"} + ]); + if (e) throw e; + var current; + var targetType = Object.getType(target); + var isObject = (targetType === Object) || (targetType === Sys.UI.DomElement); + var isComponent = Sys.Component.isInstanceOfType(target) && !target.get_isUpdating(); + if (isComponent) target.beginUpdate(); + for (var name in properties) { + var val = properties[name]; + var getter = isObject ? null : target["get_" + name]; + if (isObject || typeof(getter) !== 'function') { + var targetVal = target[name]; + if (!isObject && typeof(targetVal) === 'undefined') throw Error.invalidOperation(String.format(Sys.Res.propertyUndefined, name)); + if (!val || (typeof(val) !== 'object') || (isObject && !targetVal)) { + target[name] = val; + } + else { + Sys$Component$_setProperties(targetVal, val); + } + } + else { + var setter = target["set_" + name]; + if (typeof(setter) === 'function') { + setter.apply(target, [val]); + } + else if (val instanceof Array) { + current = getter.apply(target); + if (!(current instanceof Array)) throw new Error.invalidOperation(String.format(Sys.Res.propertyNotAnArray, name)); + for (var i = 0, j = current.length, l= val.length; i < l; i++, j++) { + current[j] = val[i]; + } + } + else if ((typeof(val) === 'object') && (Object.getType(val) === Object)) { + current = getter.apply(target); + if ((typeof(current) === 'undefined') || (current === null)) throw new Error.invalidOperation(String.format(Sys.Res.propertyNullOrUndefined, name)); + Sys$Component$_setProperties(current, val); + } + else { + throw new Error.invalidOperation(String.format(Sys.Res.propertyNotWritable, name)); + } + } + } + if (isComponent) target.endUpdate(); +} +function Sys$Component$_setReferences(component, references) { + for (var name in references) { + var setter = component["set_" + name]; + var reference = $find(references[name]); + if (typeof(setter) !== 'function') throw new Error.invalidOperation(String.format(Sys.Res.propertyNotWritable, name)); + if (!reference) throw Error.invalidOperation(String.format(Sys.Res.referenceNotFound, references[name])); + setter.apply(component, [reference]); + } +} +var $create = Sys.Component.create = function Sys$Component$create(type, properties, events, references, element) { + /// <summary locid="M:J#Sys.Component.create" /> + /// <param name="type" type="Type"></param> + /// <param name="properties" optional="true" mayBeNull="true"></param> + /// <param name="events" optional="true" mayBeNull="true"></param> + /// <param name="references" optional="true" mayBeNull="true"></param> + /// <param name="element" domElement="true" optional="true" mayBeNull="true"></param> + /// <returns type="Sys.UI.Component"></returns> + var e = Function._validateParams(arguments, [ + {name: "type", type: Type}, + {name: "properties", mayBeNull: true, optional: true}, + {name: "events", mayBeNull: true, optional: true}, + {name: "references", mayBeNull: true, optional: true}, + {name: "element", mayBeNull: true, domElement: true, optional: true} + ]); + if (e) throw e; + if (!type.inheritsFrom(Sys.Component)) { + throw Error.argument('type', String.format(Sys.Res.createNotComponent, type.getName())); + } + if (type.inheritsFrom(Sys.UI.Behavior) || type.inheritsFrom(Sys.UI.Control)) { + if (!element) throw Error.argument('element', Sys.Res.createNoDom); + } + else if (element) throw Error.argument('element', Sys.Res.createComponentOnDom); + var component = (element ? new type(element): new type()); + var app = Sys.Application; + var creatingComponents = app.get_isCreatingComponents(); + component.beginUpdate(); + if (properties) { + Sys$Component$_setProperties(component, properties); + } + if (events) { + for (var name in events) { + if (!(component["add_" + name] instanceof Function)) throw new Error.invalidOperation(String.format(Sys.Res.undefinedEvent, name)); + if (!(events[name] instanceof Function)) throw new Error.invalidOperation(Sys.Res.eventHandlerNotFunction); + component["add_" + name](events[name]); + } + } + if (component.get_id()) { + app.addComponent(component); + } + if (creatingComponents) { + app._createdComponents[app._createdComponents.length] = component; + if (references) { + app._addComponentToSecondPass(component, references); + } + else { + component.endUpdate(); + } + } + else { + if (references) { + Sys$Component$_setReferences(component, references); + } + component.endUpdate(); + } + return component; +} + +Sys.UI.MouseButton = function Sys$UI$MouseButton() { + /// <summary locid="M:J#Sys.UI.MouseButton.#ctor" /> + /// <field name="leftButton" type="Number" integer="true" static="true" locid="F:J#Sys.UI.MouseButton.leftButton"></field> + /// <field name="middleButton" type="Number" integer="true" static="true" locid="F:J#Sys.UI.MouseButton.middleButton"></field> + /// <field name="rightButton" type="Number" integer="true" static="true" locid="F:J#Sys.UI.MouseButton.rightButton"></field> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); +} +Sys.UI.MouseButton.prototype = { + leftButton: 0, + middleButton: 1, + rightButton: 2 +} +Sys.UI.MouseButton.registerEnum("Sys.UI.MouseButton"); + +Sys.UI.Key = function Sys$UI$Key() { + /// <summary locid="M:J#Sys.UI.Key.#ctor" /> + /// <field name="backspace" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.backspace"></field> + /// <field name="tab" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.tab"></field> + /// <field name="enter" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.enter"></field> + /// <field name="esc" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.esc"></field> + /// <field name="space" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.space"></field> + /// <field name="pageUp" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.pageUp"></field> + /// <field name="pageDown" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.pageDown"></field> + /// <field name="end" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.end"></field> + /// <field name="home" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.home"></field> + /// <field name="left" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.left"></field> + /// <field name="up" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.up"></field> + /// <field name="right" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.right"></field> + /// <field name="down" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.down"></field> + /// <field name="del" type="Number" integer="true" static="true" locid="F:J#Sys.UI.Key.del"></field> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); +} +Sys.UI.Key.prototype = { + backspace: 8, + tab: 9, + enter: 13, + esc: 27, + space: 32, + pageUp: 33, + pageDown: 34, + end: 35, + home: 36, + left: 37, + up: 38, + right: 39, + down: 40, + del: 127 +} +Sys.UI.Key.registerEnum("Sys.UI.Key"); + +Sys.UI.Point = function Sys$UI$Point(x, y) { + /// <summary locid="M:J#Sys.UI.Point.#ctor" /> + /// <param name="x" type="Number" integer="true"></param> + /// <param name="y" type="Number" integer="true"></param> + /// <field name="x" type="Number" integer="true" locid="F:J#Sys.UI.Point.x"></field> + /// <field name="y" type="Number" integer="true" locid="F:J#Sys.UI.Point.y"></field> + var e = Function._validateParams(arguments, [ + {name: "x", type: Number, integer: true}, + {name: "y", type: Number, integer: true} + ]); + if (e) throw e; + this.x = x; + this.y = y; +} +Sys.UI.Point.registerClass('Sys.UI.Point'); + +Sys.UI.Bounds = function Sys$UI$Bounds(x, y, width, height) { + /// <summary locid="M:J#Sys.UI.Bounds.#ctor" /> + /// <param name="x" type="Number" integer="true"></param> + /// <param name="y" type="Number" integer="true"></param> + /// <param name="width" type="Number" integer="true"></param> + /// <param name="height" type="Number" integer="true"></param> + /// <field name="x" type="Number" integer="true" locid="F:J#Sys.UI.Bounds.x"></field> + /// <field name="y" type="Number" integer="true" locid="F:J#Sys.UI.Bounds.y"></field> + /// <field name="width" type="Number" integer="true" locid="F:J#Sys.UI.Bounds.width"></field> + /// <field name="height" type="Number" integer="true" locid="F:J#Sys.UI.Bounds.height"></field> + var e = Function._validateParams(arguments, [ + {name: "x", type: Number, integer: true}, + {name: "y", type: Number, integer: true}, + {name: "width", type: Number, integer: true}, + {name: "height", type: Number, integer: true} + ]); + if (e) throw e; + this.x = x; + this.y = y; + this.height = height; + this.width = width; +} +Sys.UI.Bounds.registerClass('Sys.UI.Bounds'); + +Sys.UI.DomEvent = function Sys$UI$DomEvent(eventObject) { + /// <summary locid="M:J#Sys.UI.DomEvent.#ctor" /> + /// <param name="eventObject"></param> + /// <field name="altKey" type="Boolean" locid="F:J#Sys.UI.DomEvent.altKey"></field> + /// <field name="button" type="Sys.UI.MouseButton" locid="F:J#Sys.UI.DomEvent.button"></field> + /// <field name="charCode" type="Number" integer="true" locid="F:J#Sys.UI.DomEvent.charCode"></field> + /// <field name="clientX" type="Number" integer="true" locid="F:J#Sys.UI.DomEvent.clientX"></field> + /// <field name="clientY" type="Number" integer="true" locid="F:J#Sys.UI.DomEvent.clientY"></field> + /// <field name="ctrlKey" type="Boolean" locid="F:J#Sys.UI.DomEvent.ctrlKey"></field> + /// <field name="keyCode" type="Number" integer="true" locid="F:J#Sys.UI.DomEvent.keyCode"></field> + /// <field name="offsetX" type="Number" integer="true" locid="F:J#Sys.UI.DomEvent.offsetX"></field> + /// <field name="offsetY" type="Number" integer="true" locid="F:J#Sys.UI.DomEvent.offsetY"></field> + /// <field name="screenX" type="Number" integer="true" locid="F:J#Sys.UI.DomEvent.screenX"></field> + /// <field name="screenY" type="Number" integer="true" locid="F:J#Sys.UI.DomEvent.screenY"></field> + /// <field name="shiftKey" type="Boolean" locid="F:J#Sys.UI.DomEvent.shiftKey"></field> + /// <field name="target" locid="F:J#Sys.UI.DomEvent.target"></field> + /// <field name="type" type="String" locid="F:J#Sys.UI.DomEvent.type"></field> + var e = Function._validateParams(arguments, [ + {name: "eventObject"} + ]); + if (e) throw e; + var ev = eventObject; + var etype = this.type = ev.type.toLowerCase(); + this.rawEvent = ev; + this.altKey = ev.altKey; + if (typeof(ev.button) !== 'undefined') { + this.button = (typeof(ev.which) !== 'undefined') ? ev.button : + (ev.button === 4) ? Sys.UI.MouseButton.middleButton : + (ev.button === 2) ? Sys.UI.MouseButton.rightButton : + Sys.UI.MouseButton.leftButton; + } + if (etype === 'keypress') { + this.charCode = ev.charCode || ev.keyCode; + } + else if (ev.keyCode && (ev.keyCode === 46)) { + this.keyCode = 127; + } + else { + this.keyCode = ev.keyCode; + } + this.clientX = ev.clientX; + this.clientY = ev.clientY; + this.ctrlKey = ev.ctrlKey; + this.target = ev.target ? ev.target : ev.srcElement; + if (!etype.startsWith('key')) { + if ((typeof(ev.offsetX) !== 'undefined') && (typeof(ev.offsetY) !== 'undefined')) { + this.offsetX = ev.offsetX; + this.offsetY = ev.offsetY; + } + else if (this.target && (this.target.nodeType !== 3) && (typeof(ev.clientX) === 'number')) { + var loc = Sys.UI.DomElement.getLocation(this.target); + var w = Sys.UI.DomElement._getWindow(this.target); + this.offsetX = (w.pageXOffset || 0) + ev.clientX - loc.x; + this.offsetY = (w.pageYOffset || 0) + ev.clientY - loc.y; + } + } + this.screenX = ev.screenX; + this.screenY = ev.screenY; + this.shiftKey = ev.shiftKey; +} + function Sys$UI$DomEvent$preventDefault() { + /// <summary locid="M:J#Sys.UI.DomEvent.preventDefault" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this.rawEvent.preventDefault) { + this.rawEvent.preventDefault(); + } + else if (window.event) { + this.rawEvent.returnValue = false; + } + } + function Sys$UI$DomEvent$stopPropagation() { + /// <summary locid="M:J#Sys.UI.DomEvent.stopPropagation" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this.rawEvent.stopPropagation) { + this.rawEvent.stopPropagation(); + } + else if (window.event) { + this.rawEvent.cancelBubble = true; + } + } +Sys.UI.DomEvent.prototype = { + preventDefault: Sys$UI$DomEvent$preventDefault, + stopPropagation: Sys$UI$DomEvent$stopPropagation +} +Sys.UI.DomEvent.registerClass('Sys.UI.DomEvent'); +var $addHandler = Sys.UI.DomEvent.addHandler = function Sys$UI$DomEvent$addHandler(element, eventName, handler, autoRemove) { + /// <summary locid="M:J#Sys.UI.DomEvent.addHandler" /> + /// <param name="element"></param> + /// <param name="eventName" type="String"></param> + /// <param name="handler" type="Function"></param> + /// <param name="autoRemove" type="Boolean" optional="true"></param> + var e = Function._validateParams(arguments, [ + {name: "element"}, + {name: "eventName", type: String}, + {name: "handler", type: Function}, + {name: "autoRemove", type: Boolean, optional: true} + ]); + if (e) throw e; + Sys.UI.DomEvent._ensureDomNode(element); + if (eventName === "error") throw Error.invalidOperation(Sys.Res.addHandlerCantBeUsedForError); + if (!element._events) { + element._events = {}; + } + var eventCache = element._events[eventName]; + if (!eventCache) { + element._events[eventName] = eventCache = []; + } + var browserHandler; + if (element.addEventListener) { + browserHandler = function(e) { + return handler.call(element, new Sys.UI.DomEvent(e)); + } + element.addEventListener(eventName, browserHandler, false); + } + else if (element.attachEvent) { + browserHandler = function() { + var e = {}; + try {e = Sys.UI.DomElement._getWindow(element).event} catch(ex) {} + return handler.call(element, new Sys.UI.DomEvent(e)); + } + element.attachEvent('on' + eventName, browserHandler); + } + eventCache[eventCache.length] = {handler: handler, browserHandler: browserHandler, autoRemove: autoRemove }; + if (autoRemove) { + var d = element.dispose; + if (d !== Sys.UI.DomEvent._disposeHandlers) { + element.dispose = Sys.UI.DomEvent._disposeHandlers; + if (typeof(d) !== "undefined") { + element._chainDispose = d; + } + } + } +} +var $addHandlers = Sys.UI.DomEvent.addHandlers = function Sys$UI$DomEvent$addHandlers(element, events, handlerOwner, autoRemove) { + /// <summary locid="M:J#Sys.UI.DomEvent.addHandlers" /> + /// <param name="element"></param> + /// <param name="events" type="Object"></param> + /// <param name="handlerOwner" optional="true"></param> + /// <param name="autoRemove" type="Boolean" optional="true"></param> + var e = Function._validateParams(arguments, [ + {name: "element"}, + {name: "events", type: Object}, + {name: "handlerOwner", optional: true}, + {name: "autoRemove", type: Boolean, optional: true} + ]); + if (e) throw e; + Sys.UI.DomEvent._ensureDomNode(element); + for (var name in events) { + var handler = events[name]; + if (typeof(handler) !== 'function') throw Error.invalidOperation(Sys.Res.cantAddNonFunctionhandler); + if (handlerOwner) { + handler = Function.createDelegate(handlerOwner, handler); + } + $addHandler(element, name, handler, autoRemove || false); + } +} +var $clearHandlers = Sys.UI.DomEvent.clearHandlers = function Sys$UI$DomEvent$clearHandlers(element) { + /// <summary locid="M:J#Sys.UI.DomEvent.clearHandlers" /> + /// <param name="element"></param> + var e = Function._validateParams(arguments, [ + {name: "element"} + ]); + if (e) throw e; + Sys.UI.DomEvent._ensureDomNode(element); + Sys.UI.DomEvent._clearHandlers(element, false); +} +Sys.UI.DomEvent._clearHandlers = function Sys$UI$DomEvent$_clearHandlers(element, autoRemoving) { + if (element._events) { + var cache = element._events; + for (var name in cache) { + var handlers = cache[name]; + for (var i = handlers.length - 1; i >= 0; i--) { + var entry = handlers[i]; + if (!autoRemoving || entry.autoRemove) { + $removeHandler(element, name, entry.handler); + } + } + } + element._events = null; + } +} +Sys.UI.DomEvent._disposeHandlers = function Sys$UI$DomEvent$_disposeHandlers() { + Sys.UI.DomEvent._clearHandlers(this, true); + var d = this._chainDispose, type = typeof(d); + if (type !== "undefined") { + this.dispose = d; + this._chainDispose = null; + if (type === "function") { + this.dispose(); + } + } +} +var $removeHandler = Sys.UI.DomEvent.removeHandler = function Sys$UI$DomEvent$removeHandler(element, eventName, handler) { + /// <summary locid="M:J#Sys.UI.DomEvent.removeHandler" /> + /// <param name="element"></param> + /// <param name="eventName" type="String"></param> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "element"}, + {name: "eventName", type: String}, + {name: "handler", type: Function} + ]); + if (e) throw e; + Sys.UI.DomEvent._removeHandler(element, eventName, handler); +} +Sys.UI.DomEvent._removeHandler = function Sys$UI$DomEvent$_removeHandler(element, eventName, handler) { + Sys.UI.DomEvent._ensureDomNode(element); + var browserHandler = null; + if ((typeof(element._events) !== 'object') || !element._events) throw Error.invalidOperation(Sys.Res.eventHandlerInvalid); + var cache = element._events[eventName]; + if (!(cache instanceof Array)) throw Error.invalidOperation(Sys.Res.eventHandlerInvalid); + for (var i = 0, l = cache.length; i < l; i++) { + if (cache[i].handler === handler) { + browserHandler = cache[i].browserHandler; + break; + } + } + if (typeof(browserHandler) !== 'function') throw Error.invalidOperation(Sys.Res.eventHandlerInvalid); + if (element.removeEventListener) { + element.removeEventListener(eventName, browserHandler, false); + } + else if (element.detachEvent) { + element.detachEvent('on' + eventName, browserHandler); + } + cache.splice(i, 1); +} +Sys.UI.DomEvent._ensureDomNode = function Sys$UI$DomEvent$_ensureDomNode(element) { + if (element.tagName && (element.tagName.toUpperCase() === "SCRIPT")) return; + + var doc = element.ownerDocument || element.document || element; + if ((typeof(element.document) !== 'object') && (element != doc) && (typeof(element.nodeType) !== 'number')) { + throw Error.argument("element", Sys.Res.argumentDomNode); + } +} + +Sys.UI.DomElement = function Sys$UI$DomElement() { + /// <summary locid="M:J#Sys.UI.DomElement.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); +} +Sys.UI.DomElement.registerClass('Sys.UI.DomElement'); +Sys.UI.DomElement.addCssClass = function Sys$UI$DomElement$addCssClass(element, className) { + /// <summary locid="M:J#Sys.UI.DomElement.addCssClass" /> + /// <param name="element" domElement="true"></param> + /// <param name="className" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "className", type: String} + ]); + if (e) throw e; + if (!Sys.UI.DomElement.containsCssClass(element, className)) { + if (element.className === '') { + element.className = className; + } + else { + element.className += ' ' + className; + } + } +} +Sys.UI.DomElement.containsCssClass = function Sys$UI$DomElement$containsCssClass(element, className) { + /// <summary locid="M:J#Sys.UI.DomElement.containsCssClass" /> + /// <param name="element" domElement="true"></param> + /// <param name="className" type="String"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "className", type: String} + ]); + if (e) throw e; + return Array.contains(element.className.split(' '), className); +} +Sys.UI.DomElement.getBounds = function Sys$UI$DomElement$getBounds(element) { + /// <summary locid="M:J#Sys.UI.DomElement.getBounds" /> + /// <param name="element" domElement="true"></param> + /// <returns type="Sys.UI.Bounds"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + var offset = Sys.UI.DomElement.getLocation(element); + return new Sys.UI.Bounds(offset.x, offset.y, element.offsetWidth || 0, element.offsetHeight || 0); +} +var $get = Sys.UI.DomElement.getElementById = function Sys$UI$DomElement$getElementById(id, element) { + /// <summary locid="M:J#Sys.UI.DomElement.getElementById" /> + /// <param name="id" type="String"></param> + /// <param name="element" domElement="true" optional="true" mayBeNull="true"></param> + /// <returns domElement="true" mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "id", type: String}, + {name: "element", mayBeNull: true, domElement: true, optional: true} + ]); + if (e) throw e; + if (!element) return document.getElementById(id); + if (element.getElementById) return element.getElementById(id); + var nodeQueue = []; + var childNodes = element.childNodes; + for (var i = 0; i < childNodes.length; i++) { + var node = childNodes[i]; + if (node.nodeType == 1) { + nodeQueue[nodeQueue.length] = node; + } + } + while (nodeQueue.length) { + node = nodeQueue.shift(); + if (node.id == id) { + return node; + } + childNodes = node.childNodes; + for (i = 0; i < childNodes.length; i++) { + node = childNodes[i]; + if (node.nodeType == 1) { + nodeQueue[nodeQueue.length] = node; + } + } + } + return null; +} +if (document.documentElement.getBoundingClientRect) { + Sys.UI.DomElement.getLocation = function Sys$UI$DomElement$getLocation(element) { + /// <summary locid="M:J#Sys.UI.DomElement.getLocation" /> + /// <param name="element" domElement="true"></param> + /// <returns type="Sys.UI.Point"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + if (element.self || element.nodeType === 9) return new Sys.UI.Point(0,0); + var clientRect = element.getBoundingClientRect(); + if (!clientRect) { + return new Sys.UI.Point(0,0); + } + var documentElement = element.ownerDocument.documentElement, + offsetX = Math.floor(clientRect.left + 0.5) + documentElement.scrollLeft, + offsetY = Math.floor(clientRect.top + 0.5) + documentElement.scrollTop; + if (Sys.Browser.agent === Sys.Browser.InternetExplorer) { + try { + var f = element.ownerDocument.parentWindow.frameElement || null; + if (f) { + var offset = (f.frameBorder === "0" || f.frameBorder === "no") ? 2 : 0; + offsetX += offset; + offsetY += offset; + } + } + catch(ex) { + } + if (Sys.Browser.version <= 7) { + + var multiplier, before, rect, d = document.createElement("div"); + d.style.cssText = "position:absolute !important;left:0px !important;right:0px !important;height:0px !important;width:1px !important;display:hidden !important"; + try { + before = document.body.childNodes[0]; + document.body.insertBefore(d, before); + rect = d.getBoundingClientRect(); + document.body.removeChild(d); + multiplier = (rect.right - rect.left); + } + catch (e) { + } + if (multiplier && (multiplier !== 1)) { + offsetX = Math.floor(offsetX / multiplier); + offsetY = Math.floor(offsetY / multiplier); + } + } + if ((document.documentMode || 0) < 8) { + offsetX -= 2; + offsetY -= 2; + } + } + return new Sys.UI.Point(offsetX, offsetY); + } +} +else if (Sys.Browser.agent === Sys.Browser.Safari) { + Sys.UI.DomElement.getLocation = function Sys$UI$DomElement$getLocation(element) { + /// <summary locid="M:J#Sys.UI.DomElement.getLocation" /> + /// <param name="element" domElement="true"></param> + /// <returns type="Sys.UI.Point"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + if ((element.window && (element.window === element)) || element.nodeType === 9) return new Sys.UI.Point(0,0); + var offsetX = 0, offsetY = 0, + parent, + previous = null, + previousStyle = null, + currentStyle; + for (parent = element; parent; previous = parent, previousStyle = currentStyle, parent = parent.offsetParent) { + currentStyle = Sys.UI.DomElement._getCurrentStyle(parent); + var tagName = parent.tagName ? parent.tagName.toUpperCase() : null; + if ((parent.offsetLeft || parent.offsetTop) && + ((tagName !== "BODY") || (!previousStyle || previousStyle.position !== "absolute"))) { + offsetX += parent.offsetLeft; + offsetY += parent.offsetTop; + } + if (previous && Sys.Browser.version >= 3) { + offsetX += parseInt(currentStyle.borderLeftWidth); + offsetY += parseInt(currentStyle.borderTopWidth); + } + } + currentStyle = Sys.UI.DomElement._getCurrentStyle(element); + var elementPosition = currentStyle ? currentStyle.position : null; + if (!elementPosition || (elementPosition !== "absolute")) { + for (parent = element.parentNode; parent; parent = parent.parentNode) { + tagName = parent.tagName ? parent.tagName.toUpperCase() : null; + if ((tagName !== "BODY") && (tagName !== "HTML") && (parent.scrollLeft || parent.scrollTop)) { + offsetX -= (parent.scrollLeft || 0); + offsetY -= (parent.scrollTop || 0); + } + currentStyle = Sys.UI.DomElement._getCurrentStyle(parent); + var parentPosition = currentStyle ? currentStyle.position : null; + if (parentPosition && (parentPosition === "absolute")) break; + } + } + return new Sys.UI.Point(offsetX, offsetY); + } +} +else { + Sys.UI.DomElement.getLocation = function Sys$UI$DomElement$getLocation(element) { + /// <summary locid="M:J#Sys.UI.DomElement.getLocation" /> + /// <param name="element" domElement="true"></param> + /// <returns type="Sys.UI.Point"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + if ((element.window && (element.window === element)) || element.nodeType === 9) return new Sys.UI.Point(0,0); + var offsetX = 0, offsetY = 0, + parent, + previous = null, + previousStyle = null, + currentStyle = null; + for (parent = element; parent; previous = parent, previousStyle = currentStyle, parent = parent.offsetParent) { + var tagName = parent.tagName ? parent.tagName.toUpperCase() : null; + currentStyle = Sys.UI.DomElement._getCurrentStyle(parent); + if ((parent.offsetLeft || parent.offsetTop) && + !((tagName === "BODY") && + (!previousStyle || previousStyle.position !== "absolute"))) { + offsetX += parent.offsetLeft; + offsetY += parent.offsetTop; + } + if (previous !== null && currentStyle) { + if ((tagName !== "TABLE") && (tagName !== "TD") && (tagName !== "HTML")) { + offsetX += parseInt(currentStyle.borderLeftWidth) || 0; + offsetY += parseInt(currentStyle.borderTopWidth) || 0; + } + if (tagName === "TABLE" && + (currentStyle.position === "relative" || currentStyle.position === "absolute")) { + offsetX += parseInt(currentStyle.marginLeft) || 0; + offsetY += parseInt(currentStyle.marginTop) || 0; + } + } + } + currentStyle = Sys.UI.DomElement._getCurrentStyle(element); + var elementPosition = currentStyle ? currentStyle.position : null; + if (!elementPosition || (elementPosition !== "absolute")) { + for (parent = element.parentNode; parent; parent = parent.parentNode) { + tagName = parent.tagName ? parent.tagName.toUpperCase() : null; + if ((tagName !== "BODY") && (tagName !== "HTML") && (parent.scrollLeft || parent.scrollTop)) { + offsetX -= (parent.scrollLeft || 0); + offsetY -= (parent.scrollTop || 0); + currentStyle = Sys.UI.DomElement._getCurrentStyle(parent); + if (currentStyle) { + offsetX += parseInt(currentStyle.borderLeftWidth) || 0; + offsetY += parseInt(currentStyle.borderTopWidth) || 0; + } + } + } + } + return new Sys.UI.Point(offsetX, offsetY); + } +} +Sys.UI.DomElement.isDomElement = function Sys$UI$DomElement$isDomElement(obj) { + /// <summary locid="M:J#Sys.UI.DomElement.isDomElement" /> + /// <param name="obj"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "obj"} + ]); + if (e) throw e; + return Sys._isDomElement(obj); +} +Sys.UI.DomElement.removeCssClass = function Sys$UI$DomElement$removeCssClass(element, className) { + /// <summary locid="M:J#Sys.UI.DomElement.removeCssClass" /> + /// <param name="element" domElement="true"></param> + /// <param name="className" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "className", type: String} + ]); + if (e) throw e; + var currentClassName = ' ' + element.className + ' '; + var index = currentClassName.indexOf(' ' + className + ' '); + if (index >= 0) { + element.className = (currentClassName.substr(0, index) + ' ' + + currentClassName.substring(index + className.length + 1, currentClassName.length)).trim(); + } +} +Sys.UI.DomElement.resolveElement = function Sys$UI$DomElement$resolveElement(elementOrElementId, containerElement) { + /// <summary locid="M:J#Sys.UI.DomElement.resolveElement" /> + /// <param name="elementOrElementId" mayBeNull="true"></param> + /// <param name="containerElement" domElement="true" optional="true" mayBeNull="true"></param> + /// <returns domElement="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "elementOrElementId", mayBeNull: true}, + {name: "containerElement", mayBeNull: true, domElement: true, optional: true} + ]); + if (e) throw e; + var el = elementOrElementId; + if (!el) return null; + if (typeof(el) === "string") { + el = Sys.UI.DomElement.getElementById(el, containerElement); + if (!el) { + throw Error.argument("elementOrElementId", String.format(Sys.Res.elementNotFound, elementOrElementId)); + } + } + else if(!Sys.UI.DomElement.isDomElement(el)) { + throw Error.argument("elementOrElementId", Sys.Res.expectedElementOrId); + } + return el; +} +Sys.UI.DomElement.raiseBubbleEvent = function Sys$UI$DomElement$raiseBubbleEvent(source, args) { + /// <summary locid="M:J#Sys.UI.DomElement.raiseBubbleEvent" /> + /// <param name="source" domElement="true"></param> + /// <param name="args" type="Sys.EventArgs"></param> + var e = Function._validateParams(arguments, [ + {name: "source", domElement: true}, + {name: "args", type: Sys.EventArgs} + ]); + if (e) throw e; + var target = source; + while (target) { + var control = target.control; + if (control && control.onBubbleEvent && control.raiseBubbleEvent) { + Sys.UI.DomElement._raiseBubbleEventFromControl(control, source, args); + return; + } + target = target.parentNode; + } +} +Sys.UI.DomElement._raiseBubbleEventFromControl = function Sys$UI$DomElement$_raiseBubbleEventFromControl(control, source, args) { + if (!control.onBubbleEvent(source, args)) { + control._raiseBubbleEvent(source, args); + } +} +Sys.UI.DomElement.setLocation = function Sys$UI$DomElement$setLocation(element, x, y) { + /// <summary locid="M:J#Sys.UI.DomElement.setLocation" /> + /// <param name="element" domElement="true"></param> + /// <param name="x" type="Number" integer="true"></param> + /// <param name="y" type="Number" integer="true"></param> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "x", type: Number, integer: true}, + {name: "y", type: Number, integer: true} + ]); + if (e) throw e; + var style = element.style; + style.position = 'absolute'; + style.left = x + "px"; + style.top = y + "px"; +} +Sys.UI.DomElement.toggleCssClass = function Sys$UI$DomElement$toggleCssClass(element, className) { + /// <summary locid="M:J#Sys.UI.DomElement.toggleCssClass" /> + /// <param name="element" domElement="true"></param> + /// <param name="className" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "className", type: String} + ]); + if (e) throw e; + if (Sys.UI.DomElement.containsCssClass(element, className)) { + Sys.UI.DomElement.removeCssClass(element, className); + } + else { + Sys.UI.DomElement.addCssClass(element, className); + } +} +Sys.UI.DomElement.getVisibilityMode = function Sys$UI$DomElement$getVisibilityMode(element) { + /// <summary locid="M:J#Sys.UI.DomElement.getVisibilityMode" /> + /// <param name="element" domElement="true"></param> + /// <returns type="Sys.UI.VisibilityMode"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + return (element._visibilityMode === Sys.UI.VisibilityMode.hide) ? + Sys.UI.VisibilityMode.hide : + Sys.UI.VisibilityMode.collapse; +} +Sys.UI.DomElement.setVisibilityMode = function Sys$UI$DomElement$setVisibilityMode(element, value) { + /// <summary locid="M:J#Sys.UI.DomElement.setVisibilityMode" /> + /// <param name="element" domElement="true"></param> + /// <param name="value" type="Sys.UI.VisibilityMode"></param> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "value", type: Sys.UI.VisibilityMode} + ]); + if (e) throw e; + Sys.UI.DomElement._ensureOldDisplayMode(element); + if (element._visibilityMode !== value) { + element._visibilityMode = value; + if (Sys.UI.DomElement.getVisible(element) === false) { + if (element._visibilityMode === Sys.UI.VisibilityMode.hide) { + element.style.display = element._oldDisplayMode; + } + else { + element.style.display = 'none'; + } + } + element._visibilityMode = value; + } +} +Sys.UI.DomElement.getVisible = function Sys$UI$DomElement$getVisible(element) { + /// <summary locid="M:J#Sys.UI.DomElement.getVisible" /> + /// <param name="element" domElement="true"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + var style = element.currentStyle || Sys.UI.DomElement._getCurrentStyle(element); + if (!style) return true; + return (style.visibility !== 'hidden') && (style.display !== 'none'); +} +Sys.UI.DomElement.setVisible = function Sys$UI$DomElement$setVisible(element, value) { + /// <summary locid="M:J#Sys.UI.DomElement.setVisible" /> + /// <param name="element" domElement="true"></param> + /// <param name="value" type="Boolean"></param> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "value", type: Boolean} + ]); + if (e) throw e; + if (value !== Sys.UI.DomElement.getVisible(element)) { + Sys.UI.DomElement._ensureOldDisplayMode(element); + element.style.visibility = value ? 'visible' : 'hidden'; + if (value || (element._visibilityMode === Sys.UI.VisibilityMode.hide)) { + element.style.display = element._oldDisplayMode; + } + else { + element.style.display = 'none'; + } + } +} +Sys.UI.DomElement._ensureOldDisplayMode = function Sys$UI$DomElement$_ensureOldDisplayMode(element) { + if (!element._oldDisplayMode) { + var style = element.currentStyle || Sys.UI.DomElement._getCurrentStyle(element); + element._oldDisplayMode = style ? style.display : null; + if (!element._oldDisplayMode || element._oldDisplayMode === 'none') { + switch(element.tagName.toUpperCase()) { + case 'DIV': case 'P': case 'ADDRESS': case 'BLOCKQUOTE': case 'BODY': case 'COL': + case 'COLGROUP': case 'DD': case 'DL': case 'DT': case 'FIELDSET': case 'FORM': + case 'H1': case 'H2': case 'H3': case 'H4': case 'H5': case 'H6': case 'HR': + case 'IFRAME': case 'LEGEND': case 'OL': case 'PRE': case 'TABLE': case 'TD': + case 'TH': case 'TR': case 'UL': + element._oldDisplayMode = 'block'; + break; + case 'LI': + element._oldDisplayMode = 'list-item'; + break; + default: + element._oldDisplayMode = 'inline'; + } + } + } +} +Sys.UI.DomElement._getWindow = function Sys$UI$DomElement$_getWindow(element) { + var doc = element.ownerDocument || element.document || element; + return doc.defaultView || doc.parentWindow; +} +Sys.UI.DomElement._getCurrentStyle = function Sys$UI$DomElement$_getCurrentStyle(element) { + if (element.nodeType === 3) return null; + var w = Sys.UI.DomElement._getWindow(element); + if (element.documentElement) element = element.documentElement; + var computedStyle = (w && (element !== w) && w.getComputedStyle) ? + w.getComputedStyle(element, null) : + element.currentStyle || element.style; + if (!computedStyle && (Sys.Browser.agent === Sys.Browser.Safari) && element.style) { + var oldDisplay = element.style.display; + var oldPosition = element.style.position; + element.style.position = 'absolute'; + element.style.display = 'block'; + var style = w.getComputedStyle(element, null); + element.style.display = oldDisplay; + element.style.position = oldPosition; + computedStyle = {}; + for (var n in style) { + computedStyle[n] = style[n]; + } + computedStyle.display = 'none'; + } + return computedStyle; +} + +Sys.IContainer = function Sys$IContainer() { + throw Error.notImplemented(); +} + function Sys$IContainer$addComponent(component) { + /// <summary locid="M:J#Sys.IContainer.addComponent" /> + /// <param name="component" type="Sys.Component"></param> + var e = Function._validateParams(arguments, [ + {name: "component", type: Sys.Component} + ]); + if (e) throw e; + throw Error.notImplemented(); + } + function Sys$IContainer$removeComponent(component) { + /// <summary locid="M:J#Sys.IContainer.removeComponent" /> + /// <param name="component" type="Sys.Component"></param> + var e = Function._validateParams(arguments, [ + {name: "component", type: Sys.Component} + ]); + if (e) throw e; + throw Error.notImplemented(); + } + function Sys$IContainer$findComponent(id) { + /// <summary locid="M:J#Sys.IContainer.findComponent" /> + /// <param name="id" type="String"></param> + /// <returns type="Sys.Component"></returns> + var e = Function._validateParams(arguments, [ + {name: "id", type: String} + ]); + if (e) throw e; + throw Error.notImplemented(); + } + function Sys$IContainer$getComponents() { + /// <summary locid="M:J#Sys.IContainer.getComponents" /> + /// <returns type="Array" elementType="Sys.Component"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } +Sys.IContainer.prototype = { + addComponent: Sys$IContainer$addComponent, + removeComponent: Sys$IContainer$removeComponent, + findComponent: Sys$IContainer$findComponent, + getComponents: Sys$IContainer$getComponents +} +Sys.IContainer.registerInterface("Sys.IContainer"); + +Sys.ApplicationLoadEventArgs = function Sys$ApplicationLoadEventArgs(components, isPartialLoad) { + /// <summary locid="M:J#Sys.ApplicationLoadEventArgs.#ctor" /> + /// <param name="components" type="Array" elementType="Sys.Component"></param> + /// <param name="isPartialLoad" type="Boolean"></param> + var e = Function._validateParams(arguments, [ + {name: "components", type: Array, elementType: Sys.Component}, + {name: "isPartialLoad", type: Boolean} + ]); + if (e) throw e; + Sys.ApplicationLoadEventArgs.initializeBase(this); + this._components = components; + this._isPartialLoad = isPartialLoad; +} + + function Sys$ApplicationLoadEventArgs$get_components() { + /// <value type="Array" elementType="Sys.Component" locid="P:J#Sys.ApplicationLoadEventArgs.components"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._components; + } + function Sys$ApplicationLoadEventArgs$get_isPartialLoad() { + /// <value type="Boolean" locid="P:J#Sys.ApplicationLoadEventArgs.isPartialLoad"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._isPartialLoad; + } +Sys.ApplicationLoadEventArgs.prototype = { + get_components: Sys$ApplicationLoadEventArgs$get_components, + get_isPartialLoad: Sys$ApplicationLoadEventArgs$get_isPartialLoad +} +Sys.ApplicationLoadEventArgs.registerClass('Sys.ApplicationLoadEventArgs', Sys.EventArgs); + +Sys._Application = function Sys$_Application() { + /// <summary locid="M:J#Sys.Application.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + Sys._Application.initializeBase(this); + this._disposableObjects = []; + this._components = {}; + this._createdComponents = []; + this._secondPassComponents = []; + this._unloadHandlerDelegate = Function.createDelegate(this, this._unloadHandler); + Sys.UI.DomEvent.addHandler(window, "unload", this._unloadHandlerDelegate); + this._domReady(); +} + function Sys$_Application$get_isCreatingComponents() { + /// <value type="Boolean" locid="P:J#Sys.Application.isCreatingComponents"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._creatingComponents; + } + function Sys$_Application$get_isDisposing() { + /// <value type="Boolean" locid="P:J#Sys.Application.isDisposing"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._disposing; + } + function Sys$_Application$add_init(handler) { + /// <summary locid="E:J#Sys.Application.init" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + if (this._initialized) { + handler(this, Sys.EventArgs.Empty); + } + else { + this.get_events().addHandler("init", handler); + } + } + function Sys$_Application$remove_init(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().removeHandler("init", handler); + } + function Sys$_Application$add_load(handler) { + /// <summary locid="E:J#Sys.Application.load" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().addHandler("load", handler); + } + function Sys$_Application$remove_load(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().removeHandler("load", handler); + } + function Sys$_Application$add_unload(handler) { + /// <summary locid="E:J#Sys.Application.unload" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().addHandler("unload", handler); + } + function Sys$_Application$remove_unload(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this.get_events().removeHandler("unload", handler); + } + function Sys$_Application$addComponent(component) { + /// <summary locid="M:J#Sys.Application.addComponent" /> + /// <param name="component" type="Sys.Component"></param> + var e = Function._validateParams(arguments, [ + {name: "component", type: Sys.Component} + ]); + if (e) throw e; + var id = component.get_id(); + if (!id) throw Error.invalidOperation(Sys.Res.cantAddWithoutId); + if (typeof(this._components[id]) !== 'undefined') throw Error.invalidOperation(String.format(Sys.Res.appDuplicateComponent, id)); + this._components[id] = component; + } + function Sys$_Application$beginCreateComponents() { + /// <summary locid="M:J#Sys.Application.beginCreateComponents" /> + if (arguments.length !== 0) throw Error.parameterCount(); + this._creatingComponents = true; + } + function Sys$_Application$dispose() { + /// <summary locid="M:J#Sys.Application.dispose" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._disposing) { + this._disposing = true; + if (this._timerCookie) { + window.clearTimeout(this._timerCookie); + delete this._timerCookie; + } + if (this._endRequestHandler) { + Sys.WebForms.PageRequestManager.getInstance().remove_endRequest(this._endRequestHandler); + delete this._endRequestHandler; + } + if (this._beginRequestHandler) { + Sys.WebForms.PageRequestManager.getInstance().remove_beginRequest(this._beginRequestHandler); + delete this._beginRequestHandler; + } + if (window.pageUnload) { + window.pageUnload(this, Sys.EventArgs.Empty); + } + var unloadHandler = this.get_events().getHandler("unload"); + if (unloadHandler) { + unloadHandler(this, Sys.EventArgs.Empty); + } + var disposableObjects = Array.clone(this._disposableObjects); + for (var i = 0, l = disposableObjects.length; i < l; i++) { + var object = disposableObjects[i]; + if (typeof(object) !== "undefined") { + object.dispose(); + } + } + Array.clear(this._disposableObjects); + Sys.UI.DomEvent.removeHandler(window, "unload", this._unloadHandlerDelegate); + if (Sys._ScriptLoader) { + var sl = Sys._ScriptLoader.getInstance(); + if(sl) { + sl.dispose(); + } + } + Sys._Application.callBaseMethod(this, 'dispose'); + } + } + function Sys$_Application$disposeElement(element, childNodesOnly) { + /// <summary locid="M:J#Sys._Application.disposeElement" /> + /// <param name="element"></param> + /// <param name="childNodesOnly" type="Boolean"></param> + var e = Function._validateParams(arguments, [ + {name: "element"}, + {name: "childNodesOnly", type: Boolean} + ]); + if (e) throw e; + if (element.nodeType === 1) { + var children = element.getElementsByTagName("*"); + for (var i = children.length - 1; i >= 0; i--) { + this._disposeElementInternal(children[i]); + } + if (!childNodesOnly) { + this._disposeElementInternal(element); + } + } + } + function Sys$_Application$endCreateComponents() { + /// <summary locid="M:J#Sys.Application.endCreateComponents" /> + if (arguments.length !== 0) throw Error.parameterCount(); + var components = this._secondPassComponents; + for (var i = 0, l = components.length; i < l; i++) { + var component = components[i].component; + Sys$Component$_setReferences(component, components[i].references); + component.endUpdate(); + } + this._secondPassComponents = []; + this._creatingComponents = false; + } + function Sys$_Application$findComponent(id, parent) { + /// <summary locid="M:J#Sys.Application.findComponent" /> + /// <param name="id" type="String"></param> + /// <param name="parent" optional="true" mayBeNull="true"></param> + /// <returns type="Sys.Component" mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "id", type: String}, + {name: "parent", mayBeNull: true, optional: true} + ]); + if (e) throw e; + return (parent ? + ((Sys.IContainer.isInstanceOfType(parent)) ? + parent.findComponent(id) : + parent[id] || null) : + Sys.Application._components[id] || null); + } + function Sys$_Application$getComponents() { + /// <summary locid="M:J#Sys.Application.getComponents" /> + /// <returns type="Array" elementType="Sys.Component"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + var res = []; + var components = this._components; + for (var name in components) { + res[res.length] = components[name]; + } + return res; + } + function Sys$_Application$initialize() { + /// <summary locid="M:J#Sys.Application.initialize" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if(!this.get_isInitialized() && !this._disposing) { + Sys._Application.callBaseMethod(this, 'initialize'); + this._raiseInit(); + if (this.get_stateString) { + if (Sys.WebForms && Sys.WebForms.PageRequestManager) { + this._beginRequestHandler = Function.createDelegate(this, this._onPageRequestManagerBeginRequest); + Sys.WebForms.PageRequestManager.getInstance().add_beginRequest(this._beginRequestHandler); + this._endRequestHandler = Function.createDelegate(this, this._onPageRequestManagerEndRequest); + Sys.WebForms.PageRequestManager.getInstance().add_endRequest(this._endRequestHandler); + } + var loadedEntry = this.get_stateString(); + if (loadedEntry !== this._currentEntry) { + this._navigate(loadedEntry); + } + else { + this._ensureHistory(); + } + } + this.raiseLoad(); + } + } + function Sys$_Application$notifyScriptLoaded() { + /// <summary locid="M:J#Sys.Application.notifyScriptLoaded" /> + if (arguments.length !== 0) throw Error.parameterCount(); + } + function Sys$_Application$registerDisposableObject(object) { + /// <summary locid="M:J#Sys.Application.registerDisposableObject" /> + /// <param name="object" type="Sys.IDisposable"></param> + var e = Function._validateParams(arguments, [ + {name: "object", type: Sys.IDisposable} + ]); + if (e) throw e; + if (!this._disposing) { + var objects = this._disposableObjects, + i = objects.length; + objects[i] = object; + object.__msdisposeindex = i; + } + } + function Sys$_Application$raiseLoad() { + /// <summary locid="M:J#Sys.Application.raiseLoad" /> + if (arguments.length !== 0) throw Error.parameterCount(); + var h = this.get_events().getHandler("load"); + var args = new Sys.ApplicationLoadEventArgs(Array.clone(this._createdComponents), !!this._loaded); + this._loaded = true; + if (h) { + h(this, args); + } + if (window.pageLoad) { + window.pageLoad(this, args); + } + this._createdComponents = []; + } + function Sys$_Application$removeComponent(component) { + /// <summary locid="M:J#Sys.Application.removeComponent" /> + /// <param name="component" type="Sys.Component"></param> + var e = Function._validateParams(arguments, [ + {name: "component", type: Sys.Component} + ]); + if (e) throw e; + var id = component.get_id(); + if (id) delete this._components[id]; + } + function Sys$_Application$unregisterDisposableObject(object) { + /// <summary locid="M:J#Sys.Application.unregisterDisposableObject" /> + /// <param name="object" type="Sys.IDisposable"></param> + var e = Function._validateParams(arguments, [ + {name: "object", type: Sys.IDisposable} + ]); + if (e) throw e; + if (!this._disposing) { + var i = object.__msdisposeindex; + if (typeof(i) === "number") { + var disposableObjects = this._disposableObjects; + delete disposableObjects[i]; + delete object.__msdisposeindex; + if (++this._deleteCount > 1000) { + var newArray = []; + for (var j = 0, l = disposableObjects.length; j < l; j++) { + object = disposableObjects[j]; + if (typeof(object) !== "undefined") { + object.__msdisposeindex = newArray.length; + newArray.push(object); + } + } + this._disposableObjects = newArray; + this._deleteCount = 0; + } + } + } + } + function Sys$_Application$_addComponentToSecondPass(component, references) { + this._secondPassComponents[this._secondPassComponents.length] = {component: component, references: references}; + } + function Sys$_Application$_disposeComponents(list) { + if (list) { + for (var i = list.length - 1; i >= 0; i--) { + var item = list[i]; + if (typeof(item.dispose) === "function") { + item.dispose(); + } + } + } + } + function Sys$_Application$_disposeElementInternal(element) { + var d = element.dispose; + if (d && typeof(d) === "function") { + element.dispose(); + } + else { + var c = element.control; + if (c && typeof(c.dispose) === "function") { + c.dispose(); + } + } + var list = element._behaviors; + if (list) { + this._disposeComponents(list); + } + list = element._components; + if (list) { + this._disposeComponents(list); + element._components = null; + } + } + function Sys$_Application$_domReady() { + var check, er, app = this; + function init() { app.initialize(); } + var onload = function() { + Sys.UI.DomEvent.removeHandler(window, "load", onload); + init(); + } + Sys.UI.DomEvent.addHandler(window, "load", onload); + + if (document.addEventListener) { + try { + document.addEventListener("DOMContentLoaded", check = function() { + document.removeEventListener("DOMContentLoaded", check, false); + init(); + }, false); + } + catch (er) { } + } + else if (document.attachEvent) { + if ((window == window.top) && document.documentElement.doScroll) { + var timeout, el = document.createElement("div"); + check = function() { + try { + el.doScroll("left"); + } + catch (er) { + timeout = window.setTimeout(check, 0); + return; + } + el = null; + init(); + } + check(); + } + else { + document.attachEvent("onreadystatechange", check = function() { + if (document.readyState === "complete") { + document.detachEvent("onreadystatechange", check); + init(); + } + }); + } + } + } + function Sys$_Application$_raiseInit() { + var handler = this.get_events().getHandler("init"); + if (handler) { + this.beginCreateComponents(); + handler(this, Sys.EventArgs.Empty); + this.endCreateComponents(); + } + } + function Sys$_Application$_unloadHandler(event) { + this.dispose(); + } +Sys._Application.prototype = { + _creatingComponents: false, + _disposing: false, + _deleteCount: 0, + get_isCreatingComponents: Sys$_Application$get_isCreatingComponents, + get_isDisposing: Sys$_Application$get_isDisposing, + add_init: Sys$_Application$add_init, + remove_init: Sys$_Application$remove_init, + add_load: Sys$_Application$add_load, + remove_load: Sys$_Application$remove_load, + add_unload: Sys$_Application$add_unload, + remove_unload: Sys$_Application$remove_unload, + addComponent: Sys$_Application$addComponent, + beginCreateComponents: Sys$_Application$beginCreateComponents, + dispose: Sys$_Application$dispose, + disposeElement: Sys$_Application$disposeElement, + endCreateComponents: Sys$_Application$endCreateComponents, + findComponent: Sys$_Application$findComponent, + getComponents: Sys$_Application$getComponents, + initialize: Sys$_Application$initialize, + notifyScriptLoaded: Sys$_Application$notifyScriptLoaded, + registerDisposableObject: Sys$_Application$registerDisposableObject, + raiseLoad: Sys$_Application$raiseLoad, + removeComponent: Sys$_Application$removeComponent, + unregisterDisposableObject: Sys$_Application$unregisterDisposableObject, + _addComponentToSecondPass: Sys$_Application$_addComponentToSecondPass, + _disposeComponents: Sys$_Application$_disposeComponents, + _disposeElementInternal: Sys$_Application$_disposeElementInternal, + _domReady: Sys$_Application$_domReady, + _raiseInit: Sys$_Application$_raiseInit, + _unloadHandler: Sys$_Application$_unloadHandler +} +Sys._Application.registerClass('Sys._Application', Sys.Component, Sys.IContainer); +Sys.Application = new Sys._Application(); +var $find = Sys.Application.findComponent; + +Sys.UI.Behavior = function Sys$UI$Behavior(element) { + /// <summary locid="M:J#Sys.UI.Behavior.#ctor" /> + /// <param name="element" domElement="true"></param> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + Sys.UI.Behavior.initializeBase(this); + this._element = element; + var behaviors = element._behaviors; + if (!behaviors) { + element._behaviors = [this]; + } + else { + behaviors[behaviors.length] = this; + } +} + function Sys$UI$Behavior$get_element() { + /// <value domElement="true" locid="P:J#Sys.UI.Behavior.element"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._element; + } + function Sys$UI$Behavior$get_id() { + /// <value type="String" locid="P:J#Sys.UI.Behavior.id"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + var baseId = Sys.UI.Behavior.callBaseMethod(this, 'get_id'); + if (baseId) return baseId; + if (!this._element || !this._element.id) return ''; + return this._element.id + '$' + this.get_name(); + } + function Sys$UI$Behavior$get_name() { + /// <value type="String" locid="P:J#Sys.UI.Behavior.name"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this._name) return this._name; + var name = Object.getTypeName(this); + var i = name.lastIndexOf('.'); + if (i !== -1) name = name.substr(i + 1); + if (!this.get_isInitialized()) this._name = name; + return name; + } + function Sys$UI$Behavior$set_name(value) { + var e = Function._validateParams(arguments, [{name: "value", type: String}]); + if (e) throw e; + if ((value === '') || (value.charAt(0) === ' ') || (value.charAt(value.length - 1) === ' ')) + throw Error.argument('value', Sys.Res.invalidId); + if (typeof(this._element[value]) !== 'undefined') + throw Error.invalidOperation(String.format(Sys.Res.behaviorDuplicateName, value)); + if (this.get_isInitialized()) throw Error.invalidOperation(Sys.Res.cantSetNameAfterInit); + this._name = value; + } + function Sys$UI$Behavior$initialize() { + Sys.UI.Behavior.callBaseMethod(this, 'initialize'); + var name = this.get_name(); + if (name) this._element[name] = this; + } + function Sys$UI$Behavior$dispose() { + Sys.UI.Behavior.callBaseMethod(this, 'dispose'); + var e = this._element; + if (e) { + var name = this.get_name(); + if (name) { + e[name] = null; + } + var behaviors = e._behaviors; + Array.remove(behaviors, this); + if (behaviors.length === 0) { + e._behaviors = null; + } + delete this._element; + } + } +Sys.UI.Behavior.prototype = { + _name: null, + get_element: Sys$UI$Behavior$get_element, + get_id: Sys$UI$Behavior$get_id, + get_name: Sys$UI$Behavior$get_name, + set_name: Sys$UI$Behavior$set_name, + initialize: Sys$UI$Behavior$initialize, + dispose: Sys$UI$Behavior$dispose +} +Sys.UI.Behavior.registerClass('Sys.UI.Behavior', Sys.Component); +Sys.UI.Behavior.getBehaviorByName = function Sys$UI$Behavior$getBehaviorByName(element, name) { + /// <summary locid="M:J#Sys.UI.Behavior.getBehaviorByName" /> + /// <param name="element" domElement="true"></param> + /// <param name="name" type="String"></param> + /// <returns type="Sys.UI.Behavior" mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "name", type: String} + ]); + if (e) throw e; + var b = element[name]; + return (b && Sys.UI.Behavior.isInstanceOfType(b)) ? b : null; +} +Sys.UI.Behavior.getBehaviors = function Sys$UI$Behavior$getBehaviors(element) { + /// <summary locid="M:J#Sys.UI.Behavior.getBehaviors" /> + /// <param name="element" domElement="true"></param> + /// <returns type="Array" elementType="Sys.UI.Behavior"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + if (!element._behaviors) return []; + return Array.clone(element._behaviors); +} +Sys.UI.Behavior.getBehaviorsByType = function Sys$UI$Behavior$getBehaviorsByType(element, type) { + /// <summary locid="M:J#Sys.UI.Behavior.getBehaviorsByType" /> + /// <param name="element" domElement="true"></param> + /// <param name="type" type="Type"></param> + /// <returns type="Array" elementType="Sys.UI.Behavior"></returns> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true}, + {name: "type", type: Type} + ]); + if (e) throw e; + var behaviors = element._behaviors; + var results = []; + if (behaviors) { + for (var i = 0, l = behaviors.length; i < l; i++) { + if (type.isInstanceOfType(behaviors[i])) { + results[results.length] = behaviors[i]; + } + } + } + return results; +} + +Sys.UI.VisibilityMode = function Sys$UI$VisibilityMode() { + /// <summary locid="M:J#Sys.UI.VisibilityMode.#ctor" /> + /// <field name="hide" type="Number" integer="true" static="true" locid="F:J#Sys.UI.VisibilityMode.hide"></field> + /// <field name="collapse" type="Number" integer="true" static="true" locid="F:J#Sys.UI.VisibilityMode.collapse"></field> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); +} +Sys.UI.VisibilityMode.prototype = { + hide: 0, + collapse: 1 +} +Sys.UI.VisibilityMode.registerEnum("Sys.UI.VisibilityMode"); + +Sys.UI.Control = function Sys$UI$Control(element) { + /// <summary locid="M:J#Sys.UI.Control.#ctor" /> + /// <param name="element" domElement="true"></param> + var e = Function._validateParams(arguments, [ + {name: "element", domElement: true} + ]); + if (e) throw e; + if (typeof(element.control) !== 'undefined') throw Error.invalidOperation(Sys.Res.controlAlreadyDefined); + Sys.UI.Control.initializeBase(this); + this._element = element; + element.control = this; + var role = this.get_role(); + if (role) { + element.setAttribute("role", role); + } +} + function Sys$UI$Control$get_element() { + /// <value domElement="true" locid="P:J#Sys.UI.Control.element"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._element; + } + function Sys$UI$Control$get_id() { + /// <value type="String" locid="P:J#Sys.UI.Control.id"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._element) return ''; + return this._element.id; + } + function Sys$UI$Control$set_id(value) { + var e = Function._validateParams(arguments, [{name: "value", type: String}]); + if (e) throw e; + throw Error.invalidOperation(Sys.Res.cantSetId); + } + function Sys$UI$Control$get_parent() { + /// <value type="Sys.UI.Control" locid="P:J#Sys.UI.Control.parent"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this._parent) return this._parent; + if (!this._element) return null; + + var parentElement = this._element.parentNode; + while (parentElement) { + if (parentElement.control) { + return parentElement.control; + } + parentElement = parentElement.parentNode; + } + return null; + } + function Sys$UI$Control$set_parent(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Sys.UI.Control}]); + if (e) throw e; + if (!this._element) throw Error.invalidOperation(Sys.Res.cantBeCalledAfterDispose); + var parents = [this]; + var current = value; + while (current) { + if (Array.contains(parents, current)) throw Error.invalidOperation(Sys.Res.circularParentChain); + parents[parents.length] = current; + current = current.get_parent(); + } + this._parent = value; + } + function Sys$UI$Control$get_role() { + /// <value type="String" locid="P:J#Sys.UI.Control.role"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return null; + } + function Sys$UI$Control$get_visibilityMode() { + /// <value type="Sys.UI.VisibilityMode" locid="P:J#Sys.UI.Control.visibilityMode"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._element) throw Error.invalidOperation(Sys.Res.cantBeCalledAfterDispose); + return Sys.UI.DomElement.getVisibilityMode(this._element); + } + function Sys$UI$Control$set_visibilityMode(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Sys.UI.VisibilityMode}]); + if (e) throw e; + if (!this._element) throw Error.invalidOperation(Sys.Res.cantBeCalledAfterDispose); + Sys.UI.DomElement.setVisibilityMode(this._element, value); + } + function Sys$UI$Control$get_visible() { + /// <value type="Boolean" locid="P:J#Sys.UI.Control.visible"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._element) throw Error.invalidOperation(Sys.Res.cantBeCalledAfterDispose); + return Sys.UI.DomElement.getVisible(this._element); + } + function Sys$UI$Control$set_visible(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Boolean}]); + if (e) throw e; + if (!this._element) throw Error.invalidOperation(Sys.Res.cantBeCalledAfterDispose); + Sys.UI.DomElement.setVisible(this._element, value) + } + function Sys$UI$Control$addCssClass(className) { + /// <summary locid="M:J#Sys.UI.Control.addCssClass" /> + /// <param name="className" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "className", type: String} + ]); + if (e) throw e; + if (!this._element) throw Error.invalidOperation(Sys.Res.cantBeCalledAfterDispose); + Sys.UI.DomElement.addCssClass(this._element, className); + } + function Sys$UI$Control$dispose() { + Sys.UI.Control.callBaseMethod(this, 'dispose'); + if (this._element) { + this._element.control = null; + delete this._element; + } + if (this._parent) delete this._parent; + } + function Sys$UI$Control$onBubbleEvent(source, args) { + /// <summary locid="M:J#Sys.UI.Control.onBubbleEvent" /> + /// <param name="source"></param> + /// <param name="args" type="Sys.EventArgs"></param> + /// <returns type="Boolean"></returns> + var e = Function._validateParams(arguments, [ + {name: "source"}, + {name: "args", type: Sys.EventArgs} + ]); + if (e) throw e; + return false; + } + function Sys$UI$Control$raiseBubbleEvent(source, args) { + /// <summary locid="M:J#Sys.UI.Control.raiseBubbleEvent" /> + /// <param name="source"></param> + /// <param name="args" type="Sys.EventArgs"></param> + var e = Function._validateParams(arguments, [ + {name: "source"}, + {name: "args", type: Sys.EventArgs} + ]); + if (e) throw e; + this._raiseBubbleEvent(source, args); + } + function Sys$UI$Control$_raiseBubbleEvent(source, args) { + var currentTarget = this.get_parent(); + while (currentTarget) { + if (currentTarget.onBubbleEvent(source, args)) { + return; + } + currentTarget = currentTarget.get_parent(); + } + } + function Sys$UI$Control$removeCssClass(className) { + /// <summary locid="M:J#Sys.UI.Control.removeCssClass" /> + /// <param name="className" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "className", type: String} + ]); + if (e) throw e; + if (!this._element) throw Error.invalidOperation(Sys.Res.cantBeCalledAfterDispose); + Sys.UI.DomElement.removeCssClass(this._element, className); + } + function Sys$UI$Control$toggleCssClass(className) { + /// <summary locid="M:J#Sys.UI.Control.toggleCssClass" /> + /// <param name="className" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "className", type: String} + ]); + if (e) throw e; + if (!this._element) throw Error.invalidOperation(Sys.Res.cantBeCalledAfterDispose); + Sys.UI.DomElement.toggleCssClass(this._element, className); + } +Sys.UI.Control.prototype = { + _parent: null, + _visibilityMode: Sys.UI.VisibilityMode.hide, + get_element: Sys$UI$Control$get_element, + get_id: Sys$UI$Control$get_id, + set_id: Sys$UI$Control$set_id, + get_parent: Sys$UI$Control$get_parent, + set_parent: Sys$UI$Control$set_parent, + get_role: Sys$UI$Control$get_role, + get_visibilityMode: Sys$UI$Control$get_visibilityMode, + set_visibilityMode: Sys$UI$Control$set_visibilityMode, + get_visible: Sys$UI$Control$get_visible, + set_visible: Sys$UI$Control$set_visible, + addCssClass: Sys$UI$Control$addCssClass, + dispose: Sys$UI$Control$dispose, + onBubbleEvent: Sys$UI$Control$onBubbleEvent, + raiseBubbleEvent: Sys$UI$Control$raiseBubbleEvent, + _raiseBubbleEvent: Sys$UI$Control$_raiseBubbleEvent, + removeCssClass: Sys$UI$Control$removeCssClass, + toggleCssClass: Sys$UI$Control$toggleCssClass +} +Sys.UI.Control.registerClass('Sys.UI.Control', Sys.Component); +Sys.HistoryEventArgs = function Sys$HistoryEventArgs(state) { + /// <summary locid="M:J#Sys.HistoryEventArgs.#ctor" /> + /// <param name="state" type="Object"></param> + var e = Function._validateParams(arguments, [ + {name: "state", type: Object} + ]); + if (e) throw e; + Sys.HistoryEventArgs.initializeBase(this); + this._state = state; +} + function Sys$HistoryEventArgs$get_state() { + /// <value type="Object" locid="P:J#Sys.HistoryEventArgs.state"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._state; + } +Sys.HistoryEventArgs.prototype = { + get_state: Sys$HistoryEventArgs$get_state +} +Sys.HistoryEventArgs.registerClass('Sys.HistoryEventArgs', Sys.EventArgs); +Sys.Application._appLoadHandler = null; +Sys.Application._beginRequestHandler = null; +Sys.Application._clientId = null; +Sys.Application._currentEntry = ''; +Sys.Application._endRequestHandler = null; +Sys.Application._history = null; +Sys.Application._enableHistory = false; +Sys.Application._historyEnabledInScriptManager = false; +Sys.Application._historyFrame = null; +Sys.Application._historyInitialized = false; +Sys.Application._historyPointIsNew = false; +Sys.Application._ignoreTimer = false; +Sys.Application._initialState = null; +Sys.Application._state = {}; +Sys.Application._timerCookie = 0; +Sys.Application._timerHandler = null; +Sys.Application._uniqueId = null; +Sys._Application.prototype.get_stateString = function Sys$_Application$get_stateString() { + /// <summary locid="M:J#Sys._Application.get_stateString" /> + if (arguments.length !== 0) throw Error.parameterCount(); + var hash = null; + + if (Sys.Browser.agent === Sys.Browser.Firefox) { + var href = window.location.href; + var hashIndex = href.indexOf('#'); + if (hashIndex !== -1) { + hash = href.substring(hashIndex + 1); + } + else { + hash = ""; + } + return hash; + } + else { + hash = window.location.hash; + } + + if ((hash.length > 0) && (hash.charAt(0) === '#')) { + hash = hash.substring(1); + } + return hash; +}; +Sys._Application.prototype.get_enableHistory = function Sys$_Application$get_enableHistory() { + /// <summary locid="M:J#Sys._Application.get_enableHistory" /> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._enableHistory; +}; +Sys._Application.prototype.set_enableHistory = function Sys$_Application$set_enableHistory(value) { + if (this._initialized && !this._initializing) { + throw Error.invalidOperation(Sys.Res.historyCannotEnableHistory); + } + else if (this._historyEnabledInScriptManager && !value) { + throw Error.invalidOperation(Sys.Res.invalidHistorySettingCombination); + } + this._enableHistory = value; +}; +Sys._Application.prototype.add_navigate = function Sys$_Application$add_navigate(handler) { + /// <summary locid="E:J#Sys.Application.navigate" /> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "handler", type: Function} + ]); + if (e) throw e; + this.get_events().addHandler("navigate", handler); +}; +Sys._Application.prototype.remove_navigate = function Sys$_Application$remove_navigate(handler) { + /// <summary locid="M:J#Sys._Application.remove_navigate" /> + /// <param name="handler" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "handler", type: Function} + ]); + if (e) throw e; + this.get_events().removeHandler("navigate", handler); +}; +Sys._Application.prototype.addHistoryPoint = function Sys$_Application$addHistoryPoint(state, title) { + /// <summary locid="M:J#Sys.Application.addHistoryPoint" /> + /// <param name="state" type="Object"></param> + /// <param name="title" type="String" optional="true" mayBeNull="true"></param> + var e = Function._validateParams(arguments, [ + {name: "state", type: Object}, + {name: "title", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + if (!this._enableHistory) throw Error.invalidOperation(Sys.Res.historyCannotAddHistoryPointWithHistoryDisabled); + for (var n in state) { + var v = state[n]; + var t = typeof(v); + if ((v !== null) && ((t === 'object') || (t === 'function') || (t === 'undefined'))) { + throw Error.argument('state', Sys.Res.stateMustBeStringDictionary); + } + } + this._ensureHistory(); + var initialState = this._state; + for (var key in state) { + var value = state[key]; + if (value === null) { + if (typeof(initialState[key]) !== 'undefined') { + delete initialState[key]; + } + } + else { + initialState[key] = value; + } + } + var entry = this._serializeState(initialState); + this._historyPointIsNew = true; + this._setState(entry, title); + this._raiseNavigate(); +}; +Sys._Application.prototype.setServerId = function Sys$_Application$setServerId(clientId, uniqueId) { + /// <summary locid="M:J#Sys.Application.setServerId" /> + /// <param name="clientId" type="String"></param> + /// <param name="uniqueId" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "clientId", type: String}, + {name: "uniqueId", type: String} + ]); + if (e) throw e; + this._clientId = clientId; + this._uniqueId = uniqueId; +}; +Sys._Application.prototype.setServerState = function Sys$_Application$setServerState(value) { + /// <summary locid="M:J#Sys.Application.setServerState" /> + /// <param name="value" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "value", type: String} + ]); + if (e) throw e; + this._ensureHistory(); + this._state.__s = value; + this._updateHiddenField(value); +}; +Sys._Application.prototype._deserializeState = function Sys$_Application$_deserializeState(entry) { + var result = {}; + entry = entry || ''; + var serverSeparator = entry.indexOf('&&'); + if ((serverSeparator !== -1) && (serverSeparator + 2 < entry.length)) { + result.__s = entry.substr(serverSeparator + 2); + entry = entry.substr(0, serverSeparator); + } + var tokens = entry.split('&'); + for (var i = 0, l = tokens.length; i < l; i++) { + var token = tokens[i]; + var equal = token.indexOf('='); + if ((equal !== -1) && (equal + 1 < token.length)) { + var name = token.substr(0, equal); + var value = token.substr(equal + 1); + result[name] = decodeURIComponent(value); + } + } + return result; +}; +Sys._Application.prototype._enableHistoryInScriptManager = function Sys$_Application$_enableHistoryInScriptManager() { + this._enableHistory = true; + this._historyEnabledInScriptManager = true; +}; +Sys._Application.prototype._ensureHistory = function Sys$_Application$_ensureHistory() { + if (!this._historyInitialized && this._enableHistory) { + if ((Sys.Browser.agent === Sys.Browser.InternetExplorer) && (Sys.Browser.documentMode < 8)) { + this._historyFrame = document.getElementById('__historyFrame'); + if (!this._historyFrame) throw Error.invalidOperation(Sys.Res.historyMissingFrame); + this._ignoreIFrame = true; + } + this._timerHandler = Function.createDelegate(this, this._onIdle); + this._timerCookie = window.setTimeout(this._timerHandler, 100); + + try { + this._initialState = this._deserializeState(this.get_stateString()); + } catch(e) {} + + this._historyInitialized = true; + } +}; +Sys._Application.prototype._navigate = function Sys$_Application$_navigate(entry) { + this._ensureHistory(); + var state = this._deserializeState(entry); + + if (this._uniqueId) { + var oldServerEntry = this._state.__s || ''; + var newServerEntry = state.__s || ''; + if (newServerEntry !== oldServerEntry) { + this._updateHiddenField(newServerEntry); + __doPostBack(this._uniqueId, newServerEntry); + this._state = state; + return; + } + } + this._setState(entry); + this._state = state; + this._raiseNavigate(); +}; +Sys._Application.prototype._onIdle = function Sys$_Application$_onIdle() { + delete this._timerCookie; + + var entry = this.get_stateString(); + if (entry !== this._currentEntry) { + if (!this._ignoreTimer) { + this._historyPointIsNew = false; + this._navigate(entry); + } + } + else { + this._ignoreTimer = false; + } + this._timerCookie = window.setTimeout(this._timerHandler, 100); +}; +Sys._Application.prototype._onIFrameLoad = function Sys$_Application$_onIFrameLoad(entry) { + this._ensureHistory(); + if (!this._ignoreIFrame) { + this._historyPointIsNew = false; + this._navigate(entry); + } + this._ignoreIFrame = false; +}; +Sys._Application.prototype._onPageRequestManagerBeginRequest = function Sys$_Application$_onPageRequestManagerBeginRequest(sender, args) { + this._ignoreTimer = true; +}; +Sys._Application.prototype._onPageRequestManagerEndRequest = function Sys$_Application$_onPageRequestManagerEndRequest(sender, args) { + var dataItem = args.get_dataItems()[this._clientId]; + var eventTarget = document.getElementById("__EVENTTARGET"); + if (eventTarget && eventTarget.value === this._uniqueId) { + eventTarget.value = ''; + } + if (typeof(dataItem) !== 'undefined') { + this.setServerState(dataItem); + this._historyPointIsNew = true; + } + else { + this._ignoreTimer = false; + } + var entry = this._serializeState(this._state); + if (entry !== this._currentEntry) { + this._ignoreTimer = true; + this._setState(entry); + this._raiseNavigate(); + } +}; +Sys._Application.prototype._raiseNavigate = function Sys$_Application$_raiseNavigate() { + var h = this.get_events().getHandler("navigate"); + var stateClone = {}; + for (var key in this._state) { + if (key !== '__s') { + stateClone[key] = this._state[key]; + } + } + var args = new Sys.HistoryEventArgs(stateClone); + if (h) { + h(this, args); + } + var err; + try { + if ((Sys.Browser.agent === Sys.Browser.Firefox) && window.location.hash && + (!window.frameElement || window.top.location.hash)) { + window.history.go(0); + } + } + catch(err) { + } +}; +Sys._Application.prototype._serializeState = function Sys$_Application$_serializeState(state) { + var serialized = []; + for (var key in state) { + var value = state[key]; + if (key === '__s') { + var serverState = value; + } + else { + if (key.indexOf('=') !== -1) throw Error.argument('state', Sys.Res.stateFieldNameInvalid); + serialized[serialized.length] = key + '=' + encodeURIComponent(value); + } + } + return serialized.join('&') + (serverState ? '&&' + serverState : ''); +}; +Sys._Application.prototype._setState = function Sys$_Application$_setState(entry, title) { + if (this._enableHistory) { + entry = entry || ''; + if (entry !== this._currentEntry) { + if (window.theForm) { + var action = window.theForm.action; + var hashIndex = action.indexOf('#'); + window.theForm.action = ((hashIndex !== -1) ? action.substring(0, hashIndex) : action) + '#' + entry; + } + + if (this._historyFrame && this._historyPointIsNew) { + this._ignoreIFrame = true; + var frameDoc = this._historyFrame.contentWindow.document; + frameDoc.open("javascript:'<html></html>'"); + frameDoc.write("<html><head><title>" + (title || document.title) + + "</title><scri" + "pt type=\"text/javascript\">parent.Sys.Application._onIFrameLoad(" + + Sys.Serialization.JavaScriptSerializer.serialize(entry) + + ");</scri" + "pt></head><body></body></html>"); + frameDoc.close(); + } + this._ignoreTimer = false; + this._currentEntry = entry; + if (this._historyFrame || this._historyPointIsNew) { + var currentHash = this.get_stateString(); + if (entry !== currentHash) { + var loc = document.location; + if (loc.href.length - loc.hash.length + entry.length > 1024) { + throw Error.invalidOperation(Sys.Res.urlMustBeLessThan1024chars); + } + window.location.hash = entry; + this._currentEntry = this.get_stateString(); + if ((typeof(title) !== 'undefined') && (title !== null)) { + document.title = title; + } + } + } + this._historyPointIsNew = false; + } + } +}; +Sys._Application.prototype._updateHiddenField = function Sys$_Application$_updateHiddenField(value) { + if (this._clientId) { + var serverStateField = document.getElementById(this._clientId); + if (serverStateField) { + serverStateField.value = value; + } + } +}; + +if (!window.XMLHttpRequest) { + window.XMLHttpRequest = function window$XMLHttpRequest() { + var progIDs = [ 'Msxml2.XMLHTTP.3.0', 'Msxml2.XMLHTTP' ]; + for (var i = 0, l = progIDs.length; i < l; i++) { + try { + return new ActiveXObject(progIDs[i]); + } + catch (ex) { + } + } + return null; + } +} +Type.registerNamespace('Sys.Net'); + +Sys.Net.WebRequestExecutor = function Sys$Net$WebRequestExecutor() { + /// <summary locid="M:J#Sys.Net.WebRequestExecutor.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + this._webRequest = null; + this._resultObject = null; +} + function Sys$Net$WebRequestExecutor$get_webRequest() { + /// <value type="Sys.Net.WebRequest" locid="P:J#Sys.Net.WebRequestExecutor.webRequest"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._webRequest; + } + function Sys$Net$WebRequestExecutor$_set_webRequest(value) { + if (this.get_started()) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallOnceStarted, 'set_webRequest')); + } + this._webRequest = value; + } + function Sys$Net$WebRequestExecutor$get_started() { + /// <value type="Boolean" locid="P:J#Sys.Net.WebRequestExecutor.started"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$get_responseAvailable() { + /// <value type="Boolean" locid="P:J#Sys.Net.WebRequestExecutor.responseAvailable"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$get_timedOut() { + /// <value type="Boolean" locid="P:J#Sys.Net.WebRequestExecutor.timedOut"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$get_aborted() { + /// <value type="Boolean" locid="P:J#Sys.Net.WebRequestExecutor.aborted"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$get_responseData() { + /// <value type="String" locid="P:J#Sys.Net.WebRequestExecutor.responseData"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$get_statusCode() { + /// <value type="Number" locid="P:J#Sys.Net.WebRequestExecutor.statusCode"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$get_statusText() { + /// <value type="String" locid="P:J#Sys.Net.WebRequestExecutor.statusText"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$get_xml() { + /// <value locid="P:J#Sys.Net.WebRequestExecutor.xml"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$get_object() { + /// <value locid="P:J#Sys.Net.WebRequestExecutor.object"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._resultObject) { + this._resultObject = Sys.Serialization.JavaScriptSerializer.deserialize(this.get_responseData()); + } + return this._resultObject; + } + function Sys$Net$WebRequestExecutor$executeRequest() { + /// <summary locid="M:J#Sys.Net.WebRequestExecutor.executeRequest" /> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$abort() { + /// <summary locid="M:J#Sys.Net.WebRequestExecutor.abort" /> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$getResponseHeader(header) { + /// <summary locid="M:J#Sys.Net.WebRequestExecutor.getResponseHeader" /> + /// <param name="header" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "header", type: String} + ]); + if (e) throw e; + throw Error.notImplemented(); + } + function Sys$Net$WebRequestExecutor$getAllResponseHeaders() { + /// <summary locid="M:J#Sys.Net.WebRequestExecutor.getAllResponseHeaders" /> + if (arguments.length !== 0) throw Error.parameterCount(); + throw Error.notImplemented(); + } +Sys.Net.WebRequestExecutor.prototype = { + get_webRequest: Sys$Net$WebRequestExecutor$get_webRequest, + _set_webRequest: Sys$Net$WebRequestExecutor$_set_webRequest, + get_started: Sys$Net$WebRequestExecutor$get_started, + get_responseAvailable: Sys$Net$WebRequestExecutor$get_responseAvailable, + get_timedOut: Sys$Net$WebRequestExecutor$get_timedOut, + get_aborted: Sys$Net$WebRequestExecutor$get_aborted, + get_responseData: Sys$Net$WebRequestExecutor$get_responseData, + get_statusCode: Sys$Net$WebRequestExecutor$get_statusCode, + get_statusText: Sys$Net$WebRequestExecutor$get_statusText, + get_xml: Sys$Net$WebRequestExecutor$get_xml, + get_object: Sys$Net$WebRequestExecutor$get_object, + executeRequest: Sys$Net$WebRequestExecutor$executeRequest, + abort: Sys$Net$WebRequestExecutor$abort, + getResponseHeader: Sys$Net$WebRequestExecutor$getResponseHeader, + getAllResponseHeaders: Sys$Net$WebRequestExecutor$getAllResponseHeaders +} +Sys.Net.WebRequestExecutor.registerClass('Sys.Net.WebRequestExecutor'); + +Sys.Net.XMLDOM = function Sys$Net$XMLDOM(markup) { + /// <summary locid="M:J#Sys.Net.XMLDOM.#ctor" /> + /// <param name="markup" type="String"></param> + var e = Function._validateParams(arguments, [ + {name: "markup", type: String} + ]); + if (e) throw e; + if (!window.DOMParser) { + var progIDs = [ 'Msxml2.DOMDocument.3.0', 'Msxml2.DOMDocument' ]; + for (var i = 0, l = progIDs.length; i < l; i++) { + try { + var xmlDOM = new ActiveXObject(progIDs[i]); + xmlDOM.async = false; + xmlDOM.loadXML(markup); + xmlDOM.setProperty('SelectionLanguage', 'XPath'); + return xmlDOM; + } + catch (ex) { + } + } + } + else { + try { + var domParser = new window.DOMParser(); + return domParser.parseFromString(markup, 'text/xml'); + } + catch (ex) { + } + } + return null; +} +Sys.Net.XMLHttpExecutor = function Sys$Net$XMLHttpExecutor() { + /// <summary locid="M:J#Sys.Net.XMLHttpExecutor.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + Sys.Net.XMLHttpExecutor.initializeBase(this); + var _this = this; + this._xmlHttpRequest = null; + this._webRequest = null; + this._responseAvailable = false; + this._timedOut = false; + this._timer = null; + this._aborted = false; + this._started = false; + this._onReadyStateChange = (function () { + + if (_this._xmlHttpRequest.readyState === 4 ) { + try { + if (typeof(_this._xmlHttpRequest.status) === "undefined") { + return; + } + } + catch(ex) { + return; + } + + _this._clearTimer(); + _this._responseAvailable = true; + _this._webRequest.completed(Sys.EventArgs.Empty); + if (_this._xmlHttpRequest != null) { + _this._xmlHttpRequest.onreadystatechange = Function.emptyMethod; + _this._xmlHttpRequest = null; + } + } + }); + this._clearTimer = (function() { + if (_this._timer != null) { + window.clearTimeout(_this._timer); + _this._timer = null; + } + }); + this._onTimeout = (function() { + if (!_this._responseAvailable) { + _this._clearTimer(); + _this._timedOut = true; + _this._xmlHttpRequest.onreadystatechange = Function.emptyMethod; + _this._xmlHttpRequest.abort(); + _this._webRequest.completed(Sys.EventArgs.Empty); + _this._xmlHttpRequest = null; + } + }); +} + function Sys$Net$XMLHttpExecutor$get_timedOut() { + /// <value type="Boolean" locid="P:J#Sys.Net.XMLHttpExecutor.timedOut"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._timedOut; + } + function Sys$Net$XMLHttpExecutor$get_started() { + /// <value type="Boolean" locid="P:J#Sys.Net.XMLHttpExecutor.started"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._started; + } + function Sys$Net$XMLHttpExecutor$get_responseAvailable() { + /// <value type="Boolean" locid="P:J#Sys.Net.XMLHttpExecutor.responseAvailable"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._responseAvailable; + } + function Sys$Net$XMLHttpExecutor$get_aborted() { + /// <value type="Boolean" locid="P:J#Sys.Net.XMLHttpExecutor.aborted"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._aborted; + } + function Sys$Net$XMLHttpExecutor$executeRequest() { + /// <summary locid="M:J#Sys.Net.XMLHttpExecutor.executeRequest" /> + if (arguments.length !== 0) throw Error.parameterCount(); + this._webRequest = this.get_webRequest(); + if (this._started) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallOnceStarted, 'executeRequest')); + } + if (this._webRequest === null) { + throw Error.invalidOperation(Sys.Res.nullWebRequest); + } + var body = this._webRequest.get_body(); + var headers = this._webRequest.get_headers(); + this._xmlHttpRequest = new XMLHttpRequest(); + this._xmlHttpRequest.onreadystatechange = this._onReadyStateChange; + var verb = this._webRequest.get_httpVerb(); + this._xmlHttpRequest.open(verb, this._webRequest.getResolvedUrl(), true ); + this._xmlHttpRequest.setRequestHeader("X-Requested-With", "XMLHttpRequest"); + if (headers) { + for (var header in headers) { + var val = headers[header]; + if (typeof(val) !== "function") + this._xmlHttpRequest.setRequestHeader(header, val); + } + } + if (verb.toLowerCase() === "post") { + if ((headers === null) || !headers['Content-Type']) { + this._xmlHttpRequest.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded; charset=utf-8'); + } + if (!body) { + body = ""; + } + } + var timeout = this._webRequest.get_timeout(); + if (timeout > 0) { + this._timer = window.setTimeout(Function.createDelegate(this, this._onTimeout), timeout); + } + this._xmlHttpRequest.send(body); + this._started = true; + } + function Sys$Net$XMLHttpExecutor$getResponseHeader(header) { + /// <summary locid="M:J#Sys.Net.XMLHttpExecutor.getResponseHeader" /> + /// <param name="header" type="String"></param> + /// <returns type="String"></returns> + var e = Function._validateParams(arguments, [ + {name: "header", type: String} + ]); + if (e) throw e; + if (!this._responseAvailable) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallBeforeResponse, 'getResponseHeader')); + } + if (!this._xmlHttpRequest) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallOutsideHandler, 'getResponseHeader')); + } + var result; + try { + result = this._xmlHttpRequest.getResponseHeader(header); + } catch (e) { + } + if (!result) result = ""; + return result; + } + function Sys$Net$XMLHttpExecutor$getAllResponseHeaders() { + /// <summary locid="M:J#Sys.Net.XMLHttpExecutor.getAllResponseHeaders" /> + /// <returns type="String"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._responseAvailable) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallBeforeResponse, 'getAllResponseHeaders')); + } + if (!this._xmlHttpRequest) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallOutsideHandler, 'getAllResponseHeaders')); + } + return this._xmlHttpRequest.getAllResponseHeaders(); + } + function Sys$Net$XMLHttpExecutor$get_responseData() { + /// <value type="String" locid="P:J#Sys.Net.XMLHttpExecutor.responseData"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._responseAvailable) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallBeforeResponse, 'get_responseData')); + } + if (!this._xmlHttpRequest) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallOutsideHandler, 'get_responseData')); + } + return this._xmlHttpRequest.responseText; + } + function Sys$Net$XMLHttpExecutor$get_statusCode() { + /// <value type="Number" locid="P:J#Sys.Net.XMLHttpExecutor.statusCode"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._responseAvailable) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallBeforeResponse, 'get_statusCode')); + } + if (!this._xmlHttpRequest) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallOutsideHandler, 'get_statusCode')); + } + var result = 0; + try { + result = this._xmlHttpRequest.status; + } + catch(ex) { + } + return result; + } + function Sys$Net$XMLHttpExecutor$get_statusText() { + /// <value type="String" locid="P:J#Sys.Net.XMLHttpExecutor.statusText"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._responseAvailable) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallBeforeResponse, 'get_statusText')); + } + if (!this._xmlHttpRequest) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallOutsideHandler, 'get_statusText')); + } + return this._xmlHttpRequest.statusText; + } + function Sys$Net$XMLHttpExecutor$get_xml() { + /// <value locid="P:J#Sys.Net.XMLHttpExecutor.xml"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._responseAvailable) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallBeforeResponse, 'get_xml')); + } + if (!this._xmlHttpRequest) { + throw Error.invalidOperation(String.format(Sys.Res.cannotCallOutsideHandler, 'get_xml')); + } + var xml = this._xmlHttpRequest.responseXML; + if (!xml || !xml.documentElement) { + xml = Sys.Net.XMLDOM(this._xmlHttpRequest.responseText); + if (!xml || !xml.documentElement) + return null; + } + else if (navigator.userAgent.indexOf('MSIE') !== -1) { + xml.setProperty('SelectionLanguage', 'XPath'); + } + if (xml.documentElement.namespaceURI === "http://www.mozilla.org/newlayout/xml/parsererror.xml" && + xml.documentElement.tagName === "parsererror") { + return null; + } + + if (xml.documentElement.firstChild && xml.documentElement.firstChild.tagName === "parsererror") { + return null; + } + + return xml; + } + function Sys$Net$XMLHttpExecutor$abort() { + /// <summary locid="M:J#Sys.Net.XMLHttpExecutor.abort" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if (!this._started) { + throw Error.invalidOperation(Sys.Res.cannotAbortBeforeStart); + } + if (this._aborted || this._responseAvailable || this._timedOut) + return; + this._aborted = true; + this._clearTimer(); + if (this._xmlHttpRequest && !this._responseAvailable) { + this._xmlHttpRequest.onreadystatechange = Function.emptyMethod; + this._xmlHttpRequest.abort(); + + this._xmlHttpRequest = null; + this._webRequest.completed(Sys.EventArgs.Empty); + } + } +Sys.Net.XMLHttpExecutor.prototype = { + get_timedOut: Sys$Net$XMLHttpExecutor$get_timedOut, + get_started: Sys$Net$XMLHttpExecutor$get_started, + get_responseAvailable: Sys$Net$XMLHttpExecutor$get_responseAvailable, + get_aborted: Sys$Net$XMLHttpExecutor$get_aborted, + executeRequest: Sys$Net$XMLHttpExecutor$executeRequest, + getResponseHeader: Sys$Net$XMLHttpExecutor$getResponseHeader, + getAllResponseHeaders: Sys$Net$XMLHttpExecutor$getAllResponseHeaders, + get_responseData: Sys$Net$XMLHttpExecutor$get_responseData, + get_statusCode: Sys$Net$XMLHttpExecutor$get_statusCode, + get_statusText: Sys$Net$XMLHttpExecutor$get_statusText, + get_xml: Sys$Net$XMLHttpExecutor$get_xml, + abort: Sys$Net$XMLHttpExecutor$abort +} +Sys.Net.XMLHttpExecutor.registerClass('Sys.Net.XMLHttpExecutor', Sys.Net.WebRequestExecutor); + +Sys.Net._WebRequestManager = function Sys$Net$_WebRequestManager() { + /// <summary locid="P:J#Sys.Net.WebRequestManager.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + this._defaultTimeout = 0; + this._defaultExecutorType = "Sys.Net.XMLHttpExecutor"; +} + function Sys$Net$_WebRequestManager$add_invokingRequest(handler) { + /// <summary locid="E:J#Sys.Net.WebRequestManager.invokingRequest" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this._get_eventHandlerList().addHandler("invokingRequest", handler); + } + function Sys$Net$_WebRequestManager$remove_invokingRequest(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this._get_eventHandlerList().removeHandler("invokingRequest", handler); + } + function Sys$Net$_WebRequestManager$add_completedRequest(handler) { + /// <summary locid="E:J#Sys.Net.WebRequestManager.completedRequest" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this._get_eventHandlerList().addHandler("completedRequest", handler); + } + function Sys$Net$_WebRequestManager$remove_completedRequest(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this._get_eventHandlerList().removeHandler("completedRequest", handler); + } + function Sys$Net$_WebRequestManager$_get_eventHandlerList() { + if (!this._events) { + this._events = new Sys.EventHandlerList(); + } + return this._events; + } + function Sys$Net$_WebRequestManager$get_defaultTimeout() { + /// <value type="Number" locid="P:J#Sys.Net.WebRequestManager.defaultTimeout"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._defaultTimeout; + } + function Sys$Net$_WebRequestManager$set_defaultTimeout(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Number}]); + if (e) throw e; + if (value < 0) { + throw Error.argumentOutOfRange("value", value, Sys.Res.invalidTimeout); + } + this._defaultTimeout = value; + } + function Sys$Net$_WebRequestManager$get_defaultExecutorType() { + /// <value type="String" locid="P:J#Sys.Net.WebRequestManager.defaultExecutorType"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._defaultExecutorType; + } + function Sys$Net$_WebRequestManager$set_defaultExecutorType(value) { + var e = Function._validateParams(arguments, [{name: "value", type: String}]); + if (e) throw e; + this._defaultExecutorType = value; + } + function Sys$Net$_WebRequestManager$executeRequest(webRequest) { + /// <summary locid="M:J#Sys.Net.WebRequestManager.executeRequest" /> + /// <param name="webRequest" type="Sys.Net.WebRequest"></param> + var e = Function._validateParams(arguments, [ + {name: "webRequest", type: Sys.Net.WebRequest} + ]); + if (e) throw e; + var executor = webRequest.get_executor(); + if (!executor) { + var failed = false; + try { + var executorType = eval(this._defaultExecutorType); + executor = new executorType(); + } catch (e) { + failed = true; + } + if (failed || !Sys.Net.WebRequestExecutor.isInstanceOfType(executor) || !executor) { + throw Error.argument("defaultExecutorType", String.format(Sys.Res.invalidExecutorType, this._defaultExecutorType)); + } + webRequest.set_executor(executor); + } + if (executor.get_aborted()) { + return; + } + var evArgs = new Sys.Net.NetworkRequestEventArgs(webRequest); + var handler = this._get_eventHandlerList().getHandler("invokingRequest"); + if (handler) { + handler(this, evArgs); + } + if (!evArgs.get_cancel()) { + executor.executeRequest(); + } + } +Sys.Net._WebRequestManager.prototype = { + add_invokingRequest: Sys$Net$_WebRequestManager$add_invokingRequest, + remove_invokingRequest: Sys$Net$_WebRequestManager$remove_invokingRequest, + add_completedRequest: Sys$Net$_WebRequestManager$add_completedRequest, + remove_completedRequest: Sys$Net$_WebRequestManager$remove_completedRequest, + _get_eventHandlerList: Sys$Net$_WebRequestManager$_get_eventHandlerList, + get_defaultTimeout: Sys$Net$_WebRequestManager$get_defaultTimeout, + set_defaultTimeout: Sys$Net$_WebRequestManager$set_defaultTimeout, + get_defaultExecutorType: Sys$Net$_WebRequestManager$get_defaultExecutorType, + set_defaultExecutorType: Sys$Net$_WebRequestManager$set_defaultExecutorType, + executeRequest: Sys$Net$_WebRequestManager$executeRequest +} +Sys.Net._WebRequestManager.registerClass('Sys.Net._WebRequestManager'); +Sys.Net.WebRequestManager = new Sys.Net._WebRequestManager(); + +Sys.Net.NetworkRequestEventArgs = function Sys$Net$NetworkRequestEventArgs(webRequest) { + /// <summary locid="M:J#Sys.Net.NetworkRequestEventArgs.#ctor" /> + /// <param name="webRequest" type="Sys.Net.WebRequest"></param> + var e = Function._validateParams(arguments, [ + {name: "webRequest", type: Sys.Net.WebRequest} + ]); + if (e) throw e; + Sys.Net.NetworkRequestEventArgs.initializeBase(this); + this._webRequest = webRequest; +} + function Sys$Net$NetworkRequestEventArgs$get_webRequest() { + /// <value type="Sys.Net.WebRequest" locid="P:J#Sys.Net.NetworkRequestEventArgs.webRequest"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._webRequest; + } +Sys.Net.NetworkRequestEventArgs.prototype = { + get_webRequest: Sys$Net$NetworkRequestEventArgs$get_webRequest +} +Sys.Net.NetworkRequestEventArgs.registerClass('Sys.Net.NetworkRequestEventArgs', Sys.CancelEventArgs); + +Sys.Net.WebRequest = function Sys$Net$WebRequest() { + /// <summary locid="M:J#Sys.Net.WebRequest.#ctor" /> + if (arguments.length !== 0) throw Error.parameterCount(); + this._url = ""; + this._headers = { }; + this._body = null; + this._userContext = null; + this._httpVerb = null; + this._executor = null; + this._invokeCalled = false; + this._timeout = 0; +} + function Sys$Net$WebRequest$add_completed(handler) { + /// <summary locid="E:J#Sys.Net.WebRequest.completed" /> + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this._get_eventHandlerList().addHandler("completed", handler); + } + function Sys$Net$WebRequest$remove_completed(handler) { + var e = Function._validateParams(arguments, [{name: "handler", type: Function}]); + if (e) throw e; + this._get_eventHandlerList().removeHandler("completed", handler); + } + function Sys$Net$WebRequest$completed(eventArgs) { + /// <summary locid="M:J#Sys.Net.WebRequest.completed" /> + /// <param name="eventArgs" type="Sys.EventArgs"></param> + var e = Function._validateParams(arguments, [ + {name: "eventArgs", type: Sys.EventArgs} + ]); + if (e) throw e; + var handler = Sys.Net.WebRequestManager._get_eventHandlerList().getHandler("completedRequest"); + if (handler) { + handler(this._executor, eventArgs); + } + handler = this._get_eventHandlerList().getHandler("completed"); + if (handler) { + handler(this._executor, eventArgs); + } + } + function Sys$Net$WebRequest$_get_eventHandlerList() { + if (!this._events) { + this._events = new Sys.EventHandlerList(); + } + return this._events; + } + function Sys$Net$WebRequest$get_url() { + /// <value type="String" locid="P:J#Sys.Net.WebRequest.url"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._url; + } + function Sys$Net$WebRequest$set_url(value) { + var e = Function._validateParams(arguments, [{name: "value", type: String}]); + if (e) throw e; + this._url = value; + } + function Sys$Net$WebRequest$get_headers() { + /// <value locid="P:J#Sys.Net.WebRequest.headers"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._headers; + } + function Sys$Net$WebRequest$get_httpVerb() { + /// <value type="String" locid="P:J#Sys.Net.WebRequest.httpVerb"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this._httpVerb === null) { + if (this._body === null) { + return "GET"; + } + return "POST"; + } + return this._httpVerb; + } + function Sys$Net$WebRequest$set_httpVerb(value) { + var e = Function._validateParams(arguments, [{name: "value", type: String}]); + if (e) throw e; + if (value.length === 0) { + throw Error.argument('value', Sys.Res.invalidHttpVerb); + } + this._httpVerb = value; + } + function Sys$Net$WebRequest$get_body() { + /// <value mayBeNull="true" locid="P:J#Sys.Net.WebRequest.body"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._body; + } + function Sys$Net$WebRequest$set_body(value) { + var e = Function._validateParams(arguments, [{name: "value", mayBeNull: true}]); + if (e) throw e; + this._body = value; + } + function Sys$Net$WebRequest$get_userContext() { + /// <value mayBeNull="true" locid="P:J#Sys.Net.WebRequest.userContext"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._userContext; + } + function Sys$Net$WebRequest$set_userContext(value) { + var e = Function._validateParams(arguments, [{name: "value", mayBeNull: true}]); + if (e) throw e; + this._userContext = value; + } + function Sys$Net$WebRequest$get_executor() { + /// <value type="Sys.Net.WebRequestExecutor" locid="P:J#Sys.Net.WebRequest.executor"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._executor; + } + function Sys$Net$WebRequest$set_executor(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Sys.Net.WebRequestExecutor}]); + if (e) throw e; + if (this._executor !== null && this._executor.get_started()) { + throw Error.invalidOperation(Sys.Res.setExecutorAfterActive); + } + this._executor = value; + this._executor._set_webRequest(this); + } + function Sys$Net$WebRequest$get_timeout() { + /// <value type="Number" locid="P:J#Sys.Net.WebRequest.timeout"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this._timeout === 0) { + return Sys.Net.WebRequestManager.get_defaultTimeout(); + } + return this._timeout; + } + function Sys$Net$WebRequest$set_timeout(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Number}]); + if (e) throw e; + if (value < 0) { + throw Error.argumentOutOfRange("value", value, Sys.Res.invalidTimeout); + } + this._timeout = value; + } + function Sys$Net$WebRequest$getResolvedUrl() { + /// <summary locid="M:J#Sys.Net.WebRequest.getResolvedUrl" /> + /// <returns type="String"></returns> + if (arguments.length !== 0) throw Error.parameterCount(); + return Sys.Net.WebRequest._resolveUrl(this._url); + } + function Sys$Net$WebRequest$invoke() { + /// <summary locid="M:J#Sys.Net.WebRequest.invoke" /> + if (arguments.length !== 0) throw Error.parameterCount(); + if (this._invokeCalled) { + throw Error.invalidOperation(Sys.Res.invokeCalledTwice); + } + Sys.Net.WebRequestManager.executeRequest(this); + this._invokeCalled = true; + } +Sys.Net.WebRequest.prototype = { + add_completed: Sys$Net$WebRequest$add_completed, + remove_completed: Sys$Net$WebRequest$remove_completed, + completed: Sys$Net$WebRequest$completed, + _get_eventHandlerList: Sys$Net$WebRequest$_get_eventHandlerList, + get_url: Sys$Net$WebRequest$get_url, + set_url: Sys$Net$WebRequest$set_url, + get_headers: Sys$Net$WebRequest$get_headers, + get_httpVerb: Sys$Net$WebRequest$get_httpVerb, + set_httpVerb: Sys$Net$WebRequest$set_httpVerb, + get_body: Sys$Net$WebRequest$get_body, + set_body: Sys$Net$WebRequest$set_body, + get_userContext: Sys$Net$WebRequest$get_userContext, + set_userContext: Sys$Net$WebRequest$set_userContext, + get_executor: Sys$Net$WebRequest$get_executor, + set_executor: Sys$Net$WebRequest$set_executor, + get_timeout: Sys$Net$WebRequest$get_timeout, + set_timeout: Sys$Net$WebRequest$set_timeout, + getResolvedUrl: Sys$Net$WebRequest$getResolvedUrl, + invoke: Sys$Net$WebRequest$invoke +} +Sys.Net.WebRequest._resolveUrl = function Sys$Net$WebRequest$_resolveUrl(url, baseUrl) { + if (url && url.indexOf('://') !== -1) { + return url; + } + if (!baseUrl || baseUrl.length === 0) { + var baseElement = document.getElementsByTagName('base')[0]; + if (baseElement && baseElement.href && baseElement.href.length > 0) { + baseUrl = baseElement.href; + } + else { + baseUrl = document.URL; + } + } + var qsStart = baseUrl.indexOf('?'); + if (qsStart !== -1) { + baseUrl = baseUrl.substr(0, qsStart); + } + qsStart = baseUrl.indexOf('#'); + if (qsStart !== -1) { + baseUrl = baseUrl.substr(0, qsStart); + } + baseUrl = baseUrl.substr(0, baseUrl.lastIndexOf('/') + 1); + if (!url || url.length === 0) { + return baseUrl; + } + if (url.charAt(0) === '/') { + var slashslash = baseUrl.indexOf('://'); + if (slashslash === -1) { + throw Error.argument("baseUrl", Sys.Res.badBaseUrl1); + } + var nextSlash = baseUrl.indexOf('/', slashslash + 3); + if (nextSlash === -1) { + throw Error.argument("baseUrl", Sys.Res.badBaseUrl2); + } + return baseUrl.substr(0, nextSlash) + url; + } + else { + var lastSlash = baseUrl.lastIndexOf('/'); + if (lastSlash === -1) { + throw Error.argument("baseUrl", Sys.Res.badBaseUrl3); + } + return baseUrl.substr(0, lastSlash+1) + url; + } +} +Sys.Net.WebRequest._createQueryString = function Sys$Net$WebRequest$_createQueryString(queryString, encodeMethod, addParams) { + encodeMethod = encodeMethod || encodeURIComponent; + var i = 0, obj, val, arg, sb = new Sys.StringBuilder(); + if (queryString) { + for (arg in queryString) { + obj = queryString[arg]; + if (typeof(obj) === "function") continue; + val = Sys.Serialization.JavaScriptSerializer.serialize(obj); + if (i++) { + sb.append('&'); + } + sb.append(arg); + sb.append('='); + sb.append(encodeMethod(val)); + } + } + if (addParams) { + if (i) { + sb.append('&'); + } + sb.append(addParams); + } + return sb.toString(); +} +Sys.Net.WebRequest._createUrl = function Sys$Net$WebRequest$_createUrl(url, queryString, addParams) { + if (!queryString && !addParams) { + return url; + } + var qs = Sys.Net.WebRequest._createQueryString(queryString, null, addParams); + return qs.length + ? url + ((url && url.indexOf('?') >= 0) ? "&" : "?") + qs + : url; +} +Sys.Net.WebRequest.registerClass('Sys.Net.WebRequest'); + +Sys._ScriptLoaderTask = function Sys$_ScriptLoaderTask(scriptElement, completedCallback) { + /// <summary locid="M:J#Sys._ScriptLoaderTask.#ctor" /> + /// <param name="scriptElement" domElement="true"></param> + /// <param name="completedCallback" type="Function"></param> + var e = Function._validateParams(arguments, [ + {name: "scriptElement", domElement: true}, + {name: "completedCallback", type: Function} + ]); + if (e) throw e; + this._scriptElement = scriptElement; + this._completedCallback = completedCallback; +} + function Sys$_ScriptLoaderTask$get_scriptElement() { + /// <value domElement="true" locid="P:J#Sys._ScriptLoaderTask.scriptElement"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._scriptElement; + } + function Sys$_ScriptLoaderTask$dispose() { + if(this._disposed) { + return; + } + this._disposed = true; + this._removeScriptElementHandlers(); + Sys._ScriptLoaderTask._clearScript(this._scriptElement); + this._scriptElement = null; + } + function Sys$_ScriptLoaderTask$execute() { + /// <summary locid="M:J#Sys._ScriptLoaderTask.execute" /> + if (arguments.length !== 0) throw Error.parameterCount(); + this._addScriptElementHandlers(); + var headElements = document.getElementsByTagName('head'); + if (headElements.length === 0) { + throw new Error.invalidOperation(Sys.Res.scriptLoadFailedNoHead); + } + else { + headElements[0].appendChild(this._scriptElement); + } + } + function Sys$_ScriptLoaderTask$_addScriptElementHandlers() { + this._scriptLoadDelegate = Function.createDelegate(this, this._scriptLoadHandler); + + if (Sys.Browser.agent !== Sys.Browser.InternetExplorer) { + this._scriptElement.readyState = 'loaded'; + $addHandler(this._scriptElement, 'load', this._scriptLoadDelegate); + } + else { + $addHandler(this._scriptElement, 'readystatechange', this._scriptLoadDelegate); + } + if (this._scriptElement.addEventListener) { + this._scriptErrorDelegate = Function.createDelegate(this, this._scriptErrorHandler); + this._scriptElement.addEventListener('error', this._scriptErrorDelegate, false); + } + } + function Sys$_ScriptLoaderTask$_removeScriptElementHandlers() { + if(this._scriptLoadDelegate) { + var scriptElement = this.get_scriptElement(); + if (Sys.Browser.agent !== Sys.Browser.InternetExplorer) { + $removeHandler(scriptElement, 'load', this._scriptLoadDelegate); + } + else { + $removeHandler(scriptElement, 'readystatechange', this._scriptLoadDelegate); + } + if (this._scriptErrorDelegate) { + this._scriptElement.removeEventListener('error', this._scriptErrorDelegate, false); + this._scriptErrorDelegate = null; + } + this._scriptLoadDelegate = null; + } + } + function Sys$_ScriptLoaderTask$_scriptErrorHandler() { + if(this._disposed) { + return; + } + + this._completedCallback(this.get_scriptElement(), false); + } + function Sys$_ScriptLoaderTask$_scriptLoadHandler() { + if(this._disposed) { + return; + } + var scriptElement = this.get_scriptElement(); + if ((scriptElement.readyState !== 'loaded') && + (scriptElement.readyState !== 'complete')) { + return; + } + + this._completedCallback(scriptElement, true); + } +Sys._ScriptLoaderTask.prototype = { + get_scriptElement: Sys$_ScriptLoaderTask$get_scriptElement, + dispose: Sys$_ScriptLoaderTask$dispose, + execute: Sys$_ScriptLoaderTask$execute, + _addScriptElementHandlers: Sys$_ScriptLoaderTask$_addScriptElementHandlers, + _removeScriptElementHandlers: Sys$_ScriptLoaderTask$_removeScriptElementHandlers, + _scriptErrorHandler: Sys$_ScriptLoaderTask$_scriptErrorHandler, + _scriptLoadHandler: Sys$_ScriptLoaderTask$_scriptLoadHandler +} +Sys._ScriptLoaderTask.registerClass("Sys._ScriptLoaderTask", null, Sys.IDisposable); +Sys._ScriptLoaderTask._clearScript = function Sys$_ScriptLoaderTask$_clearScript(scriptElement) { + if (!Sys.Debug.isDebug) { + scriptElement.parentNode.removeChild(scriptElement); + } +} +Type.registerNamespace('Sys.Net'); + +Sys.Net.WebServiceProxy = function Sys$Net$WebServiceProxy() { +} + function Sys$Net$WebServiceProxy$get_timeout() { + /// <value type="Number" locid="P:J#Sys.Net.WebServiceProxy.timeout"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._timeout || 0; + } + function Sys$Net$WebServiceProxy$set_timeout(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Number}]); + if (e) throw e; + if (value < 0) { throw Error.argumentOutOfRange('value', value, Sys.Res.invalidTimeout); } + this._timeout = value; + } + function Sys$Net$WebServiceProxy$get_defaultUserContext() { + /// <value mayBeNull="true" locid="P:J#Sys.Net.WebServiceProxy.defaultUserContext"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return (typeof(this._userContext) === "undefined") ? null : this._userContext; + } + function Sys$Net$WebServiceProxy$set_defaultUserContext(value) { + var e = Function._validateParams(arguments, [{name: "value", mayBeNull: true}]); + if (e) throw e; + this._userContext = value; + } + function Sys$Net$WebServiceProxy$get_defaultSucceededCallback() { + /// <value type="Function" mayBeNull="true" locid="P:J#Sys.Net.WebServiceProxy.defaultSucceededCallback"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._succeeded || null; + } + function Sys$Net$WebServiceProxy$set_defaultSucceededCallback(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Function, mayBeNull: true}]); + if (e) throw e; + this._succeeded = value; + } + function Sys$Net$WebServiceProxy$get_defaultFailedCallback() { + /// <value type="Function" mayBeNull="true" locid="P:J#Sys.Net.WebServiceProxy.defaultFailedCallback"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._failed || null; + } + function Sys$Net$WebServiceProxy$set_defaultFailedCallback(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Function, mayBeNull: true}]); + if (e) throw e; + this._failed = value; + } + function Sys$Net$WebServiceProxy$get_enableJsonp() { + /// <value type="Boolean" locid="P:J#Sys.Net.WebServiceProxy.enableJsonp"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return !!this._jsonp; + } + function Sys$Net$WebServiceProxy$set_enableJsonp(value) { + var e = Function._validateParams(arguments, [{name: "value", type: Boolean}]); + if (e) throw e; + this._jsonp = value; + } + function Sys$Net$WebServiceProxy$get_path() { + /// <value type="String" locid="P:J#Sys.Net.WebServiceProxy.path"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._path || null; + } + function Sys$Net$WebServiceProxy$set_path(value) { + var e = Function._validateParams(arguments, [{name: "value", type: String}]); + if (e) throw e; + this._path = value; + } + function Sys$Net$WebServiceProxy$get_jsonpCallbackParameter() { + /// <value type="String" locid="P:J#Sys.Net.WebServiceProxy.jsonpCallbackParameter"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._callbackParameter || "callback"; + } + function Sys$Net$WebServiceProxy$set_jsonpCallbackParameter(value) { + var e = Function._validateParams(arguments, [{name: "value", type: String}]); + if (e) throw e; + this._callbackParameter = value; + } + function Sys$Net$WebServiceProxy$_invoke(servicePath, methodName, useGet, params, onSuccess, onFailure, userContext) { + /// <summary locid="M:J#Sys.Net.WebServiceProxy._invoke" /> + /// <param name="servicePath" type="String"></param> + /// <param name="methodName" type="String"></param> + /// <param name="useGet" type="Boolean"></param> + /// <param name="params"></param> + /// <param name="onSuccess" type="Function" mayBeNull="true" optional="true"></param> + /// <param name="onFailure" type="Function" mayBeNull="true" optional="true"></param> + /// <param name="userContext" mayBeNull="true" optional="true"></param> + /// <returns type="Sys.Net.WebRequest" mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "servicePath", type: String}, + {name: "methodName", type: String}, + {name: "useGet", type: Boolean}, + {name: "params"}, + {name: "onSuccess", type: Function, mayBeNull: true, optional: true}, + {name: "onFailure", type: Function, mayBeNull: true, optional: true}, + {name: "userContext", mayBeNull: true, optional: true} + ]); + if (e) throw e; + onSuccess = onSuccess || this.get_defaultSucceededCallback(); + onFailure = onFailure || this.get_defaultFailedCallback(); + if (userContext === null || typeof userContext === 'undefined') userContext = this.get_defaultUserContext(); + return Sys.Net.WebServiceProxy.invoke(servicePath, methodName, useGet, params, onSuccess, onFailure, userContext, this.get_timeout(), this.get_enableJsonp(), this.get_jsonpCallbackParameter()); + } +Sys.Net.WebServiceProxy.prototype = { + get_timeout: Sys$Net$WebServiceProxy$get_timeout, + set_timeout: Sys$Net$WebServiceProxy$set_timeout, + get_defaultUserContext: Sys$Net$WebServiceProxy$get_defaultUserContext, + set_defaultUserContext: Sys$Net$WebServiceProxy$set_defaultUserContext, + get_defaultSucceededCallback: Sys$Net$WebServiceProxy$get_defaultSucceededCallback, + set_defaultSucceededCallback: Sys$Net$WebServiceProxy$set_defaultSucceededCallback, + get_defaultFailedCallback: Sys$Net$WebServiceProxy$get_defaultFailedCallback, + set_defaultFailedCallback: Sys$Net$WebServiceProxy$set_defaultFailedCallback, + get_enableJsonp: Sys$Net$WebServiceProxy$get_enableJsonp, + set_enableJsonp: Sys$Net$WebServiceProxy$set_enableJsonp, + get_path: Sys$Net$WebServiceProxy$get_path, + set_path: Sys$Net$WebServiceProxy$set_path, + get_jsonpCallbackParameter: Sys$Net$WebServiceProxy$get_jsonpCallbackParameter, + set_jsonpCallbackParameter: Sys$Net$WebServiceProxy$set_jsonpCallbackParameter, + _invoke: Sys$Net$WebServiceProxy$_invoke +} +Sys.Net.WebServiceProxy.registerClass('Sys.Net.WebServiceProxy'); +Sys.Net.WebServiceProxy.invoke = function Sys$Net$WebServiceProxy$invoke(servicePath, methodName, useGet, params, onSuccess, onFailure, userContext, timeout, enableJsonp, jsonpCallbackParameter) { + /// <summary locid="M:J#Sys.Net.WebServiceProxy.invoke" /> + /// <param name="servicePath" type="String"></param> + /// <param name="methodName" type="String" mayBeNull="true" optional="true"></param> + /// <param name="useGet" type="Boolean" optional="true"></param> + /// <param name="params" mayBeNull="true" optional="true"></param> + /// <param name="onSuccess" type="Function" mayBeNull="true" optional="true"></param> + /// <param name="onFailure" type="Function" mayBeNull="true" optional="true"></param> + /// <param name="userContext" mayBeNull="true" optional="true"></param> + /// <param name="timeout" type="Number" optional="true"></param> + /// <param name="enableJsonp" type="Boolean" optional="true" mayBeNull="true"></param> + /// <param name="jsonpCallbackParameter" type="String" optional="true" mayBeNull="true"></param> + /// <returns type="Sys.Net.WebRequest" mayBeNull="true"></returns> + var e = Function._validateParams(arguments, [ + {name: "servicePath", type: String}, + {name: "methodName", type: String, mayBeNull: true, optional: true}, + {name: "useGet", type: Boolean, optional: true}, + {name: "params", mayBeNull: true, optional: true}, + {name: "onSuccess", type: Function, mayBeNull: true, optional: true}, + {name: "onFailure", type: Function, mayBeNull: true, optional: true}, + {name: "userContext", mayBeNull: true, optional: true}, + {name: "timeout", type: Number, optional: true}, + {name: "enableJsonp", type: Boolean, mayBeNull: true, optional: true}, + {name: "jsonpCallbackParameter", type: String, mayBeNull: true, optional: true} + ]); + if (e) throw e; + var schemeHost = (enableJsonp !== false) ? Sys.Net.WebServiceProxy._xdomain.exec(servicePath) : null, + tempCallback, jsonp = schemeHost && (schemeHost.length === 3) && + ((schemeHost[1] !== location.protocol) || (schemeHost[2] !== location.host)); + useGet = jsonp || useGet; + if (jsonp) { + jsonpCallbackParameter = jsonpCallbackParameter || "callback"; + tempCallback = "_jsonp" + Sys._jsonp++; + } + if (!params) params = {}; + var urlParams = params; + if (!useGet || !urlParams) urlParams = {}; + var script, error, timeoutcookie = null, loader, body = null, + url = Sys.Net.WebRequest._createUrl(methodName + ? (servicePath+"/"+encodeURIComponent(methodName)) + : servicePath, urlParams, jsonp ? (jsonpCallbackParameter + "=Sys." + tempCallback) : null); + if (jsonp) { + script = document.createElement("script"); + script.src = url; + loader = new Sys._ScriptLoaderTask(script, function(script, loaded) { + if (!loaded || tempCallback) { + jsonpComplete({ Message: String.format(Sys.Res.webServiceFailedNoMsg, methodName) }, -1); + } + }); + function jsonpComplete(data, statusCode) { + if (timeoutcookie !== null) { + window.clearTimeout(timeoutcookie); + timeoutcookie = null; + } + loader.dispose(); + delete Sys[tempCallback]; + tempCallback = null; + if ((typeof(statusCode) !== "undefined") && (statusCode !== 200)) { + if (onFailure) { + error = new Sys.Net.WebServiceError(false, + data.Message || String.format(Sys.Res.webServiceFailedNoMsg, methodName), + data.StackTrace || null, + data.ExceptionType || null, + data); + error._statusCode = statusCode; + onFailure(error, userContext, methodName); + } + else { + if (data.StackTrace && data.Message) { + error = data.StackTrace + "-- " + data.Message; + } + else { + error = data.StackTrace || data.Message; + } + error = String.format(error ? Sys.Res.webServiceFailed : Sys.Res.webServiceFailedNoMsg, methodName, error); + throw Sys.Net.WebServiceProxy._createFailedError(methodName, String.format(Sys.Res.webServiceFailed, methodName, error)); + } + } + else if (onSuccess) { + onSuccess(data, userContext, methodName); + } + } + Sys[tempCallback] = jsonpComplete; + loader.execute(); + return null; + } + var request = new Sys.Net.WebRequest(); + request.set_url(url); + request.get_headers()['Content-Type'] = 'application/json; charset=utf-8'; + if (!useGet) { + body = Sys.Serialization.JavaScriptSerializer.serialize(params); + if (body === "{}") body = ""; + } + request.set_body(body); + request.add_completed(onComplete); + if (timeout && timeout > 0) request.set_timeout(timeout); + request.invoke(); + + function onComplete(response, eventArgs) { + if (response.get_responseAvailable()) { + var statusCode = response.get_statusCode(); + var result = null; + + try { + var contentType = response.getResponseHeader("Content-Type"); + if (contentType.startsWith("application/json")) { + result = response.get_object(); + } + else if (contentType.startsWith("text/xml")) { + result = response.get_xml(); + } + else { + result = response.get_responseData(); + } + } catch (ex) { + } + var error = response.getResponseHeader("jsonerror"); + var errorObj = (error === "true"); + if (errorObj) { + if (result) { + result = new Sys.Net.WebServiceError(false, result.Message, result.StackTrace, result.ExceptionType, result); + } + } + else if (contentType.startsWith("application/json")) { + result = (!result || (typeof(result.d) === "undefined")) ? result : result.d; + } + if (((statusCode < 200) || (statusCode >= 300)) || errorObj) { + if (onFailure) { + if (!result || !errorObj) { + result = new Sys.Net.WebServiceError(false , String.format(Sys.Res.webServiceFailedNoMsg, methodName)); + } + result._statusCode = statusCode; + onFailure(result, userContext, methodName); + } + else { + if (result && errorObj) { + error = result.get_exceptionType() + "-- " + result.get_message(); + } + else { + error = response.get_responseData(); + } + throw Sys.Net.WebServiceProxy._createFailedError(methodName, String.format(Sys.Res.webServiceFailed, methodName, error)); + } + } + else if (onSuccess) { + onSuccess(result, userContext, methodName); + } + } + else { + var msg; + if (response.get_timedOut()) { + msg = String.format(Sys.Res.webServiceTimedOut, methodName); + } + else { + msg = String.format(Sys.Res.webServiceFailedNoMsg, methodName) + } + if (onFailure) { + onFailure(new Sys.Net.WebServiceError(response.get_timedOut(), msg, "", ""), userContext, methodName); + } + else { + throw Sys.Net.WebServiceProxy._createFailedError(methodName, msg); + } + } + } + return request; +} +Sys.Net.WebServiceProxy._createFailedError = function Sys$Net$WebServiceProxy$_createFailedError(methodName, errorMessage) { + var displayMessage = "Sys.Net.WebServiceFailedException: " + errorMessage; + var e = Error.create(displayMessage, { 'name': 'Sys.Net.WebServiceFailedException', 'methodName': methodName }); + e.popStackFrame(); + return e; +} +Sys.Net.WebServiceProxy._defaultFailedCallback = function Sys$Net$WebServiceProxy$_defaultFailedCallback(err, methodName) { + var error = err.get_exceptionType() + "-- " + err.get_message(); + throw Sys.Net.WebServiceProxy._createFailedError(methodName, String.format(Sys.Res.webServiceFailed, methodName, error)); +} +Sys.Net.WebServiceProxy._generateTypedConstructor = function Sys$Net$WebServiceProxy$_generateTypedConstructor(type) { + return function(properties) { + if (properties) { + for (var name in properties) { + this[name] = properties[name]; + } + } + this.__type = type; + } +} +Sys._jsonp = 0; +Sys.Net.WebServiceProxy._xdomain = /^\s*([a-zA-Z0-9\+\-\.]+\:)\/\/([^?#\/]+)/; + +Sys.Net.WebServiceError = function Sys$Net$WebServiceError(timedOut, message, stackTrace, exceptionType, errorObject) { + /// <summary locid="M:J#Sys.Net.WebServiceError.#ctor" /> + /// <param name="timedOut" type="Boolean"></param> + /// <param name="message" type="String" mayBeNull="true"></param> + /// <param name="stackTrace" type="String" mayBeNull="true" optional="true"></param> + /// <param name="exceptionType" type="String" mayBeNull="true" optional="true"></param> + /// <param name="errorObject" type="Object" mayBeNull="true" optional="true"></param> + var e = Function._validateParams(arguments, [ + {name: "timedOut", type: Boolean}, + {name: "message", type: String, mayBeNull: true}, + {name: "stackTrace", type: String, mayBeNull: true, optional: true}, + {name: "exceptionType", type: String, mayBeNull: true, optional: true}, + {name: "errorObject", type: Object, mayBeNull: true, optional: true} + ]); + if (e) throw e; + this._timedOut = timedOut; + this._message = message; + this._stackTrace = stackTrace; + this._exceptionType = exceptionType; + this._errorObject = errorObject; + this._statusCode = -1; +} + function Sys$Net$WebServiceError$get_timedOut() { + /// <value type="Boolean" locid="P:J#Sys.Net.WebServiceError.timedOut"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._timedOut; + } + function Sys$Net$WebServiceError$get_statusCode() { + /// <value type="Number" locid="P:J#Sys.Net.WebServiceError.statusCode"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._statusCode; + } + function Sys$Net$WebServiceError$get_message() { + /// <value type="String" locid="P:J#Sys.Net.WebServiceError.message"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._message; + } + function Sys$Net$WebServiceError$get_stackTrace() { + /// <value type="String" locid="P:J#Sys.Net.WebServiceError.stackTrace"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._stackTrace || ""; + } + function Sys$Net$WebServiceError$get_exceptionType() { + /// <value type="String" locid="P:J#Sys.Net.WebServiceError.exceptionType"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._exceptionType || ""; + } + function Sys$Net$WebServiceError$get_errorObject() { + /// <value type="Object" locid="P:J#Sys.Net.WebServiceError.errorObject"></value> + if (arguments.length !== 0) throw Error.parameterCount(); + return this._errorObject || null; + } +Sys.Net.WebServiceError.prototype = { + get_timedOut: Sys$Net$WebServiceError$get_timedOut, + get_statusCode: Sys$Net$WebServiceError$get_statusCode, + get_message: Sys$Net$WebServiceError$get_message, + get_stackTrace: Sys$Net$WebServiceError$get_stackTrace, + get_exceptionType: Sys$Net$WebServiceError$get_exceptionType, + get_errorObject: Sys$Net$WebServiceError$get_errorObject +} +Sys.Net.WebServiceError.registerClass('Sys.Net.WebServiceError'); + + +Type.registerNamespace('Sys'); + +Sys.Res={ +'urlMustBeLessThan1024chars':'The history state must be small enough to not make the url larger than 1024 characters.', +'argumentTypeName':'Value is not the name of an existing type.', +'cantBeCalledAfterDispose':'Can\'t be called after dispose.', +'componentCantSetIdAfterAddedToApp':'The id property of a component can\'t be set after it\'s been added to the Application object.', +'behaviorDuplicateName':'A behavior with name \'{0}\' already exists or it is the name of an existing property on the target element.', +'notATypeName':'Value is not a valid type name.', +'elementNotFound':'An element with id \'{0}\' could not be found.', +'stateMustBeStringDictionary':'The state object can only have null and string fields.', +'boolTrueOrFalse':'Value must be \'true\' or \'false\'.', +'scriptLoadFailedNoHead':'ScriptLoader requires pages to contain a <head> element.', +'stringFormatInvalid':'The format string is invalid.', +'referenceNotFound':'Component \'{0}\' was not found.', +'enumReservedName':'\'{0}\' is a reserved name that can\'t be used as an enum value name.', +'circularParentChain':'The chain of control parents can\'t have circular references.', +'namespaceContainsNonObject':'Object {0} already exists and is not an object.', +'undefinedEvent':'\'{0}\' is not an event.', +'propertyUndefined':'\'{0}\' is not a property or an existing field.', +'observableConflict':'Object already contains a member with the name \'{0}\'.', +'historyCannotEnableHistory':'Cannot set enableHistory after initialization.', +'eventHandlerInvalid':'Handler was not added through the Sys.UI.DomEvent.addHandler method.', +'scriptLoadFailedDebug':'The script \'{0}\' failed to load. Check for:\r\n Inaccessible path.\r\n Script errors. (IE) Enable \'Display a notification about every script error\' under advanced settings.', +'propertyNotWritable':'\'{0}\' is not a writable property.', +'enumInvalidValueName':'\'{0}\' is not a valid name for an enum value.', +'controlAlreadyDefined':'A control is already associated with the element.', +'addHandlerCantBeUsedForError':'Can\'t add a handler for the error event using this method. Please set the window.onerror property instead.', +'cantAddNonFunctionhandler':'Can\'t add a handler that is not a function.', +'invalidNameSpace':'Value is not a valid namespace identifier.', +'notAnInterface':'Value is not a valid interface.', +'eventHandlerNotFunction':'Handler must be a function.', +'propertyNotAnArray':'\'{0}\' is not an Array property.', +'namespaceContainsClass':'Object {0} already exists as a class, enum, or interface.', +'typeRegisteredTwice':'Type {0} has already been registered. The type may be defined multiple times or the script file that defines it may have already been loaded. A possible cause is a change of settings during a partial update.', +'cantSetNameAfterInit':'The name property can\'t be set on this object after initialization.', +'historyMissingFrame':'For the history feature to work in IE, the page must have an iFrame element with id \'__historyFrame\' pointed to a page that gets its title from the \'title\' query string parameter and calls Sys.Application._onIFrameLoad() on the parent window. This can be done by setting EnableHistory to true on ScriptManager.', +'appDuplicateComponent':'Two components with the same id \'{0}\' can\'t be added to the application.', +'historyCannotAddHistoryPointWithHistoryDisabled':'A history point can only be added if enableHistory is set to true.', +'baseNotAClass':'Value is not a class.', +'expectedElementOrId':'Value must be a DOM element or DOM element Id.', +'methodNotFound':'No method found with name \'{0}\'.', +'arrayParseBadFormat':'Value must be a valid string representation for an array. It must start with a \'[\' and end with a \']\'.', +'stateFieldNameInvalid':'State field names must not contain any \'=\' characters.', +'cantSetId':'The id property can\'t be set on this object.', +'stringFormatBraceMismatch':'The format string contains an unmatched opening or closing brace.', +'enumValueNotInteger':'An enumeration definition can only contain integer values.', +'propertyNullOrUndefined':'Cannot set the properties of \'{0}\' because it returned a null value.', +'argumentDomNode':'Value must be a DOM element or a text node.', +'componentCantSetIdTwice':'The id property of a component can\'t be set more than once.', +'createComponentOnDom':'Value must be null for Components that are not Controls or Behaviors.', +'createNotComponent':'{0} does not derive from Sys.Component.', +'createNoDom':'Value must not be null for Controls and Behaviors.', +'cantAddWithoutId':'Can\'t add a component that doesn\'t have an id.', +'notObservable':'Instances of type \'{0}\' cannot be observed.', +'badTypeName':'Value is not the name of the type being registered or the name is a reserved word.', +'argumentInteger':'Value must be an integer.', +'invokeCalledTwice':'Cannot call invoke more than once.', +'webServiceFailed':'The server method \'{0}\' failed with the following error: {1}', +'argumentType':'Object cannot be converted to the required type.', +'argumentNull':'Value cannot be null.', +'scriptAlreadyLoaded':'The script \'{0}\' has been referenced multiple times. If referencing Microsoft AJAX scripts explicitly, set the MicrosoftAjaxMode property of the ScriptManager to Explicit.', +'scriptDependencyNotFound':'The script \'{0}\' failed to load because it is dependent on script \'{1}\'.', +'formatBadFormatSpecifier':'Format specifier was invalid.', +'requiredScriptReferenceNotIncluded':'\'{0}\' requires that you have included a script reference to \'{1}\'.', +'webServiceFailedNoMsg':'The server method \'{0}\' failed.', +'argumentDomElement':'Value must be a DOM element.', +'invalidExecutorType':'Could not create a valid Sys.Net.WebRequestExecutor from: {0}.', +'cannotCallBeforeResponse':'Cannot call {0} when responseAvailable is false.', +'actualValue':'Actual value was {0}.', +'enumInvalidValue':'\'{0}\' is not a valid value for enum {1}.', +'scriptLoadFailed':'The script \'{0}\' could not be loaded.', +'parameterCount':'Parameter count mismatch.', +'cannotDeserializeEmptyString':'Cannot deserialize empty string.', +'formatInvalidString':'Input string was not in a correct format.', +'invalidTimeout':'Value must be greater than or equal to zero.', +'cannotAbortBeforeStart':'Cannot abort when executor has not started.', +'argument':'Value does not fall within the expected range.', +'cannotDeserializeInvalidJson':'Cannot deserialize. The data does not correspond to valid JSON.', +'invalidHttpVerb':'httpVerb cannot be set to an empty or null string.', +'nullWebRequest':'Cannot call executeRequest with a null webRequest.', +'eventHandlerInvalid':'Handler was not added through the Sys.UI.DomEvent.addHandler method.', +'cannotSerializeNonFiniteNumbers':'Cannot serialize non finite numbers.', +'argumentUndefined':'Value cannot be undefined.', +'webServiceInvalidReturnType':'The server method \'{0}\' returned an invalid type. Expected type: {1}', +'servicePathNotSet':'The path to the web service has not been set.', +'argumentTypeWithTypes':'Object of type \'{0}\' cannot be converted to type \'{1}\'.', +'cannotCallOnceStarted':'Cannot call {0} once started.', +'badBaseUrl1':'Base URL does not contain ://.', +'badBaseUrl2':'Base URL does not contain another /.', +'badBaseUrl3':'Cannot find last / in base URL.', +'setExecutorAfterActive':'Cannot set executor after it has become active.', +'paramName':'Parameter name: {0}', +'nullReferenceInPath':'Null reference while evaluating data path: \'{0}\'.', +'cannotCallOutsideHandler':'Cannot call {0} outside of a completed event handler.', +'cannotSerializeObjectWithCycle':'Cannot serialize object with cyclic reference within child properties.', +'format':'One of the identified items was in an invalid format.', +'assertFailedCaller':'Assertion Failed: {0}\r\nat {1}', +'argumentOutOfRange':'Specified argument was out of the range of valid values.', +'webServiceTimedOut':'The server method \'{0}\' timed out.', +'notImplemented':'The method or operation is not implemented.', +'assertFailed':'Assertion Failed: {0}', +'invalidOperation':'Operation is not valid due to the current state of the object.', +'breakIntoDebugger':'{0}\r\n\r\nBreak into debugger?' +};
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/MicrosoftAjax.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,6 @@ +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftAjax.js +Function.__typeName="Function";Function.__class=true;Function.createCallback=function(b,a){return function(){var e=arguments.length;if(e>0){var d=[];for(var c=0;c<e;c++)d[c]=arguments[c];d[e]=a;return b.apply(this,d)}return b.call(this,a)}};Function.createDelegate=function(a,b){return function(){return b.apply(a,arguments)}};Function.emptyFunction=Function.emptyMethod=function(){};Function.validateParameters=function(c,b,a){return Function._validateParams(c,b,a)};Function._validateParams=function(g,e,c){var a,d=e.length;c=c||typeof c==="undefined";a=Function._validateParameterCount(g,e,c);if(a){a.popStackFrame();return a}for(var b=0,i=g.length;b<i;b++){var f=e[Math.min(b,d-1)],h=f.name;if(f.parameterArray)h+="["+(b-d+1)+"]";else if(!c&&b>=d)break;a=Function._validateParameter(g[b],f,h);if(a){a.popStackFrame();return a}}return null};Function._validateParameterCount=function(j,d,i){var a,c,b=d.length,e=j.length;if(e<b){var f=b;for(a=0;a<b;a++){var g=d[a];if(g.optional||g.parameterArray)f--}if(e<f)c=true}else if(i&&e>b){c=true;for(a=0;a<b;a++)if(d[a].parameterArray){c=false;break}}if(c){var h=Error.parameterCount();h.popStackFrame();return h}return null};Function._validateParameter=function(c,a,h){var b,g=a.type,l=!!a.integer,k=!!a.domElement,m=!!a.mayBeNull;b=Function._validateParameterType(c,g,l,k,m,h);if(b){b.popStackFrame();return b}var e=a.elementType,f=!!a.elementMayBeNull;if(g===Array&&typeof c!=="undefined"&&c!==null&&(e||!f)){var j=!!a.elementInteger,i=!!a.elementDomElement;for(var d=0;d<c.length;d++){var n=c[d];b=Function._validateParameterType(n,e,j,i,f,h+"["+d+"]");if(b){b.popStackFrame();return b}}}return null};Function._validateParameterType=function(b,c,k,j,h,d){var a,g;if(typeof b==="undefined")if(h)return null;else{a=Error.argumentUndefined(d);a.popStackFrame();return a}if(b===null)if(h)return null;else{a=Error.argumentNull(d);a.popStackFrame();return a}if(c&&c.__enum){if(typeof b!=="number"){a=Error.argumentType(d,Object.getType(b),c);a.popStackFrame();return a}if(b%1===0){var e=c.prototype;if(!c.__flags||b===0){for(g in e)if(e[g]===b)return null}else{var i=b;for(g in e){var f=e[g];if(f===0)continue;if((f&b)===f)i-=f;if(i===0)return null}}}a=Error.argumentOutOfRange(d,b,String.format(Sys.Res.enumInvalidValue,b,c.getName()));a.popStackFrame();return a}if(j&&(!Sys._isDomElement(b)||b.nodeType===3)){a=Error.argument(d,Sys.Res.argumentDomElement);a.popStackFrame();return a}if(c&&!Sys._isInstanceOfType(c,b)){a=Error.argumentType(d,Object.getType(b),c);a.popStackFrame();return a}if(c===Number&&k)if(b%1!==0){a=Error.argumentOutOfRange(d,b,Sys.Res.argumentInteger);a.popStackFrame();return a}return null};Error.__typeName="Error";Error.__class=true;Error.create=function(d,b){var a=new Error(d);a.message=d;if(b)for(var c in b)a[c]=b[c];a.popStackFrame();return a};Error.argument=function(a,c){var b="Sys.ArgumentException: "+(c?c:Sys.Res.argument);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentException",paramName:a});d.popStackFrame();return d};Error.argumentNull=function(a,c){var b="Sys.ArgumentNullException: "+(c?c:Sys.Res.argumentNull);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentNullException",paramName:a});d.popStackFrame();return d};Error.argumentOutOfRange=function(c,a,d){var b="Sys.ArgumentOutOfRangeException: "+(d?d:Sys.Res.argumentOutOfRange);if(c)b+="\n"+String.format(Sys.Res.paramName,c);if(typeof a!=="undefined"&&a!==null)b+="\n"+String.format(Sys.Res.actualValue,a);var e=Error.create(b,{name:"Sys.ArgumentOutOfRangeException",paramName:c,actualValue:a});e.popStackFrame();return e};Error.argumentType=function(d,c,b,e){var a="Sys.ArgumentTypeException: ";if(e)a+=e;else if(c&&b)a+=String.format(Sys.Res.argumentTypeWithTypes,c.getName(),b.getName());else a+=Sys.Res.argumentType;if(d)a+="\n"+String.format(Sys.Res.paramName,d);var f=Error.create(a,{name:"Sys.ArgumentTypeException",paramName:d,actualType:c,expectedType:b});f.popStackFrame();return f};Error.argumentUndefined=function(a,c){var b="Sys.ArgumentUndefinedException: "+(c?c:Sys.Res.argumentUndefined);if(a)b+="\n"+String.format(Sys.Res.paramName,a);var d=Error.create(b,{name:"Sys.ArgumentUndefinedException",paramName:a});d.popStackFrame();return d};Error.format=function(a){var c="Sys.FormatException: "+(a?a:Sys.Res.format),b=Error.create(c,{name:"Sys.FormatException"});b.popStackFrame();return b};Error.invalidOperation=function(a){var c="Sys.InvalidOperationException: "+(a?a:Sys.Res.invalidOperation),b=Error.create(c,{name:"Sys.InvalidOperationException"});b.popStackFrame();return b};Error.notImplemented=function(a){var c="Sys.NotImplementedException: "+(a?a:Sys.Res.notImplemented),b=Error.create(c,{name:"Sys.NotImplementedException"});b.popStackFrame();return b};Error.parameterCount=function(a){var c="Sys.ParameterCountException: "+(a?a:Sys.Res.parameterCount),b=Error.create(c,{name:"Sys.ParameterCountException"});b.popStackFrame();return b};Error.prototype.popStackFrame=function(){if(typeof this.stack==="undefined"||this.stack===null||typeof this.fileName==="undefined"||this.fileName===null||typeof this.lineNumber==="undefined"||this.lineNumber===null)return;var a=this.stack.split("\n"),c=a[0],e=this.fileName+":"+this.lineNumber;while(typeof c!=="undefined"&&c!==null&&c.indexOf(e)===-1){a.shift();c=a[0]}var d=a[1];if(typeof d==="undefined"||d===null)return;var b=d.match(/@(.*):(\d+)$/);if(typeof b==="undefined"||b===null)return;this.fileName=b[1];this.lineNumber=parseInt(b[2]);a.shift();this.stack=a.join("\n")};Object.__typeName="Object";Object.__class=true;Object.getType=function(b){var a=b.constructor;if(!a||typeof a!=="function"||!a.__typeName||a.__typeName==="Object")return Object;return a};Object.getTypeName=function(a){return Object.getType(a).getName()};String.__typeName="String";String.__class=true;String.prototype.endsWith=function(a){return this.substr(this.length-a.length)===a};String.prototype.startsWith=function(a){return this.substr(0,a.length)===a};String.prototype.trim=function(){return this.replace(/^\s+|\s+$/g,"")};String.prototype.trimEnd=function(){return this.replace(/\s+$/,"")};String.prototype.trimStart=function(){return this.replace(/^\s+/,"")};String.format=function(){return String._toFormattedString(false,arguments)};String._toFormattedString=function(l,j){var c="",e=j[0];for(var a=0;true;){var f=e.indexOf("{",a),d=e.indexOf("}",a);if(f<0&&d<0){c+=e.slice(a);break}if(d>0&&(d<f||f<0)){c+=e.slice(a,d+1);a=d+2;continue}c+=e.slice(a,f);a=f+1;if(e.charAt(a)==="{"){c+="{";a++;continue}if(d<0)break;var h=e.substring(a,d),g=h.indexOf(":"),k=parseInt(g<0?h:h.substring(0,g),10)+1,i=g<0?"":h.substring(g+1),b=j[k];if(typeof b==="undefined"||b===null)b="";if(b.toFormattedString)c+=b.toFormattedString(i);else if(l&&b.localeFormat)c+=b.localeFormat(i);else if(b.format)c+=b.format(i);else c+=b.toString();a=d+1}return c};Boolean.__typeName="Boolean";Boolean.__class=true;Boolean.parse=function(b){var a=b.trim().toLowerCase();if(a==="false")return false;if(a==="true")return true};Date.__typeName="Date";Date.__class=true;Number.__typeName="Number";Number.__class=true;RegExp.__typeName="RegExp";RegExp.__class=true;if(!window)this.window=this;window.Type=Function;Type.prototype.callBaseMethod=function(a,d,b){var c=Sys._getBaseMethod(this,a,d);if(!b)return c.apply(a);else return c.apply(a,b)};Type.prototype.getBaseMethod=function(a,b){return Sys._getBaseMethod(this,a,b)};Type.prototype.getBaseType=function(){return typeof this.__baseType==="undefined"?null:this.__baseType};Type.prototype.getInterfaces=function(){var a=[],b=this;while(b){var c=b.__interfaces;if(c)for(var d=0,f=c.length;d<f;d++){var e=c[d];if(!Array.contains(a,e))a[a.length]=e}b=b.__baseType}return a};Type.prototype.getName=function(){return typeof this.__typeName==="undefined"?"":this.__typeName};Type.prototype.implementsInterface=function(d){this.resolveInheritance();var c=d.getName(),a=this.__interfaceCache;if(a){var e=a[c];if(typeof e!=="undefined")return e}else a=this.__interfaceCache={};var b=this;while(b){var f=b.__interfaces;if(f)if(Array.indexOf(f,d)!==-1)return a[c]=true;b=b.__baseType}return a[c]=false};Type.prototype.inheritsFrom=function(b){this.resolveInheritance();var a=this.__baseType;while(a){if(a===b)return true;a=a.__baseType}return false};Type.prototype.initializeBase=function(a,b){this.resolveInheritance();if(this.__baseType)if(!b)this.__baseType.apply(a);else this.__baseType.apply(a,b);return a};Type.prototype.isImplementedBy=function(a){if(typeof a==="undefined"||a===null)return false;var b=Object.getType(a);return !!(b.implementsInterface&&b.implementsInterface(this))};Type.prototype.isInstanceOfType=function(a){return Sys._isInstanceOfType(this,a)};Type.prototype.registerClass=function(c,b,d){this.prototype.constructor=this;this.__typeName=c;this.__class=true;if(b){this.__baseType=b;this.__basePrototypePending=true}Sys.__upperCaseTypes[c.toUpperCase()]=this;if(d){this.__interfaces=[];for(var a=2,f=arguments.length;a<f;a++){var e=arguments[a];this.__interfaces.push(e)}}return this};Type.prototype.registerInterface=function(a){Sys.__upperCaseTypes[a.toUpperCase()]=this;this.prototype.constructor=this;this.__typeName=a;this.__interface=true;return this};Type.prototype.resolveInheritance=function(){if(this.__basePrototypePending){var b=this.__baseType;b.resolveInheritance();for(var a in b.prototype){var c=b.prototype[a];if(!this.prototype[a])this.prototype[a]=c}delete this.__basePrototypePending}};Type.getRootNamespaces=function(){return Array.clone(Sys.__rootNamespaces)};Type.isClass=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__class};Type.isInterface=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__interface};Type.isNamespace=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__namespace};Type.parse=function(typeName,ns){var fn;if(ns){fn=Sys.__upperCaseTypes[ns.getName().toUpperCase()+"."+typeName.toUpperCase()];return fn||null}if(!typeName)return null;if(!Type.__htClasses)Type.__htClasses={};fn=Type.__htClasses[typeName];if(!fn){fn=eval(typeName);Type.__htClasses[typeName]=fn}return fn};Type.registerNamespace=function(e){var d=window,c=e.split(".");for(var b=0;b<c.length;b++){var f=c[b],a=d[f];if(!a)a=d[f]={};if(!a.__namespace){if(b===0&&e!=="Sys")Sys.__rootNamespaces[Sys.__rootNamespaces.length]=a;a.__namespace=true;a.__typeName=c.slice(0,b+1).join(".");a.getName=function(){return this.__typeName}}d=a}};Type._checkDependency=function(c,a){var d=Type._registerScript._scripts,b=d?!!d[c]:false;if(typeof a!=="undefined"&&!b)throw Error.invalidOperation(String.format(Sys.Res.requiredScriptReferenceNotIncluded,a,c));return b};Type._registerScript=function(a,c){var b=Type._registerScript._scripts;if(!b)Type._registerScript._scripts=b={};if(b[a])throw Error.invalidOperation(String.format(Sys.Res.scriptAlreadyLoaded,a));b[a]=true;if(c)for(var d=0,f=c.length;d<f;d++){var e=c[d];if(!Type._checkDependency(e))throw Error.invalidOperation(String.format(Sys.Res.scriptDependencyNotFound,a,e))}};Type.registerNamespace("Sys");Sys.__upperCaseTypes={};Sys.__rootNamespaces=[Sys];Sys._isInstanceOfType=function(c,b){if(typeof b==="undefined"||b===null)return false;if(b instanceof c)return true;var a=Object.getType(b);return !!(a===c)||a.inheritsFrom&&a.inheritsFrom(c)||a.implementsInterface&&a.implementsInterface(c)};Sys._getBaseMethod=function(d,e,c){var b=d.getBaseType();if(b){var a=b.prototype[c];return a instanceof Function?a:null}return null};Sys._isDomElement=function(a){var c=false;if(typeof a.nodeType!=="number"){var b=a.ownerDocument||a.document||a;if(b!=a){var d=b.defaultView||b.parentWindow;c=d!=a}else c=typeof b.body==="undefined"}return !c};Array.__typeName="Array";Array.__class=true;Array.add=Array.enqueue=function(a,b){a[a.length]=b};Array.addRange=function(a,b){a.push.apply(a,b)};Array.clear=function(a){a.length=0};Array.clone=function(a){if(a.length===1)return [a[0]];else return Array.apply(null,a)};Array.contains=function(a,b){return Sys._indexOf(a,b)>=0};Array.dequeue=function(a){return a.shift()};Array.forEach=function(b,e,d){for(var a=0,f=b.length;a<f;a++){var c=b[a];if(typeof c!=="undefined")e.call(d,c,a,b)}};Array.indexOf=function(a,c,b){return Sys._indexOf(a,c,b)};Array.insert=function(a,b,c){a.splice(b,0,c)};Array.parse=function(value){if(!value)return [];return eval(value)};Array.remove=function(b,c){var a=Sys._indexOf(b,c);if(a>=0)b.splice(a,1);return a>=0};Array.removeAt=function(a,b){a.splice(b,1)};Sys._indexOf=function(d,e,a){if(typeof e==="undefined")return -1;var c=d.length;if(c!==0){a=a-0;if(isNaN(a))a=0;else{if(isFinite(a))a=a-a%1;if(a<0)a=Math.max(0,c+a)}for(var b=a;b<c;b++)if(typeof d[b]!=="undefined"&&d[b]===e)return b}return -1};Type._registerScript._scripts={"MicrosoftAjaxCore.js":true,"MicrosoftAjaxGlobalization.js":true,"MicrosoftAjaxSerialization.js":true,"MicrosoftAjaxComponentModel.js":true,"MicrosoftAjaxHistory.js":true,"MicrosoftAjaxNetwork.js":true,"MicrosoftAjaxWebServices.js":true};Sys.IDisposable=function(){};Sys.IDisposable.prototype={};Sys.IDisposable.registerInterface("Sys.IDisposable");Sys.StringBuilder=function(a){this._parts=typeof a!=="undefined"&&a!==null&&a!==""?[a.toString()]:[];this._value={};this._len=0};Sys.StringBuilder.prototype={append:function(a){this._parts[this._parts.length]=a},appendLine:function(a){this._parts[this._parts.length]=typeof a==="undefined"||a===null||a===""?"\r\n":a+"\r\n"},clear:function(){this._parts=[];this._value={};this._len=0},isEmpty:function(){if(this._parts.length===0)return true;return this.toString()===""},toString:function(a){a=a||"";var b=this._parts;if(this._len!==b.length){this._value={};this._len=b.length}var d=this._value;if(typeof d[a]==="undefined"){if(a!=="")for(var c=0;c<b.length;)if(typeof b[c]==="undefined"||b[c]===""||b[c]===null)b.splice(c,1);else c++;d[a]=this._parts.join(a)}return d[a]}};Sys.StringBuilder.registerClass("Sys.StringBuilder");Sys.Browser={};Sys.Browser.InternetExplorer={};Sys.Browser.Firefox={};Sys.Browser.Safari={};Sys.Browser.Opera={};Sys.Browser.agent=null;Sys.Browser.hasDebuggerStatement=false;Sys.Browser.name=navigator.appName;Sys.Browser.version=parseFloat(navigator.appVersion);Sys.Browser.documentMode=0;if(navigator.userAgent.indexOf(" MSIE ")>-1){Sys.Browser.agent=Sys.Browser.InternetExplorer;Sys.Browser.version=parseFloat(navigator.userAgent.match(/MSIE (\d+\.\d+)/)[1]);if(Sys.Browser.version>=8)if(document.documentMode>=7)Sys.Browser.documentMode=document.documentMode;Sys.Browser.hasDebuggerStatement=true}else if(navigator.userAgent.indexOf(" Firefox/")>-1){Sys.Browser.agent=Sys.Browser.Firefox;Sys.Browser.version=parseFloat(navigator.userAgent.match(/Firefox\/(\d+\.\d+)/)[1]);Sys.Browser.name="Firefox";Sys.Browser.hasDebuggerStatement=true}else if(navigator.userAgent.indexOf(" AppleWebKit/")>-1){Sys.Browser.agent=Sys.Browser.Safari;Sys.Browser.version=parseFloat(navigator.userAgent.match(/AppleWebKit\/(\d+(\.\d+)?)/)[1]);Sys.Browser.name="Safari"}else if(navigator.userAgent.indexOf("Opera/")>-1)Sys.Browser.agent=Sys.Browser.Opera;Sys.EventArgs=function(){};Sys.EventArgs.registerClass("Sys.EventArgs");Sys.EventArgs.Empty=new Sys.EventArgs;Sys.CancelEventArgs=function(){Sys.CancelEventArgs.initializeBase(this);this._cancel=false};Sys.CancelEventArgs.prototype={get_cancel:function(){return this._cancel},set_cancel:function(a){this._cancel=a}};Sys.CancelEventArgs.registerClass("Sys.CancelEventArgs",Sys.EventArgs);Type.registerNamespace("Sys.UI");Sys._Debug=function(){};Sys._Debug.prototype={_appendConsole:function(a){if(typeof Debug!=="undefined"&&Debug.writeln)Debug.writeln(a);if(window.console&&window.console.log)window.console.log(a);if(window.opera)window.opera.postError(a);if(window.debugService)window.debugService.trace(a)},_appendTrace:function(b){var a=document.getElementById("TraceConsole");if(a&&a.tagName.toUpperCase()==="TEXTAREA")a.value+=b+"\n"},assert:function(c,a,b){if(!c){a=b&&this.assert.caller?String.format(Sys.Res.assertFailedCaller,a,this.assert.caller):String.format(Sys.Res.assertFailed,a);if(confirm(String.format(Sys.Res.breakIntoDebugger,a)))this.fail(a)}},clearTrace:function(){var a=document.getElementById("TraceConsole");if(a&&a.tagName.toUpperCase()==="TEXTAREA")a.value=""},fail:function(message){this._appendConsole(message);if(Sys.Browser.hasDebuggerStatement)eval("debugger")},trace:function(a){this._appendConsole(a);this._appendTrace(a)},traceDump:function(a,b){var c=this._traceDump(a,b,true)},_traceDump:function(a,c,f,b,d){c=c?c:"traceDump";b=b?b:"";if(a===null){this.trace(b+c+": null");return}switch(typeof a){case "undefined":this.trace(b+c+": Undefined");break;case "number":case "string":case "boolean":this.trace(b+c+": "+a);break;default:if(Date.isInstanceOfType(a)||RegExp.isInstanceOfType(a)){this.trace(b+c+": "+a.toString());break}if(!d)d=[];else if(Array.contains(d,a)){this.trace(b+c+": ...");return}Array.add(d,a);if(a==window||a===document||window.HTMLElement&&a instanceof HTMLElement||typeof a.nodeName==="string"){var k=a.tagName?a.tagName:"DomElement";if(a.id)k+=" - "+a.id;this.trace(b+c+" {"+k+"}")}else{var i=Object.getTypeName(a);this.trace(b+c+(typeof i==="string"?" {"+i+"}":""));if(b===""||f){b+=" ";var e,j,l,g,h;if(Array.isInstanceOfType(a)){j=a.length;for(e=0;e<j;e++)this._traceDump(a[e],"["+e+"]",f,b,d)}else for(g in a){h=a[g];if(!Function.isInstanceOfType(h))this._traceDump(h,g,f,b,d)}}}Array.remove(d,a)}}};Sys._Debug.registerClass("Sys._Debug");Sys.Debug=new Sys._Debug;Sys.Debug.isDebug=false;function Sys$Enum$parse(c,e){var a,b,i;if(e){a=this.__lowerCaseValues;if(!a){this.__lowerCaseValues=a={};var g=this.prototype;for(var f in g)a[f.toLowerCase()]=g[f]}}else a=this.prototype;if(!this.__flags){i=e?c.toLowerCase():c;b=a[i.trim()];if(typeof b!=="number")throw Error.argument("value",String.format(Sys.Res.enumInvalidValue,c,this.__typeName));return b}else{var h=(e?c.toLowerCase():c).split(","),j=0;for(var d=h.length-1;d>=0;d--){var k=h[d].trim();b=a[k];if(typeof b!=="number")throw Error.argument("value",String.format(Sys.Res.enumInvalidValue,c.split(",")[d].trim(),this.__typeName));j|=b}return j}}function Sys$Enum$toString(c){if(typeof c==="undefined"||c===null)return this.__string;var d=this.prototype,a;if(!this.__flags||c===0){for(a in d)if(d[a]===c)return a}else{var b=this.__sortedValues;if(!b){b=[];for(a in d)b[b.length]={key:a,value:d[a]};b.sort(function(a,b){return a.value-b.value});this.__sortedValues=b}var e=[],g=c;for(a=b.length-1;a>=0;a--){var h=b[a],f=h.value;if(f===0)continue;if((f&c)===f){e[e.length]=h.key;g-=f;if(g===0)break}}if(e.length&&g===0)return e.reverse().join(", ")}return ""}Type.prototype.registerEnum=function(b,c){Sys.__upperCaseTypes[b.toUpperCase()]=this;for(var a in this.prototype)this[a]=this.prototype[a];this.__typeName=b;this.parse=Sys$Enum$parse;this.__string=this.toString();this.toString=Sys$Enum$toString;this.__flags=c;this.__enum=true};Type.isEnum=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__enum};Type.isFlags=function(a){if(typeof a==="undefined"||a===null)return false;return !!a.__flags};Sys.CollectionChange=function(e,a,c,b,d){this.action=e;if(a)if(!(a instanceof Array))a=[a];this.newItems=a||null;if(typeof c!=="number")c=-1;this.newStartingIndex=c;if(b)if(!(b instanceof Array))b=[b];this.oldItems=b||null;if(typeof d!=="number")d=-1;this.oldStartingIndex=d};Sys.CollectionChange.registerClass("Sys.CollectionChange");Sys.NotifyCollectionChangedAction=function(){throw Error.notImplemented()};Sys.NotifyCollectionChangedAction.prototype={add:0,remove:1,reset:2};Sys.NotifyCollectionChangedAction.registerEnum("Sys.NotifyCollectionChangedAction");Sys.NotifyCollectionChangedEventArgs=function(a){this._changes=a;Sys.NotifyCollectionChangedEventArgs.initializeBase(this)};Sys.NotifyCollectionChangedEventArgs.prototype={get_changes:function(){return this._changes||[]}};Sys.NotifyCollectionChangedEventArgs.registerClass("Sys.NotifyCollectionChangedEventArgs",Sys.EventArgs);Sys.Observer=function(){};Sys.Observer.registerClass("Sys.Observer");Sys.Observer.makeObservable=function(a){var c=a instanceof Array,b=Sys.Observer;if(a.setValue===b._observeMethods.setValue)return a;b._addMethods(a,b._observeMethods);if(c)b._addMethods(a,b._arrayMethods);return a};Sys.Observer._addMethods=function(c,b){for(var a in b)c[a]=b[a]};Sys.Observer._addEventHandler=function(c,a,b){Sys.Observer._getContext(c,true).events._addHandler(a,b)};Sys.Observer.addEventHandler=function(c,a,b){Sys.Observer._addEventHandler(c,a,b)};Sys.Observer._removeEventHandler=function(c,a,b){Sys.Observer._getContext(c,true).events._removeHandler(a,b)};Sys.Observer.removeEventHandler=function(c,a,b){Sys.Observer._removeEventHandler(c,a,b)};Sys.Observer.raiseEvent=function(b,e,d){var c=Sys.Observer._getContext(b);if(!c)return;var a=c.events.getHandler(e);if(a)a(b,d)};Sys.Observer.addPropertyChanged=function(b,a){Sys.Observer._addEventHandler(b,"propertyChanged",a)};Sys.Observer.removePropertyChanged=function(b,a){Sys.Observer._removeEventHandler(b,"propertyChanged",a)};Sys.Observer.beginUpdate=function(a){Sys.Observer._getContext(a,true).updating=true};Sys.Observer.endUpdate=function(b){var a=Sys.Observer._getContext(b);if(!a||!a.updating)return;a.updating=false;var d=a.dirty;a.dirty=false;if(d){if(b instanceof Array){var c=a.changes;a.changes=null;Sys.Observer.raiseCollectionChanged(b,c)}Sys.Observer.raisePropertyChanged(b,"")}};Sys.Observer.isUpdating=function(b){var a=Sys.Observer._getContext(b);return a?a.updating:false};Sys.Observer._setValue=function(a,j,g){var b,f,k=a,d=j.split(".");for(var i=0,m=d.length-1;i<m;i++){var l=d[i];b=a["get_"+l];if(typeof b==="function")a=b.call(a);else a=a[l];var n=typeof a;if(a===null||n==="undefined")throw Error.invalidOperation(String.format(Sys.Res.nullReferenceInPath,j))}var e,c=d[m];b=a["get_"+c];f=a["set_"+c];if(typeof b==="function")e=b.call(a);else e=a[c];if(typeof f==="function")f.call(a,g);else a[c]=g;if(e!==g){var h=Sys.Observer._getContext(k);if(h&&h.updating){h.dirty=true;return}Sys.Observer.raisePropertyChanged(k,d[0])}};Sys.Observer.setValue=function(b,a,c){Sys.Observer._setValue(b,a,c)};Sys.Observer.raisePropertyChanged=function(b,a){Sys.Observer.raiseEvent(b,"propertyChanged",new Sys.PropertyChangedEventArgs(a))};Sys.Observer.addCollectionChanged=function(b,a){Sys.Observer._addEventHandler(b,"collectionChanged",a)};Sys.Observer.removeCollectionChanged=function(b,a){Sys.Observer._removeEventHandler(b,"collectionChanged",a)};Sys.Observer._collectionChange=function(d,c){var a=Sys.Observer._getContext(d);if(a&&a.updating){a.dirty=true;var b=a.changes;if(!b)a.changes=b=[c];else b.push(c)}else{Sys.Observer.raiseCollectionChanged(d,[c]);Sys.Observer.raisePropertyChanged(d,"length")}};Sys.Observer.add=function(a,b){var c=new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,[b],a.length);Array.add(a,b);Sys.Observer._collectionChange(a,c)};Sys.Observer.addRange=function(a,b){var c=new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,b,a.length);Array.addRange(a,b);Sys.Observer._collectionChange(a,c)};Sys.Observer.clear=function(a){var b=Array.clone(a);Array.clear(a);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.reset,null,-1,b,0))};Sys.Observer.insert=function(a,b,c){Array.insert(a,b,c);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.add,[c],b))};Sys.Observer.remove=function(a,b){var c=Array.indexOf(a,b);if(c!==-1){Array.remove(a,b);Sys.Observer._collectionChange(a,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.remove,null,-1,[b],c));return true}return false};Sys.Observer.removeAt=function(b,a){if(a>-1&&a<b.length){var c=b[a];Array.removeAt(b,a);Sys.Observer._collectionChange(b,new Sys.CollectionChange(Sys.NotifyCollectionChangedAction.remove,null,-1,[c],a))}};Sys.Observer.raiseCollectionChanged=function(b,a){Sys.Observer.raiseEvent(b,"collectionChanged",new Sys.NotifyCollectionChangedEventArgs(a))};Sys.Observer._observeMethods={add_propertyChanged:function(a){Sys.Observer._addEventHandler(this,"propertyChanged",a)},remove_propertyChanged:function(a){Sys.Observer._removeEventHandler(this,"propertyChanged",a)},addEventHandler:function(a,b){Sys.Observer._addEventHandler(this,a,b)},removeEventHandler:function(a,b){Sys.Observer._removeEventHandler(this,a,b)},get_isUpdating:function(){return Sys.Observer.isUpdating(this)},beginUpdate:function(){Sys.Observer.beginUpdate(this)},endUpdate:function(){Sys.Observer.endUpdate(this)},setValue:function(b,a){Sys.Observer._setValue(this,b,a)},raiseEvent:function(b,a){Sys.Observer.raiseEvent(this,b,a)},raisePropertyChanged:function(a){Sys.Observer.raiseEvent(this,"propertyChanged",new Sys.PropertyChangedEventArgs(a))}};Sys.Observer._arrayMethods={add_collectionChanged:function(a){Sys.Observer._addEventHandler(this,"collectionChanged",a)},remove_collectionChanged:function(a){Sys.Observer._removeEventHandler(this,"collectionChanged",a)},add:function(a){Sys.Observer.add(this,a)},addRange:function(a){Sys.Observer.addRange(this,a)},clear:function(){Sys.Observer.clear(this)},insert:function(a,b){Sys.Observer.insert(this,a,b)},remove:function(a){return Sys.Observer.remove(this,a)},removeAt:function(a){Sys.Observer.removeAt(this,a)},raiseCollectionChanged:function(a){Sys.Observer.raiseEvent(this,"collectionChanged",new Sys.NotifyCollectionChangedEventArgs(a))}};Sys.Observer._getContext=function(b,c){var a=b._observerContext;if(a)return a();if(c)return (b._observerContext=Sys.Observer._createContext())();return null};Sys.Observer._createContext=function(){var a={events:new Sys.EventHandlerList};return function(){return a}};Date._appendPreOrPostMatch=function(e,b){var d=0,a=false;for(var c=0,g=e.length;c<g;c++){var f=e.charAt(c);switch(f){case "'":if(a)b.append("'");else d++;a=false;break;case "\\":if(a)b.append("\\");a=!a;break;default:b.append(f);a=false}}return d};Date._expandFormat=function(a,b){if(!b)b="F";var c=b.length;if(c===1)switch(b){case "d":return a.ShortDatePattern;case "D":return a.LongDatePattern;case "t":return a.ShortTimePattern;case "T":return a.LongTimePattern;case "f":return a.LongDatePattern+" "+a.ShortTimePattern;case "F":return a.FullDateTimePattern;case "M":case "m":return a.MonthDayPattern;case "s":return a.SortableDateTimePattern;case "Y":case "y":return a.YearMonthPattern;default:throw Error.format(Sys.Res.formatInvalidString)}else if(c===2&&b.charAt(0)==="%")b=b.charAt(1);return b};Date._expandYear=function(c,a){var d=new Date,e=Date._getEra(d);if(a<100){var b=Date._getEraYear(d,c,e);a+=b-b%100;if(a>c.Calendar.TwoDigitYearMax)a-=100}return a};Date._getEra=function(e,c){if(!c)return 0;var b,d=e.getTime();for(var a=0,f=c.length;a<f;a+=4){b=c[a+2];if(b===null||d>=b)return a}return 0};Date._getEraYear=function(d,b,e,c){var a=d.getFullYear();if(!c&&b.eras)a-=b.eras[e+3];return a};Date._getParseRegExp=function(b,e){if(!b._parseRegExp)b._parseRegExp={};else if(b._parseRegExp[e])return b._parseRegExp[e];var c=Date._expandFormat(b,e);c=c.replace(/([\^\$\.\*\+\?\|\[\]\(\)\{\}])/g,"\\\\$1");var a=new Sys.StringBuilder("^"),j=[],f=0,i=0,h=Date._getTokenRegExp(),d;while((d=h.exec(c))!==null){var l=c.slice(f,d.index);f=h.lastIndex;i+=Date._appendPreOrPostMatch(l,a);if(i%2===1){a.append(d[0]);continue}switch(d[0]){case "dddd":case "ddd":case "MMMM":case "MMM":case "gg":case "g":a.append("(\\D+)");break;case "tt":case "t":a.append("(\\D*)");break;case "yyyy":a.append("(\\d{4})");break;case "fff":a.append("(\\d{3})");break;case "ff":a.append("(\\d{2})");break;case "f":a.append("(\\d)");break;case "dd":case "d":case "MM":case "M":case "yy":case "y":case "HH":case "H":case "hh":case "h":case "mm":case "m":case "ss":case "s":a.append("(\\d\\d?)");break;case "zzz":a.append("([+-]?\\d\\d?:\\d{2})");break;case "zz":case "z":a.append("([+-]?\\d\\d?)");break;case "/":a.append("(\\"+b.DateSeparator+")")}Array.add(j,d[0])}Date._appendPreOrPostMatch(c.slice(f),a);a.append("$");var k=a.toString().replace(/\s+/g,"\\s+"),g={"regExp":k,"groups":j};b._parseRegExp[e]=g;return g};Date._getTokenRegExp=function(){return /\/|dddd|ddd|dd|d|MMMM|MMM|MM|M|yyyy|yy|y|hh|h|HH|H|mm|m|ss|s|tt|t|fff|ff|f|zzz|zz|z|gg|g/g};Date.parseLocale=function(a){return Date._parse(a,Sys.CultureInfo.CurrentCulture,arguments)};Date.parseInvariant=function(a){return Date._parse(a,Sys.CultureInfo.InvariantCulture,arguments)};Date._parse=function(h,d,i){var a,c,b,f,e,g=false;for(a=1,c=i.length;a<c;a++){f=i[a];if(f){g=true;b=Date._parseExact(h,f,d);if(b)return b}}if(!g){e=d._getDateTimeFormats();for(a=0,c=e.length;a<c;a++){b=Date._parseExact(h,e[a],d);if(b)return b}}return null};Date._parseExact=function(w,D,k){w=w.trim();var g=k.dateTimeFormat,A=Date._getParseRegExp(g,D),C=(new RegExp(A.regExp)).exec(w);if(C===null)return null;var B=A.groups,x=null,e=null,c=null,j=null,i=null,d=0,h,q=0,r=0,f=0,n=null,v=false;for(var t=0,E=B.length;t<E;t++){var a=C[t+1];if(a)switch(B[t]){case "dd":case "d":j=parseInt(a,10);if(j<1||j>31)return null;break;case "MMMM":c=k._getMonthIndex(a);if(c<0||c>11)return null;break;case "MMM":c=k._getAbbrMonthIndex(a);if(c<0||c>11)return null;break;case "M":case "MM":c=parseInt(a,10)-1;if(c<0||c>11)return null;break;case "y":case "yy":e=Date._expandYear(g,parseInt(a,10));if(e<0||e>9999)return null;break;case "yyyy":e=parseInt(a,10);if(e<0||e>9999)return null;break;case "h":case "hh":d=parseInt(a,10);if(d===12)d=0;if(d<0||d>11)return null;break;case "H":case "HH":d=parseInt(a,10);if(d<0||d>23)return null;break;case "m":case "mm":q=parseInt(a,10);if(q<0||q>59)return null;break;case "s":case "ss":r=parseInt(a,10);if(r<0||r>59)return null;break;case "tt":case "t":var z=a.toUpperCase();v=z===g.PMDesignator.toUpperCase();if(!v&&z!==g.AMDesignator.toUpperCase())return null;break;case "f":f=parseInt(a,10)*100;if(f<0||f>999)return null;break;case "ff":f=parseInt(a,10)*10;if(f<0||f>999)return null;break;case "fff":f=parseInt(a,10);if(f<0||f>999)return null;break;case "dddd":i=k._getDayIndex(a);if(i<0||i>6)return null;break;case "ddd":i=k._getAbbrDayIndex(a);if(i<0||i>6)return null;break;case "zzz":var u=a.split(/:/);if(u.length!==2)return null;h=parseInt(u[0],10);if(h<-12||h>13)return null;var o=parseInt(u[1],10);if(o<0||o>59)return null;n=h*60+(a.startsWith("-")?-o:o);break;case "z":case "zz":h=parseInt(a,10);if(h<-12||h>13)return null;n=h*60;break;case "g":case "gg":var p=a;if(!p||!g.eras)return null;p=p.toLowerCase().trim();for(var s=0,F=g.eras.length;s<F;s+=4)if(p===g.eras[s+1].toLowerCase()){x=s;break}if(x===null)return null}}var b=new Date,l,m=g.Calendar.convert;if(m)l=m.fromGregorian(b);if(!m)l=[b.getFullYear(),b.getMonth(),b.getDate()];if(e===null)e=l[0];else if(g.eras)e+=g.eras[(x||0)+3];if(c===null)c=l[1];if(j===null)j=l[2];if(m){b=m.toGregorian(e,c,j);if(b===null)return null}else{b.setFullYear(e,c,j);if(b.getDate()!==j)return null;if(i!==null&&b.getDay()!==i)return null}if(v&&d<12)d+=12;b.setHours(d,q,r,f);if(n!==null){var y=b.getMinutes()-(n+b.getTimezoneOffset());b.setHours(b.getHours()+parseInt(y/60,10),y%60)}return b};Date.prototype.format=function(a){return this._toFormattedString(a,Sys.CultureInfo.InvariantCulture)};Date.prototype.localeFormat=function(a){return this._toFormattedString(a,Sys.CultureInfo.CurrentCulture)};Date.prototype._toFormattedString=function(e,j){var b=j.dateTimeFormat,n=b.Calendar.convert;if(!e||!e.length||e==="i")if(j&&j.name.length)if(n)return this._toFormattedString(b.FullDateTimePattern,j);else{var r=new Date(this.getTime()),x=Date._getEra(this,b.eras);r.setFullYear(Date._getEraYear(this,b,x));return r.toLocaleString()}else return this.toString();var l=b.eras,k=e==="s";e=Date._expandFormat(b,e);var a=new Sys.StringBuilder,c;function d(a){if(a<10)return "0"+a;return a.toString()}function m(a){if(a<10)return "00"+a;if(a<100)return "0"+a;return a.toString()}function v(a){if(a<10)return "000"+a;else if(a<100)return "00"+a;else if(a<1000)return "0"+a;return a.toString()}var h,p,t=/([^d]|^)(d|dd)([^d]|$)/g;function s(){if(h||p)return h;h=t.test(e);p=true;return h}var q=0,o=Date._getTokenRegExp(),f;if(!k&&n)f=n.fromGregorian(this);for(;true;){var w=o.lastIndex,i=o.exec(e),u=e.slice(w,i?i.index:e.length);q+=Date._appendPreOrPostMatch(u,a);if(!i)break;if(q%2===1){a.append(i[0]);continue}function g(a,b){if(f)return f[b];switch(b){case 0:return a.getFullYear();case 1:return a.getMonth();case 2:return a.getDate()}}switch(i[0]){case "dddd":a.append(b.DayNames[this.getDay()]);break;case "ddd":a.append(b.AbbreviatedDayNames[this.getDay()]);break;case "dd":h=true;a.append(d(g(this,2)));break;case "d":h=true;a.append(g(this,2));break;case "MMMM":a.append(b.MonthGenitiveNames&&s()?b.MonthGenitiveNames[g(this,1)]:b.MonthNames[g(this,1)]);break;case "MMM":a.append(b.AbbreviatedMonthGenitiveNames&&s()?b.AbbreviatedMonthGenitiveNames[g(this,1)]:b.AbbreviatedMonthNames[g(this,1)]);break;case "MM":a.append(d(g(this,1)+1));break;case "M":a.append(g(this,1)+1);break;case "yyyy":a.append(v(f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k)));break;case "yy":a.append(d((f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k))%100));break;case "y":a.append((f?f[0]:Date._getEraYear(this,b,Date._getEra(this,l),k))%100);break;case "hh":c=this.getHours()%12;if(c===0)c=12;a.append(d(c));break;case "h":c=this.getHours()%12;if(c===0)c=12;a.append(c);break;case "HH":a.append(d(this.getHours()));break;case "H":a.append(this.getHours());break;case "mm":a.append(d(this.getMinutes()));break;case "m":a.append(this.getMinutes());break;case "ss":a.append(d(this.getSeconds()));break;case "s":a.append(this.getSeconds());break;case "tt":a.append(this.getHours()<12?b.AMDesignator:b.PMDesignator);break;case "t":a.append((this.getHours()<12?b.AMDesignator:b.PMDesignator).charAt(0));break;case "f":a.append(m(this.getMilliseconds()).charAt(0));break;case "ff":a.append(m(this.getMilliseconds()).substr(0,2));break;case "fff":a.append(m(this.getMilliseconds()));break;case "z":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+Math.floor(Math.abs(c)));break;case "zz":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+d(Math.floor(Math.abs(c))));break;case "zzz":c=this.getTimezoneOffset()/60;a.append((c<=0?"+":"-")+d(Math.floor(Math.abs(c)))+":"+d(Math.abs(this.getTimezoneOffset()%60)));break;case "g":case "gg":if(b.eras)a.append(b.eras[Date._getEra(this,l)+1]);break;case "/":a.append(b.DateSeparator)}}return a.toString()};String.localeFormat=function(){return String._toFormattedString(true,arguments)};Number.parseLocale=function(a){return Number._parse(a,Sys.CultureInfo.CurrentCulture)};Number.parseInvariant=function(a){return Number._parse(a,Sys.CultureInfo.InvariantCulture)};Number._parse=function(b,o){b=b.trim();if(b.match(/^[+-]?infinity$/i))return parseFloat(b);if(b.match(/^0x[a-f0-9]+$/i))return parseInt(b);var a=o.numberFormat,g=Number._parseNumberNegativePattern(b,a,a.NumberNegativePattern),h=g[0],e=g[1];if(h===""&&a.NumberNegativePattern!==1){g=Number._parseNumberNegativePattern(b,a,1);h=g[0];e=g[1]}if(h==="")h="+";var j,d,f=e.indexOf("e");if(f<0)f=e.indexOf("E");if(f<0){d=e;j=null}else{d=e.substr(0,f);j=e.substr(f+1)}var c,k,m=d.indexOf(a.NumberDecimalSeparator);if(m<0){c=d;k=null}else{c=d.substr(0,m);k=d.substr(m+a.NumberDecimalSeparator.length)}c=c.split(a.NumberGroupSeparator).join("");var n=a.NumberGroupSeparator.replace(/\u00A0/g," ");if(a.NumberGroupSeparator!==n)c=c.split(n).join("");var l=h+c;if(k!==null)l+="."+k;if(j!==null){var i=Number._parseNumberNegativePattern(j,a,1);if(i[0]==="")i[0]="+";l+="e"+i[0]+i[1]}if(l.match(/^[+-]?\d*\.?\d*(e[+-]?\d+)?$/))return parseFloat(l);return Number.NaN};Number._parseNumberNegativePattern=function(a,d,e){var b=d.NegativeSign,c=d.PositiveSign;switch(e){case 4:b=" "+b;c=" "+c;case 3:if(a.endsWith(b))return ["-",a.substr(0,a.length-b.length)];else if(a.endsWith(c))return ["+",a.substr(0,a.length-c.length)];break;case 2:b+=" ";c+=" ";case 1:if(a.startsWith(b))return ["-",a.substr(b.length)];else if(a.startsWith(c))return ["+",a.substr(c.length)];break;case 0:if(a.startsWith("(")&&a.endsWith(")"))return ["-",a.substr(1,a.length-2)]}return ["",a]};Number.prototype.format=function(a){return this._toFormattedString(a,Sys.CultureInfo.InvariantCulture)};Number.prototype.localeFormat=function(a){return this._toFormattedString(a,Sys.CultureInfo.CurrentCulture)};Number.prototype._toFormattedString=function(e,j){if(!e||e.length===0||e==="i")if(j&&j.name.length>0)return this.toLocaleString();else return this.toString();var o=["n %","n%","%n"],n=["-n %","-n%","-%n"],p=["(n)","-n","- n","n-","n -"],m=["$n","n$","$ n","n $"],l=["($n)","-$n","$-n","$n-","(n$)","-n$","n-$","n$-","-n $","-$ n","n $-","$ n-","$ -n","n- $","($ n)","(n $)"];function g(a,c,d){for(var b=a.length;b<c;b++)a=d?"0"+a:a+"0";return a}function i(j,i,l,n,p){var h=l[0],k=1,o=Math.pow(10,i),m=Math.round(j*o)/o;if(!isFinite(m))m=j;j=m;var b=j.toString(),a="",c,e=b.split(/e/i);b=e[0];c=e.length>1?parseInt(e[1]):0;e=b.split(".");b=e[0];a=e.length>1?e[1]:"";var q;if(c>0){a=g(a,c,false);b+=a.slice(0,c);a=a.substr(c)}else if(c<0){c=-c;b=g(b,c+1,true);a=b.slice(-c,b.length)+a;b=b.slice(0,-c)}if(i>0){if(a.length>i)a=a.slice(0,i);else a=g(a,i,false);a=p+a}else a="";var d=b.length-1,f="";while(d>=0){if(h===0||h>d)if(f.length>0)return b.slice(0,d+1)+n+f+a;else return b.slice(0,d+1)+a;if(f.length>0)f=b.slice(d-h+1,d+1)+n+f;else f=b.slice(d-h+1,d+1);d-=h;if(k<l.length){h=l[k];k++}}return b.slice(0,d+1)+n+f+a}var a=j.numberFormat,d=Math.abs(this);if(!e)e="D";var b=-1;if(e.length>1)b=parseInt(e.slice(1),10);var c;switch(e.charAt(0)){case "d":case "D":c="n";if(b!==-1)d=g(""+d,b,true);if(this<0)d=-d;break;case "c":case "C":if(this<0)c=l[a.CurrencyNegativePattern];else c=m[a.CurrencyPositivePattern];if(b===-1)b=a.CurrencyDecimalDigits;d=i(Math.abs(this),b,a.CurrencyGroupSizes,a.CurrencyGroupSeparator,a.CurrencyDecimalSeparator);break;case "n":case "N":if(this<0)c=p[a.NumberNegativePattern];else c="n";if(b===-1)b=a.NumberDecimalDigits;d=i(Math.abs(this),b,a.NumberGroupSizes,a.NumberGroupSeparator,a.NumberDecimalSeparator);break;case "p":case "P":if(this<0)c=n[a.PercentNegativePattern];else c=o[a.PercentPositivePattern];if(b===-1)b=a.PercentDecimalDigits;d=i(Math.abs(this)*100,b,a.PercentGroupSizes,a.PercentGroupSeparator,a.PercentDecimalSeparator);break;default:throw Error.format(Sys.Res.formatBadFormatSpecifier)}var k=/n|\$|-|%/g,f="";for(;true;){var q=k.lastIndex,h=k.exec(c);f+=c.slice(q,h?h.index:c.length);if(!h)break;switch(h[0]){case "n":f+=d;break;case "$":f+=a.CurrencySymbol;break;case "-":if(/[1-9]/.test(d))f+=a.NegativeSign;break;case "%":f+=a.PercentSymbol}}return f};Sys.CultureInfo=function(c,b,a){this.name=c;this.numberFormat=b;this.dateTimeFormat=a};Sys.CultureInfo.prototype={_getDateTimeFormats:function(){if(!this._dateTimeFormats){var a=this.dateTimeFormat;this._dateTimeFormats=[a.MonthDayPattern,a.YearMonthPattern,a.ShortDatePattern,a.ShortTimePattern,a.LongDatePattern,a.LongTimePattern,a.FullDateTimePattern,a.RFC1123Pattern,a.SortableDateTimePattern,a.UniversalSortableDateTimePattern]}return this._dateTimeFormats},_getIndex:function(c,d,e){var b=this._toUpper(c),a=Array.indexOf(d,b);if(a===-1)a=Array.indexOf(e,b);return a},_getMonthIndex:function(a){if(!this._upperMonths){this._upperMonths=this._toUpperArray(this.dateTimeFormat.MonthNames);this._upperMonthsGenitive=this._toUpperArray(this.dateTimeFormat.MonthGenitiveNames)}return this._getIndex(a,this._upperMonths,this._upperMonthsGenitive)},_getAbbrMonthIndex:function(a){if(!this._upperAbbrMonths){this._upperAbbrMonths=this._toUpperArray(this.dateTimeFormat.AbbreviatedMonthNames);this._upperAbbrMonthsGenitive=this._toUpperArray(this.dateTimeFormat.AbbreviatedMonthGenitiveNames)}return this._getIndex(a,this._upperAbbrMonths,this._upperAbbrMonthsGenitive)},_getDayIndex:function(a){if(!this._upperDays)this._upperDays=this._toUpperArray(this.dateTimeFormat.DayNames);return Array.indexOf(this._upperDays,this._toUpper(a))},_getAbbrDayIndex:function(a){if(!this._upperAbbrDays)this._upperAbbrDays=this._toUpperArray(this.dateTimeFormat.AbbreviatedDayNames);return Array.indexOf(this._upperAbbrDays,this._toUpper(a))},_toUpperArray:function(c){var b=[];for(var a=0,d=c.length;a<d;a++)b[a]=this._toUpper(c[a]);return b},_toUpper:function(a){return a.split("\u00a0").join(" ").toUpperCase()}};Sys.CultureInfo.registerClass("Sys.CultureInfo");Sys.CultureInfo._parse=function(a){var b=a.dateTimeFormat;if(b&&!b.eras)b.eras=a.eras;return new Sys.CultureInfo(a.name,a.numberFormat,b)};Sys.CultureInfo.InvariantCulture=Sys.CultureInfo._parse({"name":"","numberFormat":{"CurrencyDecimalDigits":2,"CurrencyDecimalSeparator":".","IsReadOnly":true,"CurrencyGroupSizes":[3],"NumberGroupSizes":[3],"PercentGroupSizes":[3],"CurrencyGroupSeparator":",","CurrencySymbol":"\u00a4","NaNSymbol":"NaN","CurrencyNegativePattern":0,"NumberNegativePattern":1,"PercentPositivePattern":0,"PercentNegativePattern":0,"NegativeInfinitySymbol":"-Infinity","NegativeSign":"-","NumberDecimalDigits":2,"NumberDecimalSeparator":".","NumberGroupSeparator":",","CurrencyPositivePattern":0,"PositiveInfinitySymbol":"Infinity","PositiveSign":"+","PercentDecimalDigits":2,"PercentDecimalSeparator":".","PercentGroupSeparator":",","PercentSymbol":"%","PerMilleSymbol":"\u2030","NativeDigits":["0","1","2","3","4","5","6","7","8","9"],"DigitSubstitution":1},"dateTimeFormat":{"AMDesignator":"AM","Calendar":{"MinSupportedDateTime":"@-62135568000000@","MaxSupportedDateTime":"@253402300799999@","AlgorithmType":1,"CalendarType":1,"Eras":[1],"TwoDigitYearMax":2029,"IsReadOnly":true},"DateSeparator":"/","FirstDayOfWeek":0,"CalendarWeekRule":0,"FullDateTimePattern":"dddd, dd MMMM yyyy HH:mm:ss","LongDatePattern":"dddd, dd MMMM yyyy","LongTimePattern":"HH:mm:ss","MonthDayPattern":"MMMM dd","PMDesignator":"PM","RFC1123Pattern":"ddd, dd MMM yyyy HH':'mm':'ss 'GMT'","ShortDatePattern":"MM/dd/yyyy","ShortTimePattern":"HH:mm","SortableDateTimePattern":"yyyy'-'MM'-'dd'T'HH':'mm':'ss","TimeSeparator":":","UniversalSortableDateTimePattern":"yyyy'-'MM'-'dd HH':'mm':'ss'Z'","YearMonthPattern":"yyyy MMMM","AbbreviatedDayNames":["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],"ShortestDayNames":["Su","Mo","Tu","We","Th","Fr","Sa"],"DayNames":["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],"AbbreviatedMonthNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthNames":["January","February","March","April","May","June","July","August","September","October","November","December",""],"IsReadOnly":true,"NativeCalendarName":"Gregorian Calendar","AbbreviatedMonthGenitiveNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthGenitiveNames":["January","February","March","April","May","June","July","August","September","October","November","December",""]},"eras":[1,"A.D.",null,0]});if(typeof __cultureInfo==="object"){Sys.CultureInfo.CurrentCulture=Sys.CultureInfo._parse(__cultureInfo);delete __cultureInfo}else Sys.CultureInfo.CurrentCulture=Sys.CultureInfo._parse({"name":"en-US","numberFormat":{"CurrencyDecimalDigits":2,"CurrencyDecimalSeparator":".","IsReadOnly":false,"CurrencyGroupSizes":[3],"NumberGroupSizes":[3],"PercentGroupSizes":[3],"CurrencyGroupSeparator":",","CurrencySymbol":"$","NaNSymbol":"NaN","CurrencyNegativePattern":0,"NumberNegativePattern":1,"PercentPositivePattern":0,"PercentNegativePattern":0,"NegativeInfinitySymbol":"-Infinity","NegativeSign":"-","NumberDecimalDigits":2,"NumberDecimalSeparator":".","NumberGroupSeparator":",","CurrencyPositivePattern":0,"PositiveInfinitySymbol":"Infinity","PositiveSign":"+","PercentDecimalDigits":2,"PercentDecimalSeparator":".","PercentGroupSeparator":",","PercentSymbol":"%","PerMilleSymbol":"\u2030","NativeDigits":["0","1","2","3","4","5","6","7","8","9"],"DigitSubstitution":1},"dateTimeFormat":{"AMDesignator":"AM","Calendar":{"MinSupportedDateTime":"@-62135568000000@","MaxSupportedDateTime":"@253402300799999@","AlgorithmType":1,"CalendarType":1,"Eras":[1],"TwoDigitYearMax":2029,"IsReadOnly":false},"DateSeparator":"/","FirstDayOfWeek":0,"CalendarWeekRule":0,"FullDateTimePattern":"dddd, MMMM dd, yyyy h:mm:ss tt","LongDatePattern":"dddd, MMMM dd, yyyy","LongTimePattern":"h:mm:ss tt","MonthDayPattern":"MMMM dd","PMDesignator":"PM","RFC1123Pattern":"ddd, dd MMM yyyy HH':'mm':'ss 'GMT'","ShortDatePattern":"M/d/yyyy","ShortTimePattern":"h:mm tt","SortableDateTimePattern":"yyyy'-'MM'-'dd'T'HH':'mm':'ss","TimeSeparator":":","UniversalSortableDateTimePattern":"yyyy'-'MM'-'dd HH':'mm':'ss'Z'","YearMonthPattern":"MMMM, yyyy","AbbreviatedDayNames":["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],"ShortestDayNames":["Su","Mo","Tu","We","Th","Fr","Sa"],"DayNames":["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],"AbbreviatedMonthNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthNames":["January","February","March","April","May","June","July","August","September","October","November","December",""],"IsReadOnly":false,"NativeCalendarName":"Gregorian Calendar","AbbreviatedMonthGenitiveNames":["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec",""],"MonthGenitiveNames":["January","February","March","April","May","June","July","August","September","October","November","December",""]},"eras":[1,"A.D.",null,0]});Type.registerNamespace("Sys.Serialization");Sys.Serialization.JavaScriptSerializer=function(){};Sys.Serialization.JavaScriptSerializer.registerClass("Sys.Serialization.JavaScriptSerializer");Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs=[];Sys.Serialization.JavaScriptSerializer._charsToEscape=[];Sys.Serialization.JavaScriptSerializer._dateRegEx=new RegExp('(^|[^\\\\])\\"\\\\/Date\\((-?[0-9]+)(?:[a-zA-Z]|(?:\\+|-)[0-9]{4})?\\)\\\\/\\"',"g");Sys.Serialization.JavaScriptSerializer._escapeChars={};Sys.Serialization.JavaScriptSerializer._escapeRegEx=new RegExp('["\\\\\\x00-\\x1F]',"i");Sys.Serialization.JavaScriptSerializer._escapeRegExGlobal=new RegExp('["\\\\\\x00-\\x1F]',"g");Sys.Serialization.JavaScriptSerializer._jsonRegEx=new RegExp("[^,:{}\\[\\]0-9.\\-+Eaeflnr-u \\n\\r\\t]","g");Sys.Serialization.JavaScriptSerializer._jsonStringRegEx=new RegExp('"(\\\\.|[^"\\\\])*"',"g");Sys.Serialization.JavaScriptSerializer._serverTypeFieldName="__type";Sys.Serialization.JavaScriptSerializer._init=function(){var c=["\\u0000","\\u0001","\\u0002","\\u0003","\\u0004","\\u0005","\\u0006","\\u0007","\\b","\\t","\\n","\\u000b","\\f","\\r","\\u000e","\\u000f","\\u0010","\\u0011","\\u0012","\\u0013","\\u0014","\\u0015","\\u0016","\\u0017","\\u0018","\\u0019","\\u001a","\\u001b","\\u001c","\\u001d","\\u001e","\\u001f"];Sys.Serialization.JavaScriptSerializer._charsToEscape[0]="\\";Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs["\\"]=new RegExp("\\\\","g");Sys.Serialization.JavaScriptSerializer._escapeChars["\\"]="\\\\";Sys.Serialization.JavaScriptSerializer._charsToEscape[1]='"';Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs['"']=new RegExp('"',"g");Sys.Serialization.JavaScriptSerializer._escapeChars['"']='\\"';for(var a=0;a<32;a++){var b=String.fromCharCode(a);Sys.Serialization.JavaScriptSerializer._charsToEscape[a+2]=b;Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs[b]=new RegExp(b,"g");Sys.Serialization.JavaScriptSerializer._escapeChars[b]=c[a]}};Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder=function(b,a){a.append(b.toString())};Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder=function(a,b){if(isFinite(a))b.append(String(a));else throw Error.invalidOperation(Sys.Res.cannotSerializeNonFiniteNumbers)};Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder=function(a,c){c.append('"');if(Sys.Serialization.JavaScriptSerializer._escapeRegEx.test(a)){if(Sys.Serialization.JavaScriptSerializer._charsToEscape.length===0)Sys.Serialization.JavaScriptSerializer._init();if(a.length<128)a=a.replace(Sys.Serialization.JavaScriptSerializer._escapeRegExGlobal,function(a){return Sys.Serialization.JavaScriptSerializer._escapeChars[a]});else for(var d=0;d<34;d++){var b=Sys.Serialization.JavaScriptSerializer._charsToEscape[d];if(a.indexOf(b)!==-1)if(Sys.Browser.agent===Sys.Browser.Opera||Sys.Browser.agent===Sys.Browser.FireFox)a=a.split(b).join(Sys.Serialization.JavaScriptSerializer._escapeChars[b]);else a=a.replace(Sys.Serialization.JavaScriptSerializer._charsToEscapeRegExs[b],Sys.Serialization.JavaScriptSerializer._escapeChars[b])}}c.append(a);c.append('"')};Sys.Serialization.JavaScriptSerializer._serializeWithBuilder=function(b,a,i,g){var c;switch(typeof b){case "object":if(b)if(Number.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder(b,a);else if(Boolean.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder(b,a);else if(String.isInstanceOfType(b))Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder(b,a);else if(Array.isInstanceOfType(b)){a.append("[");for(c=0;c<b.length;++c){if(c>0)a.append(",");Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(b[c],a,false,g)}a.append("]")}else{if(Date.isInstanceOfType(b)){a.append('"\\/Date(');a.append(b.getTime());a.append(')\\/"');break}var d=[],f=0;for(var e in b){if(e.startsWith("$"))continue;if(e===Sys.Serialization.JavaScriptSerializer._serverTypeFieldName&&f!==0){d[f++]=d[0];d[0]=e}else d[f++]=e}if(i)d.sort();a.append("{");var j=false;for(c=0;c<f;c++){var h=b[d[c]];if(typeof h!=="undefined"&&typeof h!=="function"){if(j)a.append(",");else j=true;Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(d[c],a,i,g);a.append(":");Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(h,a,i,g)}}a.append("}")}else a.append("null");break;case "number":Sys.Serialization.JavaScriptSerializer._serializeNumberWithBuilder(b,a);break;case "string":Sys.Serialization.JavaScriptSerializer._serializeStringWithBuilder(b,a);break;case "boolean":Sys.Serialization.JavaScriptSerializer._serializeBooleanWithBuilder(b,a);break;default:a.append("null")}};Sys.Serialization.JavaScriptSerializer.serialize=function(b){var a=new Sys.StringBuilder;Sys.Serialization.JavaScriptSerializer._serializeWithBuilder(b,a,false);return a.toString()};Sys.Serialization.JavaScriptSerializer.deserialize=function(data,secure){if(data.length===0)throw Error.argument("data",Sys.Res.cannotDeserializeEmptyString);try{var exp=data.replace(Sys.Serialization.JavaScriptSerializer._dateRegEx,"$1new Date($2)");if(secure&&Sys.Serialization.JavaScriptSerializer._jsonRegEx.test(exp.replace(Sys.Serialization.JavaScriptSerializer._jsonStringRegEx,"")))throw null;return eval("("+exp+")")}catch(a){throw Error.argument("data",Sys.Res.cannotDeserializeInvalidJson)}};Type.registerNamespace("Sys.UI");Sys.EventHandlerList=function(){this._list={}};Sys.EventHandlerList.prototype={_addHandler:function(b,a){Array.add(this._getEvent(b,true),a)},addHandler:function(b,a){this._addHandler(b,a)},_removeHandler:function(c,b){var a=this._getEvent(c);if(!a)return;Array.remove(a,b)},removeHandler:function(b,a){this._removeHandler(b,a)},getHandler:function(b){var a=this._getEvent(b);if(!a||a.length===0)return null;a=Array.clone(a);return function(c,d){for(var b=0,e=a.length;b<e;b++)a[b](c,d)}},_getEvent:function(a,b){if(!this._list[a]){if(!b)return null;this._list[a]=[]}return this._list[a]}};Sys.EventHandlerList.registerClass("Sys.EventHandlerList");Sys.CommandEventArgs=function(c,a,b){Sys.CommandEventArgs.initializeBase(this);this._commandName=c;this._commandArgument=a;this._commandSource=b};Sys.CommandEventArgs.prototype={_commandName:null,_commandArgument:null,_commandSource:null,get_commandName:function(){return this._commandName},get_commandArgument:function(){return this._commandArgument},get_commandSource:function(){return this._commandSource}};Sys.CommandEventArgs.registerClass("Sys.CommandEventArgs",Sys.CancelEventArgs);Sys.INotifyPropertyChange=function(){};Sys.INotifyPropertyChange.prototype={};Sys.INotifyPropertyChange.registerInterface("Sys.INotifyPropertyChange");Sys.PropertyChangedEventArgs=function(a){Sys.PropertyChangedEventArgs.initializeBase(this);this._propertyName=a};Sys.PropertyChangedEventArgs.prototype={get_propertyName:function(){return this._propertyName}};Sys.PropertyChangedEventArgs.registerClass("Sys.PropertyChangedEventArgs",Sys.EventArgs);Sys.INotifyDisposing=function(){};Sys.INotifyDisposing.prototype={};Sys.INotifyDisposing.registerInterface("Sys.INotifyDisposing");Sys.Component=function(){if(Sys.Application)Sys.Application.registerDisposableObject(this)};Sys.Component.prototype={_id:null,_initialized:false,_updating:false,get_events:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_id:function(){return this._id},set_id:function(a){this._id=a},get_isInitialized:function(){return this._initialized},get_isUpdating:function(){return this._updating},add_disposing:function(a){this.get_events().addHandler("disposing",a)},remove_disposing:function(a){this.get_events().removeHandler("disposing",a)},add_propertyChanged:function(a){this.get_events().addHandler("propertyChanged",a)},remove_propertyChanged:function(a){this.get_events().removeHandler("propertyChanged",a)},beginUpdate:function(){this._updating=true},dispose:function(){if(this._events){var a=this._events.getHandler("disposing");if(a)a(this,Sys.EventArgs.Empty)}delete this._events;Sys.Application.unregisterDisposableObject(this);Sys.Application.removeComponent(this)},endUpdate:function(){this._updating=false;if(!this._initialized)this.initialize();this.updated()},initialize:function(){this._initialized=true},raisePropertyChanged:function(b){if(!this._events)return;var a=this._events.getHandler("propertyChanged");if(a)a(this,new Sys.PropertyChangedEventArgs(b))},updated:function(){}};Sys.Component.registerClass("Sys.Component",null,Sys.IDisposable,Sys.INotifyPropertyChange,Sys.INotifyDisposing);function Sys$Component$_setProperties(a,i){var d,j=Object.getType(a),e=j===Object||j===Sys.UI.DomElement,h=Sys.Component.isInstanceOfType(a)&&!a.get_isUpdating();if(h)a.beginUpdate();for(var c in i){var b=i[c],f=e?null:a["get_"+c];if(e||typeof f!=="function"){var k=a[c];if(!b||typeof b!=="object"||e&&!k)a[c]=b;else Sys$Component$_setProperties(k,b)}else{var l=a["set_"+c];if(typeof l==="function")l.apply(a,[b]);else if(b instanceof Array){d=f.apply(a);for(var g=0,m=d.length,n=b.length;g<n;g++,m++)d[m]=b[g]}else if(typeof b==="object"&&Object.getType(b)===Object){d=f.apply(a);Sys$Component$_setProperties(d,b)}}}if(h)a.endUpdate()}function Sys$Component$_setReferences(c,b){for(var a in b){var e=c["set_"+a],d=$find(b[a]);e.apply(c,[d])}}var $create=Sys.Component.create=function(h,f,d,c,g){var a=g?new h(g):new h,b=Sys.Application,i=b.get_isCreatingComponents();a.beginUpdate();if(f)Sys$Component$_setProperties(a,f);if(d)for(var e in d)a["add_"+e](d[e]);if(a.get_id())b.addComponent(a);if(i){b._createdComponents[b._createdComponents.length]=a;if(c)b._addComponentToSecondPass(a,c);else a.endUpdate()}else{if(c)Sys$Component$_setReferences(a,c);a.endUpdate()}return a};Sys.UI.MouseButton=function(){throw Error.notImplemented()};Sys.UI.MouseButton.prototype={leftButton:0,middleButton:1,rightButton:2};Sys.UI.MouseButton.registerEnum("Sys.UI.MouseButton");Sys.UI.Key=function(){throw Error.notImplemented()};Sys.UI.Key.prototype={backspace:8,tab:9,enter:13,esc:27,space:32,pageUp:33,pageDown:34,end:35,home:36,left:37,up:38,right:39,down:40,del:127};Sys.UI.Key.registerEnum("Sys.UI.Key");Sys.UI.Point=function(a,b){this.x=a;this.y=b};Sys.UI.Point.registerClass("Sys.UI.Point");Sys.UI.Bounds=function(c,d,b,a){this.x=c;this.y=d;this.height=a;this.width=b};Sys.UI.Bounds.registerClass("Sys.UI.Bounds");Sys.UI.DomEvent=function(e){var a=e,b=this.type=a.type.toLowerCase();this.rawEvent=a;this.altKey=a.altKey;if(typeof a.button!=="undefined")this.button=typeof a.which!=="undefined"?a.button:a.button===4?Sys.UI.MouseButton.middleButton:a.button===2?Sys.UI.MouseButton.rightButton:Sys.UI.MouseButton.leftButton;if(b==="keypress")this.charCode=a.charCode||a.keyCode;else if(a.keyCode&&a.keyCode===46)this.keyCode=127;else this.keyCode=a.keyCode;this.clientX=a.clientX;this.clientY=a.clientY;this.ctrlKey=a.ctrlKey;this.target=a.target?a.target:a.srcElement;if(!b.startsWith("key"))if(typeof a.offsetX!=="undefined"&&typeof a.offsetY!=="undefined"){this.offsetX=a.offsetX;this.offsetY=a.offsetY}else if(this.target&&this.target.nodeType!==3&&typeof a.clientX==="number"){var c=Sys.UI.DomElement.getLocation(this.target),d=Sys.UI.DomElement._getWindow(this.target);this.offsetX=(d.pageXOffset||0)+a.clientX-c.x;this.offsetY=(d.pageYOffset||0)+a.clientY-c.y}this.screenX=a.screenX;this.screenY=a.screenY;this.shiftKey=a.shiftKey};Sys.UI.DomEvent.prototype={preventDefault:function(){if(this.rawEvent.preventDefault)this.rawEvent.preventDefault();else if(window.event)this.rawEvent.returnValue=false},stopPropagation:function(){if(this.rawEvent.stopPropagation)this.rawEvent.stopPropagation();else if(window.event)this.rawEvent.cancelBubble=true}};Sys.UI.DomEvent.registerClass("Sys.UI.DomEvent");var $addHandler=Sys.UI.DomEvent.addHandler=function(a,d,e,g){if(!a._events)a._events={};var c=a._events[d];if(!c)a._events[d]=c=[];var b;if(a.addEventListener){b=function(b){return e.call(a,new Sys.UI.DomEvent(b))};a.addEventListener(d,b,false)}else if(a.attachEvent){b=function(){var b={};try{b=Sys.UI.DomElement._getWindow(a).event}catch(c){}return e.call(a,new Sys.UI.DomEvent(b))};a.attachEvent("on"+d,b)}c[c.length]={handler:e,browserHandler:b,autoRemove:g};if(g){var f=a.dispose;if(f!==Sys.UI.DomEvent._disposeHandlers){a.dispose=Sys.UI.DomEvent._disposeHandlers;if(typeof f!=="undefined")a._chainDispose=f}}},$addHandlers=Sys.UI.DomEvent.addHandlers=function(f,d,c,e){for(var b in d){var a=d[b];if(c)a=Function.createDelegate(c,a);$addHandler(f,b,a,e||false)}},$clearHandlers=Sys.UI.DomEvent.clearHandlers=function(a){Sys.UI.DomEvent._clearHandlers(a,false)};Sys.UI.DomEvent._clearHandlers=function(a,g){if(a._events){var e=a._events;for(var b in e){var d=e[b];for(var c=d.length-1;c>=0;c--){var f=d[c];if(!g||f.autoRemove)$removeHandler(a,b,f.handler)}}a._events=null}};Sys.UI.DomEvent._disposeHandlers=function(){Sys.UI.DomEvent._clearHandlers(this,true);var b=this._chainDispose,a=typeof b;if(a!=="undefined"){this.dispose=b;this._chainDispose=null;if(a==="function")this.dispose()}};var $removeHandler=Sys.UI.DomEvent.removeHandler=function(b,a,c){Sys.UI.DomEvent._removeHandler(b,a,c)};Sys.UI.DomEvent._removeHandler=function(a,e,f){var d=null,c=a._events[e];for(var b=0,g=c.length;b<g;b++)if(c[b].handler===f){d=c[b].browserHandler;break}if(a.removeEventListener)a.removeEventListener(e,d,false);else if(a.detachEvent)a.detachEvent("on"+e,d);c.splice(b,1)};Sys.UI.DomElement=function(){};Sys.UI.DomElement.registerClass("Sys.UI.DomElement");Sys.UI.DomElement.addCssClass=function(a,b){if(!Sys.UI.DomElement.containsCssClass(a,b))if(a.className==="")a.className=b;else a.className+=" "+b};Sys.UI.DomElement.containsCssClass=function(b,a){return Array.contains(b.className.split(" "),a)};Sys.UI.DomElement.getBounds=function(a){var b=Sys.UI.DomElement.getLocation(a);return new Sys.UI.Bounds(b.x,b.y,a.offsetWidth||0,a.offsetHeight||0)};var $get=Sys.UI.DomElement.getElementById=function(f,e){if(!e)return document.getElementById(f);if(e.getElementById)return e.getElementById(f);var c=[],d=e.childNodes;for(var b=0;b<d.length;b++){var a=d[b];if(a.nodeType==1)c[c.length]=a}while(c.length){a=c.shift();if(a.id==f)return a;d=a.childNodes;for(b=0;b<d.length;b++){a=d[b];if(a.nodeType==1)c[c.length]=a}}return null};if(document.documentElement.getBoundingClientRect)Sys.UI.DomElement.getLocation=function(b){if(b.self||b.nodeType===9)return new Sys.UI.Point(0,0);var f=b.getBoundingClientRect();if(!f)return new Sys.UI.Point(0,0);var i=b.ownerDocument.documentElement,c=Math.floor(f.left+.5)+i.scrollLeft,d=Math.floor(f.top+.5)+i.scrollTop;if(Sys.Browser.agent===Sys.Browser.InternetExplorer){try{var h=b.ownerDocument.parentWindow.frameElement||null;if(h){var k=h.frameBorder==="0"||h.frameBorder==="no"?2:0;c+=k;d+=k}}catch(l){}if(Sys.Browser.version<=7){var a,j,g,e=document.createElement("div");e.style.cssText="position:absolute !important;left:0px !important;right:0px !important;height:0px !important;width:1px !important;display:hidden !important";try{j=document.body.childNodes[0];document.body.insertBefore(e,j);g=e.getBoundingClientRect();document.body.removeChild(e);a=g.right-g.left}catch(l){}if(a&&a!==1){c=Math.floor(c/a);d=Math.floor(d/a)}}if((document.documentMode||0)<8){c-=2;d-=2}}return new Sys.UI.Point(c,d)};else if(Sys.Browser.agent===Sys.Browser.Safari)Sys.UI.DomElement.getLocation=function(c){if(c.window&&c.window===c||c.nodeType===9)return new Sys.UI.Point(0,0);var d=0,e=0,a,j=null,g=null,b;for(a=c;a;j=a,(g=b,a=a.offsetParent)){b=Sys.UI.DomElement._getCurrentStyle(a);var f=a.tagName?a.tagName.toUpperCase():null;if((a.offsetLeft||a.offsetTop)&&(f!=="BODY"||(!g||g.position!=="absolute"))){d+=a.offsetLeft;e+=a.offsetTop}if(j&&Sys.Browser.version>=3){d+=parseInt(b.borderLeftWidth);e+=parseInt(b.borderTopWidth)}}b=Sys.UI.DomElement._getCurrentStyle(c);var h=b?b.position:null;if(!h||h!=="absolute")for(a=c.parentNode;a;a=a.parentNode){f=a.tagName?a.tagName.toUpperCase():null;if(f!=="BODY"&&f!=="HTML"&&(a.scrollLeft||a.scrollTop)){d-=a.scrollLeft||0;e-=a.scrollTop||0}b=Sys.UI.DomElement._getCurrentStyle(a);var i=b?b.position:null;if(i&&i==="absolute")break}return new Sys.UI.Point(d,e)};else Sys.UI.DomElement.getLocation=function(d){if(d.window&&d.window===d||d.nodeType===9)return new Sys.UI.Point(0,0);var e=0,f=0,a,i=null,g=null,b=null;for(a=d;a;i=a,(g=b,a=a.offsetParent)){var c=a.tagName?a.tagName.toUpperCase():null;b=Sys.UI.DomElement._getCurrentStyle(a);if((a.offsetLeft||a.offsetTop)&&!(c==="BODY"&&(!g||g.position!=="absolute"))){e+=a.offsetLeft;f+=a.offsetTop}if(i!==null&&b){if(c!=="TABLE"&&c!=="TD"&&c!=="HTML"){e+=parseInt(b.borderLeftWidth)||0;f+=parseInt(b.borderTopWidth)||0}if(c==="TABLE"&&(b.position==="relative"||b.position==="absolute")){e+=parseInt(b.marginLeft)||0;f+=parseInt(b.marginTop)||0}}}b=Sys.UI.DomElement._getCurrentStyle(d);var h=b?b.position:null;if(!h||h!=="absolute")for(a=d.parentNode;a;a=a.parentNode){c=a.tagName?a.tagName.toUpperCase():null;if(c!=="BODY"&&c!=="HTML"&&(a.scrollLeft||a.scrollTop)){e-=a.scrollLeft||0;f-=a.scrollTop||0;b=Sys.UI.DomElement._getCurrentStyle(a);if(b){e+=parseInt(b.borderLeftWidth)||0;f+=parseInt(b.borderTopWidth)||0}}}return new Sys.UI.Point(e,f)};Sys.UI.DomElement.isDomElement=function(a){return Sys._isDomElement(a)};Sys.UI.DomElement.removeCssClass=function(d,c){var a=" "+d.className+" ",b=a.indexOf(" "+c+" ");if(b>=0)d.className=(a.substr(0,b)+" "+a.substring(b+c.length+1,a.length)).trim()};Sys.UI.DomElement.resolveElement=function(b,c){var a=b;if(!a)return null;if(typeof a==="string")a=Sys.UI.DomElement.getElementById(a,c);return a};Sys.UI.DomElement.raiseBubbleEvent=function(c,d){var b=c;while(b){var a=b.control;if(a&&a.onBubbleEvent&&a.raiseBubbleEvent){Sys.UI.DomElement._raiseBubbleEventFromControl(a,c,d);return}b=b.parentNode}};Sys.UI.DomElement._raiseBubbleEventFromControl=function(a,b,c){if(!a.onBubbleEvent(b,c))a._raiseBubbleEvent(b,c)};Sys.UI.DomElement.setLocation=function(b,c,d){var a=b.style;a.position="absolute";a.left=c+"px";a.top=d+"px"};Sys.UI.DomElement.toggleCssClass=function(b,a){if(Sys.UI.DomElement.containsCssClass(b,a))Sys.UI.DomElement.removeCssClass(b,a);else Sys.UI.DomElement.addCssClass(b,a)};Sys.UI.DomElement.getVisibilityMode=function(a){return a._visibilityMode===Sys.UI.VisibilityMode.hide?Sys.UI.VisibilityMode.hide:Sys.UI.VisibilityMode.collapse};Sys.UI.DomElement.setVisibilityMode=function(a,b){Sys.UI.DomElement._ensureOldDisplayMode(a);if(a._visibilityMode!==b){a._visibilityMode=b;if(Sys.UI.DomElement.getVisible(a)===false)if(a._visibilityMode===Sys.UI.VisibilityMode.hide)a.style.display=a._oldDisplayMode;else a.style.display="none";a._visibilityMode=b}};Sys.UI.DomElement.getVisible=function(b){var a=b.currentStyle||Sys.UI.DomElement._getCurrentStyle(b);if(!a)return true;return a.visibility!=="hidden"&&a.display!=="none"};Sys.UI.DomElement.setVisible=function(a,b){if(b!==Sys.UI.DomElement.getVisible(a)){Sys.UI.DomElement._ensureOldDisplayMode(a);a.style.visibility=b?"visible":"hidden";if(b||a._visibilityMode===Sys.UI.VisibilityMode.hide)a.style.display=a._oldDisplayMode;else a.style.display="none"}};Sys.UI.DomElement._ensureOldDisplayMode=function(a){if(!a._oldDisplayMode){var b=a.currentStyle||Sys.UI.DomElement._getCurrentStyle(a);a._oldDisplayMode=b?b.display:null;if(!a._oldDisplayMode||a._oldDisplayMode==="none")switch(a.tagName.toUpperCase()){case "DIV":case "P":case "ADDRESS":case "BLOCKQUOTE":case "BODY":case "COL":case "COLGROUP":case "DD":case "DL":case "DT":case "FIELDSET":case "FORM":case "H1":case "H2":case "H3":case "H4":case "H5":case "H6":case "HR":case "IFRAME":case "LEGEND":case "OL":case "PRE":case "TABLE":case "TD":case "TH":case "TR":case "UL":a._oldDisplayMode="block";break;case "LI":a._oldDisplayMode="list-item";break;default:a._oldDisplayMode="inline"}}};Sys.UI.DomElement._getWindow=function(a){var b=a.ownerDocument||a.document||a;return b.defaultView||b.parentWindow};Sys.UI.DomElement._getCurrentStyle=function(a){if(a.nodeType===3)return null;var c=Sys.UI.DomElement._getWindow(a);if(a.documentElement)a=a.documentElement;var b=c&&a!==c&&c.getComputedStyle?c.getComputedStyle(a,null):a.currentStyle||a.style;if(!b&&Sys.Browser.agent===Sys.Browser.Safari&&a.style){var g=a.style.display,f=a.style.position;a.style.position="absolute";a.style.display="block";var e=c.getComputedStyle(a,null);a.style.display=g;a.style.position=f;b={};for(var d in e)b[d]=e[d];b.display="none"}return b};Sys.IContainer=function(){};Sys.IContainer.prototype={};Sys.IContainer.registerInterface("Sys.IContainer");Sys.ApplicationLoadEventArgs=function(b,a){Sys.ApplicationLoadEventArgs.initializeBase(this);this._components=b;this._isPartialLoad=a};Sys.ApplicationLoadEventArgs.prototype={get_components:function(){return this._components},get_isPartialLoad:function(){return this._isPartialLoad}};Sys.ApplicationLoadEventArgs.registerClass("Sys.ApplicationLoadEventArgs",Sys.EventArgs);Sys._Application=function(){Sys._Application.initializeBase(this);this._disposableObjects=[];this._components={};this._createdComponents=[];this._secondPassComponents=[];this._unloadHandlerDelegate=Function.createDelegate(this,this._unloadHandler);Sys.UI.DomEvent.addHandler(window,"unload",this._unloadHandlerDelegate);this._domReady()};Sys._Application.prototype={_creatingComponents:false,_disposing:false,_deleteCount:0,get_isCreatingComponents:function(){return this._creatingComponents},get_isDisposing:function(){return this._disposing},add_init:function(a){if(this._initialized)a(this,Sys.EventArgs.Empty);else this.get_events().addHandler("init",a)},remove_init:function(a){this.get_events().removeHandler("init",a)},add_load:function(a){this.get_events().addHandler("load",a)},remove_load:function(a){this.get_events().removeHandler("load",a)},add_unload:function(a){this.get_events().addHandler("unload",a)},remove_unload:function(a){this.get_events().removeHandler("unload",a)},addComponent:function(a){this._components[a.get_id()]=a},beginCreateComponents:function(){this._creatingComponents=true},dispose:function(){if(!this._disposing){this._disposing=true;if(this._timerCookie){window.clearTimeout(this._timerCookie);delete this._timerCookie}if(this._endRequestHandler){Sys.WebForms.PageRequestManager.getInstance().remove_endRequest(this._endRequestHandler);delete this._endRequestHandler}if(this._beginRequestHandler){Sys.WebForms.PageRequestManager.getInstance().remove_beginRequest(this._beginRequestHandler);delete this._beginRequestHandler}if(window.pageUnload)window.pageUnload(this,Sys.EventArgs.Empty);var c=this.get_events().getHandler("unload");if(c)c(this,Sys.EventArgs.Empty);var b=Array.clone(this._disposableObjects);for(var a=0,f=b.length;a<f;a++){var d=b[a];if(typeof d!=="undefined")d.dispose()}Array.clear(this._disposableObjects);Sys.UI.DomEvent.removeHandler(window,"unload",this._unloadHandlerDelegate);if(Sys._ScriptLoader){var e=Sys._ScriptLoader.getInstance();if(e)e.dispose()}Sys._Application.callBaseMethod(this,"dispose")}},disposeElement:function(a,d){if(a.nodeType===1){var c=a.getElementsByTagName("*");for(var b=c.length-1;b>=0;b--)this._disposeElementInternal(c[b]);if(!d)this._disposeElementInternal(a)}},endCreateComponents:function(){var b=this._secondPassComponents;for(var a=0,d=b.length;a<d;a++){var c=b[a].component;Sys$Component$_setReferences(c,b[a].references);c.endUpdate()}this._secondPassComponents=[];this._creatingComponents=false},findComponent:function(b,a){return a?Sys.IContainer.isInstanceOfType(a)?a.findComponent(b):a[b]||null:Sys.Application._components[b]||null},getComponents:function(){var a=[],b=this._components;for(var c in b)a[a.length]=b[c];return a},initialize:function(){if(!this.get_isInitialized()&&!this._disposing){Sys._Application.callBaseMethod(this,"initialize");this._raiseInit();if(this.get_stateString){if(Sys.WebForms&&Sys.WebForms.PageRequestManager){this._beginRequestHandler=Function.createDelegate(this,this._onPageRequestManagerBeginRequest);Sys.WebForms.PageRequestManager.getInstance().add_beginRequest(this._beginRequestHandler);this._endRequestHandler=Function.createDelegate(this,this._onPageRequestManagerEndRequest);Sys.WebForms.PageRequestManager.getInstance().add_endRequest(this._endRequestHandler)}var a=this.get_stateString();if(a!==this._currentEntry)this._navigate(a);else this._ensureHistory()}this.raiseLoad()}},notifyScriptLoaded:function(){},registerDisposableObject:function(b){if(!this._disposing){var a=this._disposableObjects,c=a.length;a[c]=b;b.__msdisposeindex=c}},raiseLoad:function(){var b=this.get_events().getHandler("load"),a=new Sys.ApplicationLoadEventArgs(Array.clone(this._createdComponents),!!this._loaded);this._loaded=true;if(b)b(this,a);if(window.pageLoad)window.pageLoad(this,a);this._createdComponents=[]},removeComponent:function(b){var a=b.get_id();if(a)delete this._components[a]},unregisterDisposableObject:function(a){if(!this._disposing){var e=a.__msdisposeindex;if(typeof e==="number"){var b=this._disposableObjects;delete b[e];delete a.__msdisposeindex;if(++this._deleteCount>1000){var c=[];for(var d=0,f=b.length;d<f;d++){a=b[d];if(typeof a!=="undefined"){a.__msdisposeindex=c.length;c.push(a)}}this._disposableObjects=c;this._deleteCount=0}}}},_addComponentToSecondPass:function(b,a){this._secondPassComponents[this._secondPassComponents.length]={component:b,references:a}},_disposeComponents:function(a){if(a)for(var b=a.length-1;b>=0;b--){var c=a[b];if(typeof c.dispose==="function")c.dispose()}},_disposeElementInternal:function(a){var d=a.dispose;if(d&&typeof d==="function")a.dispose();else{var c=a.control;if(c&&typeof c.dispose==="function")c.dispose()}var b=a._behaviors;if(b)this._disposeComponents(b);b=a._components;if(b){this._disposeComponents(b);a._components=null}},_domReady:function(){var a,g,f=this;function b(){f.initialize()}var c=function(){Sys.UI.DomEvent.removeHandler(window,"load",c);b()};Sys.UI.DomEvent.addHandler(window,"load",c);if(document.addEventListener)try{document.addEventListener("DOMContentLoaded",a=function(){document.removeEventListener("DOMContentLoaded",a,false);b()},false)}catch(h){}else if(document.attachEvent)if(window==window.top&&document.documentElement.doScroll){var e,d=document.createElement("div");a=function(){try{d.doScroll("left")}catch(c){e=window.setTimeout(a,0);return}d=null;b()};a()}else document.attachEvent("onreadystatechange",a=function(){if(document.readyState==="complete"){document.detachEvent("onreadystatechange",a);b()}})},_raiseInit:function(){var a=this.get_events().getHandler("init");if(a){this.beginCreateComponents();a(this,Sys.EventArgs.Empty);this.endCreateComponents()}},_unloadHandler:function(){this.dispose()}};Sys._Application.registerClass("Sys._Application",Sys.Component,Sys.IContainer);Sys.Application=new Sys._Application;var $find=Sys.Application.findComponent;Sys.UI.Behavior=function(b){Sys.UI.Behavior.initializeBase(this);this._element=b;var a=b._behaviors;if(!a)b._behaviors=[this];else a[a.length]=this};Sys.UI.Behavior.prototype={_name:null,get_element:function(){return this._element},get_id:function(){var a=Sys.UI.Behavior.callBaseMethod(this,"get_id");if(a)return a;if(!this._element||!this._element.id)return "";return this._element.id+"$"+this.get_name()},get_name:function(){if(this._name)return this._name;var a=Object.getTypeName(this),b=a.lastIndexOf(".");if(b!==-1)a=a.substr(b+1);if(!this.get_isInitialized())this._name=a;return a},set_name:function(a){this._name=a},initialize:function(){Sys.UI.Behavior.callBaseMethod(this,"initialize");var a=this.get_name();if(a)this._element[a]=this},dispose:function(){Sys.UI.Behavior.callBaseMethod(this,"dispose");var a=this._element;if(a){var c=this.get_name();if(c)a[c]=null;var b=a._behaviors;Array.remove(b,this);if(b.length===0)a._behaviors=null;delete this._element}}};Sys.UI.Behavior.registerClass("Sys.UI.Behavior",Sys.Component);Sys.UI.Behavior.getBehaviorByName=function(b,c){var a=b[c];return a&&Sys.UI.Behavior.isInstanceOfType(a)?a:null};Sys.UI.Behavior.getBehaviors=function(a){if(!a._behaviors)return [];return Array.clone(a._behaviors)};Sys.UI.Behavior.getBehaviorsByType=function(d,e){var a=d._behaviors,c=[];if(a)for(var b=0,f=a.length;b<f;b++)if(e.isInstanceOfType(a[b]))c[c.length]=a[b];return c};Sys.UI.VisibilityMode=function(){throw Error.notImplemented()};Sys.UI.VisibilityMode.prototype={hide:0,collapse:1};Sys.UI.VisibilityMode.registerEnum("Sys.UI.VisibilityMode");Sys.UI.Control=function(a){Sys.UI.Control.initializeBase(this);this._element=a;a.control=this;var b=this.get_role();if(b)a.setAttribute("role",b)};Sys.UI.Control.prototype={_parent:null,_visibilityMode:Sys.UI.VisibilityMode.hide,get_element:function(){return this._element},get_id:function(){if(!this._element)return "";return this._element.id},set_id:function(){throw Error.invalidOperation(Sys.Res.cantSetId)},get_parent:function(){if(this._parent)return this._parent;if(!this._element)return null;var a=this._element.parentNode;while(a){if(a.control)return a.control;a=a.parentNode}return null},set_parent:function(a){this._parent=a},get_role:function(){return null},get_visibilityMode:function(){return Sys.UI.DomElement.getVisibilityMode(this._element)},set_visibilityMode:function(a){Sys.UI.DomElement.setVisibilityMode(this._element,a)},get_visible:function(){return Sys.UI.DomElement.getVisible(this._element)},set_visible:function(a){Sys.UI.DomElement.setVisible(this._element,a)},addCssClass:function(a){Sys.UI.DomElement.addCssClass(this._element,a)},dispose:function(){Sys.UI.Control.callBaseMethod(this,"dispose");if(this._element){this._element.control=null;delete this._element}if(this._parent)delete this._parent},onBubbleEvent:function(){return false},raiseBubbleEvent:function(a,b){this._raiseBubbleEvent(a,b)},_raiseBubbleEvent:function(b,c){var a=this.get_parent();while(a){if(a.onBubbleEvent(b,c))return;a=a.get_parent()}},removeCssClass:function(a){Sys.UI.DomElement.removeCssClass(this._element,a)},toggleCssClass:function(a){Sys.UI.DomElement.toggleCssClass(this._element,a)}};Sys.UI.Control.registerClass("Sys.UI.Control",Sys.Component);Sys.HistoryEventArgs=function(a){Sys.HistoryEventArgs.initializeBase(this);this._state=a};Sys.HistoryEventArgs.prototype={get_state:function(){return this._state}};Sys.HistoryEventArgs.registerClass("Sys.HistoryEventArgs",Sys.EventArgs);Sys.Application._appLoadHandler=null;Sys.Application._beginRequestHandler=null;Sys.Application._clientId=null;Sys.Application._currentEntry="";Sys.Application._endRequestHandler=null;Sys.Application._history=null;Sys.Application._enableHistory=false;Sys.Application._historyFrame=null;Sys.Application._historyInitialized=false;Sys.Application._historyPointIsNew=false;Sys.Application._ignoreTimer=false;Sys.Application._initialState=null;Sys.Application._state={};Sys.Application._timerCookie=0;Sys.Application._timerHandler=null;Sys.Application._uniqueId=null;Sys._Application.prototype.get_stateString=function(){var a=null;if(Sys.Browser.agent===Sys.Browser.Firefox){var c=window.location.href,b=c.indexOf("#");if(b!==-1)a=c.substring(b+1);else a="";return a}else a=window.location.hash;if(a.length>0&&a.charAt(0)==="#")a=a.substring(1);return a};Sys._Application.prototype.get_enableHistory=function(){return this._enableHistory};Sys._Application.prototype.set_enableHistory=function(a){this._enableHistory=a};Sys._Application.prototype.add_navigate=function(a){this.get_events().addHandler("navigate",a)};Sys._Application.prototype.remove_navigate=function(a){this.get_events().removeHandler("navigate",a)};Sys._Application.prototype.addHistoryPoint=function(c,f){this._ensureHistory();var b=this._state;for(var a in c){var d=c[a];if(d===null){if(typeof b[a]!=="undefined")delete b[a]}else b[a]=d}var e=this._serializeState(b);this._historyPointIsNew=true;this._setState(e,f);this._raiseNavigate()};Sys._Application.prototype.setServerId=function(a,b){this._clientId=a;this._uniqueId=b};Sys._Application.prototype.setServerState=function(a){this._ensureHistory();this._state.__s=a;this._updateHiddenField(a)};Sys._Application.prototype._deserializeState=function(a){var e={};a=a||"";var b=a.indexOf("&&");if(b!==-1&&b+2<a.length){e.__s=a.substr(b+2);a=a.substr(0,b)}var g=a.split("&");for(var f=0,j=g.length;f<j;f++){var d=g[f],c=d.indexOf("=");if(c!==-1&&c+1<d.length){var i=d.substr(0,c),h=d.substr(c+1);e[i]=decodeURIComponent(h)}}return e};Sys._Application.prototype._enableHistoryInScriptManager=function(){this._enableHistory=true};Sys._Application.prototype._ensureHistory=function(){if(!this._historyInitialized&&this._enableHistory){if(Sys.Browser.agent===Sys.Browser.InternetExplorer&&Sys.Browser.documentMode<8){this._historyFrame=document.getElementById("__historyFrame");this._ignoreIFrame=true}this._timerHandler=Function.createDelegate(this,this._onIdle);this._timerCookie=window.setTimeout(this._timerHandler,100);try{this._initialState=this._deserializeState(this.get_stateString())}catch(a){}this._historyInitialized=true}};Sys._Application.prototype._navigate=function(c){this._ensureHistory();var b=this._deserializeState(c);if(this._uniqueId){var d=this._state.__s||"",a=b.__s||"";if(a!==d){this._updateHiddenField(a);__doPostBack(this._uniqueId,a);this._state=b;return}}this._setState(c);this._state=b;this._raiseNavigate()};Sys._Application.prototype._onIdle=function(){delete this._timerCookie;var a=this.get_stateString();if(a!==this._currentEntry){if(!this._ignoreTimer){this._historyPointIsNew=false;this._navigate(a)}}else this._ignoreTimer=false;this._timerCookie=window.setTimeout(this._timerHandler,100)};Sys._Application.prototype._onIFrameLoad=function(a){this._ensureHistory();if(!this._ignoreIFrame){this._historyPointIsNew=false;this._navigate(a)}this._ignoreIFrame=false};Sys._Application.prototype._onPageRequestManagerBeginRequest=function(){this._ignoreTimer=true};Sys._Application.prototype._onPageRequestManagerEndRequest=function(e,d){var b=d.get_dataItems()[this._clientId],a=document.getElementById("__EVENTTARGET");if(a&&a.value===this._uniqueId)a.value="";if(typeof b!=="undefined"){this.setServerState(b);this._historyPointIsNew=true}else this._ignoreTimer=false;var c=this._serializeState(this._state);if(c!==this._currentEntry){this._ignoreTimer=true;this._setState(c);this._raiseNavigate()}};Sys._Application.prototype._raiseNavigate=function(){var c=this.get_events().getHandler("navigate"),b={};for(var a in this._state)if(a!=="__s")b[a]=this._state[a];var d=new Sys.HistoryEventArgs(b);if(c)c(this,d);var e;try{if(Sys.Browser.agent===Sys.Browser.Firefox&&window.location.hash&&(!window.frameElement||window.top.location.hash))window.history.go(0)}catch(f){}};Sys._Application.prototype._serializeState=function(d){var b=[];for(var a in d){var e=d[a];if(a==="__s")var c=e;else b[b.length]=a+"="+encodeURIComponent(e)}return b.join("&")+(c?"&&"+c:"")};Sys._Application.prototype._setState=function(a,b){if(this._enableHistory){a=a||"";if(a!==this._currentEntry){if(window.theForm){var d=window.theForm.action,e=d.indexOf("#");window.theForm.action=(e!==-1?d.substring(0,e):d)+"#"+a}if(this._historyFrame&&this._historyPointIsNew){this._ignoreIFrame=true;var c=this._historyFrame.contentWindow.document;c.open("javascript:'<html></html>'");c.write("<html><head><title>"+(b||document.title)+"</title><scri"+'pt type="text/javascript">parent.Sys.Application._onIFrameLoad('+Sys.Serialization.JavaScriptSerializer.serialize(a)+");</scri"+"pt></head><body></body></html>");c.close()}this._ignoreTimer=false;this._currentEntry=a;if(this._historyFrame||this._historyPointIsNew){var f=this.get_stateString();if(a!==f){window.location.hash=a;this._currentEntry=this.get_stateString();if(typeof b!=="undefined"&&b!==null)document.title=b}}this._historyPointIsNew=false}}};Sys._Application.prototype._updateHiddenField=function(b){if(this._clientId){var a=document.getElementById(this._clientId);if(a)a.value=b}};if(!window.XMLHttpRequest)window.XMLHttpRequest=function(){var b=["Msxml2.XMLHTTP.3.0","Msxml2.XMLHTTP"];for(var a=0,c=b.length;a<c;a++)try{return new ActiveXObject(b[a])}catch(d){}return null};Type.registerNamespace("Sys.Net");Sys.Net.WebRequestExecutor=function(){this._webRequest=null;this._resultObject=null};Sys.Net.WebRequestExecutor.prototype={get_webRequest:function(){return this._webRequest},_set_webRequest:function(a){this._webRequest=a},get_started:function(){throw Error.notImplemented()},get_responseAvailable:function(){throw Error.notImplemented()},get_timedOut:function(){throw Error.notImplemented()},get_aborted:function(){throw Error.notImplemented()},get_responseData:function(){throw Error.notImplemented()},get_statusCode:function(){throw Error.notImplemented()},get_statusText:function(){throw Error.notImplemented()},get_xml:function(){throw Error.notImplemented()},get_object:function(){if(!this._resultObject)this._resultObject=Sys.Serialization.JavaScriptSerializer.deserialize(this.get_responseData());return this._resultObject},executeRequest:function(){throw Error.notImplemented()},abort:function(){throw Error.notImplemented()},getResponseHeader:function(){throw Error.notImplemented()},getAllResponseHeaders:function(){throw Error.notImplemented()}};Sys.Net.WebRequestExecutor.registerClass("Sys.Net.WebRequestExecutor");Sys.Net.XMLDOM=function(d){if(!window.DOMParser){var c=["Msxml2.DOMDocument.3.0","Msxml2.DOMDocument"];for(var b=0,f=c.length;b<f;b++)try{var a=new ActiveXObject(c[b]);a.async=false;a.loadXML(d);a.setProperty("SelectionLanguage","XPath");return a}catch(g){}}else try{var e=new window.DOMParser;return e.parseFromString(d,"text/xml")}catch(g){}return null};Sys.Net.XMLHttpExecutor=function(){Sys.Net.XMLHttpExecutor.initializeBase(this);var a=this;this._xmlHttpRequest=null;this._webRequest=null;this._responseAvailable=false;this._timedOut=false;this._timer=null;this._aborted=false;this._started=false;this._onReadyStateChange=function(){if(a._xmlHttpRequest.readyState===4){try{if(typeof a._xmlHttpRequest.status==="undefined")return}catch(b){return}a._clearTimer();a._responseAvailable=true;try{a._webRequest.completed(Sys.EventArgs.Empty)}finally{if(a._xmlHttpRequest!=null){a._xmlHttpRequest.onreadystatechange=Function.emptyMethod;a._xmlHttpRequest=null}}}};this._clearTimer=function(){if(a._timer!=null){window.clearTimeout(a._timer);a._timer=null}};this._onTimeout=function(){if(!a._responseAvailable){a._clearTimer();a._timedOut=true;a._xmlHttpRequest.onreadystatechange=Function.emptyMethod;a._xmlHttpRequest.abort();a._webRequest.completed(Sys.EventArgs.Empty);a._xmlHttpRequest=null}}};Sys.Net.XMLHttpExecutor.prototype={get_timedOut:function(){return this._timedOut},get_started:function(){return this._started},get_responseAvailable:function(){return this._responseAvailable},get_aborted:function(){return this._aborted},executeRequest:function(){this._webRequest=this.get_webRequest();var c=this._webRequest.get_body(),a=this._webRequest.get_headers();this._xmlHttpRequest=new XMLHttpRequest;this._xmlHttpRequest.onreadystatechange=this._onReadyStateChange;var e=this._webRequest.get_httpVerb();this._xmlHttpRequest.open(e,this._webRequest.getResolvedUrl(),true);this._xmlHttpRequest.setRequestHeader("X-Requested-With","XMLHttpRequest");if(a)for(var b in a){var f=a[b];if(typeof f!=="function")this._xmlHttpRequest.setRequestHeader(b,f)}if(e.toLowerCase()==="post"){if(a===null||!a["Content-Type"])this._xmlHttpRequest.setRequestHeader("Content-Type","application/x-www-form-urlencoded; charset=utf-8");if(!c)c=""}var d=this._webRequest.get_timeout();if(d>0)this._timer=window.setTimeout(Function.createDelegate(this,this._onTimeout),d);this._xmlHttpRequest.send(c);this._started=true},getResponseHeader:function(b){var a;try{a=this._xmlHttpRequest.getResponseHeader(b)}catch(c){}if(!a)a="";return a},getAllResponseHeaders:function(){return this._xmlHttpRequest.getAllResponseHeaders()},get_responseData:function(){return this._xmlHttpRequest.responseText},get_statusCode:function(){var a=0;try{a=this._xmlHttpRequest.status}catch(b){}return a},get_statusText:function(){return this._xmlHttpRequest.statusText},get_xml:function(){var a=this._xmlHttpRequest.responseXML;if(!a||!a.documentElement){a=Sys.Net.XMLDOM(this._xmlHttpRequest.responseText);if(!a||!a.documentElement)return null}else if(navigator.userAgent.indexOf("MSIE")!==-1)a.setProperty("SelectionLanguage","XPath");if(a.documentElement.namespaceURI==="http://www.mozilla.org/newlayout/xml/parsererror.xml"&&a.documentElement.tagName==="parsererror")return null;if(a.documentElement.firstChild&&a.documentElement.firstChild.tagName==="parsererror")return null;return a},abort:function(){if(this._aborted||this._responseAvailable||this._timedOut)return;this._aborted=true;this._clearTimer();if(this._xmlHttpRequest&&!this._responseAvailable){this._xmlHttpRequest.onreadystatechange=Function.emptyMethod;this._xmlHttpRequest.abort();this._xmlHttpRequest=null;this._webRequest.completed(Sys.EventArgs.Empty)}}};Sys.Net.XMLHttpExecutor.registerClass("Sys.Net.XMLHttpExecutor",Sys.Net.WebRequestExecutor);Sys.Net._WebRequestManager=function(){this._defaultTimeout=0;this._defaultExecutorType="Sys.Net.XMLHttpExecutor"};Sys.Net._WebRequestManager.prototype={add_invokingRequest:function(a){this._get_eventHandlerList().addHandler("invokingRequest",a)},remove_invokingRequest:function(a){this._get_eventHandlerList().removeHandler("invokingRequest",a)},add_completedRequest:function(a){this._get_eventHandlerList().addHandler("completedRequest",a)},remove_completedRequest:function(a){this._get_eventHandlerList().removeHandler("completedRequest",a)},_get_eventHandlerList:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_defaultTimeout:function(){return this._defaultTimeout},set_defaultTimeout:function(a){this._defaultTimeout=a},get_defaultExecutorType:function(){return this._defaultExecutorType},set_defaultExecutorType:function(a){this._defaultExecutorType=a},executeRequest:function(webRequest){var executor=webRequest.get_executor();if(!executor){var failed=false;try{var executorType=eval(this._defaultExecutorType);executor=new executorType}catch(a){failed=true}webRequest.set_executor(executor)}if(executor.get_aborted())return;var evArgs=new Sys.Net.NetworkRequestEventArgs(webRequest),handler=this._get_eventHandlerList().getHandler("invokingRequest");if(handler)handler(this,evArgs);if(!evArgs.get_cancel())executor.executeRequest()}};Sys.Net._WebRequestManager.registerClass("Sys.Net._WebRequestManager");Sys.Net.WebRequestManager=new Sys.Net._WebRequestManager;Sys.Net.NetworkRequestEventArgs=function(a){Sys.Net.NetworkRequestEventArgs.initializeBase(this);this._webRequest=a};Sys.Net.NetworkRequestEventArgs.prototype={get_webRequest:function(){return this._webRequest}};Sys.Net.NetworkRequestEventArgs.registerClass("Sys.Net.NetworkRequestEventArgs",Sys.CancelEventArgs);Sys.Net.WebRequest=function(){this._url="";this._headers={};this._body=null;this._userContext=null;this._httpVerb=null;this._executor=null;this._invokeCalled=false;this._timeout=0};Sys.Net.WebRequest.prototype={add_completed:function(a){this._get_eventHandlerList().addHandler("completed",a)},remove_completed:function(a){this._get_eventHandlerList().removeHandler("completed",a)},completed:function(b){var a=Sys.Net.WebRequestManager._get_eventHandlerList().getHandler("completedRequest");if(a)a(this._executor,b);a=this._get_eventHandlerList().getHandler("completed");if(a)a(this._executor,b)},_get_eventHandlerList:function(){if(!this._events)this._events=new Sys.EventHandlerList;return this._events},get_url:function(){return this._url},set_url:function(a){this._url=a},get_headers:function(){return this._headers},get_httpVerb:function(){if(this._httpVerb===null){if(this._body===null)return "GET";return "POST"}return this._httpVerb},set_httpVerb:function(a){this._httpVerb=a},get_body:function(){return this._body},set_body:function(a){this._body=a},get_userContext:function(){return this._userContext},set_userContext:function(a){this._userContext=a},get_executor:function(){return this._executor},set_executor:function(a){this._executor=a;this._executor._set_webRequest(this)},get_timeout:function(){if(this._timeout===0)return Sys.Net.WebRequestManager.get_defaultTimeout();return this._timeout},set_timeout:function(a){this._timeout=a},getResolvedUrl:function(){return Sys.Net.WebRequest._resolveUrl(this._url)},invoke:function(){Sys.Net.WebRequestManager.executeRequest(this);this._invokeCalled=true}};Sys.Net.WebRequest._resolveUrl=function(b,a){if(b&&b.indexOf("://")!==-1)return b;if(!a||a.length===0){var d=document.getElementsByTagName("base")[0];if(d&&d.href&&d.href.length>0)a=d.href;else a=document.URL}var c=a.indexOf("?");if(c!==-1)a=a.substr(0,c);c=a.indexOf("#");if(c!==-1)a=a.substr(0,c);a=a.substr(0,a.lastIndexOf("/")+1);if(!b||b.length===0)return a;if(b.charAt(0)==="/"){var e=a.indexOf("://"),g=a.indexOf("/",e+3);return a.substr(0,g)+b}else{var f=a.lastIndexOf("/");return a.substr(0,f+1)+b}};Sys.Net.WebRequest._createQueryString=function(c,b,f){b=b||encodeURIComponent;var h=0,e,g,d,a=new Sys.StringBuilder;if(c)for(d in c){e=c[d];if(typeof e==="function")continue;g=Sys.Serialization.JavaScriptSerializer.serialize(e);if(h++)a.append("&");a.append(d);a.append("=");a.append(b(g))}if(f){if(h)a.append("&");a.append(f)}return a.toString()};Sys.Net.WebRequest._createUrl=function(a,b,c){if(!b&&!c)return a;var d=Sys.Net.WebRequest._createQueryString(b,null,c);return d.length?a+(a&&a.indexOf("?")>=0?"&":"?")+d:a};Sys.Net.WebRequest.registerClass("Sys.Net.WebRequest");Sys._ScriptLoaderTask=function(b,a){this._scriptElement=b;this._completedCallback=a};Sys._ScriptLoaderTask.prototype={get_scriptElement:function(){return this._scriptElement},dispose:function(){if(this._disposed)return;this._disposed=true;this._removeScriptElementHandlers();Sys._ScriptLoaderTask._clearScript(this._scriptElement);this._scriptElement=null},execute:function(){this._addScriptElementHandlers();document.getElementsByTagName("head")[0].appendChild(this._scriptElement)},_addScriptElementHandlers:function(){this._scriptLoadDelegate=Function.createDelegate(this,this._scriptLoadHandler);if(Sys.Browser.agent!==Sys.Browser.InternetExplorer){this._scriptElement.readyState="loaded";$addHandler(this._scriptElement,"load",this._scriptLoadDelegate)}else $addHandler(this._scriptElement,"readystatechange",this._scriptLoadDelegate);if(this._scriptElement.addEventListener){this._scriptErrorDelegate=Function.createDelegate(this,this._scriptErrorHandler);this._scriptElement.addEventListener("error",this._scriptErrorDelegate,false)}},_removeScriptElementHandlers:function(){if(this._scriptLoadDelegate){var a=this.get_scriptElement();if(Sys.Browser.agent!==Sys.Browser.InternetExplorer)$removeHandler(a,"load",this._scriptLoadDelegate);else $removeHandler(a,"readystatechange",this._scriptLoadDelegate);if(this._scriptErrorDelegate){this._scriptElement.removeEventListener("error",this._scriptErrorDelegate,false);this._scriptErrorDelegate=null}this._scriptLoadDelegate=null}},_scriptErrorHandler:function(){if(this._disposed)return;this._completedCallback(this.get_scriptElement(),false)},_scriptLoadHandler:function(){if(this._disposed)return;var a=this.get_scriptElement();if(a.readyState!=="loaded"&&a.readyState!=="complete")return;this._completedCallback(a,true)}};Sys._ScriptLoaderTask.registerClass("Sys._ScriptLoaderTask",null,Sys.IDisposable);Sys._ScriptLoaderTask._clearScript=function(a){if(!Sys.Debug.isDebug)a.parentNode.removeChild(a)};Type.registerNamespace("Sys.Net");Sys.Net.WebServiceProxy=function(){};Sys.Net.WebServiceProxy.prototype={get_timeout:function(){return this._timeout||0},set_timeout:function(a){if(a<0)throw Error.argumentOutOfRange("value",a,Sys.Res.invalidTimeout);this._timeout=a},get_defaultUserContext:function(){return typeof this._userContext==="undefined"?null:this._userContext},set_defaultUserContext:function(a){this._userContext=a},get_defaultSucceededCallback:function(){return this._succeeded||null},set_defaultSucceededCallback:function(a){this._succeeded=a},get_defaultFailedCallback:function(){return this._failed||null},set_defaultFailedCallback:function(a){this._failed=a},get_enableJsonp:function(){return !!this._jsonp},set_enableJsonp:function(a){this._jsonp=a},get_path:function(){return this._path||null},set_path:function(a){this._path=a},get_jsonpCallbackParameter:function(){return this._callbackParameter||"callback"},set_jsonpCallbackParameter:function(a){this._callbackParameter=a},_invoke:function(d,e,g,f,c,b,a){c=c||this.get_defaultSucceededCallback();b=b||this.get_defaultFailedCallback();if(a===null||typeof a==="undefined")a=this.get_defaultUserContext();return Sys.Net.WebServiceProxy.invoke(d,e,g,f,c,b,a,this.get_timeout(),this.get_enableJsonp(),this.get_jsonpCallbackParameter())}};Sys.Net.WebServiceProxy.registerClass("Sys.Net.WebServiceProxy");Sys.Net.WebServiceProxy.invoke=function(q,a,m,l,j,b,g,e,w,p){var i=w!==false?Sys.Net.WebServiceProxy._xdomain.exec(q):null,c,n=i&&i.length===3&&(i[1]!==location.protocol||i[2]!==location.host);m=n||m;if(n){p=p||"callback";c="_jsonp"+Sys._jsonp++}if(!l)l={};var r=l;if(!m||!r)r={};var s,h,f=null,k,o=null,u=Sys.Net.WebRequest._createUrl(a?q+"/"+encodeURIComponent(a):q,r,n?p+"=Sys."+c:null);if(n){s=document.createElement("script");s.src=u;k=new Sys._ScriptLoaderTask(s,function(d,b){if(!b||c)t({Message:String.format(Sys.Res.webServiceFailedNoMsg,a)},-1)});function v(){if(f===null)return;f=null;h=new Sys.Net.WebServiceError(true,String.format(Sys.Res.webServiceTimedOut,a));k.dispose();delete Sys[c];if(b)b(h,g,a)}function t(d,e){if(f!==null){window.clearTimeout(f);f=null}k.dispose();delete Sys[c];c=null;if(typeof e!=="undefined"&&e!==200){if(b){h=new Sys.Net.WebServiceError(false,d.Message||String.format(Sys.Res.webServiceFailedNoMsg,a),d.StackTrace||null,d.ExceptionType||null,d);h._statusCode=e;b(h,g,a)}}else if(j)j(d,g,a)}Sys[c]=t;e=e||Sys.Net.WebRequestManager.get_defaultTimeout();if(e>0)f=window.setTimeout(v,e);k.execute();return null}var d=new Sys.Net.WebRequest;d.set_url(u);d.get_headers()["Content-Type"]="application/json; charset=utf-8";if(!m){o=Sys.Serialization.JavaScriptSerializer.serialize(l);if(o==="{}")o=""}d.set_body(o);d.add_completed(x);if(e&&e>0)d.set_timeout(e);d.invoke();function x(d){if(d.get_responseAvailable()){var f=d.get_statusCode(),c=null;try{var e=d.getResponseHeader("Content-Type");if(e.startsWith("application/json"))c=d.get_object();else if(e.startsWith("text/xml"))c=d.get_xml();else c=d.get_responseData()}catch(m){}var k=d.getResponseHeader("jsonerror"),h=k==="true";if(h){if(c)c=new Sys.Net.WebServiceError(false,c.Message,c.StackTrace,c.ExceptionType,c)}else if(e.startsWith("application/json"))c=!c||typeof c.d==="undefined"?c:c.d;if(f<200||f>=300||h){if(b){if(!c||!h)c=new Sys.Net.WebServiceError(false,String.format(Sys.Res.webServiceFailedNoMsg,a));c._statusCode=f;b(c,g,a)}}else if(j)j(c,g,a)}else{var i;if(d.get_timedOut())i=String.format(Sys.Res.webServiceTimedOut,a);else i=String.format(Sys.Res.webServiceFailedNoMsg,a);if(b)b(new Sys.Net.WebServiceError(d.get_timedOut(),i,"",""),g,a)}}return d};Sys.Net.WebServiceProxy._generateTypedConstructor=function(a){return function(b){if(b)for(var c in b)this[c]=b[c];this.__type=a}};Sys._jsonp=0;Sys.Net.WebServiceProxy._xdomain=/^\s*([a-zA-Z0-9\+\-\.]+\:)\/\/([^?#\/]+)/;Sys.Net.WebServiceError=function(d,e,c,a,b){this._timedOut=d;this._message=e;this._stackTrace=c;this._exceptionType=a;this._errorObject=b;this._statusCode=-1};Sys.Net.WebServiceError.prototype={get_timedOut:function(){return this._timedOut},get_statusCode:function(){return this._statusCode},get_message:function(){return this._message},get_stackTrace:function(){return this._stackTrace||""},get_exceptionType:function(){return this._exceptionType||""},get_errorObject:function(){return this._errorObject||null}};Sys.Net.WebServiceError.registerClass("Sys.Net.WebServiceError"); +Type.registerNamespace('Sys');Sys.Res={'argumentInteger':'Value must be an integer.','invokeCalledTwice':'Cannot call invoke more than once.','webServiceFailed':'The server method \'{0}\' failed with the following error: {1}','argumentType':'Object cannot be converted to the required type.','argumentNull':'Value cannot be null.','scriptAlreadyLoaded':'The script \'{0}\' has been referenced multiple times. If referencing Microsoft AJAX scripts explicitly, set the MicrosoftAjaxMode property of the ScriptManager to Explicit.','scriptDependencyNotFound':'The script \'{0}\' failed to load because it is dependent on script \'{1}\'.','formatBadFormatSpecifier':'Format specifier was invalid.','requiredScriptReferenceNotIncluded':'\'{0}\' requires that you have included a script reference to \'{1}\'.','webServiceFailedNoMsg':'The server method \'{0}\' failed.','argumentDomElement':'Value must be a DOM element.','invalidExecutorType':'Could not create a valid Sys.Net.WebRequestExecutor from: {0}.','cannotCallBeforeResponse':'Cannot call {0} when responseAvailable is false.','actualValue':'Actual value was {0}.','enumInvalidValue':'\'{0}\' is not a valid value for enum {1}.','scriptLoadFailed':'The script \'{0}\' could not be loaded.','parameterCount':'Parameter count mismatch.','cannotDeserializeEmptyString':'Cannot deserialize empty string.','formatInvalidString':'Input string was not in a correct format.','invalidTimeout':'Value must be greater than or equal to zero.','cannotAbortBeforeStart':'Cannot abort when executor has not started.','argument':'Value does not fall within the expected range.','cannotDeserializeInvalidJson':'Cannot deserialize. The data does not correspond to valid JSON.','invalidHttpVerb':'httpVerb cannot be set to an empty or null string.','nullWebRequest':'Cannot call executeRequest with a null webRequest.','eventHandlerInvalid':'Handler was not added through the Sys.UI.DomEvent.addHandler method.','cannotSerializeNonFiniteNumbers':'Cannot serialize non finite numbers.','argumentUndefined':'Value cannot be undefined.','webServiceInvalidReturnType':'The server method \'{0}\' returned an invalid type. Expected type: {1}','servicePathNotSet':'The path to the web service has not been set.','argumentTypeWithTypes':'Object of type \'{0}\' cannot be converted to type \'{1}\'.','cannotCallOnceStarted':'Cannot call {0} once started.','badBaseUrl1':'Base URL does not contain ://.','badBaseUrl2':'Base URL does not contain another /.','badBaseUrl3':'Cannot find last / in base URL.','setExecutorAfterActive':'Cannot set executor after it has become active.','paramName':'Parameter name: {0}','nullReferenceInPath':'Null reference while evaluating data path: \'{0}\'.','cannotCallOutsideHandler':'Cannot call {0} outside of a completed event handler.','cannotSerializeObjectWithCycle':'Cannot serialize object with cyclic reference within child properties.','format':'One of the identified items was in an invalid format.','assertFailedCaller':'Assertion Failed: {0}\r\nat {1}','argumentOutOfRange':'Specified argument was out of the range of valid values.','webServiceTimedOut':'The server method \'{0}\' timed out.','notImplemented':'The method or operation is not implemented.','assertFailed':'Assertion Failed: {0}','invalidOperation':'Operation is not valid due to the current state of the object.','breakIntoDebugger':'{0}\r\n\r\nBreak into debugger?'};
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/MicrosoftMvcAjax.debug.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,408 @@ +//!---------------------------------------------------------- +//! Copyright (C) Microsoft Corporation. All rights reserved. +//!---------------------------------------------------------- +//! MicrosoftMvcAjax.js + +Type.registerNamespace('Sys.Mvc'); + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.AjaxOptions + +Sys.Mvc.$create_AjaxOptions = function Sys_Mvc_AjaxOptions() { return {}; } + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.InsertionMode + +Sys.Mvc.InsertionMode = function() { + /// <field name="replace" type="Number" integer="true" static="true"> + /// </field> + /// <field name="insertBefore" type="Number" integer="true" static="true"> + /// </field> + /// <field name="insertAfter" type="Number" integer="true" static="true"> + /// </field> +}; +Sys.Mvc.InsertionMode.prototype = { + replace: 0, + insertBefore: 1, + insertAfter: 2 +} +Sys.Mvc.InsertionMode.registerEnum('Sys.Mvc.InsertionMode', false); + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.AjaxContext + +Sys.Mvc.AjaxContext = function Sys_Mvc_AjaxContext(request, updateTarget, loadingElement, insertionMode) { + /// <param name="request" type="Sys.Net.WebRequest"> + /// </param> + /// <param name="updateTarget" type="Object" domElement="true"> + /// </param> + /// <param name="loadingElement" type="Object" domElement="true"> + /// </param> + /// <param name="insertionMode" type="Sys.Mvc.InsertionMode"> + /// </param> + /// <field name="_insertionMode" type="Sys.Mvc.InsertionMode"> + /// </field> + /// <field name="_loadingElement" type="Object" domElement="true"> + /// </field> + /// <field name="_response" type="Sys.Net.WebRequestExecutor"> + /// </field> + /// <field name="_request" type="Sys.Net.WebRequest"> + /// </field> + /// <field name="_updateTarget" type="Object" domElement="true"> + /// </field> + this._request = request; + this._updateTarget = updateTarget; + this._loadingElement = loadingElement; + this._insertionMode = insertionMode; +} +Sys.Mvc.AjaxContext.prototype = { + _insertionMode: 0, + _loadingElement: null, + _response: null, + _request: null, + _updateTarget: null, + + get_data: function Sys_Mvc_AjaxContext$get_data() { + /// <value type="String"></value> + if (this._response) { + return this._response.get_responseData(); + } + else { + return null; + } + }, + + get_insertionMode: function Sys_Mvc_AjaxContext$get_insertionMode() { + /// <value type="Sys.Mvc.InsertionMode"></value> + return this._insertionMode; + }, + + get_loadingElement: function Sys_Mvc_AjaxContext$get_loadingElement() { + /// <value type="Object" domElement="true"></value> + return this._loadingElement; + }, + + get_object: function Sys_Mvc_AjaxContext$get_object() { + /// <value type="Object"></value> + var executor = this.get_response(); + return (executor) ? executor.get_object() : null; + }, + + get_response: function Sys_Mvc_AjaxContext$get_response() { + /// <value type="Sys.Net.WebRequestExecutor"></value> + return this._response; + }, + set_response: function Sys_Mvc_AjaxContext$set_response(value) { + /// <value type="Sys.Net.WebRequestExecutor"></value> + this._response = value; + return value; + }, + + get_request: function Sys_Mvc_AjaxContext$get_request() { + /// <value type="Sys.Net.WebRequest"></value> + return this._request; + }, + + get_updateTarget: function Sys_Mvc_AjaxContext$get_updateTarget() { + /// <value type="Object" domElement="true"></value> + return this._updateTarget; + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.AsyncHyperlink + +Sys.Mvc.AsyncHyperlink = function Sys_Mvc_AsyncHyperlink() { +} +Sys.Mvc.AsyncHyperlink.handleClick = function Sys_Mvc_AsyncHyperlink$handleClick(anchor, evt, ajaxOptions) { + /// <param name="anchor" type="Object" domElement="true"> + /// </param> + /// <param name="evt" type="Sys.UI.DomEvent"> + /// </param> + /// <param name="ajaxOptions" type="Sys.Mvc.AjaxOptions"> + /// </param> + evt.preventDefault(); + Sys.Mvc.MvcHelpers._asyncRequest(anchor.href, 'post', '', anchor, ajaxOptions); +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.MvcHelpers + +Sys.Mvc.MvcHelpers = function Sys_Mvc_MvcHelpers() { +} +Sys.Mvc.MvcHelpers._serializeSubmitButton = function Sys_Mvc_MvcHelpers$_serializeSubmitButton(element, offsetX, offsetY) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + /// <param name="offsetX" type="Number" integer="true"> + /// </param> + /// <param name="offsetY" type="Number" integer="true"> + /// </param> + /// <returns type="String"></returns> + if (element.disabled) { + return null; + } + var name = element.name; + if (name) { + var tagName = element.tagName.toUpperCase(); + var encodedName = encodeURIComponent(name); + var inputElement = element; + if (tagName === 'INPUT') { + var type = inputElement.type; + if (type === 'submit') { + return encodedName + '=' + encodeURIComponent(inputElement.value); + } + else if (type === 'image') { + return encodedName + '.x=' + offsetX + '&' + encodedName + '.y=' + offsetY; + } + } + else if ((tagName === 'BUTTON') && (name.length) && (inputElement.type === 'submit')) { + return encodedName + '=' + encodeURIComponent(inputElement.value); + } + } + return null; +} +Sys.Mvc.MvcHelpers._serializeForm = function Sys_Mvc_MvcHelpers$_serializeForm(form) { + /// <param name="form" type="Object" domElement="true"> + /// </param> + /// <returns type="String"></returns> + var formElements = form.elements; + var formBody = new Sys.StringBuilder(); + var count = formElements.length; + for (var i = 0; i < count; i++) { + var element = formElements[i]; + var name = element.name; + if (!name || !name.length) { + continue; + } + var tagName = element.tagName.toUpperCase(); + if (tagName === 'INPUT') { + var inputElement = element; + var type = inputElement.type; + if ((type === 'text') || (type === 'password') || (type === 'hidden') || (((type === 'checkbox') || (type === 'radio')) && element.checked)) { + formBody.append(encodeURIComponent(name)); + formBody.append('='); + formBody.append(encodeURIComponent(inputElement.value)); + formBody.append('&'); + } + } + else if (tagName === 'SELECT') { + var selectElement = element; + var optionCount = selectElement.options.length; + for (var j = 0; j < optionCount; j++) { + var optionElement = selectElement.options[j]; + if (optionElement.selected) { + formBody.append(encodeURIComponent(name)); + formBody.append('='); + formBody.append(encodeURIComponent(optionElement.value)); + formBody.append('&'); + } + } + } + else if (tagName === 'TEXTAREA') { + formBody.append(encodeURIComponent(name)); + formBody.append('='); + formBody.append(encodeURIComponent((element.value))); + formBody.append('&'); + } + } + var additionalInput = form._additionalInput; + if (additionalInput) { + formBody.append(additionalInput); + formBody.append('&'); + } + return formBody.toString(); +} +Sys.Mvc.MvcHelpers._asyncRequest = function Sys_Mvc_MvcHelpers$_asyncRequest(url, verb, body, triggerElement, ajaxOptions) { + /// <param name="url" type="String"> + /// </param> + /// <param name="verb" type="String"> + /// </param> + /// <param name="body" type="String"> + /// </param> + /// <param name="triggerElement" type="Object" domElement="true"> + /// </param> + /// <param name="ajaxOptions" type="Sys.Mvc.AjaxOptions"> + /// </param> + if (ajaxOptions.confirm) { + if (!confirm(ajaxOptions.confirm)) { + return; + } + } + if (ajaxOptions.url) { + url = ajaxOptions.url; + } + if (ajaxOptions.httpMethod) { + verb = ajaxOptions.httpMethod; + } + if (body.length > 0 && !body.endsWith('&')) { + body += '&'; + } + body += 'X-Requested-With=XMLHttpRequest'; + var upperCaseVerb = verb.toUpperCase(); + var isGetOrPost = (upperCaseVerb === 'GET' || upperCaseVerb === 'POST'); + if (!isGetOrPost) { + body += '&'; + body += 'X-HTTP-Method-Override=' + upperCaseVerb; + } + var requestBody = ''; + if (upperCaseVerb === 'GET' || upperCaseVerb === 'DELETE') { + if (url.indexOf('?') > -1) { + if (!url.endsWith('&')) { + url += '&'; + } + url += body; + } + else { + url += '?'; + url += body; + } + } + else { + requestBody = body; + } + var request = new Sys.Net.WebRequest(); + request.set_url(url); + if (isGetOrPost) { + request.set_httpVerb(verb); + } + else { + request.set_httpVerb('POST'); + request.get_headers()['X-HTTP-Method-Override'] = upperCaseVerb; + } + request.set_body(requestBody); + if (verb.toUpperCase() === 'PUT') { + request.get_headers()['Content-Type'] = 'application/x-www-form-urlencoded;'; + } + request.get_headers()['X-Requested-With'] = 'XMLHttpRequest'; + var updateElement = null; + if (ajaxOptions.updateTargetId) { + updateElement = $get(ajaxOptions.updateTargetId); + } + var loadingElement = null; + if (ajaxOptions.loadingElementId) { + loadingElement = $get(ajaxOptions.loadingElementId); + } + var ajaxContext = new Sys.Mvc.AjaxContext(request, updateElement, loadingElement, ajaxOptions.insertionMode); + var continueRequest = true; + if (ajaxOptions.onBegin) { + continueRequest = ajaxOptions.onBegin(ajaxContext) !== false; + } + if (loadingElement) { + Sys.UI.DomElement.setVisible(ajaxContext.get_loadingElement(), true); + } + if (continueRequest) { + request.add_completed(Function.createDelegate(null, function(executor) { + Sys.Mvc.MvcHelpers._onComplete(request, ajaxOptions, ajaxContext); + })); + request.invoke(); + } +} +Sys.Mvc.MvcHelpers._onComplete = function Sys_Mvc_MvcHelpers$_onComplete(request, ajaxOptions, ajaxContext) { + /// <param name="request" type="Sys.Net.WebRequest"> + /// </param> + /// <param name="ajaxOptions" type="Sys.Mvc.AjaxOptions"> + /// </param> + /// <param name="ajaxContext" type="Sys.Mvc.AjaxContext"> + /// </param> + ajaxContext.set_response(request.get_executor()); + if (ajaxOptions.onComplete && ajaxOptions.onComplete(ajaxContext) === false) { + return; + } + var statusCode = ajaxContext.get_response().get_statusCode(); + if ((statusCode >= 200 && statusCode < 300) || statusCode === 304 || statusCode === 1223) { + if (statusCode !== 204 && statusCode !== 304 && statusCode !== 1223) { + var contentType = ajaxContext.get_response().getResponseHeader('Content-Type'); + if ((contentType) && (contentType.indexOf('application/x-javascript') !== -1)) { + eval(ajaxContext.get_data()); + } + else { + Sys.Mvc.MvcHelpers.updateDomElement(ajaxContext.get_updateTarget(), ajaxContext.get_insertionMode(), ajaxContext.get_data()); + } + } + if (ajaxOptions.onSuccess) { + ajaxOptions.onSuccess(ajaxContext); + } + } + else { + if (ajaxOptions.onFailure) { + ajaxOptions.onFailure(ajaxContext); + } + } + if (ajaxContext.get_loadingElement()) { + Sys.UI.DomElement.setVisible(ajaxContext.get_loadingElement(), false); + } +} +Sys.Mvc.MvcHelpers.updateDomElement = function Sys_Mvc_MvcHelpers$updateDomElement(target, insertionMode, content) { + /// <param name="target" type="Object" domElement="true"> + /// </param> + /// <param name="insertionMode" type="Sys.Mvc.InsertionMode"> + /// </param> + /// <param name="content" type="String"> + /// </param> + if (target) { + switch (insertionMode) { + case Sys.Mvc.InsertionMode.replace: + target.innerHTML = content; + break; + case Sys.Mvc.InsertionMode.insertBefore: + if (content && content.length > 0) { + target.innerHTML = content + target.innerHTML.trimStart(); + } + break; + case Sys.Mvc.InsertionMode.insertAfter: + if (content && content.length > 0) { + target.innerHTML = target.innerHTML.trimEnd() + content; + } + break; + } + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.AsyncForm + +Sys.Mvc.AsyncForm = function Sys_Mvc_AsyncForm() { +} +Sys.Mvc.AsyncForm.handleClick = function Sys_Mvc_AsyncForm$handleClick(form, evt) { + /// <param name="form" type="Object" domElement="true"> + /// </param> + /// <param name="evt" type="Sys.UI.DomEvent"> + /// </param> + var additionalInput = Sys.Mvc.MvcHelpers._serializeSubmitButton(evt.target, evt.offsetX, evt.offsetY); + form._additionalInput = additionalInput; +} +Sys.Mvc.AsyncForm.handleSubmit = function Sys_Mvc_AsyncForm$handleSubmit(form, evt, ajaxOptions) { + /// <param name="form" type="Object" domElement="true"> + /// </param> + /// <param name="evt" type="Sys.UI.DomEvent"> + /// </param> + /// <param name="ajaxOptions" type="Sys.Mvc.AjaxOptions"> + /// </param> + evt.preventDefault(); + var validationCallbacks = form.validationCallbacks; + if (validationCallbacks) { + for (var i = 0; i < validationCallbacks.length; i++) { + var callback = validationCallbacks[i]; + if (!callback()) { + return; + } + } + } + var body = Sys.Mvc.MvcHelpers._serializeForm(form); + Sys.Mvc.MvcHelpers._asyncRequest(form.action, form.method || 'post', body, form, ajaxOptions); +} + + +Sys.Mvc.AjaxContext.registerClass('Sys.Mvc.AjaxContext'); +Sys.Mvc.AsyncHyperlink.registerClass('Sys.Mvc.AsyncHyperlink'); +Sys.Mvc.MvcHelpers.registerClass('Sys.Mvc.MvcHelpers'); +Sys.Mvc.AsyncForm.registerClass('Sys.Mvc.AsyncForm'); + +// ---- Do not remove this footer ---- +// Generated using Script# v0.5.0.0 (http://projects.nikhilk.net) +// -----------------------------------
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/MicrosoftMvcAjax.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,25 @@ +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftMvcAjax.js + +Type.registerNamespace('Sys.Mvc');Sys.Mvc.$create_AjaxOptions=function(){return {};} +Sys.Mvc.InsertionMode=function(){};Sys.Mvc.InsertionMode.prototype = {replace:0,insertBefore:1,insertAfter:2} +Sys.Mvc.InsertionMode.registerEnum('Sys.Mvc.InsertionMode',false);Sys.Mvc.AjaxContext=function(request,updateTarget,loadingElement,insertionMode){this.$3=request;this.$4=updateTarget;this.$1=loadingElement;this.$0=insertionMode;} +Sys.Mvc.AjaxContext.prototype={$0:0,$1:null,$2:null,$3:null,$4:null,get_data:function(){if(this.$2){return this.$2.get_responseData();}else{return null;}},get_insertionMode:function(){return this.$0;},get_loadingElement:function(){return this.$1;},get_object:function(){var $0=this.get_response();return ($0)?$0.get_object():null;},get_response:function(){return this.$2;},set_response:function(value){this.$2=value;return value;},get_request:function(){return this.$3;},get_updateTarget:function(){return this.$4;}} +Sys.Mvc.AsyncHyperlink=function(){} +Sys.Mvc.AsyncHyperlink.handleClick=function(anchor,evt,ajaxOptions){evt.preventDefault();Sys.Mvc.MvcHelpers.$2(anchor.href,'post','',anchor,ajaxOptions);} +Sys.Mvc.MvcHelpers=function(){} +Sys.Mvc.MvcHelpers.$0=function($p0,$p1,$p2){if($p0.disabled){return null;}var $0=$p0.name;if($0){var $1=$p0.tagName.toUpperCase();var $2=encodeURIComponent($0);var $3=$p0;if($1==='INPUT'){var $4=$3.type;if($4==='submit'){return $2+'='+encodeURIComponent($3.value);}else if($4==='image'){return $2+'.x='+$p1+'&'+$2+'.y='+$p2;}}else if(($1==='BUTTON')&&($0.length)&&($3.type==='submit')){return $2+'='+encodeURIComponent($3.value);}}return null;} +Sys.Mvc.MvcHelpers.$1=function($p0){var $0=$p0.elements;var $1=new Sys.StringBuilder();var $2=$0.length;for(var $4=0;$4<$2;$4++){var $5=$0[$4];var $6=$5.name;if(!$6||!$6.length){continue;}var $7=$5.tagName.toUpperCase();if($7==='INPUT'){var $8=$5;var $9=$8.type;if(($9==='text')||($9==='password')||($9==='hidden')||((($9==='checkbox')||($9==='radio'))&&$5.checked)){$1.append(encodeURIComponent($6));$1.append('=');$1.append(encodeURIComponent($8.value));$1.append('&');}}else if($7==='SELECT'){var $A=$5;var $B=$A.options.length;for(var $C=0;$C<$B;$C++){var $D=$A.options[$C];if($D.selected){$1.append(encodeURIComponent($6));$1.append('=');$1.append(encodeURIComponent($D.value));$1.append('&');}}}else if($7==='TEXTAREA'){$1.append(encodeURIComponent($6));$1.append('=');$1.append(encodeURIComponent(($5.value)));$1.append('&');}}var $3=$p0._additionalInput;if($3){$1.append($3);$1.append('&');}return $1.toString();} +Sys.Mvc.MvcHelpers.$2=function($p0,$p1,$p2,$p3,$p4){if($p4.confirm){if(!confirm($p4.confirm)){return;}}if($p4.url){$p0=$p4.url;}if($p4.httpMethod){$p1=$p4.httpMethod;}if($p2.length>0&&!$p2.endsWith('&')){$p2+='&';}$p2+='X-Requested-With=XMLHttpRequest';var $0=$p1.toUpperCase();var $1=($0==='GET'||$0==='POST');if(!$1){$p2+='&';$p2+='X-HTTP-Method-Override='+$0;}var $2='';if($0==='GET'||$0==='DELETE'){if($p0.indexOf('?')>-1){if(!$p0.endsWith('&')){$p0+='&';}$p0+=$p2;}else{$p0+='?';$p0+=$p2;}}else{$2=$p2;}var $3=new Sys.Net.WebRequest();$3.set_url($p0);if($1){$3.set_httpVerb($p1);}else{$3.set_httpVerb('POST');$3.get_headers()['X-HTTP-Method-Override']=$0;}$3.set_body($2);if($p1.toUpperCase()==='PUT'){$3.get_headers()['Content-Type']='application/x-www-form-urlencoded;';}$3.get_headers()['X-Requested-With']='XMLHttpRequest';var $4=null;if($p4.updateTargetId){$4=$get($p4.updateTargetId);}var $5=null;if($p4.loadingElementId){$5=$get($p4.loadingElementId);}var $6=new Sys.Mvc.AjaxContext($3,$4,$5,$p4.insertionMode);var $7=true;if($p4.onBegin){$7=$p4.onBegin($6)!==false;}if($5){Sys.UI.DomElement.setVisible($6.get_loadingElement(),true);}if($7){$3.add_completed(Function.createDelegate(null,function($p1_0){ +Sys.Mvc.MvcHelpers.$3($3,$p4,$6);}));$3.invoke();}} +Sys.Mvc.MvcHelpers.$3=function($p0,$p1,$p2){$p2.set_response($p0.get_executor());if($p1.onComplete&&$p1.onComplete($p2)===false){return;}var $0=$p2.get_response().get_statusCode();if(($0>=200&&$0<300)||$0===304||$0===1223){if($0!==204&&$0!==304&&$0!==1223){var $1=$p2.get_response().getResponseHeader('Content-Type');if(($1)&&($1.indexOf('application/x-javascript')!==-1)){eval($p2.get_data());}else{Sys.Mvc.MvcHelpers.updateDomElement($p2.get_updateTarget(),$p2.get_insertionMode(),$p2.get_data());}}if($p1.onSuccess){$p1.onSuccess($p2);}}else{if($p1.onFailure){$p1.onFailure($p2);}}if($p2.get_loadingElement()){Sys.UI.DomElement.setVisible($p2.get_loadingElement(),false);}} +Sys.Mvc.MvcHelpers.updateDomElement=function(target,insertionMode,content){if(target){switch(insertionMode){case 0:target.innerHTML=content;break;case 1:if(content&&content.length>0){target.innerHTML=content+target.innerHTML.trimStart();}break;case 2:if(content&&content.length>0){target.innerHTML=target.innerHTML.trimEnd()+content;}break;}}} +Sys.Mvc.AsyncForm=function(){} +Sys.Mvc.AsyncForm.handleClick=function(form,evt){var $0=Sys.Mvc.MvcHelpers.$0(evt.target,evt.offsetX,evt.offsetY);form._additionalInput = $0;} +Sys.Mvc.AsyncForm.handleSubmit=function(form,evt,ajaxOptions){evt.preventDefault();var $0=form.validationCallbacks;if($0){for(var $2=0;$2<$0.length;$2++){var $3=$0[$2];if(!$3()){return;}}}var $1=Sys.Mvc.MvcHelpers.$1(form);Sys.Mvc.MvcHelpers.$2(form.action,form.method||'post',$1,form,ajaxOptions);} +Sys.Mvc.AjaxContext.registerClass('Sys.Mvc.AjaxContext');Sys.Mvc.AsyncHyperlink.registerClass('Sys.Mvc.AsyncHyperlink');Sys.Mvc.MvcHelpers.registerClass('Sys.Mvc.MvcHelpers');Sys.Mvc.AsyncForm.registerClass('Sys.Mvc.AsyncForm'); +// ---- Do not remove this footer ---- +// Generated using Script# v0.5.0.0 (http://projects.nikhilk.net) +// -----------------------------------
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/MicrosoftMvcValidation.debug.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,883 @@ +//!---------------------------------------------------------- +//! Copyright (C) Microsoft Corporation. All rights reserved. +//!---------------------------------------------------------- +//! MicrosoftMvcValidation.js + + +Type.registerNamespace('Sys.Mvc'); + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.Validation + +Sys.Mvc.$create_Validation = function Sys_Mvc_Validation() { return {}; } + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.JsonValidationField + +Sys.Mvc.$create_JsonValidationField = function Sys_Mvc_JsonValidationField() { return {}; } + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.JsonValidationOptions + +Sys.Mvc.$create_JsonValidationOptions = function Sys_Mvc_JsonValidationOptions() { return {}; } + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.JsonValidationRule + +Sys.Mvc.$create_JsonValidationRule = function Sys_Mvc_JsonValidationRule() { return {}; } + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.ValidationContext + +Sys.Mvc.$create_ValidationContext = function Sys_Mvc_ValidationContext() { return {}; } + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.NumberValidator + +Sys.Mvc.NumberValidator = function Sys_Mvc_NumberValidator() { +} +Sys.Mvc.NumberValidator.create = function Sys_Mvc_NumberValidator$create(rule) { + /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> + /// </param> + /// <returns type="Sys.Mvc.Validator"></returns> + return Function.createDelegate(new Sys.Mvc.NumberValidator(), new Sys.Mvc.NumberValidator().validate); +} +Sys.Mvc.NumberValidator.prototype = { + + validate: function Sys_Mvc_NumberValidator$validate(value, context) { + /// <param name="value" type="String"> + /// </param> + /// <param name="context" type="Sys.Mvc.ValidationContext"> + /// </param> + /// <returns type="Object"></returns> + if (Sys.Mvc._validationUtil.stringIsNullOrEmpty(value)) { + return true; + } + var n = Number.parseLocale(value); + return (!isNaN(n)); + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.FormContext + +Sys.Mvc.FormContext = function Sys_Mvc_FormContext(formElement, validationSummaryElement) { + /// <param name="formElement" type="Object" domElement="true"> + /// </param> + /// <param name="validationSummaryElement" type="Object" domElement="true"> + /// </param> + /// <field name="_validationSummaryErrorCss" type="String" static="true"> + /// </field> + /// <field name="_validationSummaryValidCss" type="String" static="true"> + /// </field> + /// <field name="_formValidationTag" type="String" static="true"> + /// </field> + /// <field name="_onClickHandler" type="Sys.UI.DomEventHandler"> + /// </field> + /// <field name="_onSubmitHandler" type="Sys.UI.DomEventHandler"> + /// </field> + /// <field name="_errors" type="Array"> + /// </field> + /// <field name="_submitButtonClicked" type="Object" domElement="true"> + /// </field> + /// <field name="_validationSummaryElement" type="Object" domElement="true"> + /// </field> + /// <field name="_validationSummaryULElement" type="Object" domElement="true"> + /// </field> + /// <field name="fields" type="Array" elementType="FieldContext"> + /// </field> + /// <field name="_formElement" type="Object" domElement="true"> + /// </field> + /// <field name="replaceValidationSummary" type="Boolean"> + /// </field> + this._errors = []; + this.fields = new Array(0); + this._formElement = formElement; + this._validationSummaryElement = validationSummaryElement; + formElement[Sys.Mvc.FormContext._formValidationTag] = this; + if (validationSummaryElement) { + var ulElements = validationSummaryElement.getElementsByTagName('ul'); + if (ulElements.length > 0) { + this._validationSummaryULElement = ulElements[0]; + } + } + this._onClickHandler = Function.createDelegate(this, this._form_OnClick); + this._onSubmitHandler = Function.createDelegate(this, this._form_OnSubmit); +} +Sys.Mvc.FormContext._Application_Load = function Sys_Mvc_FormContext$_Application_Load() { + var allFormOptions = window.mvcClientValidationMetadata; + if (allFormOptions) { + while (allFormOptions.length > 0) { + var thisFormOptions = allFormOptions.pop(); + Sys.Mvc.FormContext._parseJsonOptions(thisFormOptions); + } + } +} +Sys.Mvc.FormContext._getFormElementsWithName = function Sys_Mvc_FormContext$_getFormElementsWithName(formElement, name) { + /// <param name="formElement" type="Object" domElement="true"> + /// </param> + /// <param name="name" type="String"> + /// </param> + /// <returns type="Array" elementType="Object" elementDomElement="true"></returns> + var allElementsWithNameInForm = []; + var allElementsWithName = document.getElementsByName(name); + for (var i = 0; i < allElementsWithName.length; i++) { + var thisElement = allElementsWithName[i]; + if (Sys.Mvc.FormContext._isElementInHierarchy(formElement, thisElement)) { + Array.add(allElementsWithNameInForm, thisElement); + } + } + return allElementsWithNameInForm; +} +Sys.Mvc.FormContext.getValidationForForm = function Sys_Mvc_FormContext$getValidationForForm(formElement) { + /// <param name="formElement" type="Object" domElement="true"> + /// </param> + /// <returns type="Sys.Mvc.FormContext"></returns> + return formElement[Sys.Mvc.FormContext._formValidationTag]; +} +Sys.Mvc.FormContext._isElementInHierarchy = function Sys_Mvc_FormContext$_isElementInHierarchy(parent, child) { + /// <param name="parent" type="Object" domElement="true"> + /// </param> + /// <param name="child" type="Object" domElement="true"> + /// </param> + /// <returns type="Boolean"></returns> + while (child) { + if (parent === child) { + return true; + } + child = child.parentNode; + } + return false; +} +Sys.Mvc.FormContext._parseJsonOptions = function Sys_Mvc_FormContext$_parseJsonOptions(options) { + /// <param name="options" type="Sys.Mvc.JsonValidationOptions"> + /// </param> + /// <returns type="Sys.Mvc.FormContext"></returns> + var formElement = $get(options.FormId); + var validationSummaryElement = (!Sys.Mvc._validationUtil.stringIsNullOrEmpty(options.ValidationSummaryId)) ? $get(options.ValidationSummaryId) : null; + var formContext = new Sys.Mvc.FormContext(formElement, validationSummaryElement); + formContext.enableDynamicValidation(); + formContext.replaceValidationSummary = options.ReplaceValidationSummary; + for (var i = 0; i < options.Fields.length; i++) { + var field = options.Fields[i]; + var fieldElements = Sys.Mvc.FormContext._getFormElementsWithName(formElement, field.FieldName); + var validationMessageElement = (!Sys.Mvc._validationUtil.stringIsNullOrEmpty(field.ValidationMessageId)) ? $get(field.ValidationMessageId) : null; + var fieldContext = new Sys.Mvc.FieldContext(formContext); + Array.addRange(fieldContext.elements, fieldElements); + fieldContext.validationMessageElement = validationMessageElement; + fieldContext.replaceValidationMessageContents = field.ReplaceValidationMessageContents; + for (var j = 0; j < field.ValidationRules.length; j++) { + var rule = field.ValidationRules[j]; + var validator = Sys.Mvc.ValidatorRegistry.getValidator(rule); + if (validator) { + var validation = Sys.Mvc.$create_Validation(); + validation.fieldErrorMessage = rule.ErrorMessage; + validation.validator = validator; + Array.add(fieldContext.validations, validation); + } + } + fieldContext.enableDynamicValidation(); + Array.add(formContext.fields, fieldContext); + } + var registeredValidatorCallbacks = formElement.validationCallbacks; + if (!registeredValidatorCallbacks) { + registeredValidatorCallbacks = []; + formElement.validationCallbacks = registeredValidatorCallbacks; + } + registeredValidatorCallbacks.push(Function.createDelegate(null, function() { + return Sys.Mvc._validationUtil.arrayIsNullOrEmpty(formContext.validate('submit')); + })); + return formContext; +} +Sys.Mvc.FormContext.prototype = { + _onClickHandler: null, + _onSubmitHandler: null, + _submitButtonClicked: null, + _validationSummaryElement: null, + _validationSummaryULElement: null, + _formElement: null, + replaceValidationSummary: false, + + addError: function Sys_Mvc_FormContext$addError(message) { + /// <param name="message" type="String"> + /// </param> + this.addErrors([ message ]); + }, + + addErrors: function Sys_Mvc_FormContext$addErrors(messages) { + /// <param name="messages" type="Array" elementType="String"> + /// </param> + if (!Sys.Mvc._validationUtil.arrayIsNullOrEmpty(messages)) { + Array.addRange(this._errors, messages); + this._onErrorCountChanged(); + } + }, + + clearErrors: function Sys_Mvc_FormContext$clearErrors() { + Array.clear(this._errors); + this._onErrorCountChanged(); + }, + + _displayError: function Sys_Mvc_FormContext$_displayError() { + if (this._validationSummaryElement) { + if (this._validationSummaryULElement) { + Sys.Mvc._validationUtil.removeAllChildren(this._validationSummaryULElement); + for (var i = 0; i < this._errors.length; i++) { + var liElement = document.createElement('li'); + Sys.Mvc._validationUtil.setInnerText(liElement, this._errors[i]); + this._validationSummaryULElement.appendChild(liElement); + } + } + Sys.UI.DomElement.removeCssClass(this._validationSummaryElement, Sys.Mvc.FormContext._validationSummaryValidCss); + Sys.UI.DomElement.addCssClass(this._validationSummaryElement, Sys.Mvc.FormContext._validationSummaryErrorCss); + } + }, + + _displaySuccess: function Sys_Mvc_FormContext$_displaySuccess() { + var validationSummaryElement = this._validationSummaryElement; + if (validationSummaryElement) { + var validationSummaryULElement = this._validationSummaryULElement; + if (validationSummaryULElement) { + validationSummaryULElement.innerHTML = ''; + } + Sys.UI.DomElement.removeCssClass(validationSummaryElement, Sys.Mvc.FormContext._validationSummaryErrorCss); + Sys.UI.DomElement.addCssClass(validationSummaryElement, Sys.Mvc.FormContext._validationSummaryValidCss); + } + }, + + enableDynamicValidation: function Sys_Mvc_FormContext$enableDynamicValidation() { + Sys.UI.DomEvent.addHandler(this._formElement, 'click', this._onClickHandler); + Sys.UI.DomEvent.addHandler(this._formElement, 'submit', this._onSubmitHandler); + }, + + _findSubmitButton: function Sys_Mvc_FormContext$_findSubmitButton(element) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + /// <returns type="Object" domElement="true"></returns> + if (element.disabled) { + return null; + } + var tagName = element.tagName.toUpperCase(); + var inputElement = element; + if (tagName === 'INPUT') { + var type = inputElement.type; + if (type === 'submit' || type === 'image') { + return inputElement; + } + } + else if ((tagName === 'BUTTON') && (inputElement.type === 'submit')) { + return inputElement; + } + return null; + }, + + _form_OnClick: function Sys_Mvc_FormContext$_form_OnClick(e) { + /// <param name="e" type="Sys.UI.DomEvent"> + /// </param> + this._submitButtonClicked = this._findSubmitButton(e.target); + }, + + _form_OnSubmit: function Sys_Mvc_FormContext$_form_OnSubmit(e) { + /// <param name="e" type="Sys.UI.DomEvent"> + /// </param> + var form = e.target; + var submitButton = this._submitButtonClicked; + if (submitButton && submitButton.disableValidation) { + return; + } + var errorMessages = this.validate('submit'); + if (!Sys.Mvc._validationUtil.arrayIsNullOrEmpty(errorMessages)) { + e.preventDefault(); + } + }, + + _onErrorCountChanged: function Sys_Mvc_FormContext$_onErrorCountChanged() { + if (!this._errors.length) { + this._displaySuccess(); + } + else { + this._displayError(); + } + }, + + validate: function Sys_Mvc_FormContext$validate(eventName) { + /// <param name="eventName" type="String"> + /// </param> + /// <returns type="Array" elementType="String"></returns> + var fields = this.fields; + var errors = []; + for (var i = 0; i < fields.length; i++) { + var field = fields[i]; + if (!field.elements[0].disabled) { + var thisErrors = field.validate(eventName); + if (thisErrors) { + Array.addRange(errors, thisErrors); + } + } + } + if (this.replaceValidationSummary) { + this.clearErrors(); + this.addErrors(errors); + } + return errors; + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.FieldContext + +Sys.Mvc.FieldContext = function Sys_Mvc_FieldContext(formContext) { + /// <param name="formContext" type="Sys.Mvc.FormContext"> + /// </param> + /// <field name="_hasTextChangedTag" type="String" static="true"> + /// </field> + /// <field name="_hasValidationFiredTag" type="String" static="true"> + /// </field> + /// <field name="_inputElementErrorCss" type="String" static="true"> + /// </field> + /// <field name="_inputElementValidCss" type="String" static="true"> + /// </field> + /// <field name="_validationMessageErrorCss" type="String" static="true"> + /// </field> + /// <field name="_validationMessageValidCss" type="String" static="true"> + /// </field> + /// <field name="_onBlurHandler" type="Sys.UI.DomEventHandler"> + /// </field> + /// <field name="_onChangeHandler" type="Sys.UI.DomEventHandler"> + /// </field> + /// <field name="_onInputHandler" type="Sys.UI.DomEventHandler"> + /// </field> + /// <field name="_onPropertyChangeHandler" type="Sys.UI.DomEventHandler"> + /// </field> + /// <field name="_errors" type="Array"> + /// </field> + /// <field name="defaultErrorMessage" type="String"> + /// </field> + /// <field name="elements" type="Array" elementType="Object" elementDomElement="true"> + /// </field> + /// <field name="formContext" type="Sys.Mvc.FormContext"> + /// </field> + /// <field name="replaceValidationMessageContents" type="Boolean"> + /// </field> + /// <field name="validationMessageElement" type="Object" domElement="true"> + /// </field> + /// <field name="validations" type="Array" elementType="Validation"> + /// </field> + this._errors = []; + this.elements = new Array(0); + this.validations = new Array(0); + this.formContext = formContext; + this._onBlurHandler = Function.createDelegate(this, this._element_OnBlur); + this._onChangeHandler = Function.createDelegate(this, this._element_OnChange); + this._onInputHandler = Function.createDelegate(this, this._element_OnInput); + this._onPropertyChangeHandler = Function.createDelegate(this, this._element_OnPropertyChange); +} +Sys.Mvc.FieldContext.prototype = { + _onBlurHandler: null, + _onChangeHandler: null, + _onInputHandler: null, + _onPropertyChangeHandler: null, + defaultErrorMessage: null, + formContext: null, + replaceValidationMessageContents: false, + validationMessageElement: null, + + addError: function Sys_Mvc_FieldContext$addError(message) { + /// <param name="message" type="String"> + /// </param> + this.addErrors([ message ]); + }, + + addErrors: function Sys_Mvc_FieldContext$addErrors(messages) { + /// <param name="messages" type="Array" elementType="String"> + /// </param> + if (!Sys.Mvc._validationUtil.arrayIsNullOrEmpty(messages)) { + Array.addRange(this._errors, messages); + this._onErrorCountChanged(); + } + }, + + clearErrors: function Sys_Mvc_FieldContext$clearErrors() { + Array.clear(this._errors); + this._onErrorCountChanged(); + }, + + _displayError: function Sys_Mvc_FieldContext$_displayError() { + var validationMessageElement = this.validationMessageElement; + if (validationMessageElement) { + if (this.replaceValidationMessageContents) { + Sys.Mvc._validationUtil.setInnerText(validationMessageElement, this._errors[0]); + } + Sys.UI.DomElement.removeCssClass(validationMessageElement, Sys.Mvc.FieldContext._validationMessageValidCss); + Sys.UI.DomElement.addCssClass(validationMessageElement, Sys.Mvc.FieldContext._validationMessageErrorCss); + } + var elements = this.elements; + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + Sys.UI.DomElement.removeCssClass(element, Sys.Mvc.FieldContext._inputElementValidCss); + Sys.UI.DomElement.addCssClass(element, Sys.Mvc.FieldContext._inputElementErrorCss); + } + }, + + _displaySuccess: function Sys_Mvc_FieldContext$_displaySuccess() { + var validationMessageElement = this.validationMessageElement; + if (validationMessageElement) { + if (this.replaceValidationMessageContents) { + Sys.Mvc._validationUtil.setInnerText(validationMessageElement, ''); + } + Sys.UI.DomElement.removeCssClass(validationMessageElement, Sys.Mvc.FieldContext._validationMessageErrorCss); + Sys.UI.DomElement.addCssClass(validationMessageElement, Sys.Mvc.FieldContext._validationMessageValidCss); + } + var elements = this.elements; + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + Sys.UI.DomElement.removeCssClass(element, Sys.Mvc.FieldContext._inputElementErrorCss); + Sys.UI.DomElement.addCssClass(element, Sys.Mvc.FieldContext._inputElementValidCss); + } + }, + + _element_OnBlur: function Sys_Mvc_FieldContext$_element_OnBlur(e) { + /// <param name="e" type="Sys.UI.DomEvent"> + /// </param> + if (e.target[Sys.Mvc.FieldContext._hasTextChangedTag] || e.target[Sys.Mvc.FieldContext._hasValidationFiredTag]) { + this.validate('blur'); + } + }, + + _element_OnChange: function Sys_Mvc_FieldContext$_element_OnChange(e) { + /// <param name="e" type="Sys.UI.DomEvent"> + /// </param> + e.target[Sys.Mvc.FieldContext._hasTextChangedTag] = true; + }, + + _element_OnInput: function Sys_Mvc_FieldContext$_element_OnInput(e) { + /// <param name="e" type="Sys.UI.DomEvent"> + /// </param> + e.target[Sys.Mvc.FieldContext._hasTextChangedTag] = true; + if (e.target[Sys.Mvc.FieldContext._hasValidationFiredTag]) { + this.validate('input'); + } + }, + + _element_OnPropertyChange: function Sys_Mvc_FieldContext$_element_OnPropertyChange(e) { + /// <param name="e" type="Sys.UI.DomEvent"> + /// </param> + if (e.rawEvent.propertyName === 'value') { + e.target[Sys.Mvc.FieldContext._hasTextChangedTag] = true; + if (e.target[Sys.Mvc.FieldContext._hasValidationFiredTag]) { + this.validate('input'); + } + } + }, + + enableDynamicValidation: function Sys_Mvc_FieldContext$enableDynamicValidation() { + var elements = this.elements; + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + if (Sys.Mvc._validationUtil.elementSupportsEvent(element, 'onpropertychange')) { + var compatMode = document.documentMode; + if (compatMode && compatMode >= 8) { + Sys.UI.DomEvent.addHandler(element, 'propertychange', this._onPropertyChangeHandler); + } + } + else { + Sys.UI.DomEvent.addHandler(element, 'input', this._onInputHandler); + } + Sys.UI.DomEvent.addHandler(element, 'change', this._onChangeHandler); + Sys.UI.DomEvent.addHandler(element, 'blur', this._onBlurHandler); + } + }, + + _getErrorString: function Sys_Mvc_FieldContext$_getErrorString(validatorReturnValue, fieldErrorMessage) { + /// <param name="validatorReturnValue" type="Object"> + /// </param> + /// <param name="fieldErrorMessage" type="String"> + /// </param> + /// <returns type="String"></returns> + var fallbackErrorMessage = fieldErrorMessage || this.defaultErrorMessage; + if (Boolean.isInstanceOfType(validatorReturnValue)) { + return (validatorReturnValue) ? null : fallbackErrorMessage; + } + if (String.isInstanceOfType(validatorReturnValue)) { + return ((validatorReturnValue).length) ? validatorReturnValue : fallbackErrorMessage; + } + return null; + }, + + _getStringValue: function Sys_Mvc_FieldContext$_getStringValue() { + /// <returns type="String"></returns> + var elements = this.elements; + return (elements.length > 0) ? elements[0].value : null; + }, + + _markValidationFired: function Sys_Mvc_FieldContext$_markValidationFired() { + var elements = this.elements; + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + element[Sys.Mvc.FieldContext._hasValidationFiredTag] = true; + } + }, + + _onErrorCountChanged: function Sys_Mvc_FieldContext$_onErrorCountChanged() { + if (!this._errors.length) { + this._displaySuccess(); + } + else { + this._displayError(); + } + }, + + validate: function Sys_Mvc_FieldContext$validate(eventName) { + /// <param name="eventName" type="String"> + /// </param> + /// <returns type="Array" elementType="String"></returns> + var validations = this.validations; + var errors = []; + var value = this._getStringValue(); + for (var i = 0; i < validations.length; i++) { + var validation = validations[i]; + var context = Sys.Mvc.$create_ValidationContext(); + context.eventName = eventName; + context.fieldContext = this; + context.validation = validation; + var retVal = validation.validator(value, context); + var errorMessage = this._getErrorString(retVal, validation.fieldErrorMessage); + if (!Sys.Mvc._validationUtil.stringIsNullOrEmpty(errorMessage)) { + Array.add(errors, errorMessage); + } + } + this._markValidationFired(); + this.clearErrors(); + this.addErrors(errors); + return errors; + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.RangeValidator + +Sys.Mvc.RangeValidator = function Sys_Mvc_RangeValidator(minimum, maximum) { + /// <param name="minimum" type="Number"> + /// </param> + /// <param name="maximum" type="Number"> + /// </param> + /// <field name="_minimum" type="Number"> + /// </field> + /// <field name="_maximum" type="Number"> + /// </field> + this._minimum = minimum; + this._maximum = maximum; +} +Sys.Mvc.RangeValidator.create = function Sys_Mvc_RangeValidator$create(rule) { + /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> + /// </param> + /// <returns type="Sys.Mvc.Validator"></returns> + var min = rule.ValidationParameters['min']; + var max = rule.ValidationParameters['max']; + return Function.createDelegate(new Sys.Mvc.RangeValidator(min, max), new Sys.Mvc.RangeValidator(min, max).validate); +} +Sys.Mvc.RangeValidator.prototype = { + _minimum: null, + _maximum: null, + + validate: function Sys_Mvc_RangeValidator$validate(value, context) { + /// <param name="value" type="String"> + /// </param> + /// <param name="context" type="Sys.Mvc.ValidationContext"> + /// </param> + /// <returns type="Object"></returns> + if (Sys.Mvc._validationUtil.stringIsNullOrEmpty(value)) { + return true; + } + var n = Number.parseLocale(value); + return (!isNaN(n) && this._minimum <= n && n <= this._maximum); + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.RegularExpressionValidator + +Sys.Mvc.RegularExpressionValidator = function Sys_Mvc_RegularExpressionValidator(pattern) { + /// <param name="pattern" type="String"> + /// </param> + /// <field name="_pattern" type="String"> + /// </field> + this._pattern = pattern; +} +Sys.Mvc.RegularExpressionValidator.create = function Sys_Mvc_RegularExpressionValidator$create(rule) { + /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> + /// </param> + /// <returns type="Sys.Mvc.Validator"></returns> + var pattern = rule.ValidationParameters['pattern']; + return Function.createDelegate(new Sys.Mvc.RegularExpressionValidator(pattern), new Sys.Mvc.RegularExpressionValidator(pattern).validate); +} +Sys.Mvc.RegularExpressionValidator.prototype = { + _pattern: null, + + validate: function Sys_Mvc_RegularExpressionValidator$validate(value, context) { + /// <param name="value" type="String"> + /// </param> + /// <param name="context" type="Sys.Mvc.ValidationContext"> + /// </param> + /// <returns type="Object"></returns> + if (Sys.Mvc._validationUtil.stringIsNullOrEmpty(value)) { + return true; + } + var regExp = new RegExp(this._pattern); + var matches = regExp.exec(value); + return (!Sys.Mvc._validationUtil.arrayIsNullOrEmpty(matches) && matches[0].length === value.length); + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.RequiredValidator + +Sys.Mvc.RequiredValidator = function Sys_Mvc_RequiredValidator() { +} +Sys.Mvc.RequiredValidator.create = function Sys_Mvc_RequiredValidator$create(rule) { + /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> + /// </param> + /// <returns type="Sys.Mvc.Validator"></returns> + return Function.createDelegate(new Sys.Mvc.RequiredValidator(), new Sys.Mvc.RequiredValidator().validate); +} +Sys.Mvc.RequiredValidator._isRadioInputElement = function Sys_Mvc_RequiredValidator$_isRadioInputElement(element) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + /// <returns type="Boolean"></returns> + if (element.tagName.toUpperCase() === 'INPUT') { + var inputType = (element.type).toUpperCase(); + if (inputType === 'RADIO') { + return true; + } + } + return false; +} +Sys.Mvc.RequiredValidator._isSelectInputElement = function Sys_Mvc_RequiredValidator$_isSelectInputElement(element) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + /// <returns type="Boolean"></returns> + if (element.tagName.toUpperCase() === 'SELECT') { + return true; + } + return false; +} +Sys.Mvc.RequiredValidator._isTextualInputElement = function Sys_Mvc_RequiredValidator$_isTextualInputElement(element) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + /// <returns type="Boolean"></returns> + if (element.tagName.toUpperCase() === 'INPUT') { + var inputType = (element.type).toUpperCase(); + switch (inputType) { + case 'TEXT': + case 'PASSWORD': + case 'FILE': + return true; + } + } + if (element.tagName.toUpperCase() === 'TEXTAREA') { + return true; + } + return false; +} +Sys.Mvc.RequiredValidator._validateRadioInput = function Sys_Mvc_RequiredValidator$_validateRadioInput(elements) { + /// <param name="elements" type="Array" elementType="Object" elementDomElement="true"> + /// </param> + /// <returns type="Object"></returns> + for (var i = 0; i < elements.length; i++) { + var element = elements[i]; + if (element.checked) { + return true; + } + } + return false; +} +Sys.Mvc.RequiredValidator._validateSelectInput = function Sys_Mvc_RequiredValidator$_validateSelectInput(optionElements) { + /// <param name="optionElements" type="DOMElementCollection"> + /// </param> + /// <returns type="Object"></returns> + for (var i = 0; i < optionElements.length; i++) { + var element = optionElements[i]; + if (element.selected) { + if (!Sys.Mvc._validationUtil.stringIsNullOrEmpty(element.value)) { + return true; + } + } + } + return false; +} +Sys.Mvc.RequiredValidator._validateTextualInput = function Sys_Mvc_RequiredValidator$_validateTextualInput(element) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + /// <returns type="Object"></returns> + return (!Sys.Mvc._validationUtil.stringIsNullOrEmpty(element.value)); +} +Sys.Mvc.RequiredValidator.prototype = { + + validate: function Sys_Mvc_RequiredValidator$validate(value, context) { + /// <param name="value" type="String"> + /// </param> + /// <param name="context" type="Sys.Mvc.ValidationContext"> + /// </param> + /// <returns type="Object"></returns> + var elements = context.fieldContext.elements; + if (!elements.length) { + return true; + } + var sampleElement = elements[0]; + if (Sys.Mvc.RequiredValidator._isTextualInputElement(sampleElement)) { + return Sys.Mvc.RequiredValidator._validateTextualInput(sampleElement); + } + if (Sys.Mvc.RequiredValidator._isRadioInputElement(sampleElement)) { + return Sys.Mvc.RequiredValidator._validateRadioInput(elements); + } + if (Sys.Mvc.RequiredValidator._isSelectInputElement(sampleElement)) { + return Sys.Mvc.RequiredValidator._validateSelectInput((sampleElement).options); + } + return true; + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.StringLengthValidator + +Sys.Mvc.StringLengthValidator = function Sys_Mvc_StringLengthValidator(minLength, maxLength) { + /// <param name="minLength" type="Number" integer="true"> + /// </param> + /// <param name="maxLength" type="Number" integer="true"> + /// </param> + /// <field name="_maxLength" type="Number" integer="true"> + /// </field> + /// <field name="_minLength" type="Number" integer="true"> + /// </field> + this._minLength = minLength; + this._maxLength = maxLength; +} +Sys.Mvc.StringLengthValidator.create = function Sys_Mvc_StringLengthValidator$create(rule) { + /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> + /// </param> + /// <returns type="Sys.Mvc.Validator"></returns> + var minLength = (rule.ValidationParameters['min'] || 0); + var maxLength = (rule.ValidationParameters['max'] || Number.MAX_VALUE); + return Function.createDelegate(new Sys.Mvc.StringLengthValidator(minLength, maxLength), new Sys.Mvc.StringLengthValidator(minLength, maxLength).validate); +} +Sys.Mvc.StringLengthValidator.prototype = { + _maxLength: 0, + _minLength: 0, + + validate: function Sys_Mvc_StringLengthValidator$validate(value, context) { + /// <param name="value" type="String"> + /// </param> + /// <param name="context" type="Sys.Mvc.ValidationContext"> + /// </param> + /// <returns type="Object"></returns> + if (Sys.Mvc._validationUtil.stringIsNullOrEmpty(value)) { + return true; + } + return (this._minLength <= value.length && value.length <= this._maxLength); + } +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc._validationUtil + +Sys.Mvc._validationUtil = function Sys_Mvc__validationUtil() { +} +Sys.Mvc._validationUtil.arrayIsNullOrEmpty = function Sys_Mvc__validationUtil$arrayIsNullOrEmpty(array) { + /// <param name="array" type="Array" elementType="Object"> + /// </param> + /// <returns type="Boolean"></returns> + return (!array || !array.length); +} +Sys.Mvc._validationUtil.stringIsNullOrEmpty = function Sys_Mvc__validationUtil$stringIsNullOrEmpty(value) { + /// <param name="value" type="String"> + /// </param> + /// <returns type="Boolean"></returns> + return (!value || !value.length); +} +Sys.Mvc._validationUtil.elementSupportsEvent = function Sys_Mvc__validationUtil$elementSupportsEvent(element, eventAttributeName) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + /// <param name="eventAttributeName" type="String"> + /// </param> + /// <returns type="Boolean"></returns> + return (eventAttributeName in element); +} +Sys.Mvc._validationUtil.removeAllChildren = function Sys_Mvc__validationUtil$removeAllChildren(element) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + while (element.firstChild) { + element.removeChild(element.firstChild); + } +} +Sys.Mvc._validationUtil.setInnerText = function Sys_Mvc__validationUtil$setInnerText(element, innerText) { + /// <param name="element" type="Object" domElement="true"> + /// </param> + /// <param name="innerText" type="String"> + /// </param> + var textNode = document.createTextNode(innerText); + Sys.Mvc._validationUtil.removeAllChildren(element); + element.appendChild(textNode); +} + + +//////////////////////////////////////////////////////////////////////////////// +// Sys.Mvc.ValidatorRegistry + +Sys.Mvc.ValidatorRegistry = function Sys_Mvc_ValidatorRegistry() { + /// <field name="validators" type="Object" static="true"> + /// </field> +} +Sys.Mvc.ValidatorRegistry.getValidator = function Sys_Mvc_ValidatorRegistry$getValidator(rule) { + /// <param name="rule" type="Sys.Mvc.JsonValidationRule"> + /// </param> + /// <returns type="Sys.Mvc.Validator"></returns> + var creator = Sys.Mvc.ValidatorRegistry.validators[rule.ValidationType]; + return (creator) ? creator(rule) : null; +} +Sys.Mvc.ValidatorRegistry._getDefaultValidators = function Sys_Mvc_ValidatorRegistry$_getDefaultValidators() { + /// <returns type="Object"></returns> + return { required: Function.createDelegate(null, Sys.Mvc.RequiredValidator.create), length: Function.createDelegate(null, Sys.Mvc.StringLengthValidator.create), regex: Function.createDelegate(null, Sys.Mvc.RegularExpressionValidator.create), range: Function.createDelegate(null, Sys.Mvc.RangeValidator.create), number: Function.createDelegate(null, Sys.Mvc.NumberValidator.create) }; +} + + +Sys.Mvc.NumberValidator.registerClass('Sys.Mvc.NumberValidator'); +Sys.Mvc.FormContext.registerClass('Sys.Mvc.FormContext'); +Sys.Mvc.FieldContext.registerClass('Sys.Mvc.FieldContext'); +Sys.Mvc.RangeValidator.registerClass('Sys.Mvc.RangeValidator'); +Sys.Mvc.RegularExpressionValidator.registerClass('Sys.Mvc.RegularExpressionValidator'); +Sys.Mvc.RequiredValidator.registerClass('Sys.Mvc.RequiredValidator'); +Sys.Mvc.StringLengthValidator.registerClass('Sys.Mvc.StringLengthValidator'); +Sys.Mvc._validationUtil.registerClass('Sys.Mvc._validationUtil'); +Sys.Mvc.ValidatorRegistry.registerClass('Sys.Mvc.ValidatorRegistry'); +Sys.Mvc.FormContext._validationSummaryErrorCss = 'validation-summary-errors'; +Sys.Mvc.FormContext._validationSummaryValidCss = 'validation-summary-valid'; +Sys.Mvc.FormContext._formValidationTag = '__MVC_FormValidation'; +Sys.Mvc.FieldContext._hasTextChangedTag = '__MVC_HasTextChanged'; +Sys.Mvc.FieldContext._hasValidationFiredTag = '__MVC_HasValidationFired'; +Sys.Mvc.FieldContext._inputElementErrorCss = 'input-validation-error'; +Sys.Mvc.FieldContext._inputElementValidCss = 'input-validation-valid'; +Sys.Mvc.FieldContext._validationMessageErrorCss = 'field-validation-error'; +Sys.Mvc.FieldContext._validationMessageValidCss = 'field-validation-valid'; +Sys.Mvc.ValidatorRegistry.validators = Sys.Mvc.ValidatorRegistry._getDefaultValidators(); + +// ---- Do not remove this footer ---- +// Generated using Script# v0.5.0.0 (http://projects.nikhilk.net) +// ----------------------------------- + +// register validation +Sys.Application.add_load(function() { + Sys.Application.remove_load(arguments.callee); + Sys.Mvc.FormContext._Application_Load(); +});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/MicrosoftMvcValidation.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,55 @@ +//---------------------------------------------------------- +// Copyright (C) Microsoft Corporation. All rights reserved. +//---------------------------------------------------------- +// MicrosoftMvcValidation.js + +Type.registerNamespace('Sys.Mvc');Sys.Mvc.$create_Validation=function(){return {};} +Sys.Mvc.$create_JsonValidationField=function(){return {};} +Sys.Mvc.$create_JsonValidationOptions=function(){return {};} +Sys.Mvc.$create_JsonValidationRule=function(){return {};} +Sys.Mvc.$create_ValidationContext=function(){return {};} +Sys.Mvc.NumberValidator=function(){} +Sys.Mvc.NumberValidator.create=function(rule){return Function.createDelegate(new Sys.Mvc.NumberValidator(),new Sys.Mvc.NumberValidator().validate);} +Sys.Mvc.NumberValidator.prototype={validate:function(value,context){if(Sys.Mvc._ValidationUtil.$1(value)){return true;}var $0=Number.parseLocale(value);return (!isNaN($0));}} +Sys.Mvc.FormContext=function(formElement,validationSummaryElement){this.$5=[];this.fields=new Array(0);this.$9=formElement;this.$7=validationSummaryElement;formElement['__MVC_FormValidation'] = this;if(validationSummaryElement){var $0=validationSummaryElement.getElementsByTagName('ul');if($0.length>0){this.$8=$0[0];}}this.$3=Function.createDelegate(this,this.$D);this.$4=Function.createDelegate(this,this.$E);} +Sys.Mvc.FormContext._Application_Load=function(){var $0=window.mvcClientValidationMetadata;if($0){while($0.length>0){var $1=$0.pop();Sys.Mvc.FormContext.$12($1);}}} +Sys.Mvc.FormContext.$F=function($p0,$p1){var $0=[];var $1=document.getElementsByName($p1);for(var $2=0;$2<$1.length;$2++){var $3=$1[$2];if(Sys.Mvc.FormContext.$10($p0,$3)){Array.add($0,$3);}}return $0;} +Sys.Mvc.FormContext.getValidationForForm=function(formElement){return formElement['__MVC_FormValidation'];} +Sys.Mvc.FormContext.$10=function($p0,$p1){while($p1){if($p0===$p1){return true;}$p1=$p1.parentNode;}return false;} +Sys.Mvc.FormContext.$12=function($p0){var $0=$get($p0.FormId);var $1=(!Sys.Mvc._ValidationUtil.$1($p0.ValidationSummaryId))?$get($p0.ValidationSummaryId):null;var $2=new Sys.Mvc.FormContext($0,$1);$2.enableDynamicValidation();$2.replaceValidationSummary=$p0.ReplaceValidationSummary;for(var $4=0;$4<$p0.Fields.length;$4++){var $5=$p0.Fields[$4];var $6=Sys.Mvc.FormContext.$F($0,$5.FieldName);var $7=(!Sys.Mvc._ValidationUtil.$1($5.ValidationMessageId))?$get($5.ValidationMessageId):null;var $8=new Sys.Mvc.FieldContext($2);Array.addRange($8.elements,$6);$8.validationMessageElement=$7;$8.replaceValidationMessageContents=$5.ReplaceValidationMessageContents;for(var $9=0;$9<$5.ValidationRules.length;$9++){var $A=$5.ValidationRules[$9];var $B=Sys.Mvc.ValidatorRegistry.getValidator($A);if($B){var $C=Sys.Mvc.$create_Validation();$C.fieldErrorMessage=$A.ErrorMessage;$C.validator=$B;Array.add($8.validations,$C);}}$8.enableDynamicValidation();Array.add($2.fields,$8);}var $3=$0.validationCallbacks;if(!$3){$3=[];$0.validationCallbacks = $3;}$3.push(Function.createDelegate(null,function(){ +return Sys.Mvc._ValidationUtil.$0($2.validate('submit'));}));return $2;} +Sys.Mvc.FormContext.prototype={$3:null,$4:null,$6:null,$7:null,$8:null,$9:null,replaceValidationSummary:false,addError:function(message){this.addErrors([message]);},addErrors:function(messages){if(!Sys.Mvc._ValidationUtil.$0(messages)){Array.addRange(this.$5,messages);this.$11();}},clearErrors:function(){Array.clear(this.$5);this.$11();},$A:function(){if(this.$7){if(this.$8){Sys.Mvc._ValidationUtil.$3(this.$8);for(var $0=0;$0<this.$5.length;$0++){var $1=document.createElement('li');Sys.Mvc._ValidationUtil.$4($1,this.$5[$0]);this.$8.appendChild($1);}}Sys.UI.DomElement.removeCssClass(this.$7,'validation-summary-valid');Sys.UI.DomElement.addCssClass(this.$7,'validation-summary-errors');}},$B:function(){var $0=this.$7;if($0){var $1=this.$8;if($1){$1.innerHTML='';}Sys.UI.DomElement.removeCssClass($0,'validation-summary-errors');Sys.UI.DomElement.addCssClass($0,'validation-summary-valid');}},enableDynamicValidation:function(){Sys.UI.DomEvent.addHandler(this.$9,'click',this.$3);Sys.UI.DomEvent.addHandler(this.$9,'submit',this.$4);},$C:function($p0){if($p0.disabled){return null;}var $0=$p0.tagName.toUpperCase();var $1=$p0;if($0==='INPUT'){var $2=$1.type;if($2==='submit'||$2==='image'){return $1;}}else if(($0==='BUTTON')&&($1.type==='submit')){return $1;}return null;},$D:function($p0){this.$6=this.$C($p0.target);},$E:function($p0){var $0=$p0.target;var $1=this.$6;if($1&&$1.disableValidation){return;}var $2=this.validate('submit');if(!Sys.Mvc._ValidationUtil.$0($2)){$p0.preventDefault();}},$11:function(){if(!this.$5.length){this.$B();}else{this.$A();}},validate:function(eventName){var $0=this.fields;var $1=[];for(var $2=0;$2<$0.length;$2++){var $3=$0[$2];if(!$3.elements[0].disabled){var $4=$3.validate(eventName);if($4){Array.addRange($1,$4);}}}if(this.replaceValidationSummary){this.clearErrors();this.addErrors($1);}return $1;}} +Sys.Mvc.FieldContext=function(formContext){this.$A=[];this.elements=new Array(0);this.validations=new Array(0);this.formContext=formContext;this.$6=Function.createDelegate(this,this.$D);this.$7=Function.createDelegate(this,this.$E);this.$8=Function.createDelegate(this,this.$F);this.$9=Function.createDelegate(this,this.$10);} +Sys.Mvc.FieldContext.prototype={$6:null,$7:null,$8:null,$9:null,defaultErrorMessage:null,formContext:null,replaceValidationMessageContents:false,validationMessageElement:null,addError:function(message){this.addErrors([message]);},addErrors:function(messages){if(!Sys.Mvc._ValidationUtil.$0(messages)){Array.addRange(this.$A,messages);this.$14();}},clearErrors:function(){Array.clear(this.$A);this.$14();},$B:function(){var $0=this.validationMessageElement;if($0){if(this.replaceValidationMessageContents){Sys.Mvc._ValidationUtil.$4($0,this.$A[0]);}Sys.UI.DomElement.removeCssClass($0,'field-validation-valid');Sys.UI.DomElement.addCssClass($0,'field-validation-error');}var $1=this.elements;for(var $2=0;$2<$1.length;$2++){var $3=$1[$2];Sys.UI.DomElement.removeCssClass($3,'input-validation-valid');Sys.UI.DomElement.addCssClass($3,'input-validation-error');}},$C:function(){var $0=this.validationMessageElement;if($0){if(this.replaceValidationMessageContents){Sys.Mvc._ValidationUtil.$4($0,'');}Sys.UI.DomElement.removeCssClass($0,'field-validation-error');Sys.UI.DomElement.addCssClass($0,'field-validation-valid');}var $1=this.elements;for(var $2=0;$2<$1.length;$2++){var $3=$1[$2];Sys.UI.DomElement.removeCssClass($3,'input-validation-error');Sys.UI.DomElement.addCssClass($3,'input-validation-valid');}},$D:function($p0){if($p0.target['__MVC_HasTextChanged']||$p0.target['__MVC_HasValidationFired']){this.validate('blur');}},$E:function($p0){$p0.target['__MVC_HasTextChanged'] = true;},$F:function($p0){$p0.target['__MVC_HasTextChanged'] = true;if($p0.target['__MVC_HasValidationFired']){this.validate('input');}},$10:function($p0){if($p0.rawEvent.propertyName==='value'){$p0.target['__MVC_HasTextChanged'] = true;if($p0.target['__MVC_HasValidationFired']){this.validate('input');}}},enableDynamicValidation:function(){var $0=this.elements;for(var $1=0;$1<$0.length;$1++){var $2=$0[$1];if(Sys.Mvc._ValidationUtil.$2($2,'onpropertychange')){var $3=document.documentMode;if($3&&$3>=8){Sys.UI.DomEvent.addHandler($2,'propertychange',this.$9);}}else{Sys.UI.DomEvent.addHandler($2,'input',this.$8);}Sys.UI.DomEvent.addHandler($2,'change',this.$7);Sys.UI.DomEvent.addHandler($2,'blur',this.$6);}},$11:function($p0,$p1){var $0=$p1||this.defaultErrorMessage;if(Boolean.isInstanceOfType($p0)){return ($p0)?null:$0;}if(String.isInstanceOfType($p0)){return (($p0).length)?$p0:$0;}return null;},$12:function(){var $0=this.elements;return ($0.length>0)?$0[0].value:null;},$13:function(){var $0=this.elements;for(var $1=0;$1<$0.length;$1++){var $2=$0[$1];$2['__MVC_HasValidationFired'] = true;}},$14:function(){if(!this.$A.length){this.$C();}else{this.$B();}},validate:function(eventName){var $0=this.validations;var $1=[];var $2=this.$12();for(var $3=0;$3<$0.length;$3++){var $4=$0[$3];var $5=Sys.Mvc.$create_ValidationContext();$5.eventName=eventName;$5.fieldContext=this;$5.validation=$4;var $6=$4.validator($2,$5);var $7=this.$11($6,$4.fieldErrorMessage);if(!Sys.Mvc._ValidationUtil.$1($7)){Array.add($1,$7);}}this.$13();this.clearErrors();this.addErrors($1);return $1;}} +Sys.Mvc.RangeValidator=function(minimum,maximum){this.$0=minimum;this.$1=maximum;} +Sys.Mvc.RangeValidator.create=function(rule){var $0=rule.ValidationParameters['min'];var $1=rule.ValidationParameters['max'];return Function.createDelegate(new Sys.Mvc.RangeValidator($0,$1),new Sys.Mvc.RangeValidator($0,$1).validate);} +Sys.Mvc.RangeValidator.prototype={$0:null,$1:null,validate:function(value,context){if(Sys.Mvc._ValidationUtil.$1(value)){return true;}var $0=Number.parseLocale(value);return (!isNaN($0)&&this.$0<=$0&&$0<=this.$1);}} +Sys.Mvc.RegularExpressionValidator=function(pattern){this.$0=pattern;} +Sys.Mvc.RegularExpressionValidator.create=function(rule){var $0=rule.ValidationParameters['pattern'];return Function.createDelegate(new Sys.Mvc.RegularExpressionValidator($0),new Sys.Mvc.RegularExpressionValidator($0).validate);} +Sys.Mvc.RegularExpressionValidator.prototype={$0:null,validate:function(value,context){if(Sys.Mvc._ValidationUtil.$1(value)){return true;}var $0=new RegExp(this.$0);var $1=$0.exec(value);return (!Sys.Mvc._ValidationUtil.$0($1)&&$1[0].length===value.length);}} +Sys.Mvc.RequiredValidator=function(){} +Sys.Mvc.RequiredValidator.create=function(rule){return Function.createDelegate(new Sys.Mvc.RequiredValidator(),new Sys.Mvc.RequiredValidator().validate);} +Sys.Mvc.RequiredValidator.$0=function($p0){if($p0.tagName.toUpperCase()==='INPUT'){var $0=($p0.type).toUpperCase();if($0==='RADIO'){return true;}}return false;} +Sys.Mvc.RequiredValidator.$1=function($p0){if($p0.tagName.toUpperCase()==='SELECT'){return true;}return false;} +Sys.Mvc.RequiredValidator.$2=function($p0){if($p0.tagName.toUpperCase()==='INPUT'){var $0=($p0.type).toUpperCase();switch($0){case 'TEXT':case 'PASSWORD':case 'FILE':return true;}}if($p0.tagName.toUpperCase()==='TEXTAREA'){return true;}return false;} +Sys.Mvc.RequiredValidator.$3=function($p0){for(var $0=0;$0<$p0.length;$0++){var $1=$p0[$0];if($1.checked){return true;}}return false;} +Sys.Mvc.RequiredValidator.$4=function($p0){for(var $0=0;$0<$p0.length;$0++){var $1=$p0[$0];if($1.selected){if(!Sys.Mvc._ValidationUtil.$1($1.value)){return true;}}}return false;} +Sys.Mvc.RequiredValidator.$5=function($p0){return (!Sys.Mvc._ValidationUtil.$1($p0.value));} +Sys.Mvc.RequiredValidator.prototype={validate:function(value,context){var $0=context.fieldContext.elements;if(!$0.length){return true;}var $1=$0[0];if(Sys.Mvc.RequiredValidator.$2($1)){return Sys.Mvc.RequiredValidator.$5($1);}if(Sys.Mvc.RequiredValidator.$0($1)){return Sys.Mvc.RequiredValidator.$3($0);}if(Sys.Mvc.RequiredValidator.$1($1)){return Sys.Mvc.RequiredValidator.$4(($1).options);}return true;}} +Sys.Mvc.StringLengthValidator=function(minLength,maxLength){this.$1=minLength;this.$0=maxLength;} +Sys.Mvc.StringLengthValidator.create=function(rule){var $0=(rule.ValidationParameters['min']||0);var $1=(rule.ValidationParameters['max']||Number.MAX_VALUE);return Function.createDelegate(new Sys.Mvc.StringLengthValidator($0,$1),new Sys.Mvc.StringLengthValidator($0,$1).validate);} +Sys.Mvc.StringLengthValidator.prototype={$0:0,$1:0,validate:function(value,context){if(Sys.Mvc._ValidationUtil.$1(value)){return true;}return (this.$1<=value.length&&value.length<=this.$0);}} +Sys.Mvc._ValidationUtil=function(){} +Sys.Mvc._ValidationUtil.$0=function($p0){return (!$p0||!$p0.length);} +Sys.Mvc._ValidationUtil.$1=function($p0){return (!$p0||!$p0.length);} +Sys.Mvc._ValidationUtil.$2=function($p0,$p1){return ($p1 in $p0);} +Sys.Mvc._ValidationUtil.$3=function($p0){while($p0.firstChild){$p0.removeChild($p0.firstChild);}} +Sys.Mvc._ValidationUtil.$4=function($p0,$p1){var $0=document.createTextNode($p1);Sys.Mvc._ValidationUtil.$3($p0);$p0.appendChild($0);} +Sys.Mvc.ValidatorRegistry=function(){} +Sys.Mvc.ValidatorRegistry.getValidator=function(rule){var $0=Sys.Mvc.ValidatorRegistry.validators[rule.ValidationType];return ($0)?$0(rule):null;} +Sys.Mvc.ValidatorRegistry.$0=function(){return {required:Function.createDelegate(null,Sys.Mvc.RequiredValidator.create),length:Function.createDelegate(null,Sys.Mvc.StringLengthValidator.create),regex:Function.createDelegate(null,Sys.Mvc.RegularExpressionValidator.create),range:Function.createDelegate(null,Sys.Mvc.RangeValidator.create),number:Function.createDelegate(null,Sys.Mvc.NumberValidator.create)};} +Sys.Mvc.NumberValidator.registerClass('Sys.Mvc.NumberValidator');Sys.Mvc.FormContext.registerClass('Sys.Mvc.FormContext');Sys.Mvc.FieldContext.registerClass('Sys.Mvc.FieldContext');Sys.Mvc.RangeValidator.registerClass('Sys.Mvc.RangeValidator');Sys.Mvc.RegularExpressionValidator.registerClass('Sys.Mvc.RegularExpressionValidator');Sys.Mvc.RequiredValidator.registerClass('Sys.Mvc.RequiredValidator');Sys.Mvc.StringLengthValidator.registerClass('Sys.Mvc.StringLengthValidator');Sys.Mvc._ValidationUtil.registerClass('Sys.Mvc._ValidationUtil');Sys.Mvc.ValidatorRegistry.registerClass('Sys.Mvc.ValidatorRegistry');Sys.Mvc.ValidatorRegistry.validators=Sys.Mvc.ValidatorRegistry.$0(); +// ---- Do not remove this footer ---- +// Generated using Script# v0.5.0.0 (http://projects.nikhilk.net) +// ----------------------------------- +Sys.Application.add_load(function(){Sys.Application.remove_load(arguments.callee);Sys.Mvc.FormContext._Application_Load();}); \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery-1.4.4-vsdoc.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,9035 @@ +/* + * This file has been commented to support Visual Studio Intellisense. + * You should not use this file at runtime inside the browser--it is only + * intended to be used only for design-time IntelliSense. Please use the + * standard jQuery library for all production use. + * + * Comment version: 1.4.4a + */ + +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery JavaScript Library v1.4.4 + * http://jquery.com/ + * + * Copyright 2010, John Resig + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2010, The Dojo Foundation + * + * Date: Thu Nov 11 19:04:53 2010 -0500 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + /// <summary> + /// 1: $(expression, context) - This function accepts a string containing a CSS selector which is then used to match a set of elements. + /// 2: $(html) - Create DOM elements on-the-fly from the provided String of raw HTML. + /// 3: $(elements) - Wrap jQuery functionality around a single or multiple DOM Element(s). + /// 4: $(callback) - A shorthand for $(document).ready(). + /// 5: $() - As of jQuery 1.4, if you pass no arguments in to the jQuery() method, an empty jQuery set will be returned. + /// </summary> + /// <param name="selector" type="String"> + /// 1: expression - An expression to search with. + /// 2: html - A string of HTML to create on the fly. + /// 3: elements - DOM element(s) to be encapsulated by a jQuery object. + /// 4: callback - The function to execute when the DOM is ready. + /// </param> + /// <param name="context" type="jQuery"> + /// 1: context - A DOM Element, Document or jQuery to use as context. + /// </param> + /// <returns type="jQuery" /> + + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/, + + // Is it a simple selector + isSimple = /^.[^:#\[\.,]*$/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + rwhite = /\s/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for non-word characters + rnonword = /\W/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // Has the ready events already been bound? + readyBound = false, + + // The functions to execute on DOM ready + readyList = [], + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + init: function( selector, context ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = "body"; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $("TAG") + } else if ( !context && !rnonword.test( selector ) ) { + this.selector = selector; + this.context = document; + selector = document.getElementsByTagName( selector ); + return jQuery.merge( this, selector ); + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return jQuery( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.4.4", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + /// <summary> + /// The number of elements currently matched. + /// Part of Core + /// </summary> + /// <returns type="Number" /> + + return this.length; + }, + + toArray: function() { + /// <summary> + /// Retrieve all the DOM elements contained in the jQuery set, as an array. + /// </summary> + /// <returns type="Array" /> + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + /// <summary> + /// Access a single matched element. num is used to access the + /// Nth element matched. + /// Part of Core + /// </summary> + /// <returns type="Element" /> + /// <param name="num" type="Number"> + /// Access the element in the Nth position. + /// </param> + + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this.slice(num)[ 0 ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + /// <summary> + /// Set the jQuery object to an array of elements, while maintaining + /// the stack. + /// Part of Core + /// </summary> + /// <returns type="jQuery" /> + /// <param name="elems" type="Elements"> + /// An array of elements + /// </param> + + // Build a new jQuery matched element set + var ret = jQuery(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + /// <summary> + /// Execute a function within the context of every matched element. + /// This means that every time the passed-in function is executed + /// (which is once for every element matched) the 'this' keyword + /// points to the specific element. + /// Additionally, the function, when executed, is passed a single + /// argument representing the position of the element in the matched + /// set. + /// Part of Core + /// </summary> + /// <returns type="jQuery" /> + /// <param name="callback" type="Function"> + /// A function to execute + /// </param> + + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + /// <summary> + /// Binds a function to be executed whenever the DOM is ready to be traversed and manipulated. + /// </summary> + /// <param name="fn" type="Function">The function to be executed when the DOM is ready.</param> + + // Attach the listeners + jQuery.bindReady(); + + // If the DOM is already ready + if ( jQuery.isReady ) { + // Execute the function immediately + fn.call( document, jQuery ); + + // Otherwise, remember the function for later + } else if ( readyList ) { + // Add the function to the wait list + readyList.push( fn ); + } + + return this; + }, + + eq: function( i ) { + /// <summary> + /// Reduce the set of matched elements to a single element. + /// The position of the element in the set of matched elements + /// starts at 0 and goes to length - 1. + /// Part of Core + /// </summary> + /// <returns type="jQuery" /> + /// <param name="num" type="Number"> + /// pos The index of the element that you wish to limit to. + /// </param> + + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + /// <summary> + /// Reduce the set of matched elements to the first in the set. + /// </summary> + /// <returns type="jQuery" /> + + return this.eq( 0 ); + }, + + last: function() { + /// <summary> + /// Reduce the set of matched elements to the final one in the set. + /// </summary> + /// <returns type="jQuery" /> + + return this.eq( -1 ); + }, + + slice: function() { + /// <summary> + /// Selects a subset of the matched elements. Behaves exactly like the built-in Array slice method. + /// </summary> + /// <param name="start" type="Number" integer="true">Where to start the subset (0-based).</param> + /// <param name="end" optional="true" type="Number" integer="true">Where to end the subset (not including the end element itself). + /// If omitted, ends at the end of the selection</param> + /// <returns type="jQuery">The sliced elements</returns> + + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + /// <summary> + /// This member is internal. + /// </summary> + /// <private /> + /// <returns type="jQuery" /> + + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + /// <summary> + /// End the most recent 'destructive' operation, reverting the list of matched elements + /// back to its previous state. After an end operation, the list of matched elements will + /// revert to the last state of matched elements. + /// If there was no destructive operation before, an empty set is returned. + /// Part of DOM/Traversing + /// </summary> + /// <returns type="jQuery" /> + + return this.prevObject || jQuery(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + /// <summary> + /// Extend one object with one or more others, returning the original, + /// modified, object. This is a great utility for simple inheritance. + /// jQuery.extend(settings, options); + /// var settings = jQuery.extend({}, defaults, options); + /// Part of JavaScript + /// </summary> + /// <param name="target" type="Object"> + /// The object to extend + /// </param> + /// <param name="prop1" type="Object"> + /// The object that will be merged into the first. + /// </param> + /// <param name="propN" type="Object" optional="true" parameterArray="true"> + /// (optional) More objects to merge into the first + /// </param> + /// <returns type="Object" /> + + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + /// <summary> + /// Run this function to give control of the $ variable back + /// to whichever library first implemented it. This helps to make + /// sure that jQuery doesn't conflict with the $ object + /// of other libraries. + /// By using this function, you will only be able to access jQuery + /// using the 'jQuery' variable. For example, where you used to do + /// $("div p"), you now must do jQuery("div p"). + /// Part of Core + /// </summary> + /// <returns type="undefined" /> + + window.$ = _$; + + if ( deep ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + // A third-party is pushing the ready event forwards + if ( wait === true ) { + jQuery.readyWait--; + } + + // Make sure that the DOM is not already loaded + if ( !jQuery.readyWait || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + if ( readyList ) { + // Execute all of them + var fn, + i = 0, + ready = readyList; + + // Reset the list of functions + readyList = null; + + while ( (fn = ready[ i++ ]) ) { + fn.call( document, jQuery ); + } + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + } + }, + + bindReady: function() { + if ( readyBound ) { + return; + } + + readyBound = true; + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent("onreadystatechange", DOMContentLoaded); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + /// <summary> + /// Determines if the parameter passed is a function. + /// </summary> + /// <param name="obj" type="Object">The object to check</param> + /// <returns type="Boolean">True if the parameter is a function; otherwise false.</returns> + + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + /// <summary> + /// Determine if the parameter passed is an array. + /// </summary> + /// <param name="obj" type="Object">Object to test whether or not it is an array.</param> + /// <returns type="Boolean">True if the parameter is a function; otherwise false.</returns> + + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + /// <summary> + /// Check to see if an object is a plain object (created using "{}" or "new Object"). + /// </summary> + /// <param name="obj" type="Object"> + /// The object that will be checked to see if it's a plain object. + /// </param> + /// <returns type="Boolean" /> + + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + /// <summary> + /// Check to see if an object is empty (contains no properties). + /// </summary> + /// <param name="obj" type="Object"> + /// The object that will be checked to see if it's empty. + /// </param> + /// <returns type="Boolean" /> + + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test(data.replace(rvalidescape, "@") + .replace(rvalidtokens, "]") + .replace(rvalidbraces, "")) ) { + + // Try to use the native JSON parser first + return window.JSON && window.JSON.parse ? + window.JSON.parse( data ) : + (new Function("return " + data))(); + + } else { + jQuery.error( "Invalid JSON: " + data ); + } + }, + + noop: function() { + /// <summary> + /// An empty function. + /// </summary> + /// <returns type="Function" /> + }, + + // Evalulates a script in a global context + globalEval: function( data ) { + /// <summary> + /// Internally evaluates a script in a global context. + /// </summary> + /// <private /> + + if ( data && rnotwhite.test(data) ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.getElementsByTagName("head")[0] || document.documentElement, + script = document.createElement("script"); + + script.type = "text/javascript"; + + if ( jQuery.support.scriptEval ) { + script.appendChild( document.createTextNode( data ) ); + } else { + script.text = data; + } + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + /// <summary> + /// Checks whether the specified element has the specified DOM node name. + /// </summary> + /// <param name="elem" type="Element">The element to examine</param> + /// <param name="name" type="String">The node name to check</param> + /// <returns type="Boolean">True if the specified node name matches the node's DOM node name; otherwise false</returns> + + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + /// <summary> + /// A generic iterator function, which can be used to seemlessly + /// iterate over both objects and arrays. This function is not the same + /// as $().each() - which is used to iterate, exclusively, over a jQuery + /// object. This function can be used to iterate over anything. + /// The callback has two arguments:the key (objects) or index (arrays) as first + /// the first, and the value as the second. + /// Part of JavaScript + /// </summary> + /// <param name="obj" type="Object"> + /// The object, or array, to iterate over. + /// </param> + /// <param name="fn" type="Function"> + /// The function that will be executed on every object. + /// </param> + /// <returns type="Object" /> + + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction(object); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {} + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + /// <summary> + /// Turns anything into a true array. This is an internal method. + /// </summary> + /// <param name="array" type="Object">Anything to turn into an actual Array</param> + /// <returns type="Array" /> + /// <private /> + + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type(array); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + if ( array.indexOf ) { + return array.indexOf( elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + /// <summary> + /// Merge two arrays together, removing all duplicates. + /// The new array is: All the results from the first array, followed + /// by the unique results from the second array. + /// Part of JavaScript + /// </summary> + /// <returns type="Array" /> + /// <param name="first" type="Array"> + /// The first array to merge. + /// </param> + /// <param name="second" type="Array"> + /// The second array to merge. + /// </param> + + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + /// <summary> + /// Filter items out of an array, by using a filter function. + /// The specified function will be passed two arguments: The + /// current array item and the index of the item in the array. The + /// function must return 'true' to keep the item in the array, + /// false to remove it. + /// }); + /// Part of JavaScript + /// </summary> + /// <returns type="Array" /> + /// <param name="elems" type="Array"> + /// array The Array to find items in. + /// </param> + /// <param name="fn" type="Function"> + /// The function to process each item against. + /// </param> + /// <param name="inv" type="Boolean"> + /// Invert the selection - select the opposite of the function. + /// </param> + + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + /// <summary> + /// Translate all items in an array to another array of items. + /// The translation function that is provided to this method is + /// called for each item in the array and is passed one argument: + /// The item to be translated. + /// The function can then return the translated value, 'null' + /// (to remove the item), or an array of values - which will + /// be flattened into the full array. + /// Part of JavaScript + /// </summary> + /// <returns type="Array" /> + /// <param name="elems" type="Array"> + /// array The Array to translate. + /// </param> + /// <param name="fn" type="Function"> + /// The function to process each item against. + /// </param> + + var ret = [], value; + + // Go through the array, translating each of the items to their + // new value (or values). + for ( var i = 0, length = elems.length; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + proxy: function( fn, proxy, thisObject ) { + /// <summary> + /// Takes a function and returns a new one that will always have a particular scope. + /// </summary> + /// <param name="fn" type="Function"> + /// The function whose scope will be changed. + /// </param> + /// <param name="proxy" type="Object"> + /// The object to which the scope of the function should be set. + /// </param> + /// <returns type="Function" /> + + if ( arguments.length === 2 ) { + if ( typeof proxy === "string" ) { + thisObject = fn; + fn = thisObject[ proxy ]; + proxy = undefined; + + } else if ( proxy && !jQuery.isFunction( proxy ) ) { + thisObject = proxy; + proxy = undefined; + } + } + + if ( !proxy && fn ) { + proxy = function() { + return fn.apply( thisObject || this, arguments ); + }; + } + + // Set the guid of unique handler to the same of original handler, so it can be removed + if ( fn ) { + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + } + + // So proxy can be declared as an argument + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can be optionally by executed if its a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +if ( indexOf ) { + jQuery.inArray = function( elem, array ) { + /// <summary> + /// Determines the index of the first parameter in the array. + /// </summary> + /// <param name="elem">The value to see if it exists in the array.</param> + /// <param name="array" type="Array">The array to look through for the value</param> + /// <returns type="Number" integer="true">The 0-based index of the item if it was found, otherwise -1.</returns> + + return indexOf.call( array, elem ); + }; +} + +// Verify that \s matches non-breaking spaces +// (IE fails on this test) +if ( !rwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +// Expose jQuery to the global object +return (window.jQuery = window.$ = jQuery); + +})(); + + + +// [vsdoc] The following function has been modified for IntelliSense. +// [vsdoc] Stubbing support properties to "false" for IntelliSense compat. +(function() { + + jQuery.support = {}; + + // var root = document.documentElement, + // script = document.createElement("script"), + // div = document.createElement("div"), + // id = "script" + jQuery.now(); + + // div.style.display = "none"; + // div.innerHTML = " <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + // var all = div.getElementsByTagName("*"), + // a = div.getElementsByTagName("a")[0], + // select = document.createElement("select"), + // opt = select.appendChild( document.createElement("option") ); + + // // Can't get basic test support + // if ( !all || !all.length || !a ) { + // return; + // } + + jQuery.support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: false, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: false, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: false, + + // Get the style information from getAttribute + // (IE uses .cssText insted) + style: false, + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: false, + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: false, + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: false, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: false, + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: false, + + // Will be defined later + deleteExpando: false, + optDisabled: false, + checkClone: false, + scriptEval: false, + noCloneEvent: false, + boxModel: false, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableHiddenOffsets: true + }; + + // // Make sure that the options inside disabled selects aren't marked as disabled + // // (WebKit marks them as diabled) + // select.disabled = true; + // jQuery.support.optDisabled = !opt.disabled; + + // script.type = "text/javascript"; + // try { + // script.appendChild( document.createTextNode( "window." + id + "=1;" ) ); + // } catch(e) {} + + // root.insertBefore( script, root.firstChild ); + + // // Make sure that the execution of code works by injecting a script + // // tag with appendChild/createTextNode + // // (IE doesn't support this, fails, and uses .text instead) + // if ( window[ id ] ) { + // jQuery.support.scriptEval = true; + // delete window[ id ]; + // } + + // // Test to see if it's possible to delete an expando from an element + // // Fails in Internet Explorer + // try { + // delete script.test; + + // } catch(e) { + // jQuery.support.deleteExpando = false; + // } + + // root.removeChild( script ); + + // if ( div.attachEvent && div.fireEvent ) { + // div.attachEvent("onclick", function click() { + // // Cloning a node shouldn't copy over any + // // bound event handlers (IE does this) + // jQuery.support.noCloneEvent = false; + // div.detachEvent("onclick", click); + // }); + // div.cloneNode(true).fireEvent("onclick"); + // } + + // div = document.createElement("div"); + // div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>"; + + // var fragment = document.createDocumentFragment(); + // fragment.appendChild( div.firstChild ); + + // // WebKit doesn't clone checked state correctly in fragments + // jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked; + + // // Figure out if the W3C box model works as expected + // // document.body must exist before we can do this + // jQuery(function() { + // var div = document.createElement("div"); + // div.style.width = div.style.paddingLeft = "1px"; + + // document.body.appendChild( div ); + // jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2; + + // if ( "zoom" in div.style ) { + // // Check if natively block-level elements act like inline-block + // // elements when setting their display to 'inline' and giving + // // them layout + // // (IE < 8 does this) + // div.style.display = "inline"; + // div.style.zoom = 1; + // jQuery.support.inlineBlockNeedsLayout = div.offsetWidth === 2; + + // // Check if elements with layout shrink-wrap their children + // // (IE 6 does this) + // div.style.display = ""; + // div.innerHTML = "<div style='width:4px;'></div>"; + // jQuery.support.shrinkWrapBlocks = div.offsetWidth !== 2; + // } + + // div.innerHTML = "<table><tr><td style='padding:0;display:none'></td><td>t</td></tr></table>"; + // var tds = div.getElementsByTagName("td"); + + // // Check if table cells still have offsetWidth/Height when they are set + // // to display:none and there are still other visible table cells in a + // // table row; if so, offsetWidth/Height are not reliable for use when + // // determining if an element has been hidden directly using + // // display:none (it is still safe to use offsets if a parent element is + // // hidden; don safety goggles and see bug #4512 for more information). + // // (only IE 8 fails this test) + // jQuery.support.reliableHiddenOffsets = tds[0].offsetHeight === 0; + + // tds[0].style.display = ""; + // tds[1].style.display = "none"; + + // // Check if empty table cells still have offsetWidth/Height + // // (IE < 8 fail this test) + // jQuery.support.reliableHiddenOffsets = jQuery.support.reliableHiddenOffsets && tds[0].offsetHeight === 0; + // div.innerHTML = ""; + + // document.body.removeChild( div ).style.display = "none"; + // div = tds = null; + // }); + + // // Technique from Juriy Zaytsev + // // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + // var eventSupported = function( eventName ) { + // var el = document.createElement("div"); + // eventName = "on" + eventName; + + // var isSupported = (eventName in el); + // if ( !isSupported ) { + // el.setAttribute(eventName, "return;"); + // isSupported = typeof el[eventName] === "function"; + // } + // el = null; + + // return isSupported; + // }; + + jQuery.support.submitBubbles = false; + jQuery.support.changeBubbles = false; + + // // release memory in IE + // root = script = div = all = a = null; +})(); + + + +var windowData = {}, + rbrace = /^(?:\{.*\}|\[.*\])$/; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + expando: "jQuery" + jQuery.now(), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + data: function( elem, name, data ) { + /// <summary> + /// Store arbitrary data associated with the specified element. + /// </summary> + /// <param name="elem" type="Element"> + /// The DOM element to associate with the data. + /// </param> + /// <param name="name" type="String"> + /// A string naming the piece of data to set. + /// </param> + /// <param name="value" type="Object"> + /// The new data value. + /// </param> + /// <returns type="jQuery" /> + + if ( !jQuery.acceptData( elem ) ) { + return; + } + + elem = elem == window ? + windowData : + elem; + + var isNode = elem.nodeType, + id = isNode ? elem[ jQuery.expando ] : null, + cache = jQuery.cache, thisCache; + + if ( isNode && !id && typeof name === "string" && data === undefined ) { + return; + } + + // Get the data from the object directly + if ( !isNode ) { + cache = elem; + + // Compute a unique ID for the element + } else if ( !id ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } + + // Avoid generating a new cache unless none exists and we + // want to manipulate it. + if ( typeof name === "object" ) { + if ( isNode ) { + cache[ id ] = jQuery.extend(cache[ id ], name); + + } else { + jQuery.extend( cache, name ); + } + + } else if ( isNode && !cache[ id ] ) { + cache[ id ] = {}; + } + + thisCache = isNode ? cache[ id ] : cache; + + // Prevent overriding the named cache with undefined values + if ( data !== undefined ) { + thisCache[ name ] = data; + } + + return typeof name === "string" ? thisCache[ name ] : thisCache; + }, + + removeData: function( elem, name ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + elem = elem == window ? + windowData : + elem; + + var isNode = elem.nodeType, + id = isNode ? elem[ jQuery.expando ] : elem, + cache = jQuery.cache, + thisCache = isNode ? cache[ id ] : id; + + // If we want to remove a specific section of the element's data + if ( name ) { + if ( thisCache ) { + // Remove the section of cache data + delete thisCache[ name ]; + + // If we've removed all the data, remove the element's cache + if ( isNode && jQuery.isEmptyObject(thisCache) ) { + jQuery.removeData( elem ); + } + } + + // Otherwise, we want to remove all of the element's data + } else { + if ( isNode && jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + + // Completely remove the data cache + } else if ( isNode ) { + delete cache[ id ]; + + // Remove all fields from the object + } else { + for ( var n in elem ) { + delete elem[ n ]; + } + } + } + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + /// <summary> + /// Store arbitrary data associated with the matched elements. + /// </summary> + /// <param name="key" type="String"> + /// A string naming the piece of data to set. + /// </param> + /// <param name="value" type="Object"> + /// The new data value. + /// </param> + /// <returns type="jQuery" /> + + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + var attr = this[0].attributes, name; + data = jQuery.data( this[0] ); + + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = name.substr( 5 ); + dataAttr( this[0], name, data[ name ] ); + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + data = elem.getAttribute( "data-" + key ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + + + + +jQuery.extend({ + queue: function( elem, type, data ) { + if ( !elem ) { + return; + } + + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( !data ) { + return q || []; + } + + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data) ); + + } else { + q.push( data ); + } + + return q; + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(); + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + /// <summary> + /// 1: queue() - Returns a reference to the first element's queue (which is an array of functions). + /// 2: queue(callback) - Adds a new function, to be executed, onto the end of the queue of all matched elements. + /// 3: queue(queue) - Replaces the queue of all matched element with this new queue (the array of functions). + /// </summary> + /// <param name="type" type="Function">The function to add to the queue.</param> + /// <returns type="jQuery" /> + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function( i ) { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + /// <summary> + /// Removes a queued function from the front of the queue and executes it. + /// </summary> + /// <param name="type" type="String" optional="true">The type of queue to access.</param> + /// <returns type="jQuery" /> + + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + /// <summary> + /// Set a timer to delay execution of subsequent items in the queue. + /// </summary> + /// <param name="time" type="Number"> + /// An integer indicating the number of milliseconds to delay execution of the next item in the queue. + /// </param> + /// <param name="type" type="String"> + /// A string containing the name of the queue. Defaults to fx, the standard effects queue. + /// </param> + /// <returns type="jQuery" /> + + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + + clearQueue: function( type ) { + /// <summary> + /// Remove from the queue all items that have not yet been run. + /// </summary> + /// <param name="type" type="String" optional="true"> + /// A string containing the name of the queue. Defaults to fx, the standard effects queue. + /// </param> + /// <returns type="jQuery" /> + + return this.queue( type || "fx", [] ); + } +}); + + + + +var rclass = /[\n\t]/g, + rspaces = /\s+/, + rreturn = /\r/g, + rspecialurl = /^(?:href|src|style)$/, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rradiocheck = /^(?:radio|checkbox)$/i; + +jQuery.props = { + "for": "htmlFor", + "class": "className", + readonly: "readOnly", + maxlength: "maxLength", + cellspacing: "cellSpacing", + rowspan: "rowSpan", + colspan: "colSpan", + tabindex: "tabIndex", + usemap: "useMap", + frameborder: "frameBorder" +}; + +jQuery.fn.extend({ + attr: function( name, value ) { + /// <summary> + /// Set a single property to a computed value, on all matched elements. + /// Instead of a value, a function is provided, that computes the value. + /// Part of DOM/Attributes + /// </summary> + /// <returns type="jQuery" /> + /// <param name="name" type="String"> + /// The name of the property to set. + /// </param> + /// <param name="value" type="Function"> + /// A function returning the value to set. + /// </param> + + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name, fn ) { + /// <summary> + /// Remove an attribute from each of the matched elements. + /// Part of DOM/Attributes + /// </summary> + /// <param name="name" type="String"> + /// An attribute to remove. + /// </param> + /// <returns type="jQuery" /> + + return this.each(function(){ + jQuery.attr( this, name, "" ); + if ( this.nodeType === 1 ) { + this.removeAttribute( name ); + } + }); + }, + + addClass: function( value ) { + /// <summary> + /// Adds the specified class(es) to each of the set of matched elements. + /// Part of DOM/Attributes + /// </summary> + /// <param name="value" type="String"> + /// One or more class names to be added to the class attribute of each matched element. + /// </param> + /// <returns type="jQuery" /> + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.addClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( value && typeof value === "string" ) { + var classNames = (value || "").split( rspaces ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className ) { + elem.className = value; + + } else { + var className = " " + elem.className + " ", + setClass = elem.className; + + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) { + setClass += " " + classNames[c]; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + /// <summary> + /// Removes all or the specified class(es) from the set of matched elements. + /// Part of DOM/Attributes + /// </summary> + /// <param name="value" type="String" optional="true"> + /// (Optional) A class name to be removed from the class attribute of each matched element. + /// </param> + /// <returns type="jQuery" /> + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.removeClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + var classNames = (value || "").split( rspaces ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + var className = (" " + elem.className + " ").replace(rclass, " "); + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[c] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + /// <summary> + /// Add or remove a class from each element in the set of matched elements, depending + /// on either the class's presence or the value of the switch argument. + /// </summary> + /// <param name="value" type="Object"> + /// A class name to be toggled for each element in the matched set. + /// </param> + /// <param name="stateVal" type="Object"> + /// A boolean value to determine whether the class should be added or removed. + /// </param> + /// <returns type="jQuery" /> + + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this); + self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspaces ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery.data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery.data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + /// <summary> + /// Checks the current selection against a class and returns whether at least one selection has a given class. + /// </summary> + /// <param name="selector" type="String">The class to check against</param> + /// <returns type="Boolean">True if at least one element in the selection has the class, otherwise false.</returns> + + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + /// <summary> + /// Set the value of every matched element. + /// Part of DOM/Attributes + /// </summary> + /// <returns type="jQuery" /> + /// <param name="value" type="String"> + /// A string of text or an array of strings to set as the value property of each + /// matched element. + /// </param> + + if ( !arguments.length ) { + var elem = this[0]; + + if ( elem ) { + if ( jQuery.nodeName( elem, "option" ) ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + } + + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) { + return elem.getAttribute("value") === null ? "on" : elem.value; + } + + + // Everything else, we just grab the value + return (elem.value || "").replace(rreturn, ""); + + } + + return undefined; + } + + var isFunction = jQuery.isFunction(value); + + return this.each(function(i) { + var self = jQuery(this), val = value; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call(this, i, self.val()); + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray(val) ) { + val = jQuery.map(val, function (value) { + return value == null ? "" : value + ""; + }); + } + + if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) { + this.checked = jQuery.inArray( self.val(), val ) >= 0; + + } else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(val); + + jQuery( "option", this ).each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + this.selectedIndex = -1; + } + + } else { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + // don't set attributes on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery(elem)[name](value); + } + + var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ), + // Whether we are setting (or getting) + set = value !== undefined; + + // Try to normalize/fix the name + name = notxml && jQuery.props[ name ] || name; + + // These attributes require special treatment + var special = rspecialurl.test( name ); + + // Safari mis-reports the default selected property of an option + // Accessing the parent's selectedIndex property fixes it + if ( name === "selected" && !jQuery.support.optSelected ) { + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + + // If applicable, access the attribute via the DOM 0 way + // 'in' checks fail in Blackberry 4.7 #6931 + if ( (name in elem || elem[ name ] !== undefined) && notxml && !special ) { + if ( set ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } + + if ( value === null ) { + if ( elem.nodeType === 1 ) { + elem.removeAttribute( name ); + } + + } else { + elem[ name ] = value; + } + } + + // browsers index elements by id/name on forms, give priority to attributes. + if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) { + return elem.getAttributeNode( name ).nodeValue; + } + + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + if ( name === "tabIndex" ) { + var attributeNode = elem.getAttributeNode( "tabIndex" ); + + return attributeNode && attributeNode.specified ? + attributeNode.value : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + + return elem[ name ]; + } + + if ( !jQuery.support.style && notxml && name === "style" ) { + if ( set ) { + elem.style.cssText = "" + value; + } + + return elem.style.cssText; + } + + if ( set ) { + // convert the value to a string (all browsers do this but IE) see #1070 + elem.setAttribute( name, "" + value ); + } + + // Ensure that missing attributes return undefined + // Blackberry 4.7 returns "" from getAttribute #6938 + if ( !elem.attributes[ name ] && (elem.hasAttribute && !elem.hasAttribute( name )) ) { + return undefined; + } + + var attr = !jQuery.support.hrefNormalized && notxml && special ? + // Some attributes require a special call on IE + elem.getAttribute( name, 2 ) : + elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return attr === null ? undefined : attr; + } +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspace = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }, + focusCounts = { focusin: 0, focusout: 0 }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // For whatever reason, IE has trouble passing the window object + // around, causing it to be cloned in the process + if ( jQuery.isWindow( elem ) && ( elem !== window && !elem.frameElement ) ) { + elem = window; + } + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery.data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + // Use a key less likely to result in collisions for plain JS objects. + // Fixes bug #7150. + var eventKey = elem.nodeType ? "events" : "__events__", + events = elemData[ eventKey ], + eventHandle = elemData.handle; + + if ( typeof events === "function" ) { + // On plain objects events is a fn that holds the the data + // which prevents this data from being JSON serialized + // the function does not need to be called, it just contains the data + eventHandle = events.handle; + events = events.events; + + } else if ( !events ) { + if ( !elem.nodeType ) { + // On plain objects, create a fn that acts as the holder + // of the values to avoid JSON serialization of event data + elemData[ eventKey ] = elemData = function(){}; + } + + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function() { + // Handle the second event of a trigger and when + // an event is called after a page has unloaded + return typeof jQuery !== "undefined" && !jQuery.event.triggered ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for global triggering + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + eventKey = elem.nodeType ? "events" : "__events__", + elemData = jQuery.data( elem ), + events = elemData && elemData[ eventKey ]; + + if ( !elemData || !events ) { + return; + } + + if ( typeof events === "function" ) { + elemData = events; + events = events.events; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( typeof elemData === "function" ) { + jQuery.removeData( elem, eventKey ); + + } else if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem ); + } + } + }, + + // bubbling is internal + trigger: function( event, data, elem /*, bubbling */ ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + // Event object or event type + var type = event.type || event, + bubbling = arguments[3]; + + if ( !bubbling ) { + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + jQuery.extend( jQuery.Event(type), event ) : + // Just the event type (string) + jQuery.Event(type); + + if ( type.indexOf("!") >= 0 ) { + event.type = type = type.slice(0, -1); + event.exclusive = true; + } + + // Handle a global trigger + if ( !elem ) { + // Don't bubble custom events when global (to avoid too much overhead) + event.stopPropagation(); + + // Only trigger if we've ever bound an event for it + if ( jQuery.event.global[ type ] ) { + jQuery.each( jQuery.cache, function() { + if ( this.events && this.events[type] ) { + jQuery.event.trigger( event, data, this.handle.elem ); + } + }); + } + } + + // Handle triggering a single element + + // don't do events on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + // Clean up in case it is reused + event.result = undefined; + event.target = elem; + + // Clone the incoming data, if any + data = jQuery.makeArray( data ); + data.unshift( event ); + } + + event.currentTarget = elem; + + // Trigger the event, it is assumed that "handle" is a function + var handle = elem.nodeType ? + jQuery.data( elem, "handle" ) : + (jQuery.data( elem, "__events__" ) || {}).handle; + + if ( handle ) { + handle.apply( elem, data ); + } + + var parent = elem.parentNode || elem.ownerDocument; + + // Trigger an inline bound script + try { + if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) { + if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) { + event.result = false; + event.preventDefault(); + } + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (inlineError) {} + + if ( !event.isPropagationStopped() && parent ) { + jQuery.event.trigger( event, data, parent, true ); + + } else if ( !event.isDefaultPrevented() ) { + var old, + target = event.target, + targetType = type.replace( rnamespaces, "" ), + isClick = jQuery.nodeName( target, "a" ) && targetType === "click", + special = jQuery.event.special[ targetType ] || {}; + + if ( (!special._default || special._default.call( elem, event ) === false) && + !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) { + + try { + if ( target[ targetType ] ) { + // Make sure that we don't accidentally re-trigger the onFOO events + old = target[ "on" + targetType ]; + + if ( old ) { + target[ "on" + targetType ] = null; + } + + jQuery.event.triggered = true; + target[ targetType ](); + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (triggerError) {} + + if ( old ) { + target[ "on" + targetType ] = old; + } + + jQuery.event.triggered = false; + } + } + }, + + handle: function( event ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + var all, handlers, namespaces, namespace_re, events, + namespace_sort = [], + args = jQuery.makeArray( arguments ); + + event = args[0] = jQuery.event.fix( event || window.event ); + event.currentTarget = this; + + // Namespaced event handlers + all = event.type.indexOf(".") < 0 && !event.exclusive; + + if ( !all ) { + namespaces = event.type.split("."); + event.type = namespaces.shift(); + namespace_sort = namespaces.slice(0).sort(); + namespace_re = new RegExp("(^|\\.)" + namespace_sort.join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.namespace = event.namespace || namespace_sort.join("."); + + events = jQuery.data(this, this.nodeType ? "events" : "__events__"); + + if ( typeof events === "function" ) { + events = events.events; + } + + handlers = (events || {})[ event.type ]; + + if ( events && handlers ) { + // Clone the handlers to prevent manipulation + handlers = handlers.slice(0); + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Filter the functions by class + if ( all || namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + } + + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var doc = document.documentElement, + body = document.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + // Event type + } else { + this.type = src; + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + + // Firefox sometimes assigns relatedTarget a XUL element + // which we cannot access the parentNode property of + try { + // Traverse up the tree + while ( parent && parent !== this ) { + parent = parent.parentNode; + } + + if ( parent !== this ) { + // set the correct event type + event.type = event.data; + + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } + + // assuming we've left the element since we most likely mousedover a xul element + } catch(e) { } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( this.nodeName.toLowerCase() !== "form" ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + e.liveFired = undefined; + return trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + e.liveFired = undefined; + return trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = elem.type, val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( elem.nodeName.toLowerCase() === "select" ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery.data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery.data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + return jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = elem.type; + + if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) { + return testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = elem.type; + + if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + return testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery.data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + args[0].type = type; + return jQuery.event.handle.apply( elem, args ); +} + +// Create "bubbling" focus and blur events +if ( document.addEventListener ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + jQuery.event.special[ fix ] = { + setup: function() { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + if ( focusCounts[fix]++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + if ( --focusCounts[fix] === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + + function handler( e ) { + e = jQuery.event.fix( e ); + e.type = fix; + return jQuery.event.trigger( e, null, e.target ); + } + }); +} + +// jQuery.each(["bind", "one"], function( i, name ) { +// jQuery.fn[ name ] = function( type, data, fn ) { +// // Handle object literals +// if ( typeof type === "object" ) { +// for ( var key in type ) { +// this[ name ](key, data, type[key], fn); +// } +// return this; +// } + +// if ( jQuery.isFunction( data ) || data === false ) { +// fn = data; +// data = undefined; +// } + +// var handler = name === "one" ? jQuery.proxy( fn, function( event ) { +// jQuery( this ).unbind( event, handler ); +// return fn.apply( this, arguments ); +// }) : fn; + +// if ( type === "unload" && name !== "one" ) { +// this.one( type, data, fn ); + +// } else { +// for ( var i = 0, l = this.length; i < l; i++ ) { +// jQuery.event.add( this[i], type, handler, data ); +// } +// } + +// return this; +// }; +// }); + +jQuery.fn[ "bind" ] = function( type, data, fn ) { + /// <summary> + /// Binds a handler to one or more events for each matched element. Can also bind custom events. + /// </summary> + /// <param name="type" type="String">One or more event types separated by a space. Built-in event type values are: blur, focus, load, resize, scroll, unload, click, dblclick, mousedown, mouseup, mousemove, mouseover, mouseout, mouseenter, mouseleave, change, select, submit, keydown, keypress, keyup, error .</param> + /// <param name="data" optional="true" type="Object">Additional data passed to the event handler as event.data</param> + /// <param name="fn" type="Function">A function to bind to the event on each of the set of matched elements. function callback(eventObject) such that this corresponds to the dom element.</param> + + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ "bind" ](key, data, type[key], fn); + } + return this; + } + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + var handler = "bind" === "one" ? jQuery.proxy( fn, function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }) : fn; + + return type === "unload" && "bind" !== "one" ? + this.one( type, data, fn ) : + this.each(function() { + jQuery.event.add( this, type, handler, data ); + }); +}; + +jQuery.fn[ "one" ] = function( type, data, fn ) { + /// <summary> + /// Binds a handler to one or more events to be executed exactly once for each matched element. + /// </summary> + /// <param name="type" type="String">One or more event types separated by a space. Built-in event type values are: blur, focus, load, resize, scroll, unload, click, dblclick, mousedown, mouseup, mousemove, mouseover, mouseout, mouseenter, mouseleave, change, select, submit, keydown, keypress, keyup, error .</param> + /// <param name="data" optional="true" type="Object">Additional data passed to the event handler as event.data</param> + /// <param name="fn" type="Function">A function to bind to the event on each of the set of matched elements. function callback(eventObject) such that this corresponds to the dom element.</param> + + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ "one" ](key, data, type[key], fn); + } + return this; + } + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + var handler = "one" === "one" ? jQuery.proxy( fn, function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }) : fn; + + return type === "unload" && "one" !== "one" ? + this.one( type, data, fn ) : + this.each(function() { + jQuery.event.add( this, type, handler, data ); + }); +}; + +jQuery.fn.extend({ + unbind: function( type, fn ) { + /// <summary> + /// Unbinds a handler from one or more events for each matched element. + /// </summary> + /// <param name="type" type="String">One or more event types separated by a space. Built-in event type values are: blur, focus, load, resize, scroll, unload, click, dblclick, mousedown, mouseup, mousemove, mouseover, mouseout, mouseenter, mouseleave, change, select, submit, keydown, keypress, keyup, error .</param> + /// <param name="fn" type="Function">A function to bind to the event on each of the set of matched elements. function callback(eventObject) such that this corresponds to the dom element.</param> + + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + /// <summary> + /// Triggers a type of event on every matched element. + /// </summary> + /// <param name="type" type="String">One or more event types separated by a space. Built-in event type values are: blur, focus, load, resize, scroll, unload, click, dblclick, mousedown, mouseup, mousemove, mouseover, mouseout, mouseenter, mouseleave, change, select, submit, keydown, keypress, keyup, error .</param> + /// <param name="data" optional="true" type="Array">Additional data passed to the event handler as additional arguments.</param> + /// <param name="fn" type="Function">This parameter is undocumented.</param> + + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + /// <summary> + /// Triggers all bound event handlers on an element for a specific event type without executing the browser's default actions. + /// </summary> + /// <param name="type" type="String">One or more event types separated by a space. Built-in event type values are: blur, focus, load, resize, scroll, unload, click, dblclick, mousedown, mouseup, mousemove, mouseover, mouseout, mouseenter, mouseleave, change, select, submit, keydown, keypress, keyup, error .</param> + /// <param name="data" optional="true" type="Array">Additional data passed to the event handler as additional arguments.</param> + /// <param name="fn" type="Function">This parameter is undocumented.</param> + + if ( this[0] ) { + var event = jQuery.Event( type ); + event.preventDefault(); + event.stopPropagation(); + jQuery.event.trigger( event, data, this[0] ); + return event.result; + } + }, + + toggle: function( fn ) { + /// <summary> + /// Toggles among two or more function calls every other click. + /// </summary> + /// <param name="fn" type="Function">The functions among which to toggle execution</param> + + // Save reference to arguments for access in closure + var args = arguments, + i = 1; + + // link all the functions, so any of them can unbind this click handler + while ( i < args.length ) { + jQuery.proxy( fn, args[ i++ ] ); + } + + return this.click( jQuery.proxy( fn, function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + })); + }, + + hover: function( fnOver, fnOut ) { + /// <summary> + /// Simulates hovering (moving the mouse on or off of an object). + /// </summary> + /// <param name="fnOver" type="Function">The function to fire when the mouse is moved over a matched element.</param> + /// <param name="fnOut" type="Function">The function to fire when the mouse is moved off of a matched element.</param> + + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +// jQuery.each(["live", "die"], function( i, name ) { +// jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { +// var type, i = 0, match, namespaces, preType, +// selector = origSelector || this.selector, +// context = origSelector ? this : jQuery( this.context ); + +// if ( typeof types === "object" && !types.preventDefault ) { +// for ( var key in types ) { +// context[ name ]( key, data, types[key], selector ); +// } + +// return this; +// } + +// if ( jQuery.isFunction( data ) ) { +// fn = data; +// data = undefined; +// } + +// types = (types || "").split(" "); + +// while ( (type = types[ i++ ]) != null ) { +// match = rnamespaces.exec( type ); +// namespaces = ""; + +// if ( match ) { +// namespaces = match[0]; +// type = type.replace( rnamespaces, "" ); +// } + +// if ( type === "hover" ) { +// types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); +// continue; +// } + +// preType = type; + +// if ( type === "focus" || type === "blur" ) { +// types.push( liveMap[ type ] + namespaces ); +// type = type + namespaces; + +// } else { +// type = (liveMap[ type ] || type) + namespaces; +// } + +// if ( name === "live" ) { +// // bind live handler +// for ( var j = 0, l = context.length; j < l; j++ ) { +// jQuery.event.add( context[j], "live." + liveConvert( type, selector ), +// { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); +// } + +// } else { +// // unbind live handler +// context.unbind( "live." + liveConvert( type, selector ), fn ); +// } +// } + +// return this; +// }; +// }); + +jQuery.fn[ "live" ] = function( types, data, fn ) { + /// <summary> + /// Attach a handler to the event for all elements which match the current selector, now or + /// in the future. + /// </summary> + /// <param name="types" type="String"> + /// A string containing a JavaScript event type, such as "click" or "keydown". + /// </param> + /// <param name="data" type="Object"> + /// A map of data that will be passed to the event handler. + /// </param> + /// <param name="fn" type="Function"> + /// A function to execute at the time the event is triggered. + /// </param> + /// <returns type="jQuery" /> + + var type, i = 0; + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + types = (types || "").split( /\s+/ ); + + while ( (type = types[ i++ ]) != null ) { + type = type === "focus" ? "focusin" : // focus --> focusin + type === "blur" ? "focusout" : // blur --> focusout + type === "hover" ? types.push("mouseleave") && "mouseenter" : // hover support + type; + + if ( "live" === "live" ) { + // bind live handler + jQuery( this.context ).bind( liveConvert( type, this.selector ), { + data: data, selector: this.selector, live: type + }, fn ); + + } else { + // unbind live handler + jQuery( this.context ).unbind( liveConvert( type, this.selector ), fn ? { guid: fn.guid + this.selector + type } : null ); + } + } + + return this; +} + +jQuery.fn[ "die" ] = function( types, data, fn ) { + /// <summary> + /// Remove all event handlers previously attached using .live() from the elements. + /// </summary> + /// <param name="types" type="String"> + /// A string containing a JavaScript event type, such as click or keydown. + /// </param> + /// <param name="data" type="Object"> + /// The function that is to be no longer executed. + /// </param> + /// <returns type="jQuery" /> + + var type, i = 0; + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + types = (types || "").split( /\s+/ ); + + while ( (type = types[ i++ ]) != null ) { + type = type === "focus" ? "focusin" : // focus --> focusin + type === "blur" ? "focusout" : // blur --> focusout + type === "hover" ? types.push("mouseleave") && "mouseenter" : // hover support + type; + + if ( "die" === "live" ) { + // bind live handler + jQuery( this.context ).bind( liveConvert( type, this.selector ), { + data: data, selector: this.selector, live: type + }, fn ); + + } else { + // unbind live handler + jQuery( this.context ).unbind( liveConvert( type, this.selector ), fn ? { guid: fn.guid + this.selector + type } : null ); + } + } + + return this; +} + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery.data( this, this.nodeType ? "events" : "__events__" ); + + if ( typeof events === "function" ) { + events = events.events; + } + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) + if ( event.liveFired === this || !events || !events.live || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspace, "&"); +} + +// jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + +// "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + +// "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + +// // Handle event binding +// jQuery.fn[ name ] = function( data, fn ) { +// if ( fn == null ) { +// fn = data; +// data = null; +// } + +// return arguments.length > 0 ? +// this.bind( name, data, fn ) : +// this.trigger( name ); +// }; + +// if ( jQuery.attrFn ) { +// jQuery.attrFn[ name ] = true; +// } +// }); + +jQuery.fn[ "blur" ] = function( fn ) { + /// <summary> + /// 1: blur() - Triggers the blur event of each matched element. + /// 2: blur(fn) - Binds a function to the blur event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "blur", fn ) : this.trigger( "blur" ); +}; + +jQuery.fn[ "focus" ] = function( fn ) { + /// <summary> + /// 1: focus() - Triggers the focus event of each matched element. + /// 2: focus(fn) - Binds a function to the focus event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "focus", fn ) : this.trigger( "focus" ); +}; + +jQuery.fn[ "focusin" ] = function( fn ) { + /// <summary> + /// Bind an event handler to the "focusin" JavaScript event. + /// </summary> + /// <param name="fn" type="Function"> + /// A function to execute each time the event is triggered. + /// </param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "focusin", fn ) : this.trigger( "focusin" ); +}; + +jQuery.fn[ "focusout" ] = function( fn ) { + /// <summary> + /// Bind an event handler to the "focusout" JavaScript event. + /// </summary> + /// <param name="fn" type="Function"> + /// A function to execute each time the event is triggered. + /// </param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "focusout", fn ) : this.trigger( "focusout" ); +}; + +jQuery.fn[ "load" ] = function( fn ) { + /// <summary> + /// 1: load() - Triggers the load event of each matched element. + /// 2: load(fn) - Binds a function to the load event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "load", fn ) : this.trigger( "load" ); +}; + +jQuery.fn[ "resize" ] = function( fn ) { + /// <summary> + /// 1: resize() - Triggers the resize event of each matched element. + /// 2: resize(fn) - Binds a function to the resize event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "resize", fn ) : this.trigger( "resize" ); +}; + +jQuery.fn[ "scroll" ] = function( fn ) { + /// <summary> + /// 1: scroll() - Triggers the scroll event of each matched element. + /// 2: scroll(fn) - Binds a function to the scroll event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "scroll", fn ) : this.trigger( "scroll" ); +}; + +jQuery.fn[ "unload" ] = function( fn ) { + /// <summary> + /// 1: unload() - Triggers the unload event of each matched element. + /// 2: unload(fn) - Binds a function to the unload event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "unload", fn ) : this.trigger( "unload" ); +}; + +jQuery.fn[ "click" ] = function( fn ) { + /// <summary> + /// 1: click() - Triggers the click event of each matched element. + /// 2: click(fn) - Binds a function to the click event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "click", fn ) : this.trigger( "click" ); +}; + +jQuery.fn[ "dblclick" ] = function( fn ) { + /// <summary> + /// 1: dblclick() - Triggers the dblclick event of each matched element. + /// 2: dblclick(fn) - Binds a function to the dblclick event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "dblclick", fn ) : this.trigger( "dblclick" ); +}; + +jQuery.fn[ "mousedown" ] = function( fn ) { + /// <summary> + /// Binds a function to the mousedown event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "mousedown", fn ) : this.trigger( "mousedown" ); +}; + +jQuery.fn[ "mouseup" ] = function( fn ) { + /// <summary> + /// Bind a function to the mouseup event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "mouseup", fn ) : this.trigger( "mouseup" ); +}; + +jQuery.fn[ "mousemove" ] = function( fn ) { + /// <summary> + /// Bind a function to the mousemove event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "mousemove", fn ) : this.trigger( "mousemove" ); +}; + +jQuery.fn[ "mouseover" ] = function( fn ) { + /// <summary> + /// Bind a function to the mouseover event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "mouseover", fn ) : this.trigger( "mouseover" ); +}; + +jQuery.fn[ "mouseout" ] = function( fn ) { + /// <summary> + /// Bind a function to the mouseout event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "mouseout", fn ) : this.trigger( "mouseout" ); +}; + +jQuery.fn[ "mouseenter" ] = function( fn ) { + /// <summary> + /// Bind a function to the mouseenter event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "mouseenter", fn ) : this.trigger( "mouseenter" ); +}; + +jQuery.fn[ "mouseleave" ] = function( fn ) { + /// <summary> + /// Bind a function to the mouseleave event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "mouseleave", fn ) : this.trigger( "mouseleave" ); +}; + +jQuery.fn[ "change" ] = function( fn ) { + /// <summary> + /// 1: change() - Triggers the change event of each matched element. + /// 2: change(fn) - Binds a function to the change event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "change", fn ) : this.trigger( "change" ); +}; + +jQuery.fn[ "select" ] = function( fn ) { + /// <summary> + /// 1: select() - Triggers the select event of each matched element. + /// 2: select(fn) - Binds a function to the select event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "select", fn ) : this.trigger( "select" ); +}; + +jQuery.fn[ "submit" ] = function( fn ) { + /// <summary> + /// 1: submit() - Triggers the submit event of each matched element. + /// 2: submit(fn) - Binds a function to the submit event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "submit", fn ) : this.trigger( "submit" ); +}; + +jQuery.fn[ "keydown" ] = function( fn ) { + /// <summary> + /// 1: keydown() - Triggers the keydown event of each matched element. + /// 2: keydown(fn) - Binds a function to the keydown event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "keydown", fn ) : this.trigger( "keydown" ); +}; + +jQuery.fn[ "keypress" ] = function( fn ) { + /// <summary> + /// 1: keypress() - Triggers the keypress event of each matched element. + /// 2: keypress(fn) - Binds a function to the keypress event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "keypress", fn ) : this.trigger( "keypress" ); +}; + +jQuery.fn[ "keyup" ] = function( fn ) { + /// <summary> + /// 1: keyup() - Triggers the keyup event of each matched element. + /// 2: keyup(fn) - Binds a function to the keyup event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "keyup", fn ) : this.trigger( "keyup" ); +}; + +jQuery.fn[ "error" ] = function( fn ) { + /// <summary> + /// 1: error() - Triggers the error event of each matched element. + /// 2: error(fn) - Binds a function to the error event of each matched element. + /// </summary> + /// <param name="fn" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return fn ? this.bind( "error", fn ) : this.trigger( "error" ); +}; + +// Prevent memory leaks in IE +// Window isn't included so as not to unbind existing unload events +// More info: +// - http://isaacschlueter.com/2006/10/msie-memory-leaks/ +if ( window.attachEvent && !window.addEventListener ) { + jQuery(window).bind("unload", function() { + for ( var id in jQuery.cache ) { + if ( jQuery.cache[ id ].handle ) { + // Try/Catch is to handle iframes being unloaded, see #4280 + try { + jQuery.event.remove( jQuery.cache[ id ].handle.elem ); + } catch(e) {} + } + } + }); +} + + +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + /// <summary> + /// Removes all duplicate elements from an array of elements. + /// </summary> + /// <param name="array" type="Array<Element>">The array to translate</param> + /// <returns type="Array<Element>">The array after translation.</returns> + + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace(/\\/g, ""); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = context.getElementsByTagName( "*" ); + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+\-]*)\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !/\W/.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !/\W/.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test(part) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + return context.getElementsByTagName( match[1] ); + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace(/\\/g, "") + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace(/\\/g, ""); + }, + + TAG: function( match, curLoop ) { + return match[1].toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1].replace(/\\/g, ""); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + elem.parentNode.selectedIndex; + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + /// <summary> + /// Internal use only; use hasClass('class') + /// </summary> + /// <private /> + + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + return "text" === elem.type; + }, + radio: function( elem ) { + return "radio" === elem.type; + }, + + checkbox: function( elem ) { + return "checkbox" === elem.type; + }, + + file: function( elem ) { + return "file" === elem.type; + }, + password: function( elem ) { + return "password" === elem.type; + }, + + submit: function( elem ) { + return "submit" === elem.type; + }, + + image: function( elem ) { + return "image" === elem.type; + }, + + reset: function( elem ) { + return "reset" === elem.type; + }, + + button: function( elem ) { + return "button" === elem.type || elem.nodeName.toLowerCase() === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( "Syntax error, unrecognized expression: " + name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // If the nodes are siblings (or identical) we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// [vsdoc] The following function has been modified for IntelliSense. +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + // var form = document.createElement("div"), + // id = "script" + (new Date()).getTime(), + // root = document.documentElement; + + // form.innerHTML = "<a name='" + id + "'/>"; + + // // Inject it into the root element, check its status, and remove it quickly + // root.insertBefore( form, root.firstChild ); + + // // The workaround has to do additional checks after a getElementById + // // Which slows things down for other browsers (hence the branching) + // if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + // } + + // root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +// [vsdoc] The following function has been modified for IntelliSense. +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + // var div = document.createElement("div"); + // div.appendChild( document.createComment("") ); + + // Make sure no comments are found + // if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + // } + + // Check to see if an attribute returns normalized href attributes + // div.innerHTML = "<a href='#'></a>"; + + // if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + // div.firstChild.getAttribute("href") !== "#" ) { + + // Expr.attrHandle.href = function( elem ) { + // return elem.getAttribute( "href", 2 ); + // }; + // } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Make sure that attribute selectors are quoted + query = query.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + if ( context.nodeType === 9 ) { + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var old = context.getAttribute( "id" ), + nid = old || id; + + if ( !old ) { + context.setAttribute( "id", nid ); + } + + try { + return makeArray( context.querySelectorAll( "#" + nid + " " + query ), extra ); + + } catch(pseudoError) { + } finally { + if ( !old ) { + context.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector, + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + if ( matches ) { + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + return matches.call( node, expr ); + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + /// <summary> + /// Check to see if a DOM node is within another DOM node. + /// </summary> + /// <param name="a" type="Object"> + /// The DOM element that may contain the other element. + /// </param> + /// <param name="b" type="Object"> + /// The DOM node that may be contained by the other element. + /// </param> + /// <returns type="Boolean" /> + + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + /// <summary> + /// Check to see if a DOM node is within another DOM node. + /// </summary> + /// <param name="a" type="Object"> + /// The DOM element that may contain the other element. + /// </param> + /// <param name="b" type="Object"> + /// The DOM node that may be contained by the other element. + /// </param> + /// <returns type="Boolean" /> + + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + /// <summary> + /// Determines if the parameter passed is an XML document. + /// </summary> + /// <param name="elem" type="Object">The object to test</param> + /// <returns type="Boolean">True if the parameter is an XML document; otherwise false.</returns> + + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS; + +jQuery.fn.extend({ + find: function( selector ) { + /// <summary> + /// Searches for all elements that match the specified expression. + /// This method is a good way to find additional descendant + /// elements with which to process. + /// All searching is done using a jQuery expression. The expression can be + /// written using CSS 1-3 Selector syntax, or basic XPath. + /// Part of DOM/Traversing + /// </summary> + /// <returns type="jQuery" /> + /// <param name="selector" type="String"> + /// An expression to search with. + /// </param> + /// <returns type="jQuery" /> + + var ret = this.pushStack( "", "find", selector ), + length = 0; + + for ( var i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( var n = length; n < ret.length; n++ ) { + for ( var r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + /// <summary> + /// Reduce the set of matched elements to those that have a descendant that matches the + /// selector or DOM element. + /// </summary> + /// <param name="target" type="String"> + /// A string containing a selector expression to match elements against. + /// </param> + /// <returns type="jQuery" /> + + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + /// <summary> + /// Removes any elements inside the array of elements from the set + /// of matched elements. This method is used to remove one or more + /// elements from a jQuery object. + /// Part of DOM/Traversing + /// </summary> + /// <param name="selector" type="jQuery"> + /// A set of elements to remove from the jQuery set of matched elements. + /// </param> + /// <returns type="jQuery" /> + + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + /// <summary> + /// Removes all elements from the set of matched elements that do not + /// pass the specified filter. This method is used to narrow down + /// the results of a search. + /// }) + /// Part of DOM/Traversing + /// </summary> + /// <returns type="jQuery" /> + /// <param name="selector" type="Function"> + /// A function to use for filtering + /// </param> + /// <returns type="jQuery" /> + + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + /// <summary> + /// Checks the current selection against an expression and returns true, + /// if at least one element of the selection fits the given expression. + /// Does return false, if no element fits or the expression is not valid. + /// filter(String) is used internally, therefore all rules that apply there + /// apply here, too. + /// Part of DOM/Traversing + /// </summary> + /// <returns type="Boolean" /> + /// <param name="expr" type="String"> + /// The expression with which to filter + /// </param> + + return !!selector && jQuery.filter( selector, this ).length > 0; + }, + + closest: function( selectors, context ) { + /// <summary> + /// Get a set of elements containing the closest parent element that matches the specified selector, the starting element included. + /// </summary> + /// <param name="selectors" type="String"> + /// A string containing a selector expression to match elements against. + /// </param> + /// <param name="context" type="Element"> + /// A DOM element within which a matching element may be found. If no context is passed + /// in then the context of the jQuery set will be used instead. + /// </param> + /// <returns type="jQuery" /> + + var ret = [], i, l, cur = this[0]; + + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[selector] ) { + matches[selector] = jQuery.expr.match.POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[selector]; + + if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + var pos = POS.test( selectors ) ? + jQuery( selectors, context || this.context ) : null; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique(ret) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + /// <summary> + /// Searches every matched element for the object and returns + /// the index of the element, if found, starting with zero. + /// Returns -1 if the object wasn't found. + /// Part of Core + /// </summary> + /// <returns type="Number" /> + /// <param name="elem" type="Element"> + /// Object to search for + /// </param> + + if ( !elem || typeof elem === "string" ) { + return jQuery.inArray( this[0], + // If it receives a string, the selector is used + // If it receives nothing, the siblings are used + elem ? jQuery( elem ) : this.parent().children() ); + } + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + /// <summary> + /// Adds one or more Elements to the set of matched elements. + /// Part of DOM/Traversing + /// </summary> + /// <param name="selector" type="String"> + /// A string containing a selector expression to match additional elements against. + /// </param> + /// <param name="context" type="Element"> + /// Add some elements rooted against the specified context. + /// </param> + /// <returns type="jQuery" /> + + var set = typeof selector === "string" ? + jQuery( selector, context || this.context ) : + jQuery.makeArray( selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + /// <summary> + /// Adds the previous selection to the current selection. + /// </summary> + /// <returns type="jQuery" /> + + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + /// <summary> + /// Get the ancestors of each element in the current set of matched elements, up to but not + /// including the element matched by the selector. + /// </summary> + /// <param name="until" type="String"> + /// A string containing a selector expression to indicate where to stop matching ancestor + /// elements. + /// </param> + /// <returns type="jQuery" /> + + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + /// <summary> + /// Get all following siblings of each element up to but not including the element matched + /// by the selector. + /// </summary> + /// <param name="until" type="String"> + /// A string containing a selector expression to indicate where to stop matching following + /// sibling elements. + /// </param> + /// <returns type="jQuery" /> + + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + /// <summary> + /// Get all preceding siblings of each element up to but not including the element matched + /// by the selector. + /// </summary> + /// <param name="until" type="String"> + /// A string containing a selector expression to indicate where to stop matching preceding + /// sibling elements. + /// </param> + /// <returns type="jQuery" /> + + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, slice.call(arguments).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + /// <summary> + /// This member is internal only. + /// </summary> + /// <private /> + + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + /// <summary> + /// This member is internal only. + /// </summary> + /// <private /> + + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + /// <summary> + /// This member is internal only. + /// </summary> + /// <private /> + + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnocache = /<(?:script|object|embed|option|style)/i, + // checked="checked" or checked (html5) + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + raction = /\=([^="'>\s]+\/)>/g, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + /// <summary> + /// Set the text contents of all matched elements. + /// Similar to html(), but escapes HTML (replace "<" and ">" with their + /// HTML entities). + /// Part of DOM/Attributes + /// </summary> + /// <returns type="jQuery" /> + /// <param name="text" type="String"> + /// The text value to set the contents of the element to. + /// </param> + + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + /// <summary> + /// Wrap all matched elements with a structure of other elements. + /// This wrapping process is most useful for injecting additional + /// stucture into a document, without ruining the original semantic + /// qualities of a document. + /// This works by going through the first element + /// provided and finding the deepest ancestor element within its + /// structure - it is that element that will en-wrap everything else. + /// This does not work with elements that contain text. Any necessary text + /// must be added after the wrapping is done. + /// Part of DOM/Manipulation + /// </summary> + /// <returns type="jQuery" /> + /// <param name="html" type="Element"> + /// A DOM element that will be wrapped around the target. + /// </param> + + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function( html ) { + /// <summary> + /// Wraps the inner child contents of each matched elemenht (including text nodes) with an HTML structure. + /// </summary> + /// <param name="html" type="String"> + /// A string of HTML or a DOM element that will be wrapped around the target contents. + /// </param> + /// <returns type="jQuery" /> + + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + /// <summary> + /// Wrap all matched elements with a structure of other elements. + /// This wrapping process is most useful for injecting additional + /// stucture into a document, without ruining the original semantic + /// qualities of a document. + /// This works by going through the first element + /// provided and finding the deepest ancestor element within its + /// structure - it is that element that will en-wrap everything else. + /// This does not work with elements that contain text. Any necessary text + /// must be added after the wrapping is done. + /// Part of DOM/Manipulation + /// </summary> + /// <returns type="jQuery" /> + /// <param name="html" type="Element"> + /// A DOM element that will be wrapped around the target. + /// </param> + + return this.each(function() { + jQuery( this ).wrapAll( html ); + }); + }, + + unwrap: function() { + /// <summary> + /// Remove the parents of the set of matched elements from the DOM, leaving the matched + /// elements in their place. + /// </summary> + /// <returns type="jQuery" /> + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + /// <summary> + /// Append content to the inside of every matched element. + /// This operation is similar to doing an appendChild to all the + /// specified elements, adding them into the document. + /// Part of DOM/Manipulation + /// </summary> + /// <returns type="jQuery" /> + + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + /// <summary> + /// Prepend content to the inside of every matched element. + /// This operation is the best way to insert elements + /// inside, at the beginning, of all matched elements. + /// Part of DOM/Manipulation + /// </summary> + /// <returns type="jQuery" /> + + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + /// <summary> + /// Insert content before each of the matched elements. + /// Part of DOM/Manipulation + /// </summary> + /// <returns type="jQuery" /> + + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery(arguments[0]); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + /// <summary> + /// Insert content after each of the matched elements. + /// Part of DOM/Manipulation + /// </summary> + /// <returns type="jQuery" /> + + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery(arguments[0]).toArray() ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( events ) { + /// <summary> + /// Clone matched DOM Elements and select the clones. + /// This is useful for moving copies of the elements to another + /// location in the DOM. + /// Part of DOM/Manipulation + /// </summary> + /// <returns type="jQuery" /> + /// <param name="deep" type="Boolean" optional="true"> + /// (Optional) Set to false if you don't want to clone all descendant nodes, in addition to the element itself. + /// </param> + + // Do the clone + var ret = this.map(function() { + if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) { + // IE copies events bound via attachEvent when + // using cloneNode. Calling detachEvent on the + // clone will also remove the events from the orignal + // In order to get around this, we use innerHTML. + // Unfortunately, this means some modifications to + // attributes in IE that are actually only stored + // as properties will not be copied (such as the + // the name attribute on an input). + var html = this.outerHTML, + ownerDocument = this.ownerDocument; + + if ( !html ) { + var div = ownerDocument.createElement("div"); + div.appendChild( this.cloneNode(true) ); + html = div.innerHTML; + } + + return jQuery.clean([html.replace(rinlinejQuery, "") + // Handle the case in IE 8 where action=/test/> self-closes a tag + .replace(raction, '="$1">') + .replace(rleadingWhitespace, "")], ownerDocument)[0]; + } else { + return this.cloneNode(true); + } + }); + + // Copy the events from the original to the clone + if ( events === true ) { + cloneCopyEvent( this, ret ); + cloneCopyEvent( this.find("*"), ret.find("*") ); + } + + // Return the cloned set + return ret; + }, + + html: function( value ) { + /// <summary> + /// Set the html contents of every matched element. + /// This property is not available on XML documents. + /// Part of DOM/Attributes + /// </summary> + /// <returns type="jQuery" /> + /// <param name="value" type="String"> + /// A string of HTML to set as the content of each matched element. + /// </param> + + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnocache.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + /// <summary> + /// Replaces all matched element with the specified HTML or DOM elements. + /// </summary> + /// <param name="value" type="Object"> + /// The content to insert. May be an HTML string, DOM element, or jQuery object. + /// </param> + /// <returns type="jQuery">The element that was just replaced.</returns> + + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ); + } + }, + + detach: function( selector ) { + /// <summary> + /// Remove the set of matched elements from the DOM. + /// </summary> + /// <param name="selector" type="String"> + /// A selector expression that filters the set of matched elements to be removed. + /// </param> + /// <returns type="jQuery" /> + + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + /// <param name="args" type="Array"> + /// Args + /// </param> + /// <param name="table" type="Boolean"> + /// Insert TBODY in TABLEs if one is not found. + /// </param> + /// <param name="dir" type="Number"> + /// If dir<0, process args in reverse order. + /// </param> + /// <param name="fn" type="Function"> + /// The function doing the DOM manipulation. + /// </param> + /// <returns type="jQuery" /> + /// <summary> + /// Part of Core + /// </summary> + + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + i > 0 || results.cacheable || this.length > 1 ? + fragment.cloneNode(true) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent(orig, ret) { + var i = 0; + + ret.each(function() { + if ( this.nodeName !== (orig[i] && orig[i].nodeName) ) { + return; + } + + var oldData = jQuery.data( orig[i++] ), + curData = jQuery.data( this, oldData ), + events = oldData && oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( var type in events ) { + for ( var handler in events[ type ] ) { + jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data ); + } + } + } + }); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, + doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document); + + // Only cache "small" (1/2 KB) strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document && + !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) { + + cacheable = true; + cacheresults = jQuery.fragments[ args[0] ]; + if ( cacheresults ) { + if ( cacheresults !== 1 ) { + fragment = cacheresults; + } + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +// jQuery.each({ +// appendTo: "append", +// prependTo: "prepend", +// insertBefore: "before", +// insertAfter: "after", +// replaceAll: "replaceWith" +// }, function( name, original ) { +// jQuery.fn[ name ] = function( selector ) { +// var ret = [], +// insert = jQuery( selector ), +// parent = this.length === 1 && this[0].parentNode; + +// if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { +// insert[ original ]( this[0] ); +// return this; + +// } else { +// for ( var i = 0, l = insert.length; i < l; i++ ) { +// var elems = (i > 0 ? this.clone(true) : this).get(); +// jQuery( insert[i] )[ original ]( elems ); +// ret = ret.concat( elems ); +// } +// +// return this.pushStack( ret, name, insert.selector ); +// } +// }; +// }); +jQuery.fn[ "appendTo" ] = function( selector ) { + /// <summary> + /// Append all of the matched elements to another, specified, set of elements. + /// As of jQuery 1.3.2, returns all of the inserted elements. + /// This operation is, essentially, the reverse of doing a regular + /// $(A).append(B), in that instead of appending B to A, you're appending + /// A to B. + /// </summary> + /// <param name="selector" type="Selector"> + /// target to which the content will be appended. + /// </param> + /// <returns type="jQuery" /> + + var ret = [], insert = jQuery( selector ); + + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery.fn[ "append" ].apply( jQuery(insert[i]), elems ); + ret = ret.concat( elems ); + } + return this.pushStack( ret, "appendTo", insert.selector ); +}; + +jQuery.fn[ "prependTo" ] = function( selector ) { + /// <summary> + /// Prepend all of the matched elements to another, specified, set of elements. + /// As of jQuery 1.3.2, returns all of the inserted elements. + /// This operation is, essentially, the reverse of doing a regular + /// $(A).prepend(B), in that instead of prepending B to A, you're prepending + /// A to B. + /// </summary> + /// <param name="selector" type="Selector"> + /// target to which the content will be appended. + /// </param> + /// <returns type="jQuery" /> + + var ret = [], insert = jQuery( selector ); + + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery.fn[ "prepend" ].apply( jQuery(insert[i]), elems ); + ret = ret.concat( elems ); + } + return this.pushStack( ret, "prependTo", insert.selector ); +}; + +jQuery.fn[ "insertBefore" ] = function( selector ) { + /// <summary> + /// Insert all of the matched elements before another, specified, set of elements. + /// As of jQuery 1.3.2, returns all of the inserted elements. + /// This operation is, essentially, the reverse of doing a regular + /// $(A).before(B), in that instead of inserting B before A, you're inserting + /// A before B. + /// </summary> + /// <param name="content" type="String"> + /// Content after which the selected element(s) is inserted. + /// </param> + /// <returns type="jQuery" /> + + var ret = [], insert = jQuery( selector ); + + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery.fn[ "before" ].apply( jQuery(insert[i]), elems ); + ret = ret.concat( elems ); + } + return this.pushStack( ret, "insertBefore", insert.selector ); +}; + +jQuery.fn[ "insertAfter" ] = function( selector ) { + /// <summary> + /// Insert all of the matched elements after another, specified, set of elements. + /// As of jQuery 1.3.2, returns all of the inserted elements. + /// This operation is, essentially, the reverse of doing a regular + /// $(A).after(B), in that instead of inserting B after A, you're inserting + /// A after B. + /// </summary> + /// <param name="content" type="String"> + /// Content after which the selected element(s) is inserted. + /// </param> + /// <returns type="jQuery" /> + + var ret = [], insert = jQuery( selector ); + + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery.fn[ "after" ].apply( jQuery(insert[i]), elems ); + ret = ret.concat( elems ); + } + return this.pushStack( ret, "insertAfter", insert.selector ); +}; + +jQuery.fn[ "replaceAll" ] = function( selector ) { + /// <summary> + /// Replaces the elements matched by the specified selector with the matched elements. + /// As of jQuery 1.3.2, returns all of the inserted elements. + /// </summary> + /// <param name="selector" type="Selector">The elements to find and replace the matched elements with.</param> + /// <returns type="jQuery" /> + + var ret = [], insert = jQuery( selector ); + + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery.fn[ "replaceWith" ].apply( jQuery(insert[i]), elems ); + ret = ret.concat( elems ); + } + return this.pushStack( ret, "replaceAll", insert.selector ); +}; + +jQuery.each({ + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + if ( !selector || jQuery.filter( selector, [ this ] ).length ) { + if ( !keepData && this.nodeType === 1 ) { + jQuery.cleanData( this.getElementsByTagName("*") ); + jQuery.cleanData( [ this ] ); + } + + if ( this.parentNode ) { + this.parentNode.removeChild( this ); + } + } + }, + + empty: function() { + /// <summary> + /// Removes all child nodes from the set of matched elements. + /// Part of DOM/Manipulation + /// </summary> + /// <returns type="jQuery" /> + + // Remove element nodes and prevent memory leaks + if ( this.nodeType === 1 ) { + jQuery.cleanData( this.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( this.firstChild ) { + this.removeChild( this.firstChild ); + } + } +}, function( name, fn ) { + jQuery.fn[ name ] = function() { + return this.each( fn, arguments ); + }; +}); + +jQuery.extend({ + clean: function( elems, context, fragment, scripts ) { + /// <summary> + /// This method is internal only. + /// </summary> + /// <private /> + + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = []; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" && !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + + } else if ( typeof elem === "string" ) { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( var j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, cache = jQuery.cache, + special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rdashAlpha = /-([a-z])/ig, + rupper = /([A-Z])/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle, + + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }; + +jQuery.fn.css = function( name, value ) { + /// <summary> + /// Set a single style property to a value, on all matched elements. + /// If a number is provided, it is automatically converted into a pixel value. + /// Part of CSS + /// </summary> + /// <returns type="jQuery" /> + /// <param name="name" type="String"> + /// A CSS property name. + /// </param> + /// <param name="value" type="String"> + /// A value to set for the property. + /// </param> + + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "zIndex": true, + "fontWeight": true, + "opacity": true, + "zoom": true, + "lineHeight": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + // Make sure that NaN and null values aren't set. See: #7116 + if ( typeof value === "number" && isNaN( value ) || value == null ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( typeof value === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + /// <summary> + /// This method is internal only. + /// </summary> + /// <private /> + + // Make sure that we're working with the right name + var ret, origName = jQuery.camelCase( name ), + hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name, origName ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + /// <summary> + /// Swap in/out style options. + /// </summary> + + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + }, + + camelCase: function( string ) { + return string.replace( rdashAlpha, fcamelCase ); + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + val = getWH( elem, name, extra ); + + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + if ( val <= 0 ) { + val = curCSS( elem, name, name ); + + if ( val === "0px" && currentStyle ) { + val = currentStyle( elem, name, name ); + } + + if ( val != null ) { + // Should return "auto" instead of 0, use 0 for + // temporary backwards-compat + return val === "" || val === "auto" ? "0px" : val; + } + } + + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + + // Should return "auto" instead of 0, use 0 for + // temporary backwards-compat + return val === "" || val === "auto" ? "0px" : val; + } + + return typeof val === "string" ? val : val + "px"; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat(value); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ? + (parseFloat(RegExp.$1) / 100) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // Set the alpha filter to set the opacity + var opacity = jQuery.isNaN(value) ? + "" : + "alpha(opacity=" + value * 100 + ")", + filter = style.filter || ""; + + style.filter = ralpha.test(filter) ? + filter.replace(ralpha, opacity) : + style.filter + ' ' + opacity; + } + }; +} + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, newName, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( !(defaultView = elem.ownerDocument.defaultView) ) { + return undefined; + } + + if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, rsLeft, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + elem.runtimeStyle.left = elem.currentStyle.left; + style.left = name === "fontSize" ? "1em" : (ret || 0); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + elem.runtimeStyle.left = rsLeft; + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + var which = name === "width" ? cssWidth : cssHeight, + val = name === "width" ? elem.offsetWidth : elem.offsetHeight; + + if ( extra === "border" ) { + return val; + } + + jQuery.each( which, function() { + if ( !extra ) { + val -= parseFloat(jQuery.css( elem, "padding" + this )) || 0; + } + + if ( extra === "margin" ) { + val += parseFloat(jQuery.css( elem, "margin" + this )) || 0; + + } else { + val -= parseFloat(jQuery.css( elem, "border" + this + "Width" )) || 0; + } + }); + + return val; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var jsc = jQuery.now(), + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rnoContent = /^(?:GET|HEAD)$/, + rbracket = /\[\]$/, + jsre = /\=\?(&|$)/, + rquery = /\?/, + rts = /([?&])_=[^&]*/, + rurl = /^(\w+:)?\/\/([^\/?#]+)/, + r20 = /%20/g, + rhash = /#.*$/, + + // Keep a copy of the old load method + _load = jQuery.fn.load; + +jQuery.fn.extend({ + load: function( url, params, callback ) { + /// <summary> + /// Loads HTML from a remote file and injects it into the DOM. By default performs a GET request, but if parameters are included + /// then a POST will be performed. + /// </summary> + /// <param name="url" type="String">The URL of the HTML page to load.</param> + /// <param name="data" optional="true" type="Map">Key/value pairs that will be sent to the server.</param> + /// <param name="callback" optional="true" type="Function">The function called when the AJAX request is complete. It should map function(responseText, textStatus, XMLHttpRequest) such that this maps the injected DOM element.</param> + /// <returns type="jQuery" /> + + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf(" "); + if ( off >= 0 ) { + var selector = url.slice(off, url.length); + url = url.slice(0, off); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = null; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + complete: function( res, status ) { + // If successful, inject the HTML into all the matched elements + if ( status === "success" || status === "notmodified" ) { + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(res.responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + res.responseText ); + } + + if ( callback ) { + self.each( callback, [res.responseText, status, res] ); + } + } + }); + + return this; + }, + + serialize: function() { + /// <summary> + /// Serializes a set of input elements into a string of data. + /// </summary> + /// <returns type="String">The serialized result</returns> + + return jQuery.param(this.serializeArray()); + }, + + serializeArray: function() { + /// <summary> + /// Serializes all forms and form elements but returns a JSON data structure. + /// </summary> + /// <returns type="String">A JSON data structure representing the serialized items.</returns> + + return this.map(function() { + return this.elements ? jQuery.makeArray(this.elements) : this; + }) + .filter(function() { + return this.name && !this.disabled && + (this.checked || rselectTextarea.test(this.nodeName) || + rinput.test(this.type)); + }) + .map(function( i, elem ) { + var val = jQuery(this).val(); + + return val == null ? + null : + jQuery.isArray(val) ? + jQuery.map( val, function( val, i ) { + return { name: elem.name, value: val }; + }) : + { name: elem.name, value: val }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +// jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), function( i, o ) { +// jQuery.fn[o] = function( f ) { +// return this.bind(o, f); +// }; +// }); + +jQuery.fn["ajaxStart"] = function( f ) { + /// <summary> + /// Attach a function to be executed whenever an AJAX request begins and there is none already active. This is an Ajax Event. + /// </summary> + /// <param name="f" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return this.bind("ajaxStart", f); +}; + +jQuery.fn["ajaxStop"] = function( f ) { + /// <summary> + /// Attach a function to be executed whenever all AJAX requests have ended. This is an Ajax Event. + /// </summary> + /// <param name="f" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return this.bind("ajaxStop", f); +}; + +jQuery.fn["ajaxComplete"] = function( f ) { + /// <summary> + /// Attach a function to be executed whenever an AJAX request completes. This is an Ajax Event. + /// </summary> + /// <param name="f" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return this.bind("ajaxComplete", f); +}; + +jQuery.fn["ajaxError"] = function( f ) { + /// <summary> + /// Attach a function to be executed whenever an AJAX request fails. This is an Ajax Event. + /// </summary> + /// <param name="f" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return this.bind("ajaxError", f); +}; + +jQuery.fn["ajaxSuccess"] = function( f ) { + /// <summary> + /// Attach a function to be executed whenever an AJAX request completes successfully. This is an Ajax Event. + /// </summary> + /// <param name="f" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return this.bind("ajaxSuccess", f); +}; + +jQuery.fn["ajaxSend"] = function( f ) { + /// <summary> + /// Attach a function to be executed before an AJAX request is sent. This is an Ajax Event. + /// </summary> + /// <param name="f" type="Function">The function to execute.</param> + /// <returns type="jQuery" /> + + return this.bind("ajaxSend", f); +}; + +jQuery.extend({ + get: function( url, data, callback, type ) { + /// <summary> + /// Loads a remote page using an HTTP GET request. + /// </summary> + /// <param name="url" type="String">The URL of the HTML page to load.</param> + /// <param name="data" optional="true" type="Map">Key/value pairs that will be sent to the server.</param> + /// <param name="callback" optional="true" type="Function">The function called when the AJAX request is complete. It should map function(responseText, textStatus) such that this maps the options for this AJAX request.</param> + /// <param name="type" optional="true" type="String">Type of data to be returned to callback function. Valid valiues are xml, html, script, json, text, _default.</param> + /// <returns type="XMLHttpRequest" /> + + // shift arguments if data argument was omited + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = null; + } + + return jQuery.ajax({ + type: "GET", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + getScript: function( url, callback ) { + /// <summary> + /// Loads and executes a local JavaScript file using an HTTP GET request. + /// </summary> + /// <param name="url" type="String">The URL of the script to load.</param> + /// <param name="callback" optional="true" type="Function">The function called when the AJAX request is complete. It should map function(data, textStatus) such that this maps the options for the AJAX request.</param> + /// <returns type="XMLHttpRequest" /> + + return jQuery.get(url, null, callback, "script"); + }, + + getJSON: function( url, data, callback ) { + /// <summary> + /// Loads JSON data using an HTTP GET request. + /// </summary> + /// <param name="url" type="String">The URL of the JSON data to load.</param> + /// <param name="data" optional="true" type="Map">Key/value pairs that will be sent to the server.</param> + /// <param name="callback" optional="true" type="Function">The function called when the AJAX request is complete if the data is loaded successfully. It should map function(data, textStatus) such that this maps the options for this AJAX request.</param> + /// <returns type="XMLHttpRequest" /> + + return jQuery.get(url, data, callback, "json"); + }, + + post: function( url, data, callback, type ) { + /// <summary> + /// Loads a remote page using an HTTP POST request. + /// </summary> + /// <param name="url" type="String">The URL of the HTML page to load.</param> + /// <param name="data" optional="true" type="Map">Key/value pairs that will be sent to the server.</param> + /// <param name="callback" optional="true" type="Function">The function called when the AJAX request is complete. It should map function(responseText, textStatus) such that this maps the options for this AJAX request.</param> + /// <param name="type" optional="true" type="String">Type of data to be returned to callback function. Valid valiues are xml, html, script, json, text, _default.</param> + /// <returns type="XMLHttpRequest" /> + + // shift arguments if data argument was omited + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = {}; + } + + return jQuery.ajax({ + type: "POST", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + ajaxSetup: function( settings ) { + /// <summary> + /// Sets up global settings for AJAX requests. + /// </summary> + /// <param name="settings" type="Options">A set of key/value pairs that configure the default Ajax request.</param> + + jQuery.extend( jQuery.ajaxSettings, settings ); + }, + + ajaxSettings: { + url: location.href, + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + username: null, + password: null, + traditional: false, + */ + // This function can be overriden by calling jQuery.ajaxSetup + xhr: function() { + return new window.XMLHttpRequest(); + }, + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + script: "text/javascript, application/javascript", + json: "application/json, text/javascript", + text: "text/plain", + _default: "*/*" + } + }, + + ajax: function( origSettings ) { + /// <summary> + /// Load a remote page using an HTTP request. + /// </summary> + /// <private /> + + var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings), + jsonp, status, data, type = s.type.toUpperCase(), noContent = rnoContent.test(type); + + s.url = s.url.replace( rhash, "" ); + + // Use original (not extended) context object if it was provided + s.context = origSettings && origSettings.context != null ? origSettings.context : s; + + // convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Handle JSONP Parameter Callbacks + if ( s.dataType === "jsonp" ) { + if ( type === "GET" ) { + if ( !jsre.test( s.url ) ) { + s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp || "callback") + "=?"; + } + } else if ( !s.data || !jsre.test(s.data) ) { + s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?"; + } + s.dataType = "json"; + } + + // Build temporary JSONP function + if ( s.dataType === "json" && (s.data && jsre.test(s.data) || jsre.test(s.url)) ) { + jsonp = s.jsonpCallback || ("jsonp" + jsc++); + + // Replace the =? sequence both in the query string and the data + if ( s.data ) { + s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1"); + } + + s.url = s.url.replace(jsre, "=" + jsonp + "$1"); + + // We need to make sure + // that a JSONP style response is executed properly + s.dataType = "script"; + + // Handle JSONP-style loading + var customJsonp = window[ jsonp ]; + + window[ jsonp ] = function( tmp ) { + if ( jQuery.isFunction( customJsonp ) ) { + customJsonp( tmp ); + + } else { + // Garbage collect + window[ jsonp ] = undefined; + + try { + delete window[ jsonp ]; + } catch( jsonpError ) {} + } + + data = tmp; + jQuery.handleSuccess( s, xhr, status, data ); + jQuery.handleComplete( s, xhr, status, data ); + + if ( head ) { + head.removeChild( script ); + } + }; + } + + if ( s.dataType === "script" && s.cache === null ) { + s.cache = false; + } + + if ( s.cache === false && noContent ) { + var ts = jQuery.now(); + + // try replacing _= if it is there + var ret = s.url.replace(rts, "$1_=" + ts); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ((ret === s.url) ? (rquery.test(s.url) ? "&" : "?") + "_=" + ts : ""); + } + + // If data is available, append data to url for GET/HEAD requests + if ( s.data && noContent ) { + s.url += (rquery.test(s.url) ? "&" : "?") + s.data; + } + + // Watch for a new set of requests + if ( s.global && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Matches an absolute URL, and saves the domain + var parts = rurl.exec( s.url ), + remote = parts && (parts[1] && parts[1].toLowerCase() !== location.protocol || parts[2].toLowerCase() !== location.host); + + // If we're requesting a remote document + // and trying to load JSON or Script with a GET + if ( s.dataType === "script" && type === "GET" && remote ) { + var head = document.getElementsByTagName("head")[0] || document.documentElement; + var script = document.createElement("script"); + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + script.src = s.url; + + // Handle Script loading + if ( !jsonp ) { + var done = false; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function() { + if ( !done && (!this.readyState || + this.readyState === "loaded" || this.readyState === "complete") ) { + done = true; + jQuery.handleSuccess( s, xhr, status, data ); + jQuery.handleComplete( s, xhr, status, data ); + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + if ( head && script.parentNode ) { + head.removeChild( script ); + } + } + }; + } + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + + // We handle everything using the script element injection + return undefined; + } + + var requestDone = false; + + // Create the request object + var xhr = s.xhr(); + + if ( !xhr ) { + return; + } + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open(type, s.url, s.async, s.username, s.password); + } else { + xhr.open(type, s.url, s.async); + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + // Set content-type if data specified and content-body is valid for this type + if ( (s.data != null && !noContent) || (origSettings && origSettings.contentType) ) { + xhr.setRequestHeader("Content-Type", s.contentType); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[s.url] ) { + xhr.setRequestHeader("If-Modified-Since", jQuery.lastModified[s.url]); + } + + if ( jQuery.etag[s.url] ) { + xhr.setRequestHeader("If-None-Match", jQuery.etag[s.url]); + } + } + + // Set header so the called script knows that it's an XMLHttpRequest + // Only send the header if it's not a remote XHR + if ( !remote ) { + xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest"); + } + + // Set the Accepts header for the server, depending on the dataType + xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ? + s.accepts[ s.dataType ] + ", */*; q=0.01" : + s.accepts._default ); + } catch( headerError ) {} + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && s.beforeSend.call(s.context, xhr, s) === false ) { + // Handle the global AJAX counter + if ( s.global && jQuery.active-- === 1 ) { + jQuery.event.trigger( "ajaxStop" ); + } + + // close opended socket + xhr.abort(); + return false; + } + + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxSend", [xhr, s] ); + } + + // Wait for a response to come back + var onreadystatechange = xhr.onreadystatechange = function( isTimeout ) { + // The request was aborted + if ( !xhr || xhr.readyState === 0 || isTimeout === "abort" ) { + // Opera doesn't call onreadystatechange before this point + // so we simulate the call + if ( !requestDone ) { + jQuery.handleComplete( s, xhr, status, data ); + } + + requestDone = true; + if ( xhr ) { + xhr.onreadystatechange = jQuery.noop; + } + + // The transfer is complete and the data is available, or the request timed out + } else if ( !requestDone && xhr && (xhr.readyState === 4 || isTimeout === "timeout") ) { + requestDone = true; + xhr.onreadystatechange = jQuery.noop; + + status = isTimeout === "timeout" ? + "timeout" : + !jQuery.httpSuccess( xhr ) ? + "error" : + s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? + "notmodified" : + "success"; + + var errMsg; + + if ( status === "success" ) { + // Watch for, and catch, XML document parse errors + try { + // process the data (runs the xml through httpData regardless of callback) + data = jQuery.httpData( xhr, s.dataType, s ); + } catch( parserError ) { + status = "parsererror"; + errMsg = parserError; + } + } + + // Make sure that the request was successful or notmodified + if ( status === "success" || status === "notmodified" ) { + // JSONP handles its own success callback + if ( !jsonp ) { + jQuery.handleSuccess( s, xhr, status, data ); + } + } else { + jQuery.handleError( s, xhr, status, errMsg ); + } + + // Fire the complete handlers + if ( !jsonp ) { + jQuery.handleComplete( s, xhr, status, data ); + } + + if ( isTimeout === "timeout" ) { + xhr.abort(); + } + + // Stop memory leaks + if ( s.async ) { + xhr = null; + } + } + }; + + // Override the abort handler, if we can (IE 6 doesn't allow it, but that's OK) + // Opera doesn't fire onreadystatechange at all on abort + try { + var oldAbort = xhr.abort; + xhr.abort = function() { + if ( xhr ) { + // oldAbort has no call property in IE7 so + // just do it this way, which works in all + // browsers + Function.prototype.call.call( oldAbort, xhr ); + } + + onreadystatechange( "abort" ); + }; + } catch( abortError ) {} + + // Timeout checker + if ( s.async && s.timeout > 0 ) { + setTimeout(function() { + // Check to see if the request is still happening + if ( xhr && !requestDone ) { + onreadystatechange( "timeout" ); + } + }, s.timeout); + } + + // Send the data + try { + xhr.send( noContent || s.data == null ? null : s.data ); + + } catch( sendError ) { + jQuery.handleError( s, xhr, null, sendError ); + + // Fire the complete handlers + jQuery.handleComplete( s, xhr, status, data ); + } + + // firefox 1.5 doesn't fire statechange for sync requests + if ( !s.async ) { + onreadystatechange(); + } + + // return XMLHttpRequest to allow aborting the request etc. + return xhr; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + /// <summary> + /// Create a serialized representation of an array or object, suitable for use in a URL + /// query string or Ajax request. + /// </summary> + /// <param name="a" type="Object"> + /// An array or object to serialize. + /// </param> + /// <param name="traditional" type="Boolean"> + /// A Boolean indicating whether to perform a traditional "shallow" serialization. + /// </param> + /// <returns type="String" /> + + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction(value) ? value() : value; + s[ s.length ] = encodeURIComponent(key) + "=" + encodeURIComponent(value); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray(a) || a.jquery ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[prefix], traditional, add ); + } + } + + // Return the resulting serialization + return s.join("&").replace(r20, "+"); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray(obj) && obj.length ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + if ( jQuery.isEmptyObject( obj ) ) { + add( prefix, "" ); + + // Serialize object item. + } else { + jQuery.each( obj, function( k, v ) { + buildParams( prefix + "[" + k + "]", v, traditional, add ); + }); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + handleError: function( s, xhr, status, e ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + // If a local callback was specified, fire it + if ( s.error ) { + s.error.call( s.context, xhr, status, e ); + } + + // Fire the global callback + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxError", [xhr, s, e] ); + } + }, + + handleSuccess: function( s, xhr, status, data ) { + // If a local callback was specified, fire it and pass it the data + if ( s.success ) { + s.success.call( s.context, data, status, xhr ); + } + + // Fire the global callback + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxSuccess", [xhr, s] ); + } + }, + + handleComplete: function( s, xhr, status ) { + // Process result + if ( s.complete ) { + s.complete.call( s.context, xhr, status ); + } + + // The request was completed + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxComplete", [xhr, s] ); + } + + // Handle the global AJAX counter + if ( s.global && jQuery.active-- === 1 ) { + jQuery.event.trigger( "ajaxStop" ); + } + }, + + triggerGlobal: function( s, type, args ) { + (s.context && s.context.url == null ? jQuery(s.context) : jQuery.event).trigger(type, args); + }, + + // Determines if an XMLHttpRequest was successful or not + httpSuccess: function( xhr ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + try { + // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450 + return !xhr.status && location.protocol === "file:" || + xhr.status >= 200 && xhr.status < 300 || + xhr.status === 304 || xhr.status === 1223; + } catch(e) {} + + return false; + }, + + // Determines if an XMLHttpRequest returns NotModified + httpNotModified: function( xhr, url ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + var lastModified = xhr.getResponseHeader("Last-Modified"), + etag = xhr.getResponseHeader("Etag"); + + if ( lastModified ) { + jQuery.lastModified[url] = lastModified; + } + + if ( etag ) { + jQuery.etag[url] = etag; + } + + return xhr.status === 304; + }, + + httpData: function( xhr, type, s ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + var ct = xhr.getResponseHeader("content-type") || "", + xml = type === "xml" || !type && ct.indexOf("xml") >= 0, + data = xml ? xhr.responseXML : xhr.responseText; + + if ( xml && data.documentElement.nodeName === "parsererror" ) { + jQuery.error( "parsererror" ); + } + + // Allow a pre-filtering function to sanitize the response + // s is checked to keep backwards compatibility + if ( s && s.dataFilter ) { + data = s.dataFilter( data, type ); + } + + // The filter can actually parse the response + if ( typeof data === "string" ) { + // Get the JavaScript object, if JSON is used. + if ( type === "json" || !type && ct.indexOf("json") >= 0 ) { + data = jQuery.parseJSON( data ); + + // If the type is "script", eval it in global context + } else if ( type === "script" || !type && ct.indexOf("javascript") >= 0 ) { + jQuery.globalEval( data ); + } + } + + return data; + } + +}); + +/* + * Create the request object; Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ +if ( window.ActiveXObject ) { + jQuery.ajaxSettings.xhr = function() { + if ( window.location.protocol !== "file:" ) { + try { + return new window.XMLHttpRequest(); + } catch(xhrError) {} + } + + try { + return new window.ActiveXObject("Microsoft.XMLHTTP"); + } catch(activeError) {} + }; +} + +// Does this browser support XHR requests? +jQuery.support.ajax = !!jQuery.ajaxSettings.xhr(); + + + + +var elemdisplay = {}, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)(.*)$/, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ]; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + /// <summary> + /// Show all matched elements using a graceful animation and firing an optional callback after completion. + /// </summary> + /// <param name="speed" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[i]; + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery.data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css( elem, "display" ) === "none" ) { + jQuery.data(elem, "olddisplay", defaultDisplay(elem.nodeName)); + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[i]; + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery.data(elem, "olddisplay") || ""; + } + } + + return this; + } + }, + + hide: function( speed, callback ) { + /// <summary> + /// Hides all matched elements using a graceful animation and firing an optional callback after completion. + /// </summary> + /// <param name="speed" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + var display = jQuery.css( this[i], "display" ); + + if ( display !== "none" ) { + jQuery.data( this[i], "olddisplay", display ); + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + this[i].style.display = "none"; + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + /// <summary> + /// Toggles displaying each of the set of matched elements. + /// </summary> + /// <returns type="jQuery" /> + + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + /// <summary> + /// Fades the opacity of all matched elements to a specified opacity. + /// </summary> + /// <param name="speed" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + /// <summary> + /// A function for making custom animations. + /// </summary> + /// <param name="prop" type="Options">A set of style attributes that you wish to animate and to what end.</param> + /// <param name="speed" optional="true" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="easing" optional="true" type="String">The name of the easing effect that you want to use. There are two built-in values, 'linear' and 'swing'.</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + var optall = jQuery.speed(speed, easing, callback); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete ); + } + + return this[ optall.queue === false ? "each" : "queue" ](function() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + var opt = jQuery.extend({}, optall), p, + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + self = this; + + for ( p in prop ) { + var name = jQuery.camelCase( p ); + + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + p = name; + } + + if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) { + return opt.complete.call(this); + } + + if ( isElement && ( p === "height" || p === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height + // animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + if ( !jQuery.support.inlineBlockNeedsLayout ) { + this.style.display = "inline-block"; + + } else { + var display = defaultDisplay(this.nodeName); + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( display === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.display = "inline"; + this.style.zoom = 1; + } + } + } + } + + if ( jQuery.isArray( prop[p] ) ) { + // Create (if needed) and add to specialEasing + (opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1]; + prop[p] = prop[p][0]; + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + opt.curAnim = jQuery.extend({}, prop); + + jQuery.each( prop, function( name, val ) { + var e = new jQuery.fx( self, opt, name ); + + if ( rfxtypes.test(val) ) { + e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop ); + + } else { + var parts = rfxnum.exec(val), + start = e.cur() || 0; + + if ( parts ) { + var end = parseFloat( parts[2] ), + unit = parts[3] || "px"; + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( self, name, (end || 1) + unit); + start = ((end || 1) / e.cur()) * start; + jQuery.style( self, name, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ((parts[1] === "-=" ? -1 : 1) * end) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + }); + + // For JS strict compliance + return true; + }); + }, + + stop: function( clearQueue, gotoEnd ) { + /// <summary> + /// Stops all currently animations on the specified elements. + /// </summary> + /// <param name="clearQueue" optional="true" type="Boolean">True to clear animations that are queued to run.</param> + /// <param name="gotoEnd" optional="true" type="Boolean">True to move the element value to the end of its animation target.</param> + /// <returns type="jQuery" /> + + var timers = jQuery.timers; + + if ( clearQueue ) { + this.queue([]); + } + + this.each(function() { + // go in reverse order so anything added to the queue during the loop is ignored + for ( var i = timers.length - 1; i >= 0; i-- ) { + if ( timers[i].elem === this ) { + if (gotoEnd) { + // force the next step to be the last + timers[i](true); + } + + timers.splice(i, 1); + } + } + }); + + // start the next in the queue if the last step wasn't forced + if ( !gotoEnd ) { + this.dequeue(); + } + + return this; + } + +}); + +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +// jQuery.each({ +// slideDown: genFx("show", 1), +// slideUp: genFx("hide", 1), +// slideToggle: genFx("toggle", 1), +// fadeIn: { opacity: "show" }, +// fadeOut: { opacity: "hide" }, +// fadeToggle: { opacity: "toggle" } +// }, function( name, props ) { +// jQuery.fn[ name ] = function( speed, easing, callback ) { +// return this.animate( props, speed, easing, callback ); +// }; +// }); + +jQuery.fn[ "slideDown" ] = function( speed, callback ) { + /// <summary> + /// Reveal all matched elements by adjusting their height. + /// </summary> + /// <param name="speed" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + return this.animate( genFx("show", 1), speed, callback ); +}; + +jQuery.fn[ "slideUp" ] = function( speed, callback ) { + /// <summary> + /// Hiding all matched elements by adjusting their height. + /// </summary> + /// <param name="speed" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + return this.animate( genFx("hide", 1), speed, callback ); +}; + +jQuery.fn[ "slideToggle" ] = function( speed, callback ) { + /// <summary> + /// Toggles the visibility of all matched elements by adjusting their height. + /// </summary> + /// <param name="speed" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + return this.animate( genFx("toggle", 1), speed, callback ); +}; + +jQuery.fn[ "fadeIn" ] = function( speed, callback ) { + /// <summary> + /// Fades in all matched elements by adjusting their opacity. + /// </summary> + /// <param name="speed" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + return this.animate( { opacity: "show" }, speed, callback ); +}; + +jQuery.fn[ "fadeOut" ] = function( speed, callback ) { + /// <summary> + /// Fades the opacity of all matched elements to a specified opacity. + /// </summary> + /// <param name="speed" type="String">A string representing one of three predefined speeds ('slow', 'normal', or 'fast'), or + /// the number of milliseconds to run the animation</param> + /// <param name="callback" optional="true" type="Function">A function to be executed whenever the animation completes, once for each animated element. It should map function callback() such that this is the DOM element being animated.</param> + /// <returns type="jQuery" /> + + return this.animate( { opacity: "hide" }, speed, callback ); +}; + +jQuery.extend({ + speed: function( speed, easing, fn ) { + /// <summary> + /// This member is internal. + /// </summary> + /// <private /> + + var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function() { + if ( opt.queue !== false ) { + jQuery(this).dequeue(); + } + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + /// <summary> + /// This member is internal. + /// </summary> + /// <private /> + + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + /// <summary> + /// This member is internal. + /// </summary> + /// <private /> + + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + /// <summary> + /// This member is internal. + /// </summary> + /// <private /> + + this.options = options; + this.elem = elem; + this.prop = prop; + + if ( !options.orig ) { + options.orig = {}; + } + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + /// <summary> + /// This member is internal. + /// </summary> + /// <private /> + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + }, + + // Get the current size + cur: function() { + /// <summary> + /// This member is internal. + /// </summary> + /// <private /> + + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) { + return this.elem[ this.prop ]; + } + + var r = parseFloat( jQuery.css( this.elem, this.prop ) ); + return r && r > -10000 ? r : 0; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx; + + this.startTime = jQuery.now(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || "px"; + this.now = this.start; + this.pos = this.state = 0; + + function t( gotoEnd ) { + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval(fx.tick, fx.interval); + } + }, + + // Simple 'show' function + show: function() { + /// <summary> + /// Displays each of the set of matched elements if they are hidden. + /// </summary> + + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + /// <summary> + /// Hides each of the set of matched elements if they are shown. + /// </summary> + + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function( gotoEnd ) { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + var t = jQuery.now(), done = true; + + if ( gotoEnd || t >= this.options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + this.options.curAnim[ this.prop ] = true; + + for ( var i in this.options.curAnim ) { + if ( this.options.curAnim[i] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( this.options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + var elem = this.elem, + options = this.options; + + jQuery.each( [ "", "X", "Y" ], function (index, value) { + elem.style[ "overflow" + value ] = options.overflow[index]; + } ); + } + + // Hide the element if the "hide" operation was done + if ( this.options.hide ) { + jQuery(this.elem).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( this.options.hide || this.options.show ) { + for ( var p in this.options.curAnim ) { + jQuery.style( this.elem, p, this.options.orig[p] ); + } + } + + // Execute the complete function + this.options.complete.call( this.elem ); + } + + return false; + + } else { + var n = t - this.startTime; + this.state = n / this.options.duration; + + // Perform the easing function, defaults to swing + var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop]; + var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear"); + this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration); + this.now = this.start + ((this.end - this.start) * this.pos); + + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + var timers = jQuery.timers; + + for ( var i = 0; i < timers.length; i++ ) { + if ( !timers[i]() ) { + timers.splice(i--, 1); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +function defaultDisplay( nodeName ) { + if ( !elemdisplay[ nodeName ] ) { + var elem = jQuery("<" + nodeName + ">").appendTo("body"), + display = elem.css("display"); + + elem.remove(); + + if ( display === "none" || display === "" ) { + display = "block"; + } + + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + /// <summary> + /// Set the current coordinates of every element in the set of matched elements, + /// relative to the document. + /// </summary> + /// <param name="options" type="Object"> + /// An object containing the properties top and left, which are integers indicating the + /// new top and left coordinates for the elements. + /// </param> + /// <returns type="jQuery" /> + + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box || { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = (win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop ), + scrollLeft = (win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft), + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + /// <summary> + /// Set the current coordinates of every element in the set of matched elements, + /// relative to the document. + /// </summary> + /// <param name="options" type="Object"> + /// An object containing the properties top and left, which are integers indicating the + /// new top and left coordinates for the elements. + /// </param> + /// <returns type="jQuery" /> + + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + jQuery.offset.initialize(); + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + initialize: function() { + var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0, + html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>"; + + jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } ); + + container.innerHTML = html; + body.insertBefore( container, body.firstChild ); + innerDiv = container.firstChild; + checkDiv = innerDiv.firstChild; + td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + checkDiv.style.position = "fixed"; + checkDiv.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15); + checkDiv.style.position = checkDiv.style.top = ""; + + innerDiv.style.overflow = "hidden"; + innerDiv.style.position = "relative"; + + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop); + + body.removeChild( container ); + body = container = innerDiv = checkDiv = table = td = null; + jQuery.offset.initialize = jQuery.noop; + }, + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + jQuery.offset.initialize(); + + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = (position === "absolute" && jQuery.inArray('auto', [curCSSTop, curCSSLeft]) > -1), + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is absolute + if ( calculatePosition ) { + curPosition = curElem.position(); + } + + curTop = calculatePosition ? curPosition.top : parseInt( curCSSTop, 10 ) || 0; + curLeft = calculatePosition ? curPosition.left : parseInt( curCSSLeft, 10 ) || 0; + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if (options.top != null) { + props.top = (options.top - curOffset.top) + curTop; + } + if (options.left != null) { + props.left = (options.left - curOffset.left) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + position: function() { + /// <summary> + /// Gets the top and left positions of an element relative to its offset parent. + /// </summary> + /// <returns type="Object">An object with two integer properties, 'top' and 'left'.</returns> + + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + /// <summary> + /// This method is internal. + /// </summary> + /// <private /> + + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function(val) { + /// <summary> + /// Gets and optionally sets the scroll left offset of the first matched element. + /// </summary> + /// <param name="val" type="Number" integer="true" optional="true">A positive number representing the desired scroll left offset.</param> + /// <returns type="Number" integer="true">The scroll left offset of the first matched element.</returns> + + var elem = this[0], win; + + if ( !elem ) { + return null; + } + + if ( val !== undefined ) { + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery(win).scrollLeft(), + i ? val : jQuery(win).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + } else { + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn["inner" + name] = function() { + /// <summary> + /// Gets the inner height of the first matched element, excluding border but including padding. + /// </summary> + /// <returns type="Number" integer="true">The outer height of the first matched element.</returns> + + return this[0] ? + parseFloat( jQuery.css( this[0], type, "padding" ) ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn["outer" + name] = function( margin ) { + /// <summary> + /// Gets the outer height of the first matched element, including border and padding by default. + /// </summary> + /// <param name="margins" type="Map">A set of key/value pairs that specify the options for the method.</param> + /// <returns type="Number" integer="true">The outer height of the first matched element.</returns> + + return this[0] ? + parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) : + null; + }; + + jQuery.fn[ type ] = function( size ) { + /// <summary> + /// Set the CSS height of every matched element. If no explicit unit + /// was specified (like 'em' or '%') then "px" is added to the width. If no parameter is specified, it gets + /// the current computed pixel height of the first matched element. + /// Part of CSS + /// </summary> + /// <returns type="jQuery" type="jQuery" /> + /// <param name="cssProperty" type="String"> + /// Set the CSS property to the specified value. Omit to get the value of the first matched element. + /// </param> + + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + return elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] || + elem.document.body[ "client" + name ]; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNaN( ret ) ? orig : ret; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + +// Create innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn["inner" + name] = function() { + /// <summary> + /// Gets the inner width of the first matched element, excluding border but including padding. + /// </summary> + /// <returns type="Number" integer="true">The outer width of the first matched element.</returns> + + return this[0] ? + parseFloat( jQuery.css( this[0], type, "padding" ) ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn["outer" + name] = function( margin ) { + /// <summary> + /// Gets the outer width of the first matched element, including border and padding by default. + /// </summary> + /// <param name="margin" type="Map">A set of key/value pairs that specify the options for the method.</param> + /// <returns type="Number" integer="true">The outer width of the first matched element.</returns> + + return this[0] ? + parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) : + null; + }; + + jQuery.fn[ type ] = function( size ) { + /// <summary> + /// Set the CSS width of every matched element. If no explicit unit + /// was specified (like 'em' or '%') then "px" is added to the width. If no parameter is specified, it gets + /// the current computed pixel width of the first matched element. + /// Part of CSS + /// </summary> + /// <returns type="jQuery" type="jQuery" /> + /// <param name="cssProperty" type="String"> + /// Set the CSS property to the specified value. Omit to get the value of the first matched element. + /// </param> + + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + return elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] || + elem.document.body[ "client" + name ]; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNaN( ret ) ? orig : ret; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + +})(window);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery-1.4.4.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,7177 @@ +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery JavaScript Library v1.4.4 + * http://jquery.com/ + * + * Copyright 2010, John Resig + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2010, The Dojo Foundation + * + * Date: Thu Nov 11 19:04:53 2010 -0500 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/, + + // Is it a simple selector + isSimple = /^.[^:#\[\.,]*$/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + rwhite = /\s/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for non-word characters + rnonword = /\W/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // Has the ready events already been bound? + readyBound = false, + + // The functions to execute on DOM ready + readyList = [], + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + init: function( selector, context ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = "body"; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $("TAG") + } else if ( !context && !rnonword.test( selector ) ) { + this.selector = selector; + this.context = document; + selector = document.getElementsByTagName( selector ); + return jQuery.merge( this, selector ); + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return jQuery( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.4.4", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this.slice(num)[ 0 ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = jQuery(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // If the DOM is already ready + if ( jQuery.isReady ) { + // Execute the function immediately + fn.call( document, jQuery ); + + // Otherwise, remember the function for later + } else if ( readyList ) { + // Add the function to the wait list + readyList.push( fn ); + } + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || jQuery(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + window.$ = _$; + + if ( deep ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + // A third-party is pushing the ready event forwards + if ( wait === true ) { + jQuery.readyWait--; + } + + // Make sure that the DOM is not already loaded + if ( !jQuery.readyWait || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + if ( readyList ) { + // Execute all of them + var fn, + i = 0, + ready = readyList; + + // Reset the list of functions + readyList = null; + + while ( (fn = ready[ i++ ]) ) { + fn.call( document, jQuery ); + } + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + } + }, + + bindReady: function() { + if ( readyBound ) { + return; + } + + readyBound = true; + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent("onreadystatechange", DOMContentLoaded); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test(data.replace(rvalidescape, "@") + .replace(rvalidtokens, "]") + .replace(rvalidbraces, "")) ) { + + // Try to use the native JSON parser first + return window.JSON && window.JSON.parse ? + window.JSON.parse( data ) : + (new Function("return " + data))(); + + } else { + jQuery.error( "Invalid JSON: " + data ); + } + }, + + noop: function() {}, + + // Evalulates a script in a global context + globalEval: function( data ) { + if ( data && rnotwhite.test(data) ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.getElementsByTagName("head")[0] || document.documentElement, + script = document.createElement("script"); + + script.type = "text/javascript"; + + if ( jQuery.support.scriptEval ) { + script.appendChild( document.createTextNode( data ) ); + } else { + script.text = data; + } + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction(object); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {} + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type(array); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + if ( array.indexOf ) { + return array.indexOf( elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var ret = [], value; + + // Go through the array, translating each of the items to their + // new value (or values). + for ( var i = 0, length = elems.length; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + proxy: function( fn, proxy, thisObject ) { + if ( arguments.length === 2 ) { + if ( typeof proxy === "string" ) { + thisObject = fn; + fn = thisObject[ proxy ]; + proxy = undefined; + + } else if ( proxy && !jQuery.isFunction( proxy ) ) { + thisObject = proxy; + proxy = undefined; + } + } + + if ( !proxy && fn ) { + proxy = function() { + return fn.apply( thisObject || this, arguments ); + }; + } + + // Set the guid of unique handler to the same of original handler, so it can be removed + if ( fn ) { + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + } + + // So proxy can be declared as an argument + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can be optionally by executed if its a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +if ( indexOf ) { + jQuery.inArray = function( elem, array ) { + return indexOf.call( array, elem ); + }; +} + +// Verify that \s matches non-breaking spaces +// (IE fails on this test) +if ( !rwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +// Expose jQuery to the global object +return (window.jQuery = window.$ = jQuery); + +})(); + + +(function() { + + jQuery.support = {}; + + var root = document.documentElement, + script = document.createElement("script"), + div = document.createElement("div"), + id = "script" + jQuery.now(); + + div.style.display = "none"; + div.innerHTML = " <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + var all = div.getElementsByTagName("*"), + a = div.getElementsByTagName("a")[0], + select = document.createElement("select"), + opt = select.appendChild( document.createElement("option") ); + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return; + } + + jQuery.support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType === 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText insted) + style: /red/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: a.getAttribute("href") === "/a", + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: div.getElementsByTagName("input")[0].value === "on", + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Will be defined later + deleteExpando: true, + optDisabled: false, + checkClone: false, + scriptEval: false, + noCloneEvent: true, + boxModel: null, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableHiddenOffsets: true + }; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as diabled) + select.disabled = true; + jQuery.support.optDisabled = !opt.disabled; + + script.type = "text/javascript"; + try { + script.appendChild( document.createTextNode( "window." + id + "=1;" ) ); + } catch(e) {} + + root.insertBefore( script, root.firstChild ); + + // Make sure that the execution of code works by injecting a script + // tag with appendChild/createTextNode + // (IE doesn't support this, fails, and uses .text instead) + if ( window[ id ] ) { + jQuery.support.scriptEval = true; + delete window[ id ]; + } + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete script.test; + + } catch(e) { + jQuery.support.deleteExpando = false; + } + + root.removeChild( script ); + + if ( div.attachEvent && div.fireEvent ) { + div.attachEvent("onclick", function click() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + jQuery.support.noCloneEvent = false; + div.detachEvent("onclick", click); + }); + div.cloneNode(true).fireEvent("onclick"); + } + + div = document.createElement("div"); + div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>"; + + var fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked; + + // Figure out if the W3C box model works as expected + // document.body must exist before we can do this + jQuery(function() { + var div = document.createElement("div"); + div.style.width = div.style.paddingLeft = "1px"; + + document.body.appendChild( div ); + jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + jQuery.support.inlineBlockNeedsLayout = div.offsetWidth === 2; + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + jQuery.support.shrinkWrapBlocks = div.offsetWidth !== 2; + } + + div.innerHTML = "<table><tr><td style='padding:0;display:none'></td><td>t</td></tr></table>"; + var tds = div.getElementsByTagName("td"); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + jQuery.support.reliableHiddenOffsets = tds[0].offsetHeight === 0; + + tds[0].style.display = ""; + tds[1].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + jQuery.support.reliableHiddenOffsets = jQuery.support.reliableHiddenOffsets && tds[0].offsetHeight === 0; + div.innerHTML = ""; + + document.body.removeChild( div ).style.display = "none"; + div = tds = null; + }); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + var eventSupported = function( eventName ) { + var el = document.createElement("div"); + eventName = "on" + eventName; + + var isSupported = (eventName in el); + if ( !isSupported ) { + el.setAttribute(eventName, "return;"); + isSupported = typeof el[eventName] === "function"; + } + el = null; + + return isSupported; + }; + + jQuery.support.submitBubbles = eventSupported("submit"); + jQuery.support.changeBubbles = eventSupported("change"); + + // release memory in IE + root = script = div = all = a = null; +})(); + + + +var windowData = {}, + rbrace = /^(?:\{.*\}|\[.*\])$/; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + expando: "jQuery" + jQuery.now(), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + data: function( elem, name, data ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + elem = elem == window ? + windowData : + elem; + + var isNode = elem.nodeType, + id = isNode ? elem[ jQuery.expando ] : null, + cache = jQuery.cache, thisCache; + + if ( isNode && !id && typeof name === "string" && data === undefined ) { + return; + } + + // Get the data from the object directly + if ( !isNode ) { + cache = elem; + + // Compute a unique ID for the element + } else if ( !id ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } + + // Avoid generating a new cache unless none exists and we + // want to manipulate it. + if ( typeof name === "object" ) { + if ( isNode ) { + cache[ id ] = jQuery.extend(cache[ id ], name); + + } else { + jQuery.extend( cache, name ); + } + + } else if ( isNode && !cache[ id ] ) { + cache[ id ] = {}; + } + + thisCache = isNode ? cache[ id ] : cache; + + // Prevent overriding the named cache with undefined values + if ( data !== undefined ) { + thisCache[ name ] = data; + } + + return typeof name === "string" ? thisCache[ name ] : thisCache; + }, + + removeData: function( elem, name ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + elem = elem == window ? + windowData : + elem; + + var isNode = elem.nodeType, + id = isNode ? elem[ jQuery.expando ] : elem, + cache = jQuery.cache, + thisCache = isNode ? cache[ id ] : id; + + // If we want to remove a specific section of the element's data + if ( name ) { + if ( thisCache ) { + // Remove the section of cache data + delete thisCache[ name ]; + + // If we've removed all the data, remove the element's cache + if ( isNode && jQuery.isEmptyObject(thisCache) ) { + jQuery.removeData( elem ); + } + } + + // Otherwise, we want to remove all of the element's data + } else { + if ( isNode && jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + + // Completely remove the data cache + } else if ( isNode ) { + delete cache[ id ]; + + // Remove all fields from the object + } else { + for ( var n in elem ) { + delete elem[ n ]; + } + } + } + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + var attr = this[0].attributes, name; + data = jQuery.data( this[0] ); + + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = name.substr( 5 ); + dataAttr( this[0], name, data[ name ] ); + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + data = elem.getAttribute( "data-" + key ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + + + + +jQuery.extend({ + queue: function( elem, type, data ) { + if ( !elem ) { + return; + } + + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( !data ) { + return q || []; + } + + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data) ); + + } else { + q.push( data ); + } + + return q; + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(); + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function( i ) { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + } +}); + + + + +var rclass = /[\n\t]/g, + rspaces = /\s+/, + rreturn = /\r/g, + rspecialurl = /^(?:href|src|style)$/, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rradiocheck = /^(?:radio|checkbox)$/i; + +jQuery.props = { + "for": "htmlFor", + "class": "className", + readonly: "readOnly", + maxlength: "maxLength", + cellspacing: "cellSpacing", + rowspan: "rowSpan", + colspan: "colSpan", + tabindex: "tabIndex", + usemap: "useMap", + frameborder: "frameBorder" +}; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name, fn ) { + return this.each(function(){ + jQuery.attr( this, name, "" ); + if ( this.nodeType === 1 ) { + this.removeAttribute( name ); + } + }); + }, + + addClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.addClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( value && typeof value === "string" ) { + var classNames = (value || "").split( rspaces ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className ) { + elem.className = value; + + } else { + var className = " " + elem.className + " ", + setClass = elem.className; + + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) { + setClass += " " + classNames[c]; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.removeClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + var classNames = (value || "").split( rspaces ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + var className = (" " + elem.className + " ").replace(rclass, " "); + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[c] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this); + self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspaces ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery.data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery.data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + if ( !arguments.length ) { + var elem = this[0]; + + if ( elem ) { + if ( jQuery.nodeName( elem, "option" ) ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + } + + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) { + return elem.getAttribute("value") === null ? "on" : elem.value; + } + + + // Everything else, we just grab the value + return (elem.value || "").replace(rreturn, ""); + + } + + return undefined; + } + + var isFunction = jQuery.isFunction(value); + + return this.each(function(i) { + var self = jQuery(this), val = value; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call(this, i, self.val()); + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray(val) ) { + val = jQuery.map(val, function (value) { + return value == null ? "" : value + ""; + }); + } + + if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) { + this.checked = jQuery.inArray( self.val(), val ) >= 0; + + } else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(val); + + jQuery( "option", this ).each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + this.selectedIndex = -1; + } + + } else { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + // don't set attributes on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery(elem)[name](value); + } + + var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ), + // Whether we are setting (or getting) + set = value !== undefined; + + // Try to normalize/fix the name + name = notxml && jQuery.props[ name ] || name; + + // These attributes require special treatment + var special = rspecialurl.test( name ); + + // Safari mis-reports the default selected property of an option + // Accessing the parent's selectedIndex property fixes it + if ( name === "selected" && !jQuery.support.optSelected ) { + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + + // If applicable, access the attribute via the DOM 0 way + // 'in' checks fail in Blackberry 4.7 #6931 + if ( (name in elem || elem[ name ] !== undefined) && notxml && !special ) { + if ( set ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } + + if ( value === null ) { + if ( elem.nodeType === 1 ) { + elem.removeAttribute( name ); + } + + } else { + elem[ name ] = value; + } + } + + // browsers index elements by id/name on forms, give priority to attributes. + if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) { + return elem.getAttributeNode( name ).nodeValue; + } + + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + if ( name === "tabIndex" ) { + var attributeNode = elem.getAttributeNode( "tabIndex" ); + + return attributeNode && attributeNode.specified ? + attributeNode.value : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + + return elem[ name ]; + } + + if ( !jQuery.support.style && notxml && name === "style" ) { + if ( set ) { + elem.style.cssText = "" + value; + } + + return elem.style.cssText; + } + + if ( set ) { + // convert the value to a string (all browsers do this but IE) see #1070 + elem.setAttribute( name, "" + value ); + } + + // Ensure that missing attributes return undefined + // Blackberry 4.7 returns "" from getAttribute #6938 + if ( !elem.attributes[ name ] && (elem.hasAttribute && !elem.hasAttribute( name )) ) { + return undefined; + } + + var attr = !jQuery.support.hrefNormalized && notxml && special ? + // Some attributes require a special call on IE + elem.getAttribute( name, 2 ) : + elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return attr === null ? undefined : attr; + } +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspace = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }, + focusCounts = { focusin: 0, focusout: 0 }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // For whatever reason, IE has trouble passing the window object + // around, causing it to be cloned in the process + if ( jQuery.isWindow( elem ) && ( elem !== window && !elem.frameElement ) ) { + elem = window; + } + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery.data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + // Use a key less likely to result in collisions for plain JS objects. + // Fixes bug #7150. + var eventKey = elem.nodeType ? "events" : "__events__", + events = elemData[ eventKey ], + eventHandle = elemData.handle; + + if ( typeof events === "function" ) { + // On plain objects events is a fn that holds the the data + // which prevents this data from being JSON serialized + // the function does not need to be called, it just contains the data + eventHandle = events.handle; + events = events.events; + + } else if ( !events ) { + if ( !elem.nodeType ) { + // On plain objects, create a fn that acts as the holder + // of the values to avoid JSON serialization of event data + elemData[ eventKey ] = elemData = function(){}; + } + + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function() { + // Handle the second event of a trigger and when + // an event is called after a page has unloaded + return typeof jQuery !== "undefined" && !jQuery.event.triggered ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for global triggering + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + eventKey = elem.nodeType ? "events" : "__events__", + elemData = jQuery.data( elem ), + events = elemData && elemData[ eventKey ]; + + if ( !elemData || !events ) { + return; + } + + if ( typeof events === "function" ) { + elemData = events; + events = events.events; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( typeof elemData === "function" ) { + jQuery.removeData( elem, eventKey ); + + } else if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem ); + } + } + }, + + // bubbling is internal + trigger: function( event, data, elem /*, bubbling */ ) { + // Event object or event type + var type = event.type || event, + bubbling = arguments[3]; + + if ( !bubbling ) { + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + jQuery.extend( jQuery.Event(type), event ) : + // Just the event type (string) + jQuery.Event(type); + + if ( type.indexOf("!") >= 0 ) { + event.type = type = type.slice(0, -1); + event.exclusive = true; + } + + // Handle a global trigger + if ( !elem ) { + // Don't bubble custom events when global (to avoid too much overhead) + event.stopPropagation(); + + // Only trigger if we've ever bound an event for it + if ( jQuery.event.global[ type ] ) { + jQuery.each( jQuery.cache, function() { + if ( this.events && this.events[type] ) { + jQuery.event.trigger( event, data, this.handle.elem ); + } + }); + } + } + + // Handle triggering a single element + + // don't do events on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + // Clean up in case it is reused + event.result = undefined; + event.target = elem; + + // Clone the incoming data, if any + data = jQuery.makeArray( data ); + data.unshift( event ); + } + + event.currentTarget = elem; + + // Trigger the event, it is assumed that "handle" is a function + var handle = elem.nodeType ? + jQuery.data( elem, "handle" ) : + (jQuery.data( elem, "__events__" ) || {}).handle; + + if ( handle ) { + handle.apply( elem, data ); + } + + var parent = elem.parentNode || elem.ownerDocument; + + // Trigger an inline bound script + try { + if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) { + if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) { + event.result = false; + event.preventDefault(); + } + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (inlineError) {} + + if ( !event.isPropagationStopped() && parent ) { + jQuery.event.trigger( event, data, parent, true ); + + } else if ( !event.isDefaultPrevented() ) { + var old, + target = event.target, + targetType = type.replace( rnamespaces, "" ), + isClick = jQuery.nodeName( target, "a" ) && targetType === "click", + special = jQuery.event.special[ targetType ] || {}; + + if ( (!special._default || special._default.call( elem, event ) === false) && + !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) { + + try { + if ( target[ targetType ] ) { + // Make sure that we don't accidentally re-trigger the onFOO events + old = target[ "on" + targetType ]; + + if ( old ) { + target[ "on" + targetType ] = null; + } + + jQuery.event.triggered = true; + target[ targetType ](); + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (triggerError) {} + + if ( old ) { + target[ "on" + targetType ] = old; + } + + jQuery.event.triggered = false; + } + } + }, + + handle: function( event ) { + var all, handlers, namespaces, namespace_re, events, + namespace_sort = [], + args = jQuery.makeArray( arguments ); + + event = args[0] = jQuery.event.fix( event || window.event ); + event.currentTarget = this; + + // Namespaced event handlers + all = event.type.indexOf(".") < 0 && !event.exclusive; + + if ( !all ) { + namespaces = event.type.split("."); + event.type = namespaces.shift(); + namespace_sort = namespaces.slice(0).sort(); + namespace_re = new RegExp("(^|\\.)" + namespace_sort.join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.namespace = event.namespace || namespace_sort.join("."); + + events = jQuery.data(this, this.nodeType ? "events" : "__events__"); + + if ( typeof events === "function" ) { + events = events.events; + } + + handlers = (events || {})[ event.type ]; + + if ( events && handlers ) { + // Clone the handlers to prevent manipulation + handlers = handlers.slice(0); + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Filter the functions by class + if ( all || namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + } + + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var doc = document.documentElement, + body = document.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + // Event type + } else { + this.type = src; + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + + // Firefox sometimes assigns relatedTarget a XUL element + // which we cannot access the parentNode property of + try { + // Traverse up the tree + while ( parent && parent !== this ) { + parent = parent.parentNode; + } + + if ( parent !== this ) { + // set the correct event type + event.type = event.data; + + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } + + // assuming we've left the element since we most likely mousedover a xul element + } catch(e) { } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( this.nodeName.toLowerCase() !== "form" ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + e.liveFired = undefined; + return trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + e.liveFired = undefined; + return trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = elem.type, val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( elem.nodeName.toLowerCase() === "select" ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery.data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery.data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + return jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = elem.type; + + if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) { + return testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = elem.type; + + if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + return testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery.data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + args[0].type = type; + return jQuery.event.handle.apply( elem, args ); +} + +// Create "bubbling" focus and blur events +if ( document.addEventListener ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + jQuery.event.special[ fix ] = { + setup: function() { + if ( focusCounts[fix]++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --focusCounts[fix] === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + + function handler( e ) { + e = jQuery.event.fix( e ); + e.type = fix; + return jQuery.event.trigger( e, null, e.target ); + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( jQuery.isFunction( data ) || data === false ) { + fn = data; + data = undefined; + } + + var handler = name === "one" ? jQuery.proxy( fn, function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }) : fn; + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + var event = jQuery.Event( type ); + event.preventDefault(); + event.stopPropagation(); + jQuery.event.trigger( event, data, this[0] ); + return event.result; + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + i = 1; + + // link all the functions, so any of them can unbind this click handler + while ( i < args.length ) { + jQuery.proxy( fn, args[ i++ ] ); + } + + return this.click( jQuery.proxy( fn, function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + })); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( typeof types === "object" && !types.preventDefault ) { + for ( var key in types ) { + context[ name ]( key, data, types[key], selector ); + } + + return this; + } + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( type === "focus" || type === "blur" ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + for ( var j = 0, l = context.length; j < l; j++ ) { + jQuery.event.add( context[j], "live." + liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + } + + } else { + // unbind live handler + context.unbind( "live." + liveConvert( type, selector ), fn ); + } + } + + return this; + }; +}); + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery.data( this, this.nodeType ? "events" : "__events__" ); + + if ( typeof events === "function" ) { + events = events.events; + } + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) + if ( event.liveFired === this || !events || !events.live || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspace, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + +// Prevent memory leaks in IE +// Window isn't included so as not to unbind existing unload events +// More info: +// - http://isaacschlueter.com/2006/10/msie-memory-leaks/ +if ( window.attachEvent && !window.addEventListener ) { + jQuery(window).bind("unload", function() { + for ( var id in jQuery.cache ) { + if ( jQuery.cache[ id ].handle ) { + // Try/Catch is to handle iframes being unloaded, see #4280 + try { + jQuery.event.remove( jQuery.cache[ id ].handle.elem ); + } catch(e) {} + } + } + }); +} + + +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace(/\\/g, ""); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = context.getElementsByTagName( "*" ); + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+\-]*)\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !/\W/.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !/\W/.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test(part) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + return context.getElementsByTagName( match[1] ); + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace(/\\/g, "") + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace(/\\/g, ""); + }, + + TAG: function( match, curLoop ) { + return match[1].toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1].replace(/\\/g, ""); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + elem.parentNode.selectedIndex; + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + return "text" === elem.type; + }, + radio: function( elem ) { + return "radio" === elem.type; + }, + + checkbox: function( elem ) { + return "checkbox" === elem.type; + }, + + file: function( elem ) { + return "file" === elem.type; + }, + password: function( elem ) { + return "password" === elem.type; + }, + + submit: function( elem ) { + return "submit" === elem.type; + }, + + image: function( elem ) { + return "image" === elem.type; + }, + + reset: function( elem ) { + return "reset" === elem.type; + }, + + button: function( elem ) { + return "button" === elem.type || elem.nodeName.toLowerCase() === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( "Syntax error, unrecognized expression: " + name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // If the nodes are siblings (or identical) we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Make sure that attribute selectors are quoted + query = query.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + if ( context.nodeType === 9 ) { + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var old = context.getAttribute( "id" ), + nid = old || id; + + if ( !old ) { + context.setAttribute( "id", nid ); + } + + try { + return makeArray( context.querySelectorAll( "#" + nid + " " + query ), extra ); + + } catch(pseudoError) { + } finally { + if ( !old ) { + context.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector, + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + if ( matches ) { + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + return matches.call( node, expr ); + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS; + +jQuery.fn.extend({ + find: function( selector ) { + var ret = this.pushStack( "", "find", selector ), + length = 0; + + for ( var i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( var n = length; n < ret.length; n++ ) { + for ( var r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && jQuery.filter( selector, this ).length > 0; + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[selector] ) { + matches[selector] = jQuery.expr.match.POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[selector]; + + if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + var pos = POS.test( selectors ) ? + jQuery( selectors, context || this.context ) : null; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique(ret) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + if ( !elem || typeof elem === "string" ) { + return jQuery.inArray( this[0], + // If it receives a string, the selector is used + // If it receives nothing, the siblings are used + elem ? jQuery( elem ) : this.parent().children() ); + } + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context || this.context ) : + jQuery.makeArray( selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, slice.call(arguments).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnocache = /<(?:script|object|embed|option|style)/i, + // checked="checked" or checked (html5) + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + raction = /\=([^="'>\s]+\/)>/g, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + return this.each(function() { + jQuery( this ).wrapAll( html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery(arguments[0]); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery(arguments[0]).toArray() ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( events ) { + // Do the clone + var ret = this.map(function() { + if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) { + // IE copies events bound via attachEvent when + // using cloneNode. Calling detachEvent on the + // clone will also remove the events from the orignal + // In order to get around this, we use innerHTML. + // Unfortunately, this means some modifications to + // attributes in IE that are actually only stored + // as properties will not be copied (such as the + // the name attribute on an input). + var html = this.outerHTML, + ownerDocument = this.ownerDocument; + + if ( !html ) { + var div = ownerDocument.createElement("div"); + div.appendChild( this.cloneNode(true) ); + html = div.innerHTML; + } + + return jQuery.clean([html.replace(rinlinejQuery, "") + // Handle the case in IE 8 where action=/test/> self-closes a tag + .replace(raction, '="$1">') + .replace(rleadingWhitespace, "")], ownerDocument)[0]; + } else { + return this.cloneNode(true); + } + }); + + // Copy the events from the original to the clone + if ( events === true ) { + cloneCopyEvent( this, ret ); + cloneCopyEvent( this.find("*"), ret.find("*") ); + } + + // Return the cloned set + return ret; + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnocache.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ); + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + i > 0 || results.cacheable || this.length > 1 ? + fragment.cloneNode(true) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent(orig, ret) { + var i = 0; + + ret.each(function() { + if ( this.nodeName !== (orig[i] && orig[i].nodeName) ) { + return; + } + + var oldData = jQuery.data( orig[i++] ), + curData = jQuery.data( this, oldData ), + events = oldData && oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( var type in events ) { + for ( var handler in events[ type ] ) { + jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data ); + } + } + } + }); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, + doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document); + + // Only cache "small" (1/2 KB) strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document && + !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) { + + cacheable = true; + cacheresults = jQuery.fragments[ args[0] ]; + if ( cacheresults ) { + if ( cacheresults !== 1 ) { + fragment = cacheresults; + } + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +jQuery.extend({ + clean: function( elems, context, fragment, scripts ) { + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = []; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" && !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + + } else if ( typeof elem === "string" ) { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( var j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, cache = jQuery.cache, + special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rdashAlpha = /-([a-z])/ig, + rupper = /([A-Z])/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle, + + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "zIndex": true, + "fontWeight": true, + "opacity": true, + "zoom": true, + "lineHeight": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + // Make sure that NaN and null values aren't set. See: #7116 + if ( typeof value === "number" && isNaN( value ) || value == null ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( typeof value === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + // Make sure that we're working with the right name + var ret, origName = jQuery.camelCase( name ), + hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name, origName ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + }, + + camelCase: function( string ) { + return string.replace( rdashAlpha, fcamelCase ); + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + val = getWH( elem, name, extra ); + + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + if ( val <= 0 ) { + val = curCSS( elem, name, name ); + + if ( val === "0px" && currentStyle ) { + val = currentStyle( elem, name, name ); + } + + if ( val != null ) { + // Should return "auto" instead of 0, use 0 for + // temporary backwards-compat + return val === "" || val === "auto" ? "0px" : val; + } + } + + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + + // Should return "auto" instead of 0, use 0 for + // temporary backwards-compat + return val === "" || val === "auto" ? "0px" : val; + } + + return typeof val === "string" ? val : val + "px"; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat(value); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ? + (parseFloat(RegExp.$1) / 100) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // Set the alpha filter to set the opacity + var opacity = jQuery.isNaN(value) ? + "" : + "alpha(opacity=" + value * 100 + ")", + filter = style.filter || ""; + + style.filter = ralpha.test(filter) ? + filter.replace(ralpha, opacity) : + style.filter + ' ' + opacity; + } + }; +} + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, newName, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( !(defaultView = elem.ownerDocument.defaultView) ) { + return undefined; + } + + if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, rsLeft, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + elem.runtimeStyle.left = elem.currentStyle.left; + style.left = name === "fontSize" ? "1em" : (ret || 0); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + elem.runtimeStyle.left = rsLeft; + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + var which = name === "width" ? cssWidth : cssHeight, + val = name === "width" ? elem.offsetWidth : elem.offsetHeight; + + if ( extra === "border" ) { + return val; + } + + jQuery.each( which, function() { + if ( !extra ) { + val -= parseFloat(jQuery.css( elem, "padding" + this )) || 0; + } + + if ( extra === "margin" ) { + val += parseFloat(jQuery.css( elem, "margin" + this )) || 0; + + } else { + val -= parseFloat(jQuery.css( elem, "border" + this + "Width" )) || 0; + } + }); + + return val; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var jsc = jQuery.now(), + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rnoContent = /^(?:GET|HEAD)$/, + rbracket = /\[\]$/, + jsre = /\=\?(&|$)/, + rquery = /\?/, + rts = /([?&])_=[^&]*/, + rurl = /^(\w+:)?\/\/([^\/?#]+)/, + r20 = /%20/g, + rhash = /#.*$/, + + // Keep a copy of the old load method + _load = jQuery.fn.load; + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf(" "); + if ( off >= 0 ) { + var selector = url.slice(off, url.length); + url = url.slice(0, off); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = null; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + complete: function( res, status ) { + // If successful, inject the HTML into all the matched elements + if ( status === "success" || status === "notmodified" ) { + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(res.responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + res.responseText ); + } + + if ( callback ) { + self.each( callback, [res.responseText, status, res] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param(this.serializeArray()); + }, + + serializeArray: function() { + return this.map(function() { + return this.elements ? jQuery.makeArray(this.elements) : this; + }) + .filter(function() { + return this.name && !this.disabled && + (this.checked || rselectTextarea.test(this.nodeName) || + rinput.test(this.type)); + }) + .map(function( i, elem ) { + var val = jQuery(this).val(); + + return val == null ? + null : + jQuery.isArray(val) ? + jQuery.map( val, function( val, i ) { + return { name: elem.name, value: val }; + }) : + { name: elem.name, value: val }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), function( i, o ) { + jQuery.fn[o] = function( f ) { + return this.bind(o, f); + }; +}); + +jQuery.extend({ + get: function( url, data, callback, type ) { + // shift arguments if data argument was omited + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = null; + } + + return jQuery.ajax({ + type: "GET", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + getScript: function( url, callback ) { + return jQuery.get(url, null, callback, "script"); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get(url, data, callback, "json"); + }, + + post: function( url, data, callback, type ) { + // shift arguments if data argument was omited + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = {}; + } + + return jQuery.ajax({ + type: "POST", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + ajaxSetup: function( settings ) { + jQuery.extend( jQuery.ajaxSettings, settings ); + }, + + ajaxSettings: { + url: location.href, + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + username: null, + password: null, + traditional: false, + */ + // This function can be overriden by calling jQuery.ajaxSetup + xhr: function() { + return new window.XMLHttpRequest(); + }, + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + script: "text/javascript, application/javascript", + json: "application/json, text/javascript", + text: "text/plain", + _default: "*/*" + } + }, + + ajax: function( origSettings ) { + var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings), + jsonp, status, data, type = s.type.toUpperCase(), noContent = rnoContent.test(type); + + s.url = s.url.replace( rhash, "" ); + + // Use original (not extended) context object if it was provided + s.context = origSettings && origSettings.context != null ? origSettings.context : s; + + // convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Handle JSONP Parameter Callbacks + if ( s.dataType === "jsonp" ) { + if ( type === "GET" ) { + if ( !jsre.test( s.url ) ) { + s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp || "callback") + "=?"; + } + } else if ( !s.data || !jsre.test(s.data) ) { + s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?"; + } + s.dataType = "json"; + } + + // Build temporary JSONP function + if ( s.dataType === "json" && (s.data && jsre.test(s.data) || jsre.test(s.url)) ) { + jsonp = s.jsonpCallback || ("jsonp" + jsc++); + + // Replace the =? sequence both in the query string and the data + if ( s.data ) { + s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1"); + } + + s.url = s.url.replace(jsre, "=" + jsonp + "$1"); + + // We need to make sure + // that a JSONP style response is executed properly + s.dataType = "script"; + + // Handle JSONP-style loading + var customJsonp = window[ jsonp ]; + + window[ jsonp ] = function( tmp ) { + if ( jQuery.isFunction( customJsonp ) ) { + customJsonp( tmp ); + + } else { + // Garbage collect + window[ jsonp ] = undefined; + + try { + delete window[ jsonp ]; + } catch( jsonpError ) {} + } + + data = tmp; + jQuery.handleSuccess( s, xhr, status, data ); + jQuery.handleComplete( s, xhr, status, data ); + + if ( head ) { + head.removeChild( script ); + } + }; + } + + if ( s.dataType === "script" && s.cache === null ) { + s.cache = false; + } + + if ( s.cache === false && noContent ) { + var ts = jQuery.now(); + + // try replacing _= if it is there + var ret = s.url.replace(rts, "$1_=" + ts); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ((ret === s.url) ? (rquery.test(s.url) ? "&" : "?") + "_=" + ts : ""); + } + + // If data is available, append data to url for GET/HEAD requests + if ( s.data && noContent ) { + s.url += (rquery.test(s.url) ? "&" : "?") + s.data; + } + + // Watch for a new set of requests + if ( s.global && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Matches an absolute URL, and saves the domain + var parts = rurl.exec( s.url ), + remote = parts && (parts[1] && parts[1].toLowerCase() !== location.protocol || parts[2].toLowerCase() !== location.host); + + // If we're requesting a remote document + // and trying to load JSON or Script with a GET + if ( s.dataType === "script" && type === "GET" && remote ) { + var head = document.getElementsByTagName("head")[0] || document.documentElement; + var script = document.createElement("script"); + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + script.src = s.url; + + // Handle Script loading + if ( !jsonp ) { + var done = false; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function() { + if ( !done && (!this.readyState || + this.readyState === "loaded" || this.readyState === "complete") ) { + done = true; + jQuery.handleSuccess( s, xhr, status, data ); + jQuery.handleComplete( s, xhr, status, data ); + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + if ( head && script.parentNode ) { + head.removeChild( script ); + } + } + }; + } + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + + // We handle everything using the script element injection + return undefined; + } + + var requestDone = false; + + // Create the request object + var xhr = s.xhr(); + + if ( !xhr ) { + return; + } + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open(type, s.url, s.async, s.username, s.password); + } else { + xhr.open(type, s.url, s.async); + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + // Set content-type if data specified and content-body is valid for this type + if ( (s.data != null && !noContent) || (origSettings && origSettings.contentType) ) { + xhr.setRequestHeader("Content-Type", s.contentType); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[s.url] ) { + xhr.setRequestHeader("If-Modified-Since", jQuery.lastModified[s.url]); + } + + if ( jQuery.etag[s.url] ) { + xhr.setRequestHeader("If-None-Match", jQuery.etag[s.url]); + } + } + + // Set header so the called script knows that it's an XMLHttpRequest + // Only send the header if it's not a remote XHR + if ( !remote ) { + xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest"); + } + + // Set the Accepts header for the server, depending on the dataType + xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ? + s.accepts[ s.dataType ] + ", */*; q=0.01" : + s.accepts._default ); + } catch( headerError ) {} + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && s.beforeSend.call(s.context, xhr, s) === false ) { + // Handle the global AJAX counter + if ( s.global && jQuery.active-- === 1 ) { + jQuery.event.trigger( "ajaxStop" ); + } + + // close opended socket + xhr.abort(); + return false; + } + + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxSend", [xhr, s] ); + } + + // Wait for a response to come back + var onreadystatechange = xhr.onreadystatechange = function( isTimeout ) { + // The request was aborted + if ( !xhr || xhr.readyState === 0 || isTimeout === "abort" ) { + // Opera doesn't call onreadystatechange before this point + // so we simulate the call + if ( !requestDone ) { + jQuery.handleComplete( s, xhr, status, data ); + } + + requestDone = true; + if ( xhr ) { + xhr.onreadystatechange = jQuery.noop; + } + + // The transfer is complete and the data is available, or the request timed out + } else if ( !requestDone && xhr && (xhr.readyState === 4 || isTimeout === "timeout") ) { + requestDone = true; + xhr.onreadystatechange = jQuery.noop; + + status = isTimeout === "timeout" ? + "timeout" : + !jQuery.httpSuccess( xhr ) ? + "error" : + s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? + "notmodified" : + "success"; + + var errMsg; + + if ( status === "success" ) { + // Watch for, and catch, XML document parse errors + try { + // process the data (runs the xml through httpData regardless of callback) + data = jQuery.httpData( xhr, s.dataType, s ); + } catch( parserError ) { + status = "parsererror"; + errMsg = parserError; + } + } + + // Make sure that the request was successful or notmodified + if ( status === "success" || status === "notmodified" ) { + // JSONP handles its own success callback + if ( !jsonp ) { + jQuery.handleSuccess( s, xhr, status, data ); + } + } else { + jQuery.handleError( s, xhr, status, errMsg ); + } + + // Fire the complete handlers + if ( !jsonp ) { + jQuery.handleComplete( s, xhr, status, data ); + } + + if ( isTimeout === "timeout" ) { + xhr.abort(); + } + + // Stop memory leaks + if ( s.async ) { + xhr = null; + } + } + }; + + // Override the abort handler, if we can (IE 6 doesn't allow it, but that's OK) + // Opera doesn't fire onreadystatechange at all on abort + try { + var oldAbort = xhr.abort; + xhr.abort = function() { + if ( xhr ) { + // oldAbort has no call property in IE7 so + // just do it this way, which works in all + // browsers + Function.prototype.call.call( oldAbort, xhr ); + } + + onreadystatechange( "abort" ); + }; + } catch( abortError ) {} + + // Timeout checker + if ( s.async && s.timeout > 0 ) { + setTimeout(function() { + // Check to see if the request is still happening + if ( xhr && !requestDone ) { + onreadystatechange( "timeout" ); + } + }, s.timeout); + } + + // Send the data + try { + xhr.send( noContent || s.data == null ? null : s.data ); + + } catch( sendError ) { + jQuery.handleError( s, xhr, null, sendError ); + + // Fire the complete handlers + jQuery.handleComplete( s, xhr, status, data ); + } + + // firefox 1.5 doesn't fire statechange for sync requests + if ( !s.async ) { + onreadystatechange(); + } + + // return XMLHttpRequest to allow aborting the request etc. + return xhr; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction(value) ? value() : value; + s[ s.length ] = encodeURIComponent(key) + "=" + encodeURIComponent(value); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray(a) || a.jquery ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[prefix], traditional, add ); + } + } + + // Return the resulting serialization + return s.join("&").replace(r20, "+"); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray(obj) && obj.length ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + if ( jQuery.isEmptyObject( obj ) ) { + add( prefix, "" ); + + // Serialize object item. + } else { + jQuery.each( obj, function( k, v ) { + buildParams( prefix + "[" + k + "]", v, traditional, add ); + }); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + handleError: function( s, xhr, status, e ) { + // If a local callback was specified, fire it + if ( s.error ) { + s.error.call( s.context, xhr, status, e ); + } + + // Fire the global callback + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxError", [xhr, s, e] ); + } + }, + + handleSuccess: function( s, xhr, status, data ) { + // If a local callback was specified, fire it and pass it the data + if ( s.success ) { + s.success.call( s.context, data, status, xhr ); + } + + // Fire the global callback + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxSuccess", [xhr, s] ); + } + }, + + handleComplete: function( s, xhr, status ) { + // Process result + if ( s.complete ) { + s.complete.call( s.context, xhr, status ); + } + + // The request was completed + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxComplete", [xhr, s] ); + } + + // Handle the global AJAX counter + if ( s.global && jQuery.active-- === 1 ) { + jQuery.event.trigger( "ajaxStop" ); + } + }, + + triggerGlobal: function( s, type, args ) { + (s.context && s.context.url == null ? jQuery(s.context) : jQuery.event).trigger(type, args); + }, + + // Determines if an XMLHttpRequest was successful or not + httpSuccess: function( xhr ) { + try { + // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450 + return !xhr.status && location.protocol === "file:" || + xhr.status >= 200 && xhr.status < 300 || + xhr.status === 304 || xhr.status === 1223; + } catch(e) {} + + return false; + }, + + // Determines if an XMLHttpRequest returns NotModified + httpNotModified: function( xhr, url ) { + var lastModified = xhr.getResponseHeader("Last-Modified"), + etag = xhr.getResponseHeader("Etag"); + + if ( lastModified ) { + jQuery.lastModified[url] = lastModified; + } + + if ( etag ) { + jQuery.etag[url] = etag; + } + + return xhr.status === 304; + }, + + httpData: function( xhr, type, s ) { + var ct = xhr.getResponseHeader("content-type") || "", + xml = type === "xml" || !type && ct.indexOf("xml") >= 0, + data = xml ? xhr.responseXML : xhr.responseText; + + if ( xml && data.documentElement.nodeName === "parsererror" ) { + jQuery.error( "parsererror" ); + } + + // Allow a pre-filtering function to sanitize the response + // s is checked to keep backwards compatibility + if ( s && s.dataFilter ) { + data = s.dataFilter( data, type ); + } + + // The filter can actually parse the response + if ( typeof data === "string" ) { + // Get the JavaScript object, if JSON is used. + if ( type === "json" || !type && ct.indexOf("json") >= 0 ) { + data = jQuery.parseJSON( data ); + + // If the type is "script", eval it in global context + } else if ( type === "script" || !type && ct.indexOf("javascript") >= 0 ) { + jQuery.globalEval( data ); + } + } + + return data; + } + +}); + +/* + * Create the request object; Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ +if ( window.ActiveXObject ) { + jQuery.ajaxSettings.xhr = function() { + if ( window.location.protocol !== "file:" ) { + try { + return new window.XMLHttpRequest(); + } catch(xhrError) {} + } + + try { + return new window.ActiveXObject("Microsoft.XMLHTTP"); + } catch(activeError) {} + }; +} + +// Does this browser support XHR requests? +jQuery.support.ajax = !!jQuery.ajaxSettings.xhr(); + + + + +var elemdisplay = {}, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)(.*)$/, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ]; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[i]; + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery.data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css( elem, "display" ) === "none" ) { + jQuery.data(elem, "olddisplay", defaultDisplay(elem.nodeName)); + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[i]; + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery.data(elem, "olddisplay") || ""; + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + var display = jQuery.css( this[i], "display" ); + + if ( display !== "none" ) { + jQuery.data( this[i], "olddisplay", display ); + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + this[i].style.display = "none"; + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete ); + } + + return this[ optall.queue === false ? "each" : "queue" ](function() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + var opt = jQuery.extend({}, optall), p, + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + self = this; + + for ( p in prop ) { + var name = jQuery.camelCase( p ); + + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + p = name; + } + + if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) { + return opt.complete.call(this); + } + + if ( isElement && ( p === "height" || p === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height + // animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + if ( !jQuery.support.inlineBlockNeedsLayout ) { + this.style.display = "inline-block"; + + } else { + var display = defaultDisplay(this.nodeName); + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( display === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.display = "inline"; + this.style.zoom = 1; + } + } + } + } + + if ( jQuery.isArray( prop[p] ) ) { + // Create (if needed) and add to specialEasing + (opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1]; + prop[p] = prop[p][0]; + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + opt.curAnim = jQuery.extend({}, prop); + + jQuery.each( prop, function( name, val ) { + var e = new jQuery.fx( self, opt, name ); + + if ( rfxtypes.test(val) ) { + e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop ); + + } else { + var parts = rfxnum.exec(val), + start = e.cur() || 0; + + if ( parts ) { + var end = parseFloat( parts[2] ), + unit = parts[3] || "px"; + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( self, name, (end || 1) + unit); + start = ((end || 1) / e.cur()) * start; + jQuery.style( self, name, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ((parts[1] === "-=" ? -1 : 1) * end) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + }); + + // For JS strict compliance + return true; + }); + }, + + stop: function( clearQueue, gotoEnd ) { + var timers = jQuery.timers; + + if ( clearQueue ) { + this.queue([]); + } + + this.each(function() { + // go in reverse order so anything added to the queue during the loop is ignored + for ( var i = timers.length - 1; i >= 0; i-- ) { + if ( timers[i].elem === this ) { + if (gotoEnd) { + // force the next step to be the last + timers[i](true); + } + + timers.splice(i, 1); + } + } + }); + + // start the next in the queue if the last step wasn't forced + if ( !gotoEnd ) { + this.dequeue(); + } + + return this; + } + +}); + +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function() { + if ( opt.queue !== false ) { + jQuery(this).dequeue(); + } + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + if ( !options.orig ) { + options.orig = {}; + } + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) { + return this.elem[ this.prop ]; + } + + var r = parseFloat( jQuery.css( this.elem, this.prop ) ); + return r && r > -10000 ? r : 0; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx; + + this.startTime = jQuery.now(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || "px"; + this.now = this.start; + this.pos = this.state = 0; + + function t( gotoEnd ) { + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval(fx.tick, fx.interval); + } + }, + + // Simple 'show' function + show: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var t = jQuery.now(), done = true; + + if ( gotoEnd || t >= this.options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + this.options.curAnim[ this.prop ] = true; + + for ( var i in this.options.curAnim ) { + if ( this.options.curAnim[i] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( this.options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + var elem = this.elem, + options = this.options; + + jQuery.each( [ "", "X", "Y" ], function (index, value) { + elem.style[ "overflow" + value ] = options.overflow[index]; + } ); + } + + // Hide the element if the "hide" operation was done + if ( this.options.hide ) { + jQuery(this.elem).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( this.options.hide || this.options.show ) { + for ( var p in this.options.curAnim ) { + jQuery.style( this.elem, p, this.options.orig[p] ); + } + } + + // Execute the complete function + this.options.complete.call( this.elem ); + } + + return false; + + } else { + var n = t - this.startTime; + this.state = n / this.options.duration; + + // Perform the easing function, defaults to swing + var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop]; + var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear"); + this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration); + this.now = this.start + ((this.end - this.start) * this.pos); + + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + var timers = jQuery.timers; + + for ( var i = 0; i < timers.length; i++ ) { + if ( !timers[i]() ) { + timers.splice(i--, 1); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +function defaultDisplay( nodeName ) { + if ( !elemdisplay[ nodeName ] ) { + var elem = jQuery("<" + nodeName + ">").appendTo("body"), + display = elem.css("display"); + + elem.remove(); + + if ( display === "none" || display === "" ) { + display = "block"; + } + + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box || { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = (win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop ), + scrollLeft = (win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft), + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + jQuery.offset.initialize(); + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + initialize: function() { + var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0, + html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>"; + + jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } ); + + container.innerHTML = html; + body.insertBefore( container, body.firstChild ); + innerDiv = container.firstChild; + checkDiv = innerDiv.firstChild; + td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + checkDiv.style.position = "fixed"; + checkDiv.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15); + checkDiv.style.position = checkDiv.style.top = ""; + + innerDiv.style.overflow = "hidden"; + innerDiv.style.position = "relative"; + + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop); + + body.removeChild( container ); + body = container = innerDiv = checkDiv = table = td = null; + jQuery.offset.initialize = jQuery.noop; + }, + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + jQuery.offset.initialize(); + + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = (position === "absolute" && jQuery.inArray('auto', [curCSSTop, curCSSLeft]) > -1), + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is absolute + if ( calculatePosition ) { + curPosition = curElem.position(); + } + + curTop = calculatePosition ? curPosition.top : parseInt( curCSSTop, 10 ) || 0; + curLeft = calculatePosition ? curPosition.left : parseInt( curCSSLeft, 10 ) || 0; + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if (options.top != null) { + props.top = (options.top - curOffset.top) + curTop; + } + if (options.left != null) { + props.left = (options.left - curOffset.left) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function(val) { + var elem = this[0], win; + + if ( !elem ) { + return null; + } + + if ( val !== undefined ) { + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery(win).scrollLeft(), + i ? val : jQuery(win).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + } else { + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn["inner" + name] = function() { + return this[0] ? + parseFloat( jQuery.css( this[0], type, "padding" ) ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn["outer" + name] = function( margin ) { + return this[0] ? + parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + return elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] || + elem.document.body[ "client" + name ]; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNaN( ret ) ? orig : ret; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + +})(window);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery-1.4.4.min.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,171 @@ +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery JavaScript Library v1.4.4 + * http://jquery.com/ + * + * Copyright 2010, John Resig + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2010, The Dojo Foundation + * + * Date: Thu Nov 11 19:04:53 2010 -0500 + */ +(function(E,B){function ka(a,b,d){if(d===B&&a.nodeType===1){d=a.getAttribute("data-"+b);if(typeof d==="string"){try{d=d==="true"?true:d==="false"?false:d==="null"?null:!c.isNaN(d)?parseFloat(d):Ja.test(d)?c.parseJSON(d):d}catch(e){}c.data(a,b,d)}else d=B}return d}function U(){return false}function ca(){return true}function la(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function Ka(a){var b,d,e,f,h,l,k,o,x,r,A,C=[];f=[];h=c.data(this,this.nodeType?"events":"__events__");if(typeof h==="function")h= +h.events;if(!(a.liveFired===this||!h||!h.live||a.button&&a.type==="click")){if(a.namespace)A=RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)");a.liveFired=this;var J=h.live.slice(0);for(k=0;k<J.length;k++){h=J[k];h.origType.replace(X,"")===a.type?f.push(h.selector):J.splice(k--,1)}f=c(a.target).closest(f,a.currentTarget);o=0;for(x=f.length;o<x;o++){r=f[o];for(k=0;k<J.length;k++){h=J[k];if(r.selector===h.selector&&(!A||A.test(h.namespace))){l=r.elem;e=null;if(h.preType==="mouseenter"|| +h.preType==="mouseleave"){a.type=h.preType;e=c(a.relatedTarget).closest(h.selector)[0]}if(!e||e!==l)C.push({elem:l,handleObj:h,level:r.level})}}}o=0;for(x=C.length;o<x;o++){f=C[o];if(d&&f.level>d)break;a.currentTarget=f.elem;a.data=f.handleObj.data;a.handleObj=f.handleObj;A=f.handleObj.origHandler.apply(f.elem,arguments);if(A===false||a.isPropagationStopped()){d=f.level;if(A===false)b=false;if(a.isImmediatePropagationStopped())break}}return b}}function Y(a,b){return(a&&a!=="*"?a+".":"")+b.replace(La, +"`").replace(Ma,"&")}function ma(a,b,d){if(c.isFunction(b))return c.grep(a,function(f,h){return!!b.call(f,h,f)===d});else if(b.nodeType)return c.grep(a,function(f){return f===b===d});else if(typeof b==="string"){var e=c.grep(a,function(f){return f.nodeType===1});if(Na.test(b))return c.filter(b,e,!d);else b=c.filter(b,e)}return c.grep(a,function(f){return c.inArray(f,b)>=0===d})}function na(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var e=c.data(a[d++]),f=c.data(this, +e);if(e=e&&e.events){delete f.handle;f.events={};for(var h in e)for(var l in e[h])c.event.add(this,h,e[h][l],e[h][l].data)}}})}function Oa(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function oa(a,b,d){var e=b==="width"?a.offsetWidth:a.offsetHeight;if(d==="border")return e;c.each(b==="width"?Pa:Qa,function(){d||(e-=parseFloat(c.css(a,"padding"+this))||0);if(d==="margin")e+=parseFloat(c.css(a, +"margin"+this))||0;else e-=parseFloat(c.css(a,"border"+this+"Width"))||0});return e}function da(a,b,d,e){if(c.isArray(b)&&b.length)c.each(b,function(f,h){d||Ra.test(a)?e(a,h):da(a+"["+(typeof h==="object"||c.isArray(h)?f:"")+"]",h,d,e)});else if(!d&&b!=null&&typeof b==="object")c.isEmptyObject(b)?e(a,""):c.each(b,function(f,h){da(a+"["+f+"]",h,d,e)});else e(a,b)}function S(a,b){var d={};c.each(pa.concat.apply([],pa.slice(0,b)),function(){d[this]=a});return d}function qa(a){if(!ea[a]){var b=c("<"+ +a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d==="")d="block";ea[a]=d}return ea[a]}function fa(a){return c.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var t=E.document,c=function(){function a(){if(!b.isReady){try{t.documentElement.doScroll("left")}catch(j){setTimeout(a,1);return}b.ready()}}var b=function(j,s){return new b.fn.init(j,s)},d=E.jQuery,e=E.$,f,h=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,l=/\S/,k=/^\s+/,o=/\s+$/,x=/\W/,r=/\d/,A=/^<(\w+)\s*\/?>(?:<\/\1>)?$/, +C=/^[\],:{}\s]*$/,J=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,w=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,I=/(?:^|:|,)(?:\s*\[)+/g,L=/(webkit)[ \/]([\w.]+)/,g=/(opera)(?:.*version)?[ \/]([\w.]+)/,i=/(msie) ([\w.]+)/,n=/(mozilla)(?:.*? rv:([\w.]+))?/,m=navigator.userAgent,p=false,q=[],u,y=Object.prototype.toString,F=Object.prototype.hasOwnProperty,M=Array.prototype.push,N=Array.prototype.slice,O=String.prototype.trim,D=Array.prototype.indexOf,R={};b.fn=b.prototype={init:function(j, +s){var v,z,H;if(!j)return this;if(j.nodeType){this.context=this[0]=j;this.length=1;return this}if(j==="body"&&!s&&t.body){this.context=t;this[0]=t.body;this.selector="body";this.length=1;return this}if(typeof j==="string")if((v=h.exec(j))&&(v[1]||!s))if(v[1]){H=s?s.ownerDocument||s:t;if(z=A.exec(j))if(b.isPlainObject(s)){j=[t.createElement(z[1])];b.fn.attr.call(j,s,true)}else j=[H.createElement(z[1])];else{z=b.buildFragment([v[1]],[H]);j=(z.cacheable?z.fragment.cloneNode(true):z.fragment).childNodes}return b.merge(this, +j)}else{if((z=t.getElementById(v[2]))&&z.parentNode){if(z.id!==v[2])return f.find(j);this.length=1;this[0]=z}this.context=t;this.selector=j;return this}else if(!s&&!x.test(j)){this.selector=j;this.context=t;j=t.getElementsByTagName(j);return b.merge(this,j)}else return!s||s.jquery?(s||f).find(j):b(s).find(j);else if(b.isFunction(j))return f.ready(j);if(j.selector!==B){this.selector=j.selector;this.context=j.context}return b.makeArray(j,this)},selector:"",jquery:"1.4.4",length:0,size:function(){return this.length}, +toArray:function(){return N.call(this,0)},get:function(j){return j==null?this.toArray():j<0?this.slice(j)[0]:this[j]},pushStack:function(j,s,v){var z=b();b.isArray(j)?M.apply(z,j):b.merge(z,j);z.prevObject=this;z.context=this.context;if(s==="find")z.selector=this.selector+(this.selector?" ":"")+v;else if(s)z.selector=this.selector+"."+s+"("+v+")";return z},each:function(j,s){return b.each(this,j,s)},ready:function(j){b.bindReady();if(b.isReady)j.call(t,b);else q&&q.push(j);return this},eq:function(j){return j=== +-1?this.slice(j):this.slice(j,+j+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(N.apply(this,arguments),"slice",N.call(arguments).join(","))},map:function(j){return this.pushStack(b.map(this,function(s,v){return j.call(s,v,s)}))},end:function(){return this.prevObject||b(null)},push:M,sort:[].sort,splice:[].splice};b.fn.init.prototype=b.fn;b.extend=b.fn.extend=function(){var j,s,v,z,H,G=arguments[0]||{},K=1,Q=arguments.length,ga=false; +if(typeof G==="boolean"){ga=G;G=arguments[1]||{};K=2}if(typeof G!=="object"&&!b.isFunction(G))G={};if(Q===K){G=this;--K}for(;K<Q;K++)if((j=arguments[K])!=null)for(s in j){v=G[s];z=j[s];if(G!==z)if(ga&&z&&(b.isPlainObject(z)||(H=b.isArray(z)))){if(H){H=false;v=v&&b.isArray(v)?v:[]}else v=v&&b.isPlainObject(v)?v:{};G[s]=b.extend(ga,v,z)}else if(z!==B)G[s]=z}return G};b.extend({noConflict:function(j){E.$=e;if(j)E.jQuery=d;return b},isReady:false,readyWait:1,ready:function(j){j===true&&b.readyWait--; +if(!b.readyWait||j!==true&&!b.isReady){if(!t.body)return setTimeout(b.ready,1);b.isReady=true;if(!(j!==true&&--b.readyWait>0))if(q){var s=0,v=q;for(q=null;j=v[s++];)j.call(t,b);b.fn.trigger&&b(t).trigger("ready").unbind("ready")}}},bindReady:function(){if(!p){p=true;if(t.readyState==="complete")return setTimeout(b.ready,1);if(t.addEventListener){t.addEventListener("DOMContentLoaded",u,false);E.addEventListener("load",b.ready,false)}else if(t.attachEvent){t.attachEvent("onreadystatechange",u);E.attachEvent("onload", +b.ready);var j=false;try{j=E.frameElement==null}catch(s){}t.documentElement.doScroll&&j&&a()}}},isFunction:function(j){return b.type(j)==="function"},isArray:Array.isArray||function(j){return b.type(j)==="array"},isWindow:function(j){return j&&typeof j==="object"&&"setInterval"in j},isNaN:function(j){return j==null||!r.test(j)||isNaN(j)},type:function(j){return j==null?String(j):R[y.call(j)]||"object"},isPlainObject:function(j){if(!j||b.type(j)!=="object"||j.nodeType||b.isWindow(j))return false;if(j.constructor&& +!F.call(j,"constructor")&&!F.call(j.constructor.prototype,"isPrototypeOf"))return false;for(var s in j);return s===B||F.call(j,s)},isEmptyObject:function(j){for(var s in j)return false;return true},error:function(j){throw j;},parseJSON:function(j){if(typeof j!=="string"||!j)return null;j=b.trim(j);if(C.test(j.replace(J,"@").replace(w,"]").replace(I,"")))return E.JSON&&E.JSON.parse?E.JSON.parse(j):(new Function("return "+j))();else b.error("Invalid JSON: "+j)},noop:function(){},globalEval:function(j){if(j&& +l.test(j)){var s=t.getElementsByTagName("head")[0]||t.documentElement,v=t.createElement("script");v.type="text/javascript";if(b.support.scriptEval)v.appendChild(t.createTextNode(j));else v.text=j;s.insertBefore(v,s.firstChild);s.removeChild(v)}},nodeName:function(j,s){return j.nodeName&&j.nodeName.toUpperCase()===s.toUpperCase()},each:function(j,s,v){var z,H=0,G=j.length,K=G===B||b.isFunction(j);if(v)if(K)for(z in j){if(s.apply(j[z],v)===false)break}else for(;H<G;){if(s.apply(j[H++],v)===false)break}else if(K)for(z in j){if(s.call(j[z], +z,j[z])===false)break}else for(v=j[0];H<G&&s.call(v,H,v)!==false;v=j[++H]);return j},trim:O?function(j){return j==null?"":O.call(j)}:function(j){return j==null?"":j.toString().replace(k,"").replace(o,"")},makeArray:function(j,s){var v=s||[];if(j!=null){var z=b.type(j);j.length==null||z==="string"||z==="function"||z==="regexp"||b.isWindow(j)?M.call(v,j):b.merge(v,j)}return v},inArray:function(j,s){if(s.indexOf)return s.indexOf(j);for(var v=0,z=s.length;v<z;v++)if(s[v]===j)return v;return-1},merge:function(j, +s){var v=j.length,z=0;if(typeof s.length==="number")for(var H=s.length;z<H;z++)j[v++]=s[z];else for(;s[z]!==B;)j[v++]=s[z++];j.length=v;return j},grep:function(j,s,v){var z=[],H;v=!!v;for(var G=0,K=j.length;G<K;G++){H=!!s(j[G],G);v!==H&&z.push(j[G])}return z},map:function(j,s,v){for(var z=[],H,G=0,K=j.length;G<K;G++){H=s(j[G],G,v);if(H!=null)z[z.length]=H}return z.concat.apply([],z)},guid:1,proxy:function(j,s,v){if(arguments.length===2)if(typeof s==="string"){v=j;j=v[s];s=B}else if(s&&!b.isFunction(s)){v= +s;s=B}if(!s&&j)s=function(){return j.apply(v||this,arguments)};if(j)s.guid=j.guid=j.guid||s.guid||b.guid++;return s},access:function(j,s,v,z,H,G){var K=j.length;if(typeof s==="object"){for(var Q in s)b.access(j,Q,s[Q],z,H,v);return j}if(v!==B){z=!G&&z&&b.isFunction(v);for(Q=0;Q<K;Q++)H(j[Q],s,z?v.call(j[Q],Q,H(j[Q],s)):v,G);return j}return K?H(j[0],s):B},now:function(){return(new Date).getTime()},uaMatch:function(j){j=j.toLowerCase();j=L.exec(j)||g.exec(j)||i.exec(j)||j.indexOf("compatible")<0&&n.exec(j)|| +[];return{browser:j[1]||"",version:j[2]||"0"}},browser:{}});b.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(j,s){R["[object "+s+"]"]=s.toLowerCase()});m=b.uaMatch(m);if(m.browser){b.browser[m.browser]=true;b.browser.version=m.version}if(b.browser.webkit)b.browser.safari=true;if(D)b.inArray=function(j,s){return D.call(s,j)};if(!/\s/.test("\u00a0")){k=/^[\s\xA0]+/;o=/[\s\xA0]+$/}f=b(t);if(t.addEventListener)u=function(){t.removeEventListener("DOMContentLoaded",u, +false);b.ready()};else if(t.attachEvent)u=function(){if(t.readyState==="complete"){t.detachEvent("onreadystatechange",u);b.ready()}};return E.jQuery=E.$=b}();(function(){c.support={};var a=t.documentElement,b=t.createElement("script"),d=t.createElement("div"),e="script"+c.now();d.style.display="none";d.innerHTML=" <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";var f=d.getElementsByTagName("*"),h=d.getElementsByTagName("a")[0],l=t.createElement("select"), +k=l.appendChild(t.createElement("option"));if(!(!f||!f.length||!h)){c.support={leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(h.getAttribute("style")),hrefNormalized:h.getAttribute("href")==="/a",opacity:/^0.55$/.test(h.style.opacity),cssFloat:!!h.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:k.selected,deleteExpando:true,optDisabled:false,checkClone:false, +scriptEval:false,noCloneEvent:true,boxModel:null,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableHiddenOffsets:true};l.disabled=true;c.support.optDisabled=!k.disabled;b.type="text/javascript";try{b.appendChild(t.createTextNode("window."+e+"=1;"))}catch(o){}a.insertBefore(b,a.firstChild);if(E[e]){c.support.scriptEval=true;delete E[e]}try{delete b.test}catch(x){c.support.deleteExpando=false}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function r(){c.support.noCloneEvent= +false;d.detachEvent("onclick",r)});d.cloneNode(true).fireEvent("onclick")}d=t.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=t.createDocumentFragment();a.appendChild(d.firstChild);c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var r=t.createElement("div");r.style.width=r.style.paddingLeft="1px";t.body.appendChild(r);c.boxModel=c.support.boxModel=r.offsetWidth===2;if("zoom"in r.style){r.style.display="inline";r.style.zoom= +1;c.support.inlineBlockNeedsLayout=r.offsetWidth===2;r.style.display="";r.innerHTML="<div style='width:4px;'></div>";c.support.shrinkWrapBlocks=r.offsetWidth!==2}r.innerHTML="<table><tr><td style='padding:0;display:none'></td><td>t</td></tr></table>";var A=r.getElementsByTagName("td");c.support.reliableHiddenOffsets=A[0].offsetHeight===0;A[0].style.display="";A[1].style.display="none";c.support.reliableHiddenOffsets=c.support.reliableHiddenOffsets&&A[0].offsetHeight===0;r.innerHTML="";t.body.removeChild(r).style.display= +"none"});a=function(r){var A=t.createElement("div");r="on"+r;var C=r in A;if(!C){A.setAttribute(r,"return;");C=typeof A[r]==="function"}return C};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=f=h=null}})();var ra={},Ja=/^(?:\{.*\}|\[.*\])$/;c.extend({cache:{},uuid:0,expando:"jQuery"+c.now(),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},data:function(a,b,d){if(c.acceptData(a)){a=a==E?ra:a;var e=a.nodeType,f=e?a[c.expando]:null,h= +c.cache;if(!(e&&!f&&typeof b==="string"&&d===B)){if(e)f||(a[c.expando]=f=++c.uuid);else h=a;if(typeof b==="object")if(e)h[f]=c.extend(h[f],b);else c.extend(h,b);else if(e&&!h[f])h[f]={};a=e?h[f]:h;if(d!==B)a[b]=d;return typeof b==="string"?a[b]:a}}},removeData:function(a,b){if(c.acceptData(a)){a=a==E?ra:a;var d=a.nodeType,e=d?a[c.expando]:a,f=c.cache,h=d?f[e]:e;if(b){if(h){delete h[b];d&&c.isEmptyObject(h)&&c.removeData(a)}}else if(d&&c.support.deleteExpando)delete a[c.expando];else if(a.removeAttribute)a.removeAttribute(c.expando); +else if(d)delete f[e];else for(var l in a)delete a[l]}},acceptData:function(a){if(a.nodeName){var b=c.noData[a.nodeName.toLowerCase()];if(b)return!(b===true||a.getAttribute("classid")!==b)}return true}});c.fn.extend({data:function(a,b){var d=null;if(typeof a==="undefined"){if(this.length){var e=this[0].attributes,f;d=c.data(this[0]);for(var h=0,l=e.length;h<l;h++){f=e[h].name;if(f.indexOf("data-")===0){f=f.substr(5);ka(this[0],f,d[f])}}}return d}else if(typeof a==="object")return this.each(function(){c.data(this, +a)});var k=a.split(".");k[1]=k[1]?"."+k[1]:"";if(b===B){d=this.triggerHandler("getData"+k[1]+"!",[k[0]]);if(d===B&&this.length){d=c.data(this[0],a);d=ka(this[0],a,d)}return d===B&&k[1]?this.data(k[0]):d}else return this.each(function(){var o=c(this),x=[k[0],b];o.triggerHandler("setData"+k[1]+"!",x);c.data(this,a,b);o.triggerHandler("changeData"+k[1]+"!",x)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var e= +c.data(a,b);if(!d)return e||[];if(!e||c.isArray(d))e=c.data(a,b,c.makeArray(d));else e.push(d);return e}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),e=d.shift();if(e==="inprogress")e=d.shift();if(e){b==="fx"&&d.unshift("inprogress");e.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===B)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this, +a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var sa=/[\n\t]/g,ha=/\s+/,Sa=/\r/g,Ta=/^(?:href|src|style)$/,Ua=/^(?:button|input)$/i,Va=/^(?:button|input|object|select|textarea)$/i,Wa=/^a(?:rea)?$/i,ta=/^(?:radio|checkbox)$/i;c.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan", +colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};c.fn.extend({attr:function(a,b){return c.access(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(x){var r=c(this);r.addClass(a.call(this,x,r.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ha),d=0,e=this.length;d<e;d++){var f=this[d];if(f.nodeType=== +1)if(f.className){for(var h=" "+f.className+" ",l=f.className,k=0,o=b.length;k<o;k++)if(h.indexOf(" "+b[k]+" ")<0)l+=" "+b[k];f.className=c.trim(l)}else f.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(o){var x=c(this);x.removeClass(a.call(this,o,x.attr("class")))});if(a&&typeof a==="string"||a===B)for(var b=(a||"").split(ha),d=0,e=this.length;d<e;d++){var f=this[d];if(f.nodeType===1&&f.className)if(a){for(var h=(" "+f.className+" ").replace(sa," "), +l=0,k=b.length;l<k;l++)h=h.replace(" "+b[l]+" "," ");f.className=c.trim(h)}else f.className=""}return this},toggleClass:function(a,b){var d=typeof a,e=typeof b==="boolean";if(c.isFunction(a))return this.each(function(f){var h=c(this);h.toggleClass(a.call(this,f,h.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var f,h=0,l=c(this),k=b,o=a.split(ha);f=o[h++];){k=e?k:!l.hasClass(f);l[k?"addClass":"removeClass"](f)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this, +"__className__",this.className);this.className=this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(sa," ").indexOf(a)>-1)return true;return false},val:function(a){if(!arguments.length){var b=this[0];if(b){if(c.nodeName(b,"option")){var d=b.attributes.value;return!d||d.specified?b.value:b.text}if(c.nodeName(b,"select")){var e=b.selectedIndex;d=[];var f=b.options;b=b.type==="select-one"; +if(e<0)return null;var h=b?e:0;for(e=b?e+1:f.length;h<e;h++){var l=f[h];if(l.selected&&(c.support.optDisabled?!l.disabled:l.getAttribute("disabled")===null)&&(!l.parentNode.disabled||!c.nodeName(l.parentNode,"optgroup"))){a=c(l).val();if(b)return a;d.push(a)}}return d}if(ta.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Sa,"")}return B}var k=c.isFunction(a);return this.each(function(o){var x=c(this),r=a;if(this.nodeType===1){if(k)r= +a.call(this,o,x.val());if(r==null)r="";else if(typeof r==="number")r+="";else if(c.isArray(r))r=c.map(r,function(C){return C==null?"":C+""});if(c.isArray(r)&&ta.test(this.type))this.checked=c.inArray(x.val(),r)>=0;else if(c.nodeName(this,"select")){var A=c.makeArray(r);c("option",this).each(function(){this.selected=c.inArray(c(this).val(),A)>=0});if(!A.length)this.selectedIndex=-1}else this.value=r}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true}, +attr:function(a,b,d,e){if(!a||a.nodeType===3||a.nodeType===8)return B;if(e&&b in c.attrFn)return c(a)[b](d);e=a.nodeType!==1||!c.isXMLDoc(a);var f=d!==B;b=e&&c.props[b]||b;var h=Ta.test(b);if((b in a||a[b]!==B)&&e&&!h){if(f){b==="type"&&Ua.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");if(d===null)a.nodeType===1&&a.removeAttribute(b);else a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&& +b.specified?b.value:Va.test(a.nodeName)||Wa.test(a.nodeName)&&a.href?0:B;return a[b]}if(!c.support.style&&e&&b==="style"){if(f)a.style.cssText=""+d;return a.style.cssText}f&&a.setAttribute(b,""+d);if(!a.attributes[b]&&a.hasAttribute&&!a.hasAttribute(b))return B;a=!c.support.hrefNormalized&&e&&h?a.getAttribute(b,2):a.getAttribute(b);return a===null?B:a}});var X=/\.(.*)$/,ia=/^(?:textarea|input|select)$/i,La=/\./g,Ma=/ /g,Xa=/[^\w\s.|`]/g,Ya=function(a){return a.replace(Xa,"\\$&")},ua={focusin:0,focusout:0}; +c.event={add:function(a,b,d,e){if(!(a.nodeType===3||a.nodeType===8)){if(c.isWindow(a)&&a!==E&&!a.frameElement)a=E;if(d===false)d=U;else if(!d)return;var f,h;if(d.handler){f=d;d=f.handler}if(!d.guid)d.guid=c.guid++;if(h=c.data(a)){var l=a.nodeType?"events":"__events__",k=h[l],o=h.handle;if(typeof k==="function"){o=k.handle;k=k.events}else if(!k){a.nodeType||(h[l]=h=function(){});h.events=k={}}if(!o)h.handle=o=function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(o.elem, +arguments):B};o.elem=a;b=b.split(" ");for(var x=0,r;l=b[x++];){h=f?c.extend({},f):{handler:d,data:e};if(l.indexOf(".")>-1){r=l.split(".");l=r.shift();h.namespace=r.slice(0).sort().join(".")}else{r=[];h.namespace=""}h.type=l;if(!h.guid)h.guid=d.guid;var A=k[l],C=c.event.special[l]||{};if(!A){A=k[l]=[];if(!C.setup||C.setup.call(a,e,r,o)===false)if(a.addEventListener)a.addEventListener(l,o,false);else a.attachEvent&&a.attachEvent("on"+l,o)}if(C.add){C.add.call(a,h);if(!h.handler.guid)h.handler.guid= +d.guid}A.push(h);c.event.global[l]=true}a=null}}},global:{},remove:function(a,b,d,e){if(!(a.nodeType===3||a.nodeType===8)){if(d===false)d=U;var f,h,l=0,k,o,x,r,A,C,J=a.nodeType?"events":"__events__",w=c.data(a),I=w&&w[J];if(w&&I){if(typeof I==="function"){w=I;I=I.events}if(b&&b.type){d=b.handler;b=b.type}if(!b||typeof b==="string"&&b.charAt(0)==="."){b=b||"";for(f in I)c.event.remove(a,f+b)}else{for(b=b.split(" ");f=b[l++];){r=f;k=f.indexOf(".")<0;o=[];if(!k){o=f.split(".");f=o.shift();x=RegExp("(^|\\.)"+ +c.map(o.slice(0).sort(),Ya).join("\\.(?:.*\\.)?")+"(\\.|$)")}if(A=I[f])if(d){r=c.event.special[f]||{};for(h=e||0;h<A.length;h++){C=A[h];if(d.guid===C.guid){if(k||x.test(C.namespace)){e==null&&A.splice(h--,1);r.remove&&r.remove.call(a,C)}if(e!=null)break}}if(A.length===0||e!=null&&A.length===1){if(!r.teardown||r.teardown.call(a,o)===false)c.removeEvent(a,f,w.handle);delete I[f]}}else for(h=0;h<A.length;h++){C=A[h];if(k||x.test(C.namespace)){c.event.remove(a,r,C.handler,h);A.splice(h--,1)}}}if(c.isEmptyObject(I)){if(b= +w.handle)b.elem=null;delete w.events;delete w.handle;if(typeof w==="function")c.removeData(a,J);else c.isEmptyObject(w)&&c.removeData(a)}}}}},trigger:function(a,b,d,e){var f=a.type||a;if(!e){a=typeof a==="object"?a[c.expando]?a:c.extend(c.Event(f),a):c.Event(f);if(f.indexOf("!")>=0){a.type=f=f.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();c.event.global[f]&&c.each(c.cache,function(){this.events&&this.events[f]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType=== +8)return B;a.result=B;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(e=d.nodeType?c.data(d,"handle"):(c.data(d,"__events__")||{}).handle)&&e.apply(d,b);e=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+f]&&d["on"+f].apply(d,b)===false){a.result=false;a.preventDefault()}}catch(h){}if(!a.isPropagationStopped()&&e)c.event.trigger(a,b,e,true);else if(!a.isDefaultPrevented()){var l;e=a.target;var k=f.replace(X,""),o=c.nodeName(e,"a")&&k=== +"click",x=c.event.special[k]||{};if((!x._default||x._default.call(d,a)===false)&&!o&&!(e&&e.nodeName&&c.noData[e.nodeName.toLowerCase()])){try{if(e[k]){if(l=e["on"+k])e["on"+k]=null;c.event.triggered=true;e[k]()}}catch(r){}if(l)e["on"+k]=l;c.event.triggered=false}}},handle:function(a){var b,d,e,f;d=[];var h=c.makeArray(arguments);a=h[0]=c.event.fix(a||E.event);a.currentTarget=this;b=a.type.indexOf(".")<0&&!a.exclusive;if(!b){e=a.type.split(".");a.type=e.shift();d=e.slice(0).sort();e=RegExp("(^|\\.)"+ +d.join("\\.(?:.*\\.)?")+"(\\.|$)")}a.namespace=a.namespace||d.join(".");f=c.data(this,this.nodeType?"events":"__events__");if(typeof f==="function")f=f.events;d=(f||{})[a.type];if(f&&d){d=d.slice(0);f=0;for(var l=d.length;f<l;f++){var k=d[f];if(b||e.test(k.namespace)){a.handler=k.handler;a.data=k.data;a.handleObj=k;k=k.handler.apply(this,h);if(k!==B){a.result=k;if(k===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), +fix:function(a){if(a[c.expando])return a;var b=a;a=c.Event(b);for(var d=this.props.length,e;d;){e=this.props[--d];a[e]=b[e]}if(!a.target)a.target=a.srcElement||t;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=t.documentElement;d=t.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop|| +d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(a.which==null&&(a.charCode!=null||a.keyCode!=null))a.which=a.charCode!=null?a.charCode:a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==B)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a){c.event.add(this,Y(a.origType,a.selector),c.extend({},a,{handler:Ka,guid:a.handler.guid}))},remove:function(a){c.event.remove(this, +Y(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,d){if(c.isWindow(this))this.onbeforeunload=d},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};c.removeEvent=t.removeEventListener?function(a,b,d){a.removeEventListener&&a.removeEventListener(b,d,false)}:function(a,b,d){a.detachEvent&&a.detachEvent("on"+b,d)};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=a;this.type=a.type}else this.type=a;this.timeStamp= +c.now();this[c.expando]=true};c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=ca;var a=this.originalEvent;if(a)if(a.preventDefault)a.preventDefault();else a.returnValue=false},stopPropagation:function(){this.isPropagationStopped=ca;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=ca;this.stopPropagation()},isDefaultPrevented:U,isPropagationStopped:U,isImmediatePropagationStopped:U}; +var va=function(a){var b=a.relatedTarget;try{for(;b&&b!==this;)b=b.parentNode;if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}}catch(d){}},wa=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?wa:va,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?wa:va)}}});if(!c.support.submitBubbles)c.event.special.submit={setup:function(){if(this.nodeName.toLowerCase()!== +"form"){c.event.add(this,"click.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="submit"||d==="image")&&c(b).closest("form").length){a.liveFired=B;return la("submit",this,arguments)}});c.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="text"||d==="password")&&c(b).closest("form").length&&a.keyCode===13){a.liveFired=B;return la("submit",this,arguments)}})}else return false},teardown:function(){c.event.remove(this,".specialSubmit")}};if(!c.support.changeBubbles){var V, +xa=function(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(e){return e.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d},Z=function(a,b){var d=a.target,e,f;if(!(!ia.test(d.nodeName)||d.readOnly)){e=c.data(d,"_change_data");f=xa(d);if(a.type!=="focusout"||d.type!=="radio")c.data(d,"_change_data",f);if(!(e===B||f===e))if(e!=null||f){a.type="change";a.liveFired= +B;return c.event.trigger(a,b,d)}}};c.event.special.change={filters:{focusout:Z,beforedeactivate:Z,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return Z.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return Z.call(this,a)},beforeactivate:function(a){a=a.target;c.data(a,"_change_data",xa(a))}},setup:function(){if(this.type=== +"file")return false;for(var a in V)c.event.add(this,a+".specialChange",V[a]);return ia.test(this.nodeName)},teardown:function(){c.event.remove(this,".specialChange");return ia.test(this.nodeName)}};V=c.event.special.change.filters;V.focus=V.beforeactivate}t.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(e){e=c.event.fix(e);e.type=b;return c.event.trigger(e,null,e.target)}c.event.special[b]={setup:function(){ua[b]++===0&&t.addEventListener(a,d,true)},teardown:function(){--ua[b]=== +0&&t.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,e,f){if(typeof d==="object"){for(var h in d)this[b](h,e,d[h],f);return this}if(c.isFunction(e)||e===false){f=e;e=B}var l=b==="one"?c.proxy(f,function(o){c(this).unbind(o,l);return f.apply(this,arguments)}):f;if(d==="unload"&&b!=="one")this.one(d,e,f);else{h=0;for(var k=this.length;h<k;h++)c.event.add(this[h],d,l,e)}return this}});c.fn.extend({unbind:function(a,b){if(typeof a==="object"&&!a.preventDefault)for(var d in a)this.unbind(d, +a[d]);else{d=0;for(var e=this.length;d<e;d++)c.event.remove(this[d],a,b)}return this},delegate:function(a,b,d,e){return this.live(b,d,e,a)},undelegate:function(a,b,d){return arguments.length===0?this.unbind("live"):this.die(b,null,d,a)},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){var d=c.Event(a);d.preventDefault();d.stopPropagation();c.event.trigger(d,b,this[0]);return d.result}},toggle:function(a){for(var b=arguments,d= +1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(e){var f=(c.data(this,"lastToggle"+a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,f+1);e.preventDefault();return b[f].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var ya={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};c.each(["live","die"],function(a,b){c.fn[b]=function(d,e,f,h){var l,k=0,o,x,r=h||this.selector;h=h?this:c(this.context);if(typeof d=== +"object"&&!d.preventDefault){for(l in d)h[b](l,e,d[l],r);return this}if(c.isFunction(e)){f=e;e=B}for(d=(d||"").split(" ");(l=d[k++])!=null;){o=X.exec(l);x="";if(o){x=o[0];l=l.replace(X,"")}if(l==="hover")d.push("mouseenter"+x,"mouseleave"+x);else{o=l;if(l==="focus"||l==="blur"){d.push(ya[l]+x);l+=x}else l=(ya[l]||l)+x;if(b==="live"){x=0;for(var A=h.length;x<A;x++)c.event.add(h[x],"live."+Y(l,r),{data:e,selector:r,handler:f,origType:l,origHandler:f,preType:o})}else h.unbind("live."+Y(l,r),f)}}return this}}); +c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){c.fn[b]=function(d,e){if(e==null){e=d;d=null}return arguments.length>0?this.bind(b,d,e):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});E.attachEvent&&!E.addEventListener&&c(E).bind("unload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}}); +(function(){function a(g,i,n,m,p,q){p=0;for(var u=m.length;p<u;p++){var y=m[p];if(y){var F=false;for(y=y[g];y;){if(y.sizcache===n){F=m[y.sizset];break}if(y.nodeType===1&&!q){y.sizcache=n;y.sizset=p}if(y.nodeName.toLowerCase()===i){F=y;break}y=y[g]}m[p]=F}}}function b(g,i,n,m,p,q){p=0;for(var u=m.length;p<u;p++){var y=m[p];if(y){var F=false;for(y=y[g];y;){if(y.sizcache===n){F=m[y.sizset];break}if(y.nodeType===1){if(!q){y.sizcache=n;y.sizset=p}if(typeof i!=="string"){if(y===i){F=true;break}}else if(k.filter(i, +[y]).length>0){F=y;break}}y=y[g]}m[p]=F}}}var d=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,f=Object.prototype.toString,h=false,l=true;[0,0].sort(function(){l=false;return 0});var k=function(g,i,n,m){n=n||[];var p=i=i||t;if(i.nodeType!==1&&i.nodeType!==9)return[];if(!g||typeof g!=="string")return n;var q,u,y,F,M,N=true,O=k.isXML(i),D=[],R=g;do{d.exec("");if(q=d.exec(R)){R=q[3];D.push(q[1]);if(q[2]){F=q[3]; +break}}}while(q);if(D.length>1&&x.exec(g))if(D.length===2&&o.relative[D[0]])u=L(D[0]+D[1],i);else for(u=o.relative[D[0]]?[i]:k(D.shift(),i);D.length;){g=D.shift();if(o.relative[g])g+=D.shift();u=L(g,u)}else{if(!m&&D.length>1&&i.nodeType===9&&!O&&o.match.ID.test(D[0])&&!o.match.ID.test(D[D.length-1])){q=k.find(D.shift(),i,O);i=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]}if(i){q=m?{expr:D.pop(),set:C(m)}:k.find(D.pop(),D.length===1&&(D[0]==="~"||D[0]==="+")&&i.parentNode?i.parentNode:i,O);u=q.expr?k.filter(q.expr, +q.set):q.set;if(D.length>0)y=C(u);else N=false;for(;D.length;){q=M=D.pop();if(o.relative[M])q=D.pop();else M="";if(q==null)q=i;o.relative[M](y,q,O)}}else y=[]}y||(y=u);y||k.error(M||g);if(f.call(y)==="[object Array]")if(N)if(i&&i.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&k.contains(i,y[g])))n.push(u[g])}else for(g=0;y[g]!=null;g++)y[g]&&y[g].nodeType===1&&n.push(u[g]);else n.push.apply(n,y);else C(y,n);if(F){k(F,p,n,m);k.uniqueSort(n)}return n};k.uniqueSort=function(g){if(w){h= +l;g.sort(w);if(h)for(var i=1;i<g.length;i++)g[i]===g[i-1]&&g.splice(i--,1)}return g};k.matches=function(g,i){return k(g,null,null,i)};k.matchesSelector=function(g,i){return k(i,null,null,[g]).length>0};k.find=function(g,i,n){var m;if(!g)return[];for(var p=0,q=o.order.length;p<q;p++){var u,y=o.order[p];if(u=o.leftMatch[y].exec(g)){var F=u[1];u.splice(1,1);if(F.substr(F.length-1)!=="\\"){u[1]=(u[1]||"").replace(/\\/g,"");m=o.find[y](u,i,n);if(m!=null){g=g.replace(o.match[y],"");break}}}}m||(m=i.getElementsByTagName("*")); +return{set:m,expr:g}};k.filter=function(g,i,n,m){for(var p,q,u=g,y=[],F=i,M=i&&i[0]&&k.isXML(i[0]);g&&i.length;){for(var N in o.filter)if((p=o.leftMatch[N].exec(g))!=null&&p[2]){var O,D,R=o.filter[N];D=p[1];q=false;p.splice(1,1);if(D.substr(D.length-1)!=="\\"){if(F===y)y=[];if(o.preFilter[N])if(p=o.preFilter[N](p,F,n,y,m,M)){if(p===true)continue}else q=O=true;if(p)for(var j=0;(D=F[j])!=null;j++)if(D){O=R(D,p,j,F);var s=m^!!O;if(n&&O!=null)if(s)q=true;else F[j]=false;else if(s){y.push(D);q=true}}if(O!== +B){n||(F=y);g=g.replace(o.match[N],"");if(!q)return[];break}}}if(g===u)if(q==null)k.error(g);else break;u=g}return F};k.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var o=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+\-]*)\))?/, +POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},relative:{"+":function(g,i){var n=typeof i==="string",m=n&&!/\W/.test(i);n=n&&!m;if(m)i=i.toLowerCase();m=0;for(var p=g.length,q;m<p;m++)if(q=g[m]){for(;(q=q.previousSibling)&&q.nodeType!==1;);g[m]=n||q&&q.nodeName.toLowerCase()=== +i?q||false:q===i}n&&k.filter(i,g,true)},">":function(g,i){var n,m=typeof i==="string",p=0,q=g.length;if(m&&!/\W/.test(i))for(i=i.toLowerCase();p<q;p++){if(n=g[p]){n=n.parentNode;g[p]=n.nodeName.toLowerCase()===i?n:false}}else{for(;p<q;p++)if(n=g[p])g[p]=m?n.parentNode:n.parentNode===i;m&&k.filter(i,g,true)}},"":function(g,i,n){var m,p=e++,q=b;if(typeof i==="string"&&!/\W/.test(i)){m=i=i.toLowerCase();q=a}q("parentNode",i,p,g,m,n)},"~":function(g,i,n){var m,p=e++,q=b;if(typeof i==="string"&&!/\W/.test(i)){m= +i=i.toLowerCase();q=a}q("previousSibling",i,p,g,m,n)}},find:{ID:function(g,i,n){if(typeof i.getElementById!=="undefined"&&!n)return(g=i.getElementById(g[1]))&&g.parentNode?[g]:[]},NAME:function(g,i){if(typeof i.getElementsByName!=="undefined"){for(var n=[],m=i.getElementsByName(g[1]),p=0,q=m.length;p<q;p++)m[p].getAttribute("name")===g[1]&&n.push(m[p]);return n.length===0?null:n}},TAG:function(g,i){return i.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,i,n,m,p,q){g=" "+g[1].replace(/\\/g, +"")+" ";if(q)return g;q=0;for(var u;(u=i[q])!=null;q++)if(u)if(p^(u.className&&(" "+u.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))n||m.push(u);else if(n)i[q]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},CHILD:function(g){if(g[1]==="nth"){var i=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=i[1]+(i[2]||1)-0;g[3]=i[3]-0}g[0]=e++;return g},ATTR:function(g,i,n, +m,p,q){i=g[1].replace(/\\/g,"");if(!q&&o.attrMap[i])g[1]=o.attrMap[i];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,i,n,m,p){if(g[1]==="not")if((d.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=k(g[3],null,null,i);else{g=k.filter(g[3],i,n,true^p);n||m.push.apply(m,g);return false}else if(o.match.POS.test(g[0])||o.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled=== +true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,i,n){return!!k(n[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"=== +g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},setFilters:{first:function(g,i){return i===0},last:function(g,i,n,m){return i===m.length-1},even:function(g,i){return i%2===0},odd:function(g,i){return i%2===1},lt:function(g,i,n){return i<n[3]-0},gt:function(g,i,n){return i>n[3]-0},nth:function(g,i,n){return n[3]- +0===i},eq:function(g,i,n){return n[3]-0===i}},filter:{PSEUDO:function(g,i,n,m){var p=i[1],q=o.filters[p];if(q)return q(g,n,i,m);else if(p==="contains")return(g.textContent||g.innerText||k.getText([g])||"").indexOf(i[3])>=0;else if(p==="not"){i=i[3];n=0;for(m=i.length;n<m;n++)if(i[n]===g)return false;return true}else k.error("Syntax error, unrecognized expression: "+p)},CHILD:function(g,i){var n=i[1],m=g;switch(n){case "only":case "first":for(;m=m.previousSibling;)if(m.nodeType===1)return false;if(n=== +"first")return true;m=g;case "last":for(;m=m.nextSibling;)if(m.nodeType===1)return false;return true;case "nth":n=i[2];var p=i[3];if(n===1&&p===0)return true;var q=i[0],u=g.parentNode;if(u&&(u.sizcache!==q||!g.nodeIndex)){var y=0;for(m=u.firstChild;m;m=m.nextSibling)if(m.nodeType===1)m.nodeIndex=++y;u.sizcache=q}m=g.nodeIndex-p;return n===0?m===0:m%n===0&&m/n>=0}},ID:function(g,i){return g.nodeType===1&&g.getAttribute("id")===i},TAG:function(g,i){return i==="*"&&g.nodeType===1||g.nodeName.toLowerCase()=== +i},CLASS:function(g,i){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(i)>-1},ATTR:function(g,i){var n=i[1];n=o.attrHandle[n]?o.attrHandle[n](g):g[n]!=null?g[n]:g.getAttribute(n);var m=n+"",p=i[2],q=i[4];return n==null?p==="!=":p==="="?m===q:p==="*="?m.indexOf(q)>=0:p==="~="?(" "+m+" ").indexOf(q)>=0:!q?m&&n!==false:p==="!="?m!==q:p==="^="?m.indexOf(q)===0:p==="$="?m.substr(m.length-q.length)===q:p==="|="?m===q||m.substr(0,q.length+1)===q+"-":false},POS:function(g,i,n,m){var p=o.setFilters[i[2]]; +if(p)return p(g,n,i,m)}}},x=o.match.POS,r=function(g,i){return"\\"+(i-0+1)},A;for(A in o.match){o.match[A]=RegExp(o.match[A].source+/(?![^\[]*\])(?![^\(]*\))/.source);o.leftMatch[A]=RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[A].source.replace(/\\(\d+)/g,r))}var C=function(g,i){g=Array.prototype.slice.call(g,0);if(i){i.push.apply(i,g);return i}return g};try{Array.prototype.slice.call(t.documentElement.childNodes,0)}catch(J){C=function(g,i){var n=0,m=i||[];if(f.call(g)==="[object Array]")Array.prototype.push.apply(m, +g);else if(typeof g.length==="number")for(var p=g.length;n<p;n++)m.push(g[n]);else for(;g[n];n++)m.push(g[n]);return m}}var w,I;if(t.documentElement.compareDocumentPosition)w=function(g,i){if(g===i){h=true;return 0}if(!g.compareDocumentPosition||!i.compareDocumentPosition)return g.compareDocumentPosition?-1:1;return g.compareDocumentPosition(i)&4?-1:1};else{w=function(g,i){var n,m,p=[],q=[];n=g.parentNode;m=i.parentNode;var u=n;if(g===i){h=true;return 0}else if(n===m)return I(g,i);else if(n){if(!m)return 1}else return-1; +for(;u;){p.unshift(u);u=u.parentNode}for(u=m;u;){q.unshift(u);u=u.parentNode}n=p.length;m=q.length;for(u=0;u<n&&u<m;u++)if(p[u]!==q[u])return I(p[u],q[u]);return u===n?I(g,q[u],-1):I(p[u],i,1)};I=function(g,i,n){if(g===i)return n;for(g=g.nextSibling;g;){if(g===i)return-1;g=g.nextSibling}return 1}}k.getText=function(g){for(var i="",n,m=0;g[m];m++){n=g[m];if(n.nodeType===3||n.nodeType===4)i+=n.nodeValue;else if(n.nodeType!==8)i+=k.getText(n.childNodes)}return i};(function(){var g=t.createElement("div"), +i="script"+(new Date).getTime(),n=t.documentElement;g.innerHTML="<a name='"+i+"'/>";n.insertBefore(g,n.firstChild);if(t.getElementById(i)){o.find.ID=function(m,p,q){if(typeof p.getElementById!=="undefined"&&!q)return(p=p.getElementById(m[1]))?p.id===m[1]||typeof p.getAttributeNode!=="undefined"&&p.getAttributeNode("id").nodeValue===m[1]?[p]:B:[]};o.filter.ID=function(m,p){var q=typeof m.getAttributeNode!=="undefined"&&m.getAttributeNode("id");return m.nodeType===1&&q&&q.nodeValue===p}}n.removeChild(g); +n=g=null})();(function(){var g=t.createElement("div");g.appendChild(t.createComment(""));if(g.getElementsByTagName("*").length>0)o.find.TAG=function(i,n){var m=n.getElementsByTagName(i[1]);if(i[1]==="*"){for(var p=[],q=0;m[q];q++)m[q].nodeType===1&&p.push(m[q]);m=p}return m};g.innerHTML="<a href='#'></a>";if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")o.attrHandle.href=function(i){return i.getAttribute("href",2)};g=null})();t.querySelectorAll&& +function(){var g=k,i=t.createElement("div");i.innerHTML="<p class='TEST'></p>";if(!(i.querySelectorAll&&i.querySelectorAll(".TEST").length===0)){k=function(m,p,q,u){p=p||t;m=m.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!u&&!k.isXML(p))if(p.nodeType===9)try{return C(p.querySelectorAll(m),q)}catch(y){}else if(p.nodeType===1&&p.nodeName.toLowerCase()!=="object"){var F=p.getAttribute("id"),M=F||"__sizzle__";F||p.setAttribute("id",M);try{return C(p.querySelectorAll("#"+M+" "+m),q)}catch(N){}finally{F|| +p.removeAttribute("id")}}return g(m,p,q,u)};for(var n in g)k[n]=g[n];i=null}}();(function(){var g=t.documentElement,i=g.matchesSelector||g.mozMatchesSelector||g.webkitMatchesSelector||g.msMatchesSelector,n=false;try{i.call(t.documentElement,"[test!='']:sizzle")}catch(m){n=true}if(i)k.matchesSelector=function(p,q){q=q.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(p))try{if(n||!o.match.PSEUDO.test(q)&&!/!=/.test(q))return i.call(p,q)}catch(u){}return k(q,null,null,[p]).length>0}})();(function(){var g= +t.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){o.order.splice(1,0,"CLASS");o.find.CLASS=function(i,n,m){if(typeof n.getElementsByClassName!=="undefined"&&!m)return n.getElementsByClassName(i[1])};g=null}}})();k.contains=t.documentElement.contains?function(g,i){return g!==i&&(g.contains?g.contains(i):true)}:t.documentElement.compareDocumentPosition? +function(g,i){return!!(g.compareDocumentPosition(i)&16)}:function(){return false};k.isXML=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false};var L=function(g,i){for(var n,m=[],p="",q=i.nodeType?[i]:i;n=o.match.PSEUDO.exec(g);){p+=n[0];g=g.replace(o.match.PSEUDO,"")}g=o.relative[g]?g+"*":g;n=0;for(var u=q.length;n<u;n++)k(g,q[n],m);return k.filter(p,m)};c.find=k;c.expr=k.selectors;c.expr[":"]=c.expr.filters;c.unique=k.uniqueSort;c.text=k.getText;c.isXMLDoc=k.isXML; +c.contains=k.contains})();var Za=/Until$/,$a=/^(?:parents|prevUntil|prevAll)/,ab=/,/,Na=/^.[^:#\[\.,]*$/,bb=Array.prototype.slice,cb=c.expr.match.POS;c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,e=0,f=this.length;e<f;e++){d=b.length;c.find(a,this[e],b);if(e>0)for(var h=d;h<b.length;h++)for(var l=0;l<d;l++)if(b[l]===b[h]){b.splice(h--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=0,e=b.length;d<e;d++)if(c.contains(this,b[d]))return true})}, +not:function(a){return this.pushStack(ma(this,a,false),"not",a)},filter:function(a){return this.pushStack(ma(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){var d=[],e,f,h=this[0];if(c.isArray(a)){var l,k={},o=1;if(h&&a.length){e=0;for(f=a.length;e<f;e++){l=a[e];k[l]||(k[l]=c.expr.match.POS.test(l)?c(l,b||this.context):l)}for(;h&&h.ownerDocument&&h!==b;){for(l in k){e=k[l];if(e.jquery?e.index(h)>-1:c(h).is(e))d.push({selector:l,elem:h,level:o})}h= +h.parentNode;o++}}return d}l=cb.test(a)?c(a,b||this.context):null;e=0;for(f=this.length;e<f;e++)for(h=this[e];h;)if(l?l.index(h)>-1:c.find.matchesSelector(h,a)){d.push(h);break}else{h=h.parentNode;if(!h||!h.ownerDocument||h===b)break}d=d.length>1?c.unique(d):d;return this.pushStack(d,"closest",a)},index:function(a){if(!a||typeof a==="string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var d=typeof a==="string"?c(a,b||this.context): +c.makeArray(a),e=c.merge(this.get(),d);return this.pushStack(!d[0]||!d[0].parentNode||d[0].parentNode.nodeType===11||!e[0]||!e[0].parentNode||e[0].parentNode.nodeType===11?e:c.unique(e))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a, +2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a, +b){c.fn[a]=function(d,e){var f=c.map(this,b,d);Za.test(a)||(e=d);if(e&&typeof e==="string")f=c.filter(e,f);f=this.length>1?c.unique(f):f;if((this.length>1||ab.test(e))&&$a.test(a))f=f.reverse();return this.pushStack(f,a,bb.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return b.length===1?c.find.matchesSelector(b[0],a)?[b[0]]:[]:c.find.matches(a,b)},dir:function(a,b,d){var e=[];for(a=a[b];a&&a.nodeType!==9&&(d===B||a.nodeType!==1||!c(a).is(d));){a.nodeType===1&& +e.push(a);a=a[b]}return e},nth:function(a,b,d){b=b||1;for(var e=0;a;a=a[d])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==b&&d.push(a);return d}});var za=/ jQuery\d+="(?:\d+|null)"/g,$=/^\s+/,Aa=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Ba=/<([\w:]+)/,db=/<tbody/i,eb=/<|&#?\w+;/,Ca=/<(?:script|object|embed|option|style)/i,Da=/checked\s*(?:[^=]|=\s*.checked.)/i,fb=/\=([^="'>\s]+\/)>/g,P={option:[1, +"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};P.optgroup=P.option;P.tbody=P.tfoot=P.colgroup=P.caption=P.thead;P.th=P.td;if(!c.support.htmlSerialize)P._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d= +c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==B)return this.empty().append((this[0]&&this[0].ownerDocument||t).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this}, +wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})}, +prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b, +this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,e;(e=this[d])!=null;d++)if(!a||c.filter(a,[e]).length){if(!b&&e.nodeType===1){c.cleanData(e.getElementsByTagName("*"));c.cleanData([e])}e.parentNode&&e.parentNode.removeChild(e)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild); +return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,e=this.ownerDocument;if(!d){d=e.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(za,"").replace(fb,'="$1">').replace($,"")],e)[0]}else return this.cloneNode(true)});if(a===true){na(this,b);na(this.find("*"),b.find("*"))}return b},html:function(a){if(a===B)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(za,""):null; +else if(typeof a==="string"&&!Ca.test(a)&&(c.support.leadingWhitespace||!$.test(a))&&!P[(Ba.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Aa,"<$1></$2>");try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(e){this.empty().append(a)}}else c.isFunction(a)?this.each(function(f){var h=c(this);h.html(a.call(this,f,h.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d= +c(this),e=d.html();d.replaceWith(a.call(this,b,e))});if(typeof a!=="string")a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){var e,f,h,l=a[0],k=[];if(!c.support.checkClone&&arguments.length===3&&typeof l==="string"&&Da.test(l))return this.each(function(){c(this).domManip(a, +b,d,true)});if(c.isFunction(l))return this.each(function(x){var r=c(this);a[0]=l.call(this,x,b?r.html():B);r.domManip(a,b,d)});if(this[0]){e=l&&l.parentNode;e=c.support.parentNode&&e&&e.nodeType===11&&e.childNodes.length===this.length?{fragment:e}:c.buildFragment(a,this,k);h=e.fragment;if(f=h.childNodes.length===1?h=h.firstChild:h.firstChild){b=b&&c.nodeName(f,"tr");f=0;for(var o=this.length;f<o;f++)d.call(b?c.nodeName(this[f],"table")?this[f].getElementsByTagName("tbody")[0]||this[f].appendChild(this[f].ownerDocument.createElement("tbody")): +this[f]:this[f],f>0||e.cacheable||this.length>1?h.cloneNode(true):h)}k.length&&c.each(k,Oa)}return this}});c.buildFragment=function(a,b,d){var e,f,h;b=b&&b[0]?b[0].ownerDocument||b[0]:t;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&b===t&&!Ca.test(a[0])&&(c.support.checkClone||!Da.test(a[0]))){f=true;if(h=c.fragments[a[0]])if(h!==1)e=h}if(!e){e=b.createDocumentFragment();c.clean(a,b,e,d)}if(f)c.fragments[a[0]]=h?e:1;return{fragment:e,cacheable:f}};c.fragments={};c.each({appendTo:"append", +prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var e=[];d=c(d);var f=this.length===1&&this[0].parentNode;if(f&&f.nodeType===11&&f.childNodes.length===1&&d.length===1){d[b](this[0]);return this}else{f=0;for(var h=d.length;f<h;f++){var l=(f>0?this.clone(true):this).get();c(d[f])[b](l);e=e.concat(l)}return this.pushStack(e,a,d.selector)}}});c.extend({clean:function(a,b,d,e){b=b||t;if(typeof b.createElement==="undefined")b=b.ownerDocument|| +b[0]&&b[0].ownerDocument||t;for(var f=[],h=0,l;(l=a[h])!=null;h++){if(typeof l==="number")l+="";if(l){if(typeof l==="string"&&!eb.test(l))l=b.createTextNode(l);else if(typeof l==="string"){l=l.replace(Aa,"<$1></$2>");var k=(Ba.exec(l)||["",""])[1].toLowerCase(),o=P[k]||P._default,x=o[0],r=b.createElement("div");for(r.innerHTML=o[1]+l+o[2];x--;)r=r.lastChild;if(!c.support.tbody){x=db.test(l);k=k==="table"&&!x?r.firstChild&&r.firstChild.childNodes:o[1]==="<table>"&&!x?r.childNodes:[];for(o=k.length- +1;o>=0;--o)c.nodeName(k[o],"tbody")&&!k[o].childNodes.length&&k[o].parentNode.removeChild(k[o])}!c.support.leadingWhitespace&&$.test(l)&&r.insertBefore(b.createTextNode($.exec(l)[0]),r.firstChild);l=r.childNodes}if(l.nodeType)f.push(l);else f=c.merge(f,l)}}if(d)for(h=0;f[h];h++)if(e&&c.nodeName(f[h],"script")&&(!f[h].type||f[h].type.toLowerCase()==="text/javascript"))e.push(f[h].parentNode?f[h].parentNode.removeChild(f[h]):f[h]);else{f[h].nodeType===1&&f.splice.apply(f,[h+1,0].concat(c.makeArray(f[h].getElementsByTagName("script")))); +d.appendChild(f[h])}return f},cleanData:function(a){for(var b,d,e=c.cache,f=c.event.special,h=c.support.deleteExpando,l=0,k;(k=a[l])!=null;l++)if(!(k.nodeName&&c.noData[k.nodeName.toLowerCase()]))if(d=k[c.expando]){if((b=e[d])&&b.events)for(var o in b.events)f[o]?c.event.remove(k,o):c.removeEvent(k,o,b.handle);if(h)delete k[c.expando];else k.removeAttribute&&k.removeAttribute(c.expando);delete e[d]}}});var Ea=/alpha\([^)]*\)/i,gb=/opacity=([^)]*)/,hb=/-([a-z])/ig,ib=/([A-Z])/g,Fa=/^-?\d+(?:px)?$/i, +jb=/^-?\d/,kb={position:"absolute",visibility:"hidden",display:"block"},Pa=["Left","Right"],Qa=["Top","Bottom"],W,Ga,aa,lb=function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){if(arguments.length===2&&b===B)return this;return c.access(this,a,b,true,function(d,e,f){return f!==B?c.style(d,e,f):c.css(d,e)})};c.extend({cssHooks:{opacity:{get:function(a,b){if(b){var d=W(a,"opacity","opacity");return d===""?"1":d}else return a.style.opacity}}},cssNumber:{zIndex:true,fontWeight:true,opacity:true, +zoom:true,lineHeight:true},cssProps:{"float":c.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,b,d,e){if(!(!a||a.nodeType===3||a.nodeType===8||!a.style)){var f,h=c.camelCase(b),l=a.style,k=c.cssHooks[h];b=c.cssProps[h]||h;if(d!==B){if(!(typeof d==="number"&&isNaN(d)||d==null)){if(typeof d==="number"&&!c.cssNumber[h])d+="px";if(!k||!("set"in k)||(d=k.set(a,d))!==B)try{l[b]=d}catch(o){}}}else{if(k&&"get"in k&&(f=k.get(a,false,e))!==B)return f;return l[b]}}},css:function(a,b,d){var e,f=c.camelCase(b), +h=c.cssHooks[f];b=c.cssProps[f]||f;if(h&&"get"in h&&(e=h.get(a,true,d))!==B)return e;else if(W)return W(a,b,f)},swap:function(a,b,d){var e={},f;for(f in b){e[f]=a.style[f];a.style[f]=b[f]}d.call(a);for(f in b)a.style[f]=e[f]},camelCase:function(a){return a.replace(hb,lb)}});c.curCSS=c.css;c.each(["height","width"],function(a,b){c.cssHooks[b]={get:function(d,e,f){var h;if(e){if(d.offsetWidth!==0)h=oa(d,b,f);else c.swap(d,kb,function(){h=oa(d,b,f)});if(h<=0){h=W(d,b,b);if(h==="0px"&&aa)h=aa(d,b,b); +if(h!=null)return h===""||h==="auto"?"0px":h}if(h<0||h==null){h=d.style[b];return h===""||h==="auto"?"0px":h}return typeof h==="string"?h:h+"px"}},set:function(d,e){if(Fa.test(e)){e=parseFloat(e);if(e>=0)return e+"px"}else return e}}});if(!c.support.opacity)c.cssHooks.opacity={get:function(a,b){return gb.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var d=a.style;d.zoom=1;var e=c.isNaN(b)?"":"alpha(opacity="+b*100+")",f= +d.filter||"";d.filter=Ea.test(f)?f.replace(Ea,e):d.filter+" "+e}};if(t.defaultView&&t.defaultView.getComputedStyle)Ga=function(a,b,d){var e;d=d.replace(ib,"-$1").toLowerCase();if(!(b=a.ownerDocument.defaultView))return B;if(b=b.getComputedStyle(a,null)){e=b.getPropertyValue(d);if(e===""&&!c.contains(a.ownerDocument.documentElement,a))e=c.style(a,d)}return e};if(t.documentElement.currentStyle)aa=function(a,b){var d,e,f=a.currentStyle&&a.currentStyle[b],h=a.style;if(!Fa.test(f)&&jb.test(f)){d=h.left; +e=a.runtimeStyle.left;a.runtimeStyle.left=a.currentStyle.left;h.left=b==="fontSize"?"1em":f||0;f=h.pixelLeft+"px";h.left=d;a.runtimeStyle.left=e}return f===""?"auto":f};W=Ga||aa;if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=a.offsetHeight;return a.offsetWidth===0&&b===0||!c.support.reliableHiddenOffsets&&(a.style.display||c.css(a,"display"))==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var mb=c.now(),nb=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, +ob=/^(?:select|textarea)/i,pb=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,qb=/^(?:GET|HEAD)$/,Ra=/\[\]$/,T=/\=\?(&|$)/,ja=/\?/,rb=/([?&])_=[^&]*/,sb=/^(\w+:)?\/\/([^\/?#]+)/,tb=/%20/g,ub=/#.*$/,Ha=c.fn.load;c.fn.extend({load:function(a,b,d){if(typeof a!=="string"&&Ha)return Ha.apply(this,arguments);else if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var f=a.slice(e,a.length);a=a.slice(0,e)}e="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b=== +"object"){b=c.param(b,c.ajaxSettings.traditional);e="POST"}var h=this;c.ajax({url:a,type:e,dataType:"html",data:b,complete:function(l,k){if(k==="success"||k==="notmodified")h.html(f?c("<div>").append(l.responseText.replace(nb,"")).find(f):l.responseText);d&&h.each(d,[l.responseText,k,l])}});return this},serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&& +!this.disabled&&(this.checked||ob.test(this.nodeName)||pb.test(this.type))}).map(function(a,b){var d=c(this).val();return d==null?null:c.isArray(d)?c.map(d,function(e){return{name:b.name,value:e}}):{name:b.name,value:d}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,e){if(c.isFunction(b)){e=e||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:e})}, +getScript:function(a,b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,e){if(c.isFunction(b)){e=e||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:e})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return new E.XMLHttpRequest},accepts:{xml:"application/xml, text/xml",html:"text/html", +script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},ajax:function(a){var b=c.extend(true,{},c.ajaxSettings,a),d,e,f,h=b.type.toUpperCase(),l=qb.test(h);b.url=b.url.replace(ub,"");b.context=a&&a.context!=null?a.context:b;if(b.data&&b.processData&&typeof b.data!=="string")b.data=c.param(b.data,b.traditional);if(b.dataType==="jsonp"){if(h==="GET")T.test(b.url)||(b.url+=(ja.test(b.url)?"&":"?")+(b.jsonp||"callback")+"=?");else if(!b.data|| +!T.test(b.data))b.data=(b.data?b.data+"&":"")+(b.jsonp||"callback")+"=?";b.dataType="json"}if(b.dataType==="json"&&(b.data&&T.test(b.data)||T.test(b.url))){d=b.jsonpCallback||"jsonp"+mb++;if(b.data)b.data=(b.data+"").replace(T,"="+d+"$1");b.url=b.url.replace(T,"="+d+"$1");b.dataType="script";var k=E[d];E[d]=function(m){if(c.isFunction(k))k(m);else{E[d]=B;try{delete E[d]}catch(p){}}f=m;c.handleSuccess(b,w,e,f);c.handleComplete(b,w,e,f);r&&r.removeChild(A)}}if(b.dataType==="script"&&b.cache===null)b.cache= +false;if(b.cache===false&&l){var o=c.now(),x=b.url.replace(rb,"$1_="+o);b.url=x+(x===b.url?(ja.test(b.url)?"&":"?")+"_="+o:"")}if(b.data&&l)b.url+=(ja.test(b.url)?"&":"?")+b.data;b.global&&c.active++===0&&c.event.trigger("ajaxStart");o=(o=sb.exec(b.url))&&(o[1]&&o[1].toLowerCase()!==location.protocol||o[2].toLowerCase()!==location.host);if(b.dataType==="script"&&h==="GET"&&o){var r=t.getElementsByTagName("head")[0]||t.documentElement,A=t.createElement("script");if(b.scriptCharset)A.charset=b.scriptCharset; +A.src=b.url;if(!d){var C=false;A.onload=A.onreadystatechange=function(){if(!C&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){C=true;c.handleSuccess(b,w,e,f);c.handleComplete(b,w,e,f);A.onload=A.onreadystatechange=null;r&&A.parentNode&&r.removeChild(A)}}}r.insertBefore(A,r.firstChild);return B}var J=false,w=b.xhr();if(w){b.username?w.open(h,b.url,b.async,b.username,b.password):w.open(h,b.url,b.async);try{if(b.data!=null&&!l||a&&a.contentType)w.setRequestHeader("Content-Type", +b.contentType);if(b.ifModified){c.lastModified[b.url]&&w.setRequestHeader("If-Modified-Since",c.lastModified[b.url]);c.etag[b.url]&&w.setRequestHeader("If-None-Match",c.etag[b.url])}o||w.setRequestHeader("X-Requested-With","XMLHttpRequest");w.setRequestHeader("Accept",b.dataType&&b.accepts[b.dataType]?b.accepts[b.dataType]+", */*; q=0.01":b.accepts._default)}catch(I){}if(b.beforeSend&&b.beforeSend.call(b.context,w,b)===false){b.global&&c.active--===1&&c.event.trigger("ajaxStop");w.abort();return false}b.global&& +c.triggerGlobal(b,"ajaxSend",[w,b]);var L=w.onreadystatechange=function(m){if(!w||w.readyState===0||m==="abort"){J||c.handleComplete(b,w,e,f);J=true;if(w)w.onreadystatechange=c.noop}else if(!J&&w&&(w.readyState===4||m==="timeout")){J=true;w.onreadystatechange=c.noop;e=m==="timeout"?"timeout":!c.httpSuccess(w)?"error":b.ifModified&&c.httpNotModified(w,b.url)?"notmodified":"success";var p;if(e==="success")try{f=c.httpData(w,b.dataType,b)}catch(q){e="parsererror";p=q}if(e==="success"||e==="notmodified")d|| +c.handleSuccess(b,w,e,f);else c.handleError(b,w,e,p);d||c.handleComplete(b,w,e,f);m==="timeout"&&w.abort();if(b.async)w=null}};try{var g=w.abort;w.abort=function(){w&&Function.prototype.call.call(g,w);L("abort")}}catch(i){}b.async&&b.timeout>0&&setTimeout(function(){w&&!J&&L("timeout")},b.timeout);try{w.send(l||b.data==null?null:b.data)}catch(n){c.handleError(b,w,null,n);c.handleComplete(b,w,e,f)}b.async||L();return w}},param:function(a,b){var d=[],e=function(h,l){l=c.isFunction(l)?l():l;d[d.length]= +encodeURIComponent(h)+"="+encodeURIComponent(l)};if(b===B)b=c.ajaxSettings.traditional;if(c.isArray(a)||a.jquery)c.each(a,function(){e(this.name,this.value)});else for(var f in a)da(f,a[f],b,e);return d.join("&").replace(tb,"+")}});c.extend({active:0,lastModified:{},etag:{},handleError:function(a,b,d,e){a.error&&a.error.call(a.context,b,d,e);a.global&&c.triggerGlobal(a,"ajaxError",[b,a,e])},handleSuccess:function(a,b,d,e){a.success&&a.success.call(a.context,e,d,b);a.global&&c.triggerGlobal(a,"ajaxSuccess", +[b,a])},handleComplete:function(a,b,d){a.complete&&a.complete.call(a.context,b,d);a.global&&c.triggerGlobal(a,"ajaxComplete",[b,a]);a.global&&c.active--===1&&c.event.trigger("ajaxStop")},triggerGlobal:function(a,b,d){(a.context&&a.context.url==null?c(a.context):c.event).trigger(b,d)},httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===1223}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"), +e=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(e)c.etag[b]=e;return a.status===304},httpData:function(a,b,d){var e=a.getResponseHeader("content-type")||"",f=b==="xml"||!b&&e.indexOf("xml")>=0;a=f?a.responseXML:a.responseText;f&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b==="json"||!b&&e.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&e.indexOf("javascript")>=0)c.globalEval(a);return a}}); +if(E.ActiveXObject)c.ajaxSettings.xhr=function(){if(E.location.protocol!=="file:")try{return new E.XMLHttpRequest}catch(a){}try{return new E.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}};c.support.ajax=!!c.ajaxSettings.xhr();var ea={},vb=/^(?:toggle|show|hide)$/,wb=/^([+\-]=)?([\d+.\-]+)(.*)$/,ba,pa=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b,d){if(a||a===0)return this.animate(S("show", +3),a,b,d);else{d=0;for(var e=this.length;d<e;d++){a=this[d];b=a.style.display;if(!c.data(a,"olddisplay")&&b==="none")b=a.style.display="";b===""&&c.css(a,"display")==="none"&&c.data(a,"olddisplay",qa(a.nodeName))}for(d=0;d<e;d++){a=this[d];b=a.style.display;if(b===""||b==="none")a.style.display=c.data(a,"olddisplay")||""}return this}},hide:function(a,b,d){if(a||a===0)return this.animate(S("hide",3),a,b,d);else{a=0;for(b=this.length;a<b;a++){d=c.css(this[a],"display");d!=="none"&&c.data(this[a],"olddisplay", +d)}for(a=0;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b,d){var e=typeof a==="boolean";if(c.isFunction(a)&&c.isFunction(b))this._toggle.apply(this,arguments);else a==null||e?this.each(function(){var f=e?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(S("toggle",3),a,b,d);return this},fadeTo:function(a,b,d,e){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d,e)},animate:function(a,b,d,e){var f=c.speed(b, +d,e);if(c.isEmptyObject(a))return this.each(f.complete);return this[f.queue===false?"each":"queue"](function(){var h=c.extend({},f),l,k=this.nodeType===1,o=k&&c(this).is(":hidden"),x=this;for(l in a){var r=c.camelCase(l);if(l!==r){a[r]=a[l];delete a[l];l=r}if(a[l]==="hide"&&o||a[l]==="show"&&!o)return h.complete.call(this);if(k&&(l==="height"||l==="width")){h.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(c.css(this,"display")==="inline"&&c.css(this,"float")==="none")if(c.support.inlineBlockNeedsLayout)if(qa(this.nodeName)=== +"inline")this.style.display="inline-block";else{this.style.display="inline";this.style.zoom=1}else this.style.display="inline-block"}if(c.isArray(a[l])){(h.specialEasing=h.specialEasing||{})[l]=a[l][1];a[l]=a[l][0]}}if(h.overflow!=null)this.style.overflow="hidden";h.curAnim=c.extend({},a);c.each(a,function(A,C){var J=new c.fx(x,h,A);if(vb.test(C))J[C==="toggle"?o?"show":"hide":C](a);else{var w=wb.exec(C),I=J.cur()||0;if(w){var L=parseFloat(w[2]),g=w[3]||"px";if(g!=="px"){c.style(x,A,(L||1)+g);I=(L|| +1)/J.cur()*I;c.style(x,A,I+g)}if(w[1])L=(w[1]==="-="?-1:1)*L+I;J.custom(I,L,g)}else J.custom(I,C,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);this.each(function(){for(var e=d.length-1;e>=0;e--)if(d[e].elem===this){b&&d[e](true);d.splice(e,1)}});b||this.dequeue();return this}});c.each({slideDown:S("show",1),slideUp:S("hide",1),slideToggle:S("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){c.fn[a]=function(d,e,f){return this.animate(b, +d,e,f)}});c.extend({speed:function(a,b,d){var e=a&&typeof a==="object"?c.extend({},a):{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};e.duration=c.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in c.fx.speeds?c.fx.speeds[e.duration]:c.fx.speeds._default;e.old=e.complete;e.complete=function(){e.queue!==false&&c(this).dequeue();c.isFunction(e.old)&&e.old.call(this)};return e},easing:{linear:function(a,b,d,e){return d+e*a},swing:function(a,b,d,e){return(-Math.cos(a* +Math.PI)/2+0.5)*e+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||c.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a=parseFloat(c.css(this.elem,this.prop));return a&&a>-1E4?a:0},custom:function(a,b,d){function e(l){return f.step(l)} +var f=this,h=c.fx;this.startTime=c.now();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;this.pos=this.state=0;e.elem=this.elem;if(e()&&c.timers.push(e)&&!ba)ba=setInterval(h.tick,h.interval)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true; +this.custom(this.cur(),0)},step:function(a){var b=c.now(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var e in this.options.curAnim)if(this.options.curAnim[e]!==true)d=false;if(d){if(this.options.overflow!=null&&!c.support.shrinkWrapBlocks){var f=this.elem,h=this.options;c.each(["","X","Y"],function(k,o){f.style["overflow"+o]=h.overflow[k]})}this.options.hide&&c(this.elem).hide();if(this.options.hide|| +this.options.show)for(var l in this.options.curAnim)c.style(this.elem,l,this.options.orig[l]);this.options.complete.call(this.elem)}return false}else{a=b-this.startTime;this.state=a/this.options.duration;b=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||b](this.state,a,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a= +c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||c.fx.stop()},interval:13,stop:function(){clearInterval(ba);ba=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a=== +b.elem}).length};var xb=/^t(?:able|d|h)$/i,Ia=/^(?:body|html)$/i;c.fn.offset="getBoundingClientRect"in t.documentElement?function(a){var b=this[0],d;if(a)return this.each(function(l){c.offset.setOffset(this,a,l)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);try{d=b.getBoundingClientRect()}catch(e){}var f=b.ownerDocument,h=f.documentElement;if(!d||!c.contains(h,b))return d||{top:0,left:0};b=f.body;f=fa(f);return{top:d.top+(f.pageYOffset||c.support.boxModel&& +h.scrollTop||b.scrollTop)-(h.clientTop||b.clientTop||0),left:d.left+(f.pageXOffset||c.support.boxModel&&h.scrollLeft||b.scrollLeft)-(h.clientLeft||b.clientLeft||0)}}:function(a){var b=this[0];if(a)return this.each(function(x){c.offset.setOffset(this,a,x)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d,e=b.offsetParent,f=b.ownerDocument,h=f.documentElement,l=f.body;d=(f=f.defaultView)?f.getComputedStyle(b,null):b.currentStyle; +for(var k=b.offsetTop,o=b.offsetLeft;(b=b.parentNode)&&b!==l&&b!==h;){if(c.offset.supportsFixedPosition&&d.position==="fixed")break;d=f?f.getComputedStyle(b,null):b.currentStyle;k-=b.scrollTop;o-=b.scrollLeft;if(b===e){k+=b.offsetTop;o+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&xb.test(b.nodeName))){k+=parseFloat(d.borderTopWidth)||0;o+=parseFloat(d.borderLeftWidth)||0}e=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&d.overflow!=="visible"){k+= +parseFloat(d.borderTopWidth)||0;o+=parseFloat(d.borderLeftWidth)||0}d=d}if(d.position==="relative"||d.position==="static"){k+=l.offsetTop;o+=l.offsetLeft}if(c.offset.supportsFixedPosition&&d.position==="fixed"){k+=Math.max(h.scrollTop,l.scrollTop);o+=Math.max(h.scrollLeft,l.scrollLeft)}return{top:k,left:o}};c.offset={initialize:function(){var a=t.body,b=t.createElement("div"),d,e,f,h=parseFloat(c.css(a,"marginTop"))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px", +height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";a.insertBefore(b,a.firstChild);d=b.firstChild;e=d.firstChild;f=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=e.offsetTop!==5;this.doesAddBorderForTableAndCells= +f.offsetTop===5;e.style.position="fixed";e.style.top="20px";this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15;e.style.position=e.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==h;a.removeChild(b);c.offset.initialize=c.noop},bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.css(a, +"marginTop"))||0;d+=parseFloat(c.css(a,"marginLeft"))||0}return{top:b,left:d}},setOffset:function(a,b,d){var e=c.css(a,"position");if(e==="static")a.style.position="relative";var f=c(a),h=f.offset(),l=c.css(a,"top"),k=c.css(a,"left"),o=e==="absolute"&&c.inArray("auto",[l,k])>-1;e={};var x={};if(o)x=f.position();l=o?x.top:parseInt(l,10)||0;k=o?x.left:parseInt(k,10)||0;if(c.isFunction(b))b=b.call(a,d,h);if(b.top!=null)e.top=b.top-h.top+l;if(b.left!=null)e.left=b.left-h.left+k;"using"in b?b.using.call(a, +e):f.css(e)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),e=Ia.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.css(a,"marginTop"))||0;d.left-=parseFloat(c.css(a,"marginLeft"))||0;e.top+=parseFloat(c.css(b[0],"borderTopWidth"))||0;e.left+=parseFloat(c.css(b[0],"borderLeftWidth"))||0;return{top:d.top-e.top,left:d.left-e.left}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||t.body;a&&!Ia.test(a.nodeName)&& +c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(e){var f=this[0],h;if(!f)return null;if(e!==B)return this.each(function(){if(h=fa(this))h.scrollTo(!a?e:c(h).scrollLeft(),a?e:c(h).scrollTop());else this[d]=e});else return(h=fa(f))?"pageXOffset"in h?h[a?"pageYOffset":"pageXOffset"]:c.support.boxModel&&h.document.documentElement[d]||h.document.body[d]:f[d]}});c.each(["Height","Width"],function(a,b){var d=b.toLowerCase(); +c.fn["inner"+b]=function(){return this[0]?parseFloat(c.css(this[0],d,"padding")):null};c.fn["outer"+b]=function(e){return this[0]?parseFloat(c.css(this[0],d,e?"margin":"border")):null};c.fn[d]=function(e){var f=this[0];if(!f)return e==null?null:this;if(c.isFunction(e))return this.each(function(l){var k=c(this);k[d](e.call(this,l,k[d]()))});if(c.isWindow(f))return f.document.compatMode==="CSS1Compat"&&f.document.documentElement["client"+b]||f.document.body["client"+b];else if(f.nodeType===9)return Math.max(f.documentElement["client"+ +b],f.body["scroll"+b],f.documentElement["scroll"+b],f.body["offset"+b],f.documentElement["offset"+b]);else if(e===B){f=c.css(f,d);var h=parseFloat(f);return c.isNaN(h)?f:h}else return this.css(d,typeof e==="string"?e:e+"px")}})})(window);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery-ui.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,11630 @@ +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.7", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr( element, "tabindex" ); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || !isNaN( tabIndex ) + : !isNaN( tabIndex )) + // the element and all of its ancestors must be visible + && visible( element ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ); + return ( isNaN( tabIndex ) || tabIndex >= 0 ) && $( element ).is( ":focusable" ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Widget 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Mouse 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Draggable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue + if(!this.element[0] || !this.element[0].parentNode) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + (o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.7" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Droppable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.7" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = dropped || this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + } +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Resizable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.7" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Selectable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.7" +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Sortable 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are floating + this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp(); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.7" +}); + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.each(function() { + $.queue(this, 'fx', function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('className'); + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('className', className); + + that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + }); + + // $.animate adds a function to the end of the queue + // but we want it at the front + var queue = $.queue(this), + anim = queue.splice(queue.length - 1, 1)[0]; + queue.splice(1, 0, anim); + $.dequeue(this); + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.7", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }); + + element.wrap(wrapper); + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0 }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * Copyright 2008 George McGinley Smith + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * Copyright 2001 Robert Penner + * + */ + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Blind 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Bounce 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Clip 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Drop 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Explode 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Fade 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Fold 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Highlight 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Pulsate 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Scale 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left','width','height','overflow','opacity']; + var props1 = ['position','top','left','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Shake 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Slide 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','left']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Effects Transfer 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Accordion 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // switch classes + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + // find elements to show and hide + var toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.7", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt( s.parent().width(), 10 ) + - parseInt( s.css( "paddingLeft" ), 10 ) + - parseInt( s.css( "paddingRight" ), 10 ) + - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) + - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Autocomplete 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.attr( "readonly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._move( "previous", event ); + // prevent moving cursor to beginning of text field in some browsers + event.preventDefault(); + break; + case keyCode.DOWN: + self._move( "next", event ); + // prevent moving cursor to end of text field in some browsers + event.preventDefault(); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.response = function() { + return self._response.apply( self, arguments ); + }; + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if (self.xhr) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status, xhr ) { + if ( xhr === self.xhr ) { + response( data ); + } + self.xhr = null; + }, + error: function( xhr ) { + if ( xhr === self.xhr ) { + response( [] ); + } + self.xhr = null; + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this.response ); + }, + + _response: function( content ) { + if ( content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + this.element.removeClass( "ui-autocomplete-loading" ); + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + ul.width( "" ).outerWidth(), + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.attr("scrollTop"), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.attr("scrollTop", scroll + offset); + } else if (offset >= elementHeight) { + this.element.attr("scrollTop", scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element.attr("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Button 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function( event ) { + $( ":ui-button", event.target.form ).each(function() { + var inst = $( this ).data( "button" ); + setTimeout(function() { + inst.refresh(); + }, 1 ); + }); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.attr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + $( this ).addClass( focusClass ); + }) + .bind( "blur.button", function() { + $( this ).removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + self.refresh(); + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", true ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else { + if ( this.element.is(":radio") ) { + this.type = "radio"; + } else { + if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + } + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + this.buttonElement = this.element.parents().last() + .find( "label[for=" + this.element.attr("id") + "]" ); + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.attr( "disabled", true ); + } else { + this.element.removeAttr( "disabled" ); + } + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary; + if ( icons.primary || icons.secondary ) { + buttonElement.addClass( "ui-button-text-icon" + + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + if ( !this.options.text ) { + buttonElement + .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ) + .removeClass( "ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary" ); + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonElement.addClass( "ui-button-text-only" ); + } + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Datepicker 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.7" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false // True to size the input for the date format, false to leave as is + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + inst.dpDiv.show(); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + extendRemove(inst.settings, settings); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDateDatepicker(target, date); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._datepickerShowing = true; + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + var borders = $.datepicker._getBorders(inst.dpDiv); + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a') + .bind('mouseout', function(){ + $(this).removeClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .bind('mouseover', function(){ + if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }) + .end() + .find('.' + this._dayOverClass + ' a') + .trigger('mouseover') + .end(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + else + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear) { + setTimeout(function() { + inst.input.focus(); + }, 0); + } + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = (lookAhead(match) ? longNames : shortNames); + for (var i = 0; i < names.length; i++) { + if (value.substr(iValue, names[i].length).toLowerCase() == names[i].toLowerCase()) { + iValue += names[i].length; + return i + 1; + } + } + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/* + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._gotoToday(\'#' + inst.id + '\');"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' + + inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' + + 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' + + '>'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' + + 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' + + '>'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + //when showing there is no need for later update + if( ! $.browser.mozilla ){ + html += inst.yearshtml; + inst.yearshtml = null; + } else { + // will be replaced later with inst.yearshtml + html += '<select class="ui-datepicker-year"><option value="' + drawYear + '" selected="selected">' + drawYear + '</option></select>'; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - new Date(year, month, 32).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.7"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Dialog 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .attr( props, true ) + .unbind('click') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.7", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Position 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if (options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + parseInt( $.curCSS( this, "marginRight", true ) ) || 0, + collisionHeight = elemHeight + marginTop + + parseInt( $.curCSS( this, "marginBottom", true ) ) || 0, + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Progressbar 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.7" +}); + +})( jQuery ); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Slider 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + if ( o.disabled ) { + this.element.addClass( "ui-slider-disabled ui-disabled" ); + } + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + this.range = $( "<div></div>" ); + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } else { + this.range = $( "<div></div>" ); + } + + this.range + .appendTo( this.element ) + .addClass( "ui-slider-range" ); + + if ( o.range === "min" || o.range === "max" ) { + this.range.addClass( "ui-slider-range-" + o.range ); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass( "ui-widget-header" ); + } + + if ( $( ".ui-slider-handle", this.element ).length === 0 ) { + $( "<a href='#'></a>" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + + if ( o.values && o.values.length ) { + while ( $(".ui-slider-handle", this.element).length < o.values.length ) { + $( "<a href='#'></a>" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + } + + this.handles = $( ".ui-slider-handle", this.element ) + .addClass( "ui-state-default" + + " ui-corner-all" ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.attr( "disabled", "disabled" ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.removeAttr( "disabled" ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step; + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.7" +}); + +}(jQuery)); +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI Tabs 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ) ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.7" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery );
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery-ui.min.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,409 @@ +/*! + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery UI 1.8.7 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * + * http://docs.jquery.com/UI + */ +(function(b,c){function f(g){return!b(g).parents().andSelf().filter(function(){return b.curCSS(this,"visibility")==="hidden"||b.expr.filters.hidden(this)}).length}b.ui=b.ui||{};if(!b.ui.version){b.extend(b.ui,{version:"1.8.7",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});b.fn.extend({_focus:b.fn.focus,focus:function(g,e){return typeof g==="number"?this.each(function(){var a=this;setTimeout(function(){b(a).focus();e&&e.call(a)},g)}):this._focus.apply(this,arguments)},scrollParent:function(){var g;g=b.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(b.curCSS(this, +"position",1))&&/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(b.curCSS(this,"overflow",1)+b.curCSS(this,"overflow-y",1)+b.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!g.length?b(document):g},zIndex:function(g){if(g!==c)return this.css("zIndex",g);if(this.length){g=b(this[0]);for(var e;g.length&&g[0]!==document;){e=g.css("position"); +if(e==="absolute"||e==="relative"||e==="fixed"){e=parseInt(g.css("zIndex"),10);if(!isNaN(e)&&e!==0)return e}g=g.parent()}}return 0},disableSelection:function(){return this.bind((b.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(g){g.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});b.each(["Width","Height"],function(g,e){function a(j,n,q,l){b.each(d,function(){n-=parseFloat(b.curCSS(j,"padding"+this,true))||0;if(q)n-=parseFloat(b.curCSS(j, +"border"+this+"Width",true))||0;if(l)n-=parseFloat(b.curCSS(j,"margin"+this,true))||0});return n}var d=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),i={innerWidth:b.fn.innerWidth,innerHeight:b.fn.innerHeight,outerWidth:b.fn.outerWidth,outerHeight:b.fn.outerHeight};b.fn["inner"+e]=function(j){if(j===c)return i["inner"+e].call(this);return this.each(function(){b(this).css(h,a(this,j)+"px")})};b.fn["outer"+e]=function(j,n){if(typeof j!=="number")return i["outer"+e].call(this,j);return this.each(function(){b(this).css(h, +a(this,j,true,n)+"px")})}});b.extend(b.expr[":"],{data:function(g,e,a){return!!b.data(g,a[3])},focusable:function(g){var e=g.nodeName.toLowerCase(),a=b.attr(g,"tabindex");if("area"===e){e=g.parentNode;a=e.name;if(!g.href||!a||e.nodeName.toLowerCase()!=="map")return false;g=b("img[usemap=#"+a+"]")[0];return!!g&&f(g)}return(/input|select|textarea|button|object/.test(e)?!g.disabled:"a"==e?g.href||!isNaN(a):!isNaN(a))&&f(g)},tabbable:function(g){var e=b.attr(g,"tabindex");return(isNaN(e)||e>=0)&&b(g).is(":focusable")}}); +b(function(){var g=document.body,e=g.appendChild(e=document.createElement("div"));b.extend(e.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});b.support.minHeight=e.offsetHeight===100;b.support.selectstart="onselectstart"in e;g.removeChild(e).style.display="none"});b.extend(b.ui,{plugin:{add:function(g,e,a){g=b.ui[g].prototype;for(var d in a){g.plugins[d]=g.plugins[d]||[];g.plugins[d].push([e,a[d]])}},call:function(g,e,a){if((e=g.plugins[e])&&g.element[0].parentNode)for(var d=0;d<e.length;d++)g.options[e[d][0]]&& +e[d][1].apply(g.element,a)}},contains:function(g,e){return document.compareDocumentPosition?g.compareDocumentPosition(e)&16:g!==e&&g.contains(e)},hasScroll:function(g,e){if(b(g).css("overflow")==="hidden")return false;e=e&&e==="left"?"scrollLeft":"scrollTop";var a=false;if(g[e]>0)return true;g[e]=1;a=g[e]>0;g[e]=0;return a},isOverAxis:function(g,e,a){return g>e&&g<e+a},isOver:function(g,e,a,d,h,i){return b.ui.isOverAxis(g,a,h)&&b.ui.isOverAxis(e,d,i)}})}})(jQuery); +(function(b,c){if(b.cleanData){var f=b.cleanData;b.cleanData=function(e){for(var a=0,d;(d=e[a])!=null;a++)b(d).triggerHandler("remove");f(e)}}else{var g=b.fn.remove;b.fn.remove=function(e,a){return this.each(function(){if(!a)if(!e||b.filter(e,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return g.call(b(this),e,a)})}}b.widget=function(e,a,d){var h=e.split(".")[0],i;e=e.split(".")[1];i=h+"-"+e;if(!d){d=a;a=b.Widget}b.expr[":"][i]=function(j){return!!b.data(j, +e)};b[h]=b[h]||{};b[h][e]=function(j,n){arguments.length&&this._createWidget(j,n)};a=new a;a.options=b.extend(true,{},a.options);b[h][e].prototype=b.extend(true,a,{namespace:h,widgetName:e,widgetEventPrefix:b[h][e].prototype.widgetEventPrefix||e,widgetBaseClass:i},d);b.widget.bridge(e,b[h][e])};b.widget.bridge=function(e,a){b.fn[e]=function(d){var h=typeof d==="string",i=Array.prototype.slice.call(arguments,1),j=this;d=!h&&i.length?b.extend.apply(null,[true,d].concat(i)):d;if(h&&d.charAt(0)==="_")return j; +h?this.each(function(){var n=b.data(this,e),q=n&&b.isFunction(n[d])?n[d].apply(n,i):n;if(q!==n&&q!==c){j=q;return false}}):this.each(function(){var n=b.data(this,e);n?n.option(d||{})._init():b.data(this,e,new a(d,this))});return j}};b.Widget=function(e,a){arguments.length&&this._createWidget(e,a)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(e,a){b.data(a,this.widgetName,this);this.element=b(a);this.options=b.extend(true,{},this.options, +this._getCreateOptions(),e);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, +widget:function(){return this.element},option:function(e,a){var d=e;if(arguments.length===0)return b.extend({},this.options);if(typeof e==="string"){if(a===c)return this.options[e];d={};d[e]=a}this._setOptions(d);return this},_setOptions:function(e){var a=this;b.each(e,function(d,h){a._setOption(d,h)});return this},_setOption:function(e,a){this.options[e]=a;if(e==="disabled")this.widget()[a?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",a);return this}, +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,a,d){var h=this.options[e];a=b.Event(a);a.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();d=d||{};if(a.originalEvent){e=b.event.props.length;for(var i;e;){i=b.event.props[--e];a[i]=a.originalEvent[i]}}this.element.trigger(a,d);return!(b.isFunction(h)&&h.call(this.element[0],a,d)===false||a.isDefaultPrevented())}}})(jQuery); +(function(b){b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var c=this;this.element.bind("mousedown."+this.widgetName,function(f){return c._mouseDown(f)}).bind("click."+this.widgetName,function(f){if(true===b.data(f.target,c.widgetName+".preventClickEvent")){b.removeData(f.target,c.widgetName+".preventClickEvent");f.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(c){c.originalEvent= +c.originalEvent||{};if(!c.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(c);this._mouseDownEvent=c;var f=this,g=c.which==1,e=typeof this.options.cancel=="string"?b(c.target).parents().add(c.target).filter(this.options.cancel).length:false;if(!g||e||!this._mouseCapture(c))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){f.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c)){this._mouseStarted= +this._mouseStart(c)!==false;if(!this._mouseStarted){c.preventDefault();return true}}this._mouseMoveDelegate=function(a){return f._mouseMove(a)};this._mouseUpDelegate=function(a){return f._mouseUp(a)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.preventDefault();return c.originalEvent.mouseHandled=true}},_mouseMove:function(c){if(b.browser.msie&&!(document.documentMode>=9)&&!c.button)return this._mouseUp(c);if(this._mouseStarted){this._mouseDrag(c); +return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,c)!==false)?this._mouseDrag(c):this._mouseUp(c);return!this._mouseStarted},_mouseUp:function(c){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;c.target==this._mouseDownEvent.target&&b.data(c.target,this.widgetName+".preventClickEvent", +true);this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +(function(b){b.widget("ui.draggable",b.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(c){var f= +this.options;if(this.helper||f.disabled||b(c.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(c);if(!this.handle)return false;return true},_mouseStart:function(c){var f=this.options;this.helper=this._createHelper(c);this._cacheHelperProportions();if(b.ui.ddmanager)b.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- +this.margins.top,left:this.offset.left-this.margins.left};b.extend(this.offset,{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;f.cursorAt&&this._adjustOffsetFromHelper(f.cursorAt);f.containment&&this._setContainment();if(this._trigger("start",c)===false){this._clear();return false}this._cacheHelperProportions(); +b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(c,true);return true},_mouseDrag:function(c,f){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute");if(!f){f=this._uiHash();if(this._trigger("drag",c,f)===false){this._mouseUp({});return false}this.position=f.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";b.ui.ddmanager&&b.ui.ddmanager.drag(this,c);return false},_mouseStop:function(c){var f=false;if(b.ui.ddmanager&&!this.options.dropBehaviour)f=b.ui.ddmanager.drop(this,c);if(this.dropped){f=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!f||this.options.revert=="valid"&&f||this.options.revert===true||b.isFunction(this.options.revert)&&this.options.revert.call(this.element, +f)){var g=this;b(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){g._trigger("stop",c)!==false&&g._clear()})}else this._trigger("stop",c)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(c){var f=!this.options.handle||!b(this.options.handle,this.element).length?true:false;b(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +c.target)f=true});return f},_createHelper:function(c){var f=this.options;c=b.isFunction(f.helper)?b(f.helper.apply(this.element[0],[c])):f.helper=="clone"?this.element.clone():this.element;c.parents("body").length||c.appendTo(f.appendTo=="parent"?this.element[0].parentNode:f.appendTo);c[0]!=this.element[0]&&!/(fixed|absolute)/.test(c.css("position"))&&c.css("position","absolute");return c},_adjustOffsetFromHelper:function(c){if(typeof c=="string")c=c.split(" ");if(b.isArray(c))c={left:+c[0],top:+c[1]|| +0};if("left"in c)this.offset.click.left=c.left+this.margins.left;if("right"in c)this.offset.click.left=this.helperProportions.width-c.right+this.margins.left;if("top"in c)this.offset.click.top=c.top+this.margins.top;if("bottom"in c)this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0], +this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)c={top:0,left:0};return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var c=this.element.position();return{top:c.top- +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var c=this.options;if(c.containment== +"parent")c.containment=this.helper[0].parentNode;if(c.containment=="document"||c.containment=="window")this.containment=[(c.containment=="document"?0:b(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(c.containment=="document"?0:b(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(c.containment=="document"?0:b(window).scrollLeft())+b(c.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(c.containment=="document"? +0:b(window).scrollTop())+(b(c.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(c.containment)&&c.containment.constructor!=Array){var f=b(c.containment)[0];if(f){c=b(c.containment).offset();var g=b(f).css("overflow")!="hidden";this.containment=[c.left+(parseInt(b(f).css("borderLeftWidth"),10)||0)+(parseInt(b(f).css("paddingLeft"),10)||0)-this.margins.left,c.top+(parseInt(b(f).css("borderTopWidth"), +10)||0)+(parseInt(b(f).css("paddingTop"),10)||0)-this.margins.top,c.left+(g?Math.max(f.scrollWidth,f.offsetWidth):f.offsetWidth)-(parseInt(b(f).css("borderLeftWidth"),10)||0)-(parseInt(b(f).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,c.top+(g?Math.max(f.scrollHeight,f.offsetHeight):f.offsetHeight)-(parseInt(b(f).css("borderTopWidth"),10)||0)-(parseInt(b(f).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(c.containment.constructor== +Array)this.containment=c.containment},_convertPositionTo:function(c,f){if(!f)f=this.position;c=c=="absolute"?1:-1;var g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);return{top:f.top+this.offset.relative.top*c+this.offset.parent.top*c-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop(): +e?0:g.scrollTop())*c),left:f.left+this.offset.relative.left*c+this.offset.parent.left*c-(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())*c)}},_generatePosition:function(c){var f=this.options,g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName),a=c.pageX,d=c.pageY; +if(this.originalPosition){if(this.containment){if(c.pageX-this.offset.click.left<this.containment[0])a=this.containment[0]+this.offset.click.left;if(c.pageY-this.offset.click.top<this.containment[1])d=this.containment[1]+this.offset.click.top;if(c.pageX-this.offset.click.left>this.containment[2])a=this.containment[2]+this.offset.click.left;if(c.pageY-this.offset.click.top>this.containment[3])d=this.containment[3]+this.offset.click.top}if(f.grid){d=this.originalPageY+Math.round((d-this.originalPageY)/ +f.grid[1])*f.grid[1];d=this.containment?!(d-this.offset.click.top<this.containment[1]||d-this.offset.click.top>this.containment[3])?d:!(d-this.offset.click.top<this.containment[1])?d-f.grid[1]:d+f.grid[1]:d;a=this.originalPageX+Math.round((a-this.originalPageX)/f.grid[0])*f.grid[0];a=this.containment?!(a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2])?a:!(a-this.offset.click.left<this.containment[0])?a-f.grid[0]:a+f.grid[0]:a}}return{top:d-this.offset.click.top- +this.offset.relative.top-this.offset.parent.top+(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:g.scrollTop()),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(b.browser.safari&&b.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!= +this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(c,f,g){g=g||this._uiHash();b.ui.plugin.call(this,c,[f,g]);if(c=="drag")this.positionAbs=this._convertPositionTo("absolute");return b.Widget.prototype._trigger.call(this,c,f,g)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});b.extend(b.ui.draggable,{version:"1.8.7"}); +b.ui.plugin.add("draggable","connectToSortable",{start:function(c,f){var g=b(this).data("draggable"),e=g.options,a=b.extend({},f,{item:g.element});g.sortables=[];b(e.connectToSortable).each(function(){var d=b.data(this,"sortable");if(d&&!d.options.disabled){g.sortables.push({instance:d,shouldRevert:d.options.revert});d._refreshItems();d._trigger("activate",c,a)}})},stop:function(c,f){var g=b(this).data("draggable"),e=b.extend({},f,{item:g.element});b.each(g.sortables,function(){if(this.instance.isOver){this.instance.isOver= +0;g.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(c);this.instance.options.helper=this.instance.options._helper;g.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",c,e)}})},drag:function(c,f){var g=b(this).data("draggable"),e=this;b.each(g.sortables,function(){this.instance.positionAbs= +g.positionAbs;this.instance.helperProportions=g.helperProportions;this.instance.offset.click=g.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=b(e).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return f.helper[0]};c.target=this.instance.currentItem[0];this.instance._mouseCapture(c, +true);this.instance._mouseStart(c,true,true);this.instance.offset.click.top=g.offset.click.top;this.instance.offset.click.left=g.offset.click.left;this.instance.offset.parent.left-=g.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=g.offset.parent.top-this.instance.offset.parent.top;g._trigger("toSortable",c);g.dropped=this.instance.element;g.currentItem=g.element;this.instance.fromOutside=g}this.instance.currentItem&&this.instance._mouseDrag(c)}else if(this.instance.isOver){this.instance.isOver= +0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",c,this.instance._uiHash(this.instance));this.instance._mouseStop(c,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();g._trigger("fromSortable",c);g.dropped=false}})}});b.ui.plugin.add("draggable","cursor",{start:function(){var c=b("body"),f=b(this).data("draggable").options;if(c.css("cursor"))f._cursor= +c.css("cursor");c.css("cursor",f.cursor)},stop:function(){var c=b(this).data("draggable").options;c._cursor&&b("body").css("cursor",c._cursor)}});b.ui.plugin.add("draggable","iframeFix",{start:function(){var c=b(this).data("draggable").options;b(c.iframeFix===true?"iframe":c.iframeFix).each(function(){b('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(b(this).offset()).appendTo("body")})}, +stop:function(){b("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});b.ui.plugin.add("draggable","opacity",{start:function(c,f){c=b(f.helper);f=b(this).data("draggable").options;if(c.css("opacity"))f._opacity=c.css("opacity");c.css("opacity",f.opacity)},stop:function(c,f){c=b(this).data("draggable").options;c._opacity&&b(f.helper).css("opacity",c._opacity)}});b.ui.plugin.add("draggable","scroll",{start:function(){var c=b(this).data("draggable");if(c.scrollParent[0]!= +document&&c.scrollParent[0].tagName!="HTML")c.overflowOffset=c.scrollParent.offset()},drag:function(c){var f=b(this).data("draggable"),g=f.options,e=false;if(f.scrollParent[0]!=document&&f.scrollParent[0].tagName!="HTML"){if(!g.axis||g.axis!="x")if(f.overflowOffset.top+f.scrollParent[0].offsetHeight-c.pageY<g.scrollSensitivity)f.scrollParent[0].scrollTop=e=f.scrollParent[0].scrollTop+g.scrollSpeed;else if(c.pageY-f.overflowOffset.top<g.scrollSensitivity)f.scrollParent[0].scrollTop=e=f.scrollParent[0].scrollTop- +g.scrollSpeed;if(!g.axis||g.axis!="y")if(f.overflowOffset.left+f.scrollParent[0].offsetWidth-c.pageX<g.scrollSensitivity)f.scrollParent[0].scrollLeft=e=f.scrollParent[0].scrollLeft+g.scrollSpeed;else if(c.pageX-f.overflowOffset.left<g.scrollSensitivity)f.scrollParent[0].scrollLeft=e=f.scrollParent[0].scrollLeft-g.scrollSpeed}else{if(!g.axis||g.axis!="x")if(c.pageY-b(document).scrollTop()<g.scrollSensitivity)e=b(document).scrollTop(b(document).scrollTop()-g.scrollSpeed);else if(b(window).height()- +(c.pageY-b(document).scrollTop())<g.scrollSensitivity)e=b(document).scrollTop(b(document).scrollTop()+g.scrollSpeed);if(!g.axis||g.axis!="y")if(c.pageX-b(document).scrollLeft()<g.scrollSensitivity)e=b(document).scrollLeft(b(document).scrollLeft()-g.scrollSpeed);else if(b(window).width()-(c.pageX-b(document).scrollLeft())<g.scrollSensitivity)e=b(document).scrollLeft(b(document).scrollLeft()+g.scrollSpeed)}e!==false&&b.ui.ddmanager&&!g.dropBehaviour&&b.ui.ddmanager.prepareOffsets(f,c)}});b.ui.plugin.add("draggable", +"snap",{start:function(){var c=b(this).data("draggable"),f=c.options;c.snapElements=[];b(f.snap.constructor!=String?f.snap.items||":data(draggable)":f.snap).each(function(){var g=b(this),e=g.offset();this!=c.element[0]&&c.snapElements.push({item:this,width:g.outerWidth(),height:g.outerHeight(),top:e.top,left:e.left})})},drag:function(c,f){for(var g=b(this).data("draggable"),e=g.options,a=e.snapTolerance,d=f.offset.left,h=d+g.helperProportions.width,i=f.offset.top,j=i+g.helperProportions.height,n= +g.snapElements.length-1;n>=0;n--){var q=g.snapElements[n].left,l=q+g.snapElements[n].width,k=g.snapElements[n].top,m=k+g.snapElements[n].height;if(q-a<d&&d<l+a&&k-a<i&&i<m+a||q-a<d&&d<l+a&&k-a<j&&j<m+a||q-a<h&&h<l+a&&k-a<i&&i<m+a||q-a<h&&h<l+a&&k-a<j&&j<m+a){if(e.snapMode!="inner"){var o=Math.abs(k-j)<=a,p=Math.abs(m-i)<=a,s=Math.abs(q-h)<=a,r=Math.abs(l-d)<=a;if(o)f.position.top=g._convertPositionTo("relative",{top:k-g.helperProportions.height,left:0}).top-g.margins.top;if(p)f.position.top=g._convertPositionTo("relative", +{top:m,left:0}).top-g.margins.top;if(s)f.position.left=g._convertPositionTo("relative",{top:0,left:q-g.helperProportions.width}).left-g.margins.left;if(r)f.position.left=g._convertPositionTo("relative",{top:0,left:l}).left-g.margins.left}var u=o||p||s||r;if(e.snapMode!="outer"){o=Math.abs(k-i)<=a;p=Math.abs(m-j)<=a;s=Math.abs(q-d)<=a;r=Math.abs(l-h)<=a;if(o)f.position.top=g._convertPositionTo("relative",{top:k,left:0}).top-g.margins.top;if(p)f.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height, +left:0}).top-g.margins.top;if(s)f.position.left=g._convertPositionTo("relative",{top:0,left:q}).left-g.margins.left;if(r)f.position.left=g._convertPositionTo("relative",{top:0,left:l-g.helperProportions.width}).left-g.margins.left}if(!g.snapElements[n].snapping&&(o||p||s||r||u))g.options.snap.snap&&g.options.snap.snap.call(g.element,c,b.extend(g._uiHash(),{snapItem:g.snapElements[n].item}));g.snapElements[n].snapping=o||p||s||r||u}else{g.snapElements[n].snapping&&g.options.snap.release&&g.options.snap.release.call(g.element, +c,b.extend(g._uiHash(),{snapItem:g.snapElements[n].item}));g.snapElements[n].snapping=false}}}});b.ui.plugin.add("draggable","stack",{start:function(){var c=b(this).data("draggable").options;c=b.makeArray(b(c.stack)).sort(function(g,e){return(parseInt(b(g).css("zIndex"),10)||0)-(parseInt(b(e).css("zIndex"),10)||0)});if(c.length){var f=parseInt(c[0].style.zIndex)||0;b(c).each(function(g){this.style.zIndex=f+g});this[0].style.zIndex=f+c.length}}});b.ui.plugin.add("draggable","zIndex",{start:function(c, +f){c=b(f.helper);f=b(this).data("draggable").options;if(c.css("zIndex"))f._zIndex=c.css("zIndex");c.css("zIndex",f.zIndex)},stop:function(c,f){c=b(this).data("draggable").options;c._zIndex&&b(f.helper).css("zIndex",c._zIndex)}})})(jQuery); +(function(b){b.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var c=this.options,f=c.accept;this.isover=0;this.isout=1;this.accept=b.isFunction(f)?f:function(g){return g.is(f)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};b.ui.ddmanager.droppables[c.scope]=b.ui.ddmanager.droppables[c.scope]||[];b.ui.ddmanager.droppables[c.scope].push(this); +c.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var c=b.ui.ddmanager.droppables[this.options.scope],f=0;f<c.length;f++)c[f]==this&&c.splice(f,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(c,f){if(c=="accept")this.accept=b.isFunction(f)?f:function(g){return g.is(f)};b.Widget.prototype._setOption.apply(this,arguments)},_activate:function(c){var f=b.ui.ddmanager.current;this.options.activeClass&& +this.element.addClass(this.options.activeClass);f&&this._trigger("activate",c,this.ui(f))},_deactivate:function(c){var f=b.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);f&&this._trigger("deactivate",c,this.ui(f))},_over:function(c){var f=b.ui.ddmanager.current;if(!(!f||(f.currentItem||f.element)[0]==this.element[0]))if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); +this._trigger("over",c,this.ui(f))}},_out:function(c){var f=b.ui.ddmanager.current;if(!(!f||(f.currentItem||f.element)[0]==this.element[0]))if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",c,this.ui(f))}},_drop:function(c,f){var g=f||b.ui.ddmanager.current;if(!g||(g.currentItem||g.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var a= +b.data(this,"droppable");if(a.options.greedy&&!a.options.disabled&&a.options.scope==g.options.scope&&a.accept.call(a.element[0],g.currentItem||g.element)&&b.ui.intersect(g,b.extend(a,{offset:a.element.offset()}),a.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],g.currentItem||g.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", +c,this.ui(g));return this.element}return false},ui:function(c){return{draggable:c.currentItem||c.element,helper:c.helper,position:c.position,offset:c.positionAbs}}});b.extend(b.ui.droppable,{version:"1.8.7"});b.ui.intersect=function(c,f,g){if(!f.offset)return false;var e=(c.positionAbs||c.position.absolute).left,a=e+c.helperProportions.width,d=(c.positionAbs||c.position.absolute).top,h=d+c.helperProportions.height,i=f.offset.left,j=i+f.proportions.width,n=f.offset.top,q=n+f.proportions.height; +switch(g){case "fit":return i<=e&&a<=j&&n<=d&&h<=q;case "intersect":return i<e+c.helperProportions.width/2&&a-c.helperProportions.width/2<j&&n<d+c.helperProportions.height/2&&h-c.helperProportions.height/2<q;case "pointer":return b.ui.isOver((c.positionAbs||c.position.absolute).top+(c.clickOffset||c.offset.click).top,(c.positionAbs||c.position.absolute).left+(c.clickOffset||c.offset.click).left,n,i,f.proportions.height,f.proportions.width);case "touch":return(d>=n&&d<=q||h>=n&&h<=q||d<n&&h>q)&&(e>= +i&&e<=j||a>=i&&a<=j||e<i&&a>j);default:return false}};b.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(c,f){var g=b.ui.ddmanager.droppables[c.options.scope]||[],e=f?f.type:null,a=(c.currentItem||c.element).find(":data(droppable)").andSelf(),d=0;a:for(;d<g.length;d++)if(!(g[d].options.disabled||c&&!g[d].accept.call(g[d].element[0],c.currentItem||c.element))){for(var h=0;h<a.length;h++)if(a[h]==g[d].element[0]){g[d].proportions.height=0;continue a}g[d].visible=g[d].element.css("display")!= +"none";if(g[d].visible){g[d].offset=g[d].element.offset();g[d].proportions={width:g[d].element[0].offsetWidth,height:g[d].element[0].offsetHeight};e=="mousedown"&&g[d]._activate.call(g[d],f)}}},drop:function(c,f){var g=false;b.each(b.ui.ddmanager.droppables[c.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&b.ui.intersect(c,this,this.options.tolerance))g=g||this._drop.call(this,f);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],c.currentItem|| +c.element)){this.isout=1;this.isover=0;this._deactivate.call(this,f)}}});return g},drag:function(c,f){c.options.refreshPositions&&b.ui.ddmanager.prepareOffsets(c,f);b.each(b.ui.ddmanager.droppables[c.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var g=b.ui.intersect(c,this,this.options.tolerance);if(g=!g&&this.isover==1?"isout":g&&this.isover==0?"isover":null){var e;if(this.options.greedy){var a=this.element.parents(":data(droppable):eq(0)");if(a.length){e= +b.data(a[0],"droppable");e.greedyChild=g=="isover"?1:0}}if(e&&g=="isover"){e.isover=0;e.isout=1;e._out.call(e,f)}this[g]=1;this[g=="isout"?"isover":"isout"]=0;this[g=="isover"?"_over":"_out"].call(this,f);if(e&&g=="isout"){e.isout=0;e.isover=1;e._over.call(e,f)}}}})}}})(jQuery); +(function(b){b.widget("ui.resizable",b.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var g=this,e=this.options;this.element.addClass("ui-resizable");b.extend(this,{_aspectRatio:!!e.aspectRatio,aspectRatio:e.aspectRatio,originalElement:this.element, +_proportionallyResizeElements:[],_helper:e.helper||e.ghost||e.animate?e.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&b.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(b('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=e.handles||(!b(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var a=this.handles.split(",");this.handles={};for(var d=0;d<a.length;d++){var h=b.trim(a[d]),i=b('<div class="ui-resizable-handle '+("ui-resizable-"+h)+'"></div>');/sw|se|ne|nw/.test(h)&&i.css({zIndex:++e.zIndex});"se"==h&&i.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[h]=".ui-resizable-"+h;this.element.append(i)}}this._renderAxis=function(j){j=j||this.element;for(var n in this.handles){if(this.handles[n].constructor== +String)this.handles[n]=b(this.handles[n],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var q=b(this.handles[n],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(n)?q.outerHeight():q.outerWidth();q=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");j.css(q,l);this._proportionallyResize()}b(this.handles[n])}};this._renderAxis(this.element);this._handles=b(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!g.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);g.axis=j&&j[1]?j[1]:"se"}});if(e.autoHide){this._handles.hide();b(this.element).addClass("ui-resizable-autohide").hover(function(){b(this).removeClass("ui-resizable-autohide");g._handles.show()},function(){if(!g.resizing){b(this).addClass("ui-resizable-autohide");g._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var g=function(a){b(a).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; +if(this.elementIsWrapper){g(this.element);var e=this.element;e.after(this.originalElement.css({position:e.css("position"),width:e.outerWidth(),height:e.outerHeight(),top:e.css("top"),left:e.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);g(this.originalElement);return this},_mouseCapture:function(g){var e=false;for(var a in this.handles)if(b(this.handles[a])[0]==g.target)e=true;return!this.options.disabled&&e},_mouseStart:function(g){var e=this.options,a=this.element.position(), +d=this.element;this.resizing=true;this.documentScroll={top:b(document).scrollTop(),left:b(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:a.top,left:a.left});b.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();a=c(this.helper.css("left"));var h=c(this.helper.css("top"));if(e.containment){a+=b(e.containment).scrollLeft()||0;h+=b(e.containment).scrollTop()||0}this.offset= +this.helper.offset();this.position={left:a,top:h};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:a,top:h};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=typeof e.aspectRatio=="number"?e.aspectRatio: +this.originalSize.width/this.originalSize.height||1;e=b(".ui-resizable-"+this.axis).css("cursor");b("body").css("cursor",e=="auto"?this.axis+"-resize":e);d.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(g){var e=this.helper,a=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;a=d.apply(this,[g,g.pageX-a.left||0,g.pageY-a.top||0]);if(this._aspectRatio||g.shiftKey)a=this._updateRatio(a,g);a=this._respectSize(a,g);this._propagate("resize", +g);e.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(a);this._trigger("resize",g,this.ui());return false},_mouseStop:function(g){this.resizing=false;var e=this.options,a=this;if(this._helper){var d=this._proportionallyResizeElements,h=d.length&&/textarea/i.test(d[0].nodeName);d=h&&b.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height; +h={width:a.size.width-(h?0:a.sizeDiff.width),height:a.size.height-d};d=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var i=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;e.animate||this.element.css(b.extend(h,{top:i,left:d}));a.helper.height(a.size.height);a.helper.width(a.size.width);this._helper&&!e.animate&&this._proportionallyResize()}b("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop", +g);this._helper&&this.helper.remove();return false},_updateCache:function(g){this.offset=this.helper.offset();if(f(g.left))this.position.left=g.left;if(f(g.top))this.position.top=g.top;if(f(g.height))this.size.height=g.height;if(f(g.width))this.size.width=g.width},_updateRatio:function(g){var e=this.position,a=this.size,d=this.axis;if(g.height)g.width=a.height*this.aspectRatio;else if(g.width)g.height=a.width/this.aspectRatio;if(d=="sw"){g.left=e.left+(a.width-g.width);g.top=null}if(d=="nw"){g.top= +e.top+(a.height-g.height);g.left=e.left+(a.width-g.width)}return g},_respectSize:function(g){var e=this.options,a=this.axis,d=f(g.width)&&e.maxWidth&&e.maxWidth<g.width,h=f(g.height)&&e.maxHeight&&e.maxHeight<g.height,i=f(g.width)&&e.minWidth&&e.minWidth>g.width,j=f(g.height)&&e.minHeight&&e.minHeight>g.height;if(i)g.width=e.minWidth;if(j)g.height=e.minHeight;if(d)g.width=e.maxWidth;if(h)g.height=e.maxHeight;var n=this.originalPosition.left+this.originalSize.width,q=this.position.top+this.size.height, +l=/sw|nw|w/.test(a);a=/nw|ne|n/.test(a);if(i&&l)g.left=n-e.minWidth;if(d&&l)g.left=n-e.maxWidth;if(j&&a)g.top=q-e.minHeight;if(h&&a)g.top=q-e.maxHeight;if((e=!g.width&&!g.height)&&!g.left&&g.top)g.top=null;else if(e&&!g.top&&g.left)g.left=null;return g},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var g=this.helper||this.element,e=0;e<this._proportionallyResizeElements.length;e++){var a=this._proportionallyResizeElements[e];if(!this.borderDif){var d=[a.css("borderTopWidth"), +a.css("borderRightWidth"),a.css("borderBottomWidth"),a.css("borderLeftWidth")],h=[a.css("paddingTop"),a.css("paddingRight"),a.css("paddingBottom"),a.css("paddingLeft")];this.borderDif=b.map(d,function(i,j){i=parseInt(i,10)||0;j=parseInt(h[j],10)||0;return i+j})}b.browser.msie&&(b(g).is(":hidden")||b(g).parents(":hidden").length)||a.css({height:g.height()-this.borderDif[0]-this.borderDif[2]||0,width:g.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var g=this.options;this.elementOffset= +this.element.offset();if(this._helper){this.helper=this.helper||b('<div style="overflow:hidden;"></div>');var e=b.browser.msie&&b.browser.version<7,a=e?1:0;e=e?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+e,height:this.element.outerHeight()+e,position:"absolute",left:this.elementOffset.left-a+"px",top:this.elementOffset.top-a+"px",zIndex:++g.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(g,e){return{width:this.originalSize.width+ +e}},w:function(g,e){return{left:this.originalPosition.left+e,width:this.originalSize.width-e}},n:function(g,e,a){return{top:this.originalPosition.top+a,height:this.originalSize.height-a}},s:function(g,e,a){return{height:this.originalSize.height+a}},se:function(g,e,a){return b.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,e,a]))},sw:function(g,e,a){return b.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,e,a]))},ne:function(g,e,a){return b.extend(this._change.n.apply(this, +arguments),this._change.e.apply(this,[g,e,a]))},nw:function(g,e,a){return b.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,e,a]))}},_propagate:function(g,e){b.ui.plugin.call(this,g,[e,this.ui()]);g!="resize"&&this._trigger(g,e,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});b.extend(b.ui.resizable, +{version:"1.8.7"});b.ui.plugin.add("resizable","alsoResize",{start:function(){var g=b(this).data("resizable").options,e=function(a){b(a).each(function(){var d=b(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof g.alsoResize=="object"&&!g.alsoResize.parentNode)if(g.alsoResize.length){g.alsoResize=g.alsoResize[0];e(g.alsoResize)}else b.each(g.alsoResize, +function(a){e(a)});else e(g.alsoResize)},resize:function(g,e){var a=b(this).data("resizable");g=a.options;var d=a.originalSize,h=a.originalPosition,i={height:a.size.height-d.height||0,width:a.size.width-d.width||0,top:a.position.top-h.top||0,left:a.position.left-h.left||0},j=function(n,q){b(n).each(function(){var l=b(this),k=b(this).data("resizable-alsoresize"),m={},o=q&&q.length?q:l.parents(e.originalElement[0]).length?["width","height"]:["width","height","top","left"];b.each(o,function(p,s){if((p= +(k[s]||0)+(i[s]||0))&&p>=0)m[s]=p||null});if(b.browser.opera&&/relative/.test(l.css("position"))){a._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(m)})};typeof g.alsoResize=="object"&&!g.alsoResize.nodeType?b.each(g.alsoResize,function(n,q){j(n,q)}):j(g.alsoResize)},stop:function(){var g=b(this).data("resizable"),e=g.options,a=function(d){b(d).each(function(){var h=b(this);h.css({position:h.data("resizable-alsoresize").position})})};if(g._revertToRelativePosition){g._revertToRelativePosition= +false;typeof e.alsoResize=="object"&&!e.alsoResize.nodeType?b.each(e.alsoResize,function(d){a(d)}):a(e.alsoResize)}b(this).removeData("resizable-alsoresize")}});b.ui.plugin.add("resizable","animate",{stop:function(g){var e=b(this).data("resizable"),a=e.options,d=e._proportionallyResizeElements,h=d.length&&/textarea/i.test(d[0].nodeName),i=h&&b.ui.hasScroll(d[0],"left")?0:e.sizeDiff.height;h={width:e.size.width-(h?0:e.sizeDiff.width),height:e.size.height-i};i=parseInt(e.element.css("left"),10)+(e.position.left- +e.originalPosition.left)||null;var j=parseInt(e.element.css("top"),10)+(e.position.top-e.originalPosition.top)||null;e.element.animate(b.extend(h,j&&i?{top:j,left:i}:{}),{duration:a.animateDuration,easing:a.animateEasing,step:function(){var n={width:parseInt(e.element.css("width"),10),height:parseInt(e.element.css("height"),10),top:parseInt(e.element.css("top"),10),left:parseInt(e.element.css("left"),10)};d&&d.length&&b(d[0]).css({width:n.width,height:n.height});e._updateCache(n);e._propagate("resize", +g)}})}});b.ui.plugin.add("resizable","containment",{start:function(){var g=b(this).data("resizable"),e=g.element,a=g.options.containment;if(e=a instanceof b?a.get(0):/parent/.test(a)?e.parent().get(0):a){g.containerElement=b(e);if(/document/.test(a)||a==document){g.containerOffset={left:0,top:0};g.containerPosition={left:0,top:0};g.parentData={element:b(document),left:0,top:0,width:b(document).width(),height:b(document).height()||document.body.parentNode.scrollHeight}}else{var d=b(e),h=[];b(["Top", +"Right","Left","Bottom"]).each(function(n,q){h[n]=c(d.css("padding"+q))});g.containerOffset=d.offset();g.containerPosition=d.position();g.containerSize={height:d.innerHeight()-h[3],width:d.innerWidth()-h[1]};a=g.containerOffset;var i=g.containerSize.height,j=g.containerSize.width;j=b.ui.hasScroll(e,"left")?e.scrollWidth:j;i=b.ui.hasScroll(e)?e.scrollHeight:i;g.parentData={element:e,left:a.left,top:a.top,width:j,height:i}}}},resize:function(g){var e=b(this).data("resizable"),a=e.options,d=e.containerOffset, +h=e.position;g=e._aspectRatio||g.shiftKey;var i={top:0,left:0},j=e.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))i=d;if(h.left<(e._helper?d.left:0)){e.size.width+=e._helper?e.position.left-d.left:e.position.left-i.left;if(g)e.size.height=e.size.width/a.aspectRatio;e.position.left=a.helper?d.left:0}if(h.top<(e._helper?d.top:0)){e.size.height+=e._helper?e.position.top-d.top:e.position.top;if(g)e.size.width=e.size.height*a.aspectRatio;e.position.top=e._helper?d.top:0}e.offset.left= +e.parentData.left+e.position.left;e.offset.top=e.parentData.top+e.position.top;a=Math.abs((e._helper?e.offset.left-i.left:e.offset.left-i.left)+e.sizeDiff.width);d=Math.abs((e._helper?e.offset.top-i.top:e.offset.top-d.top)+e.sizeDiff.height);h=e.containerElement.get(0)==e.element.parent().get(0);i=/relative|absolute/.test(e.containerElement.css("position"));if(h&&i)a-=e.parentData.left;if(a+e.size.width>=e.parentData.width){e.size.width=e.parentData.width-a;if(g)e.size.height=e.size.width/e.aspectRatio}if(d+ +e.size.height>=e.parentData.height){e.size.height=e.parentData.height-d;if(g)e.size.width=e.size.height*e.aspectRatio}},stop:function(){var g=b(this).data("resizable"),e=g.options,a=g.containerOffset,d=g.containerPosition,h=g.containerElement,i=b(g.helper),j=i.offset(),n=i.outerWidth()-g.sizeDiff.width;i=i.outerHeight()-g.sizeDiff.height;g._helper&&!e.animate&&/relative/.test(h.css("position"))&&b(this).css({left:j.left-d.left-a.left,width:n,height:i});g._helper&&!e.animate&&/static/.test(h.css("position"))&& +b(this).css({left:j.left-d.left-a.left,width:n,height:i})}});b.ui.plugin.add("resizable","ghost",{start:function(){var g=b(this).data("resizable"),e=g.options,a=g.size;g.ghost=g.originalElement.clone();g.ghost.css({opacity:0.25,display:"block",position:"relative",height:a.height,width:a.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof e.ghost=="string"?e.ghost:"");g.ghost.appendTo(g.helper)},resize:function(){var g=b(this).data("resizable");g.ghost&&g.ghost.css({position:"relative", +height:g.size.height,width:g.size.width})},stop:function(){var g=b(this).data("resizable");g.ghost&&g.helper&&g.helper.get(0).removeChild(g.ghost.get(0))}});b.ui.plugin.add("resizable","grid",{resize:function(){var g=b(this).data("resizable"),e=g.options,a=g.size,d=g.originalSize,h=g.originalPosition,i=g.axis;e.grid=typeof e.grid=="number"?[e.grid,e.grid]:e.grid;var j=Math.round((a.width-d.width)/(e.grid[0]||1))*(e.grid[0]||1);e=Math.round((a.height-d.height)/(e.grid[1]||1))*(e.grid[1]||1);if(/^(se|s|e)$/.test(i)){g.size.width= +d.width+j;g.size.height=d.height+e}else if(/^(ne)$/.test(i)){g.size.width=d.width+j;g.size.height=d.height+e;g.position.top=h.top-e}else{if(/^(sw)$/.test(i)){g.size.width=d.width+j;g.size.height=d.height+e}else{g.size.width=d.width+j;g.size.height=d.height+e;g.position.top=h.top-e}g.position.left=h.left-j}}});var c=function(g){return parseInt(g,10)||0},f=function(g){return!isNaN(parseInt(g,10))}})(jQuery); +(function(b){b.widget("ui.selectable",b.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=b(c.options.filter,c.element[0]);f.each(function(){var g=b(this),e=g.offset();b.data(this,"selectable-item",{element:this,$element:g,left:e.left,top:e.top,right:e.left+g.outerWidth(),bottom:e.top+g.outerHeight(),startselected:false,selected:g.hasClass("ui-selected"), +selecting:g.hasClass("ui-selecting"),unselecting:g.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=b("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var g=this.options;this.selectees=b(g.filter,this.element[0]);this._trigger("start",c);b(g.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});g.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var e=b.data(this,"selectable-item");e.startselected=true;if(!c.metaKey){e.$element.removeClass("ui-selected");e.selected=false;e.$element.addClass("ui-unselecting");e.unselecting=true;f._trigger("unselecting", +c,{unselecting:e.element})}});b(c.target).parents().andSelf().each(function(){var e=b.data(this,"selectable-item");if(e){var a=!c.metaKey||!e.$element.hasClass("ui-selected");e.$element.removeClass(a?"ui-unselecting":"ui-selected").addClass(a?"ui-selecting":"ui-unselecting");e.unselecting=!a;e.selecting=a;(e.selected=a)?f._trigger("selecting",c,{selecting:e.element}):f._trigger("unselecting",c,{unselecting:e.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var g= +this.options,e=this.opos[0],a=this.opos[1],d=c.pageX,h=c.pageY;if(e>d){var i=d;d=e;e=i}if(a>h){i=h;h=a;a=i}this.helper.css({left:e,top:a,width:d-e,height:h-a});this.selectees.each(function(){var j=b.data(this,"selectable-item");if(!(!j||j.element==f.element[0])){var n=false;if(g.tolerance=="touch")n=!(j.left>d||j.right<e||j.top>h||j.bottom<a);else if(g.tolerance=="fit")n=j.left>e&&j.right<d&&j.top>a&&j.bottom<h;if(n){if(j.selected){j.$element.removeClass("ui-selected");j.selected=false}if(j.unselecting){j.$element.removeClass("ui-unselecting"); +j.unselecting=false}if(!j.selecting){j.$element.addClass("ui-selecting");j.selecting=true;f._trigger("selecting",c,{selecting:j.element})}}else{if(j.selecting)if(c.metaKey&&j.startselected){j.$element.removeClass("ui-selecting");j.selecting=false;j.$element.addClass("ui-selected");j.selected=true}else{j.$element.removeClass("ui-selecting");j.selecting=false;if(j.startselected){j.$element.addClass("ui-unselecting");j.unselecting=true}f._trigger("unselecting",c,{unselecting:j.element})}if(j.selected)if(!c.metaKey&& +!j.startselected){j.$element.removeClass("ui-selected");j.selected=false;j.$element.addClass("ui-unselecting");j.unselecting=true;f._trigger("unselecting",c,{unselecting:j.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;b(".ui-unselecting",this.element[0]).each(function(){var g=b.data(this,"selectable-item");g.$element.removeClass("ui-unselecting");g.unselecting=false;g.startselected=false;f._trigger("unselected",c,{unselected:g.element})});b(".ui-selecting",this.element[0]).each(function(){var g= +b.data(this,"selectable-item");g.$element.removeClass("ui-selecting").addClass("ui-selected");g.selecting=false;g.selected=true;g.startselected=true;f._trigger("selected",c,{selected:g.element})});this._trigger("stop",c);this.helper.remove();return false}});b.extend(b.ui.selectable,{version:"1.8.7"})})(jQuery); +(function(b){b.widget("ui.sortable",b.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var c=this.items.length-1;c>=0;c--)this.items[c].item.removeData("sortable-item");return this},_setOption:function(c,f){if(c==="disabled"){this.options[c]=f;this.widget()[f?"addClass":"removeClass"]("ui-sortable-disabled")}else b.Widget.prototype._setOption.apply(this, +arguments)},_mouseCapture:function(c,f){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(c);var g=null,e=this;b(c.target).parents().each(function(){if(b.data(this,"sortable-item")==e){g=b(this);return false}});if(b.data(c.target,"sortable-item")==e)g=b(c.target);if(!g)return false;if(this.options.handle&&!f){var a=false;b(this.options.handle,g).find("*").andSelf().each(function(){if(this==c.target)a=true});if(!a)return false}this.currentItem= +g;this._removeCurrentsFromItems();return true},_mouseStart:function(c,f,g){f=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(c);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");b.extend(this.offset, +{click:{left:c.pageX-this.offset.left,top:c.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(c);this.originalPageX=c.pageX;this.originalPageY=c.pageY;f.cursorAt&&this._adjustOffsetFromHelper(f.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();f.containment&&this._setContainment(); +if(f.cursor){if(b("body").css("cursor"))this._storedCursor=b("body").css("cursor");b("body").css("cursor",f.cursor)}if(f.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",f.opacity)}if(f.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",f.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start", +c,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!g)for(g=this.containers.length-1;g>=0;g--)this.containers[g]._trigger("activate",c,e._uiHash(this));if(b.ui.ddmanager)b.ui.ddmanager.current=this;b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(c);return true},_mouseDrag:function(c){this.position=this._generatePosition(c);this.positionAbs=this._convertPositionTo("absolute"); +if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var f=this.options,g=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-c.pageY<f.scrollSensitivity)this.scrollParent[0].scrollTop=g=this.scrollParent[0].scrollTop+f.scrollSpeed;else if(c.pageY-this.overflowOffset.top<f.scrollSensitivity)this.scrollParent[0].scrollTop=g=this.scrollParent[0].scrollTop-f.scrollSpeed;if(this.overflowOffset.left+ +this.scrollParent[0].offsetWidth-c.pageX<f.scrollSensitivity)this.scrollParent[0].scrollLeft=g=this.scrollParent[0].scrollLeft+f.scrollSpeed;else if(c.pageX-this.overflowOffset.left<f.scrollSensitivity)this.scrollParent[0].scrollLeft=g=this.scrollParent[0].scrollLeft-f.scrollSpeed}else{if(c.pageY-b(document).scrollTop()<f.scrollSensitivity)g=b(document).scrollTop(b(document).scrollTop()-f.scrollSpeed);else if(b(window).height()-(c.pageY-b(document).scrollTop())<f.scrollSensitivity)g=b(document).scrollTop(b(document).scrollTop()+ +f.scrollSpeed);if(c.pageX-b(document).scrollLeft()<f.scrollSensitivity)g=b(document).scrollLeft(b(document).scrollLeft()-f.scrollSpeed);else if(b(window).width()-(c.pageX-b(document).scrollLeft())<f.scrollSensitivity)g=b(document).scrollLeft(b(document).scrollLeft()+f.scrollSpeed)}g!==false&&b.ui.ddmanager&&!f.dropBehaviour&&b.ui.ddmanager.prepareOffsets(this,c)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+ +"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(f=this.items.length-1;f>=0;f--){g=this.items[f];var e=g.item[0],a=this._intersectsWithPointer(g);if(a)if(e!=this.currentItem[0]&&this.placeholder[a==1?"next":"prev"]()[0]!=e&&!b.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!b.ui.contains(this.element[0],e):true)){this.direction=a==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(g))this._rearrange(c, +g);else break;this._trigger("change",c,this._uiHash());break}}this._contactContainers(c);b.ui.ddmanager&&b.ui.ddmanager.drag(this,c);this._trigger("sort",c,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,f){if(c){b.ui.ddmanager&&!this.options.dropBehaviour&&b.ui.ddmanager.drop(this,c);if(this.options.revert){var g=this;f=g.placeholder.offset();g.reverting=true;b(this.helper).animate({left:f.left-this.offset.parent.left-g.margins.left+(this.offsetParent[0]== +document.body?0:this.offsetParent[0].scrollLeft),top:f.top-this.offset.parent.top-g.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){g._clear(c)})}else this._clear(c,f);return false}},cancel:function(){var c=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var f=this.containers.length-1;f>=0;f--){this.containers[f]._trigger("deactivate", +null,c._uiHash(this));if(this.containers[f].containerCache.over){this.containers[f]._trigger("out",null,c._uiHash(this));this.containers[f].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();b.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?b(this.domPosition.prev).after(this.currentItem): +b(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(c){var f=this._getItemsAsjQuery(c&&c.connected),g=[];c=c||{};b(f).each(function(){var e=(b(c.item||this).attr(c.attribute||"id")||"").match(c.expression||/(.+)[-=_](.+)/);if(e)g.push((c.key||e[1]+"[]")+"="+(c.key&&c.expression?e[1]:e[2]))});!g.length&&c.key&&g.push(c.key+"=");return g.join("&")},toArray:function(c){var f=this._getItemsAsjQuery(c&&c.connected),g=[];c=c||{};f.each(function(){g.push(b(c.item||this).attr(c.attribute|| +"id")||"")});return g},_intersectsWith:function(c){var f=this.positionAbs.left,g=f+this.helperProportions.width,e=this.positionAbs.top,a=e+this.helperProportions.height,d=c.left,h=d+c.width,i=c.top,j=i+c.height,n=this.offset.click.top,q=this.offset.click.left;n=e+n>i&&e+n<j&&f+q>d&&f+q<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>c[this.floating?"width":"height"]?n:d<f+ +this.helperProportions.width/2&&g-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&a-this.helperProportions.height/2<j},_intersectsWithPointer:function(c){var f=b.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,c.top,c.height);c=b.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,c.left,c.width);f=f&&c;c=this._getDragVerticalDirection();var g=this._getDragHorizontalDirection();if(!f)return false;return this.floating?g&&g=="right"||c=="down"?2:1:c&&(c=="down"? +2:1)},_intersectsWithSides:function(c){var f=b.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,c.top+c.height/2,c.height);c=b.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,c.left+c.width/2,c.width);var g=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&c||e=="left"&&!c:g&&(g=="down"&&f||g=="up"&&!f)},_getDragVerticalDirection:function(){var c=this.positionAbs.top-this.lastPositionAbs.top;return c!=0&&(c>0?"down":"up")}, +_getDragHorizontalDirection:function(){var c=this.positionAbs.left-this.lastPositionAbs.left;return c!=0&&(c>0?"right":"left")},refresh:function(c){this._refreshItems(c);this.refreshPositions();return this},_connectWith:function(){var c=this.options;return c.connectWith.constructor==String?[c.connectWith]:c.connectWith},_getItemsAsjQuery:function(c){var f=[],g=[],e=this._connectWith();if(e&&c)for(c=e.length-1;c>=0;c--)for(var a=b(e[c]),d=a.length-1;d>=0;d--){var h=b.data(a[d],"sortable");if(h&&h!= +this&&!h.options.disabled)g.push([b.isFunction(h.options.items)?h.options.items.call(h.element):b(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}g.push([b.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):b(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(c=g.length-1;c>=0;c--)g[c][0].each(function(){f.push(this)});return b(f)},_removeCurrentsFromItems:function(){for(var c= +this.currentItem.find(":data(sortable-item)"),f=0;f<this.items.length;f++)for(var g=0;g<c.length;g++)c[g]==this.items[f].item[0]&&this.items.splice(f,1)},_refreshItems:function(c){this.items=[];this.containers=[this];var f=this.items,g=[[b.isFunction(this.options.items)?this.options.items.call(this.element[0],c,{item:this.currentItem}):b(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var a=e.length-1;a>=0;a--)for(var d=b(e[a]),h=d.length-1;h>=0;h--){var i=b.data(d[h],"sortable"); +if(i&&i!=this&&!i.options.disabled){g.push([b.isFunction(i.options.items)?i.options.items.call(i.element[0],c,{item:this.currentItem}):b(i.options.items,i.element),i]);this.containers.push(i)}}for(a=g.length-1;a>=0;a--){c=g[a][1];e=g[a][0];h=0;for(d=e.length;h<d;h++){i=b(e[h]);i.data("sortable-item",c);f.push({item:i,instance:c,width:0,height:0,left:0,top:0})}}},refreshPositions:function(c){if(this.offsetParent&&this.helper)this.offset.parent=this._getParentOffset();for(var f=this.items.length-1;f>= +0;f--){var g=this.items[f],e=this.options.toleranceElement?b(this.options.toleranceElement,g.item):g.item;if(!c){g.width=e.outerWidth();g.height=e.outerHeight()}e=e.offset();g.left=e.left;g.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(f=this.containers.length-1;f>=0;f--){e=this.containers[f].element.offset();this.containers[f].containerCache.left=e.left;this.containers[f].containerCache.top=e.top;this.containers[f].containerCache.width= +this.containers[f].element.outerWidth();this.containers[f].containerCache.height=this.containers[f].element.outerHeight()}return this},_createPlaceholder:function(c){var f=c||this,g=f.options;if(!g.placeholder||g.placeholder.constructor==String){var e=g.placeholder;g.placeholder={element:function(){var a=b(document.createElement(f.currentItem[0].nodeName)).addClass(e||f.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)a.style.visibility="hidden";return a}, +update:function(a,d){if(!(e&&!g.forcePlaceholderSize)){d.height()||d.height(f.currentItem.innerHeight()-parseInt(f.currentItem.css("paddingTop")||0,10)-parseInt(f.currentItem.css("paddingBottom")||0,10));d.width()||d.width(f.currentItem.innerWidth()-parseInt(f.currentItem.css("paddingLeft")||0,10)-parseInt(f.currentItem.css("paddingRight")||0,10))}}}}f.placeholder=b(g.placeholder.element.call(f.element,f.currentItem));f.currentItem.after(f.placeholder);g.placeholder.update(f,f.placeholder)},_contactContainers:function(c){for(var f= +null,g=null,e=this.containers.length-1;e>=0;e--)if(!b.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(f&&b.ui.contains(this.containers[e].element[0],f.element[0]))){f=this.containers[e];g=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",c,this._uiHash(this));this.containers[e].containerCache.over=0}if(f)if(this.containers.length===1){this.containers[g]._trigger("over",c,this._uiHash(this)); +this.containers[g].containerCache.over=1}else if(this.currentContainer!=this.containers[g]){f=1E4;e=null;for(var a=this.positionAbs[this.containers[g].floating?"left":"top"],d=this.items.length-1;d>=0;d--)if(b.ui.contains(this.containers[g].element[0],this.items[d].item[0])){var h=this.items[d][this.containers[g].floating?"left":"top"];if(Math.abs(h-a)<f){f=Math.abs(h-a);e=this.items[d]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[g];e?this._rearrange(c,e,null,true):this._rearrange(c, +null,this.containers[g].element,true);this._trigger("change",c,this._uiHash());this.containers[g]._trigger("change",c,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[g]._trigger("over",c,this._uiHash(this));this.containers[g].containerCache.over=1}}},_createHelper:function(c){var f=this.options;c=b.isFunction(f.helper)?b(f.helper.apply(this.element[0],[c,this.currentItem])):f.helper=="clone"?this.currentItem.clone():this.currentItem;c.parents("body").length|| +b(f.appendTo!="parent"?f.appendTo:this.currentItem[0].parentNode)[0].appendChild(c[0]);if(c[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(c[0].style.width==""||f.forceHelperSize)c.width(this.currentItem.width());if(c[0].style.height==""||f.forceHelperSize)c.height(this.currentItem.height());return c},_adjustOffsetFromHelper:function(c){if(typeof c== +"string")c=c.split(" ");if(b.isArray(c))c={left:+c[0],top:+c[1]||0};if("left"in c)this.offset.click.left=c.left+this.margins.left;if("right"in c)this.offset.click.left=this.helperProportions.width-c.right+this.margins.left;if("top"in c)this.offset.click.top=c.top+this.margins.top;if("bottom"in c)this.offset.click.top=this.helperProportions.height-c.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var c=this.offsetParent.offset();if(this.cssPosition== +"absolute"&&this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0])){c.left+=this.scrollParent.scrollLeft();c.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&b.browser.msie)c={top:0,left:0};return{top:c.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:c.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition== +"relative"){var c=this.currentItem.position();return{top:c.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:c.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}}, +_setContainment:function(){var c=this.options;if(c.containment=="parent")c.containment=this.helper[0].parentNode;if(c.containment=="document"||c.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,b(c.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(b(c.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height- +this.margins.top];if(!/^(document|window|parent)$/.test(c.containment)){var f=b(c.containment)[0];c=b(c.containment).offset();var g=b(f).css("overflow")!="hidden";this.containment=[c.left+(parseInt(b(f).css("borderLeftWidth"),10)||0)+(parseInt(b(f).css("paddingLeft"),10)||0)-this.margins.left,c.top+(parseInt(b(f).css("borderTopWidth"),10)||0)+(parseInt(b(f).css("paddingTop"),10)||0)-this.margins.top,c.left+(g?Math.max(f.scrollWidth,f.offsetWidth):f.offsetWidth)-(parseInt(b(f).css("borderLeftWidth"), +10)||0)-(parseInt(b(f).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,c.top+(g?Math.max(f.scrollHeight,f.offsetHeight):f.offsetHeight)-(parseInt(b(f).css("borderTopWidth"),10)||0)-(parseInt(b(f).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(c,f){if(!f)f=this.position;c=c=="absolute"?1:-1;var g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))? +this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);return{top:f.top+this.offset.relative.top*c+this.offset.parent.top*c-(b.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:g.scrollTop())*c),left:f.left+this.offset.relative.left*c+this.offset.parent.left*c-(b.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())*c)}},_generatePosition:function(c){var f= +this.options,g=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&b.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(g[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var a=c.pageX,d=c.pageY;if(this.originalPosition){if(this.containment){if(c.pageX-this.offset.click.left<this.containment[0])a=this.containment[0]+ +this.offset.click.left;if(c.pageY-this.offset.click.top<this.containment[1])d=this.containment[1]+this.offset.click.top;if(c.pageX-this.offset.click.left>this.containment[2])a=this.containment[2]+this.offset.click.left;if(c.pageY-this.offset.click.top>this.containment[3])d=this.containment[3]+this.offset.click.top}if(f.grid){d=this.originalPageY+Math.round((d-this.originalPageY)/f.grid[1])*f.grid[1];d=this.containment?!(d-this.offset.click.top<this.containment[1]||d-this.offset.click.top>this.containment[3])? +d:!(d-this.offset.click.top<this.containment[1])?d-f.grid[1]:d+f.grid[1]:d;a=this.originalPageX+Math.round((a-this.originalPageX)/f.grid[0])*f.grid[0];a=this.containment?!(a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2])?a:!(a-this.offset.click.left<this.containment[0])?a-f.grid[0]:a+f.grid[0]:a}}return{top:d-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(b.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop(): +e?0:g.scrollTop()),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(b.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:g.scrollLeft())}},_rearrange:function(c,f,g,e){g?g[0].appendChild(this.placeholder[0]):f.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?f.item[0]:f.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var a=this,d=this.counter;window.setTimeout(function(){d== +a.counter&&a.refreshPositions(!e)},0)},_clear:function(c,f){this.reverting=false;var g=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!f&&g.push(function(a){this._trigger("receive", +a,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!f)g.push(function(a){this._trigger("update",a,this._uiHash())});if(!b.ui.contains(this.element[0],this.currentItem[0])){f||g.push(function(a){this._trigger("remove",a,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(b.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!f){g.push(function(a){return function(d){a._trigger("receive", +d,this._uiHash(this))}}.call(this,this.containers[e]));g.push(function(a){return function(d){a._trigger("update",d,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){f||g.push(function(a){return function(d){a._trigger("deactivate",d,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){g.push(function(a){return function(d){a._trigger("out",d,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over= +0}}this._storedCursor&&b("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!f){this._trigger("beforeStop",c,this._uiHash());for(e=0;e<g.length;e++)g[e].call(this,c);this._trigger("stop",c,this._uiHash())}return false}f||this._trigger("beforeStop",c,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]); +this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!f){for(e=0;e<g.length;e++)g[e].call(this,c);this._trigger("stop",c,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){b.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(c){var f=c||this;return{helper:f.helper,placeholder:f.placeholder||b([]),position:f.position,originalPosition:f.originalPosition,offset:f.positionAbs,item:f.currentItem,sender:c?c.element:null}}}); +b.extend(b.ui.sortable,{version:"1.8.7"})})(jQuery); +jQuery.effects||function(b,c){function f(l){var k;if(l&&l.constructor==Array&&l.length==3)return l;if(k=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(l))return[parseInt(k[1],10),parseInt(k[2],10),parseInt(k[3],10)];if(k=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(l))return[parseFloat(k[1])*2.55,parseFloat(k[2])*2.55,parseFloat(k[3])*2.55];if(k=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(l))return[parseInt(k[1],16), +parseInt(k[2],16),parseInt(k[3],16)];if(k=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(l))return[parseInt(k[1]+k[1],16),parseInt(k[2]+k[2],16),parseInt(k[3]+k[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(l))return j.transparent;return j[b.trim(l).toLowerCase()]}function g(l,k){var m;do{m=b.curCSS(l,k);if(m!=""&&m!="transparent"||b.nodeName(l,"body"))break;k="backgroundColor"}while(l=l.parentNode);return f(m)}function e(){var l=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +k={},m,o;if(l&&l.length&&l[0]&&l[l[0]])for(var p=l.length;p--;){m=l[p];if(typeof l[m]=="string"){o=m.replace(/\-(\w)/g,function(s,r){return r.toUpperCase()});k[o]=l[m]}}else for(m in l)if(typeof l[m]==="string")k[m]=l[m];return k}function a(l){var k,m;for(k in l){m=l[k];if(m==null||b.isFunction(m)||k in q||/scrollbar/.test(k)||!/color/i.test(k)&&isNaN(parseFloat(m)))delete l[k]}return l}function d(l,k){var m={_:0},o;for(o in k)if(l[o]!=k[o])m[o]=k[o];return m}function h(l,k,m,o){if(typeof l=="object"){o= +k;m=null;k=l;l=k.effect}if(b.isFunction(k)){o=k;m=null;k={}}if(typeof k=="number"||b.fx.speeds[k]){o=m;m=k;k={}}if(b.isFunction(m)){o=m;m=null}k=k||{};m=m||k.duration;m=b.fx.off?0:typeof m=="number"?m:m in b.fx.speeds?b.fx.speeds[m]:b.fx.speeds._default;o=o||k.complete;return[l,k,m,o]}function i(l){if(!l||typeof l==="number"||b.fx.speeds[l])return true;if(typeof l==="string"&&!b.effects[l])return true;return false}b.effects={};b.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(l,k){b.fx.step[k]=function(m){if(!m.colorInit){m.start=g(m.elem,k);m.end=f(m.end);m.colorInit=true}m.elem.style[k]="rgb("+Math.max(Math.min(parseInt(m.pos*(m.end[0]-m.start[0])+m.start[0],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[1]-m.start[1])+m.start[1],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[2]-m.start[2])+m.start[2],10),255),0)+")"}});var j={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},n=["add","remove","toggle"],q={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};b.effects.animateClass=function(l,k,m, +o){if(b.isFunction(m)){o=m;m=null}return this.each(function(){b.queue(this,"fx",function(){var p=b(this),s=p.attr("style")||" ",r=a(e.call(this)),u,v=p.attr("className");b.each(n,function(w,y){l[y]&&p[y+"Class"](l[y])});u=a(e.call(this));p.attr("className",v);p.animate(d(r,u),k,m,function(){b.each(n,function(w,y){l[y]&&p[y+"Class"](l[y])});if(typeof p.attr("style")=="object"){p.attr("style").cssText="";p.attr("style").cssText=s}else p.attr("style",s);o&&o.apply(this,arguments)});r=b.queue(this);u= +r.splice(r.length-1,1)[0];r.splice(1,0,u);b.dequeue(this)})})};b.fn.extend({_addClass:b.fn.addClass,addClass:function(l,k,m,o){return k?b.effects.animateClass.apply(this,[{add:l},k,m,o]):this._addClass(l)},_removeClass:b.fn.removeClass,removeClass:function(l,k,m,o){return k?b.effects.animateClass.apply(this,[{remove:l},k,m,o]):this._removeClass(l)},_toggleClass:b.fn.toggleClass,toggleClass:function(l,k,m,o,p){return typeof k=="boolean"||k===c?m?b.effects.animateClass.apply(this,[k?{add:l}:{remove:l}, +m,o,p]):this._toggleClass(l,k):b.effects.animateClass.apply(this,[{toggle:l},k,m,o])},switchClass:function(l,k,m,o,p){return b.effects.animateClass.apply(this,[{add:k,remove:l},m,o,p])}});b.extend(b.effects,{version:"1.8.7",save:function(l,k){for(var m=0;m<k.length;m++)k[m]!==null&&l.data("ec.storage."+k[m],l[0].style[k[m]])},restore:function(l,k){for(var m=0;m<k.length;m++)k[m]!==null&&l.css(k[m],l.data("ec.storage."+k[m]))},setMode:function(l,k){if(k=="toggle")k=l.is(":hidden")?"show":"hide"; +return k},getBaseline:function(l,k){var m;switch(l[0]){case "top":m=0;break;case "middle":m=0.5;break;case "bottom":m=1;break;default:m=l[0]/k.height}switch(l[1]){case "left":l=0;break;case "center":l=0.5;break;case "right":l=1;break;default:l=l[1]/k.width}return{x:l,y:m}},createWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent();var k={width:l.outerWidth(true),height:l.outerHeight(true),"float":l.css("float")},m=b("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%", +background:"transparent",border:"none",margin:0,padding:0});l.wrap(m);m=l.parent();if(l.css("position")=="static"){m.css({position:"relative"});l.css({position:"relative"})}else{b.extend(k,{position:l.css("position"),zIndex:l.css("z-index")});b.each(["top","left","bottom","right"],function(o,p){k[p]=l.css(p);if(isNaN(parseInt(k[p],10)))k[p]="auto"});l.css({position:"relative",top:0,left:0})}return m.css(k).show()},removeWrapper:function(l){if(l.parent().is(".ui-effects-wrapper"))return l.parent().replaceWith(l); +return l},setTransition:function(l,k,m,o){o=o||{};b.each(k,function(p,s){unit=l.cssUnit(s);if(unit[0]>0)o[s]=unit[0]*m+unit[1]});return o}});b.fn.extend({effect:function(l){var k=h.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var o=b.effects[l];if(b.fx.off||!o)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)});return o.call(this,m)},_show:b.fn.show,show:function(l){if(i(l))return this._show.apply(this,arguments); +else{var k=h.apply(this,arguments);k[1].mode="show";return this.effect.apply(this,k)}},_hide:b.fn.hide,hide:function(l){if(i(l))return this._hide.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:b.fn.toggle,toggle:function(l){if(i(l)||typeof l==="boolean"||b.isFunction(l))return this.__toggle.apply(this,arguments);else{var k=h.apply(this,arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(l){var k=this.css(l), +m=[];b.each(["em","px","%","pt"],function(o,p){if(k.indexOf(p)>0)m=[parseFloat(k),p]});return m}});b.easing.jswing=b.easing.swing;b.extend(b.easing,{def:"easeOutQuad",swing:function(l,k,m,o,p){return b.easing[b.easing.def](l,k,m,o,p)},easeInQuad:function(l,k,m,o,p){return o*(k/=p)*k+m},easeOutQuad:function(l,k,m,o,p){return-o*(k/=p)*(k-2)+m},easeInOutQuad:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k+m;return-o/2*(--k*(k-2)-1)+m},easeInCubic:function(l,k,m,o,p){return o*(k/=p)*k*k+m},easeOutCubic:function(l, +k,m,o,p){return o*((k=k/p-1)*k*k+1)+m},easeInOutCubic:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k+m;return o/2*((k-=2)*k*k+2)+m},easeInQuart:function(l,k,m,o,p){return o*(k/=p)*k*k*k+m},easeOutQuart:function(l,k,m,o,p){return-o*((k=k/p-1)*k*k*k-1)+m},easeInOutQuart:function(l,k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k*k+m;return-o/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(l,k,m,o,p){return o*(k/=p)*k*k*k*k+m},easeOutQuint:function(l,k,m,o,p){return o*((k=k/p-1)*k*k*k*k+1)+m},easeInOutQuint:function(l, +k,m,o,p){if((k/=p/2)<1)return o/2*k*k*k*k*k+m;return o/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(l,k,m,o,p){return-o*Math.cos(k/p*(Math.PI/2))+o+m},easeOutSine:function(l,k,m,o,p){return o*Math.sin(k/p*(Math.PI/2))+m},easeInOutSine:function(l,k,m,o,p){return-o/2*(Math.cos(Math.PI*k/p)-1)+m},easeInExpo:function(l,k,m,o,p){return k==0?m:o*Math.pow(2,10*(k/p-1))+m},easeOutExpo:function(l,k,m,o,p){return k==p?m+o:o*(-Math.pow(2,-10*k/p)+1)+m},easeInOutExpo:function(l,k,m,o,p){if(k==0)return m;if(k== +p)return m+o;if((k/=p/2)<1)return o/2*Math.pow(2,10*(k-1))+m;return o/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(l,k,m,o,p){return-o*(Math.sqrt(1-(k/=p)*k)-1)+m},easeOutCirc:function(l,k,m,o,p){return o*Math.sqrt(1-(k=k/p-1)*k)+m},easeInOutCirc:function(l,k,m,o,p){if((k/=p/2)<1)return-o/2*(Math.sqrt(1-k*k)-1)+m;return o/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p)==1)return m+o;s||(s=p*0.3);if(r<Math.abs(o)){r=o;l=s/4}else l= +s/(2*Math.PI)*Math.asin(o/r);return-(r*Math.pow(2,10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s))+m},easeOutElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p)==1)return m+o;s||(s=p*0.3);if(r<Math.abs(o)){r=o;l=s/4}else l=s/(2*Math.PI)*Math.asin(o/r);return r*Math.pow(2,-10*k)*Math.sin((k*p-l)*2*Math.PI/s)+o+m},easeInOutElastic:function(l,k,m,o,p){l=1.70158;var s=0,r=o;if(k==0)return m;if((k/=p/2)==2)return m+o;s||(s=p*0.3*1.5);if(r<Math.abs(o)){r=o;l=s/4}else l=s/(2*Math.PI)*Math.asin(o/ +r);if(k<1)return-0.5*r*Math.pow(2,10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s)+m;return r*Math.pow(2,-10*(k-=1))*Math.sin((k*p-l)*2*Math.PI/s)*0.5+o+m},easeInBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;return o*(k/=p)*k*((s+1)*k-s)+m},easeOutBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;return o*((k=k/p-1)*k*((s+1)*k+s)+1)+m},easeInOutBack:function(l,k,m,o,p,s){if(s==c)s=1.70158;if((k/=p/2)<1)return o/2*k*k*(((s*=1.525)+1)*k-s)+m;return o/2*((k-=2)*k*(((s*=1.525)+1)*k+s)+2)+m},easeInBounce:function(l, +k,m,o,p){return o-b.easing.easeOutBounce(l,p-k,0,o,p)+m},easeOutBounce:function(l,k,m,o,p){return(k/=p)<1/2.75?o*7.5625*k*k+m:k<2/2.75?o*(7.5625*(k-=1.5/2.75)*k+0.75)+m:k<2.5/2.75?o*(7.5625*(k-=2.25/2.75)*k+0.9375)+m:o*(7.5625*(k-=2.625/2.75)*k+0.984375)+m},easeInOutBounce:function(l,k,m,o,p){if(k<p/2)return b.easing.easeInBounce(l,k*2,0,o,p)*0.5+m;return b.easing.easeOutBounce(l,k*2-p,0,o,p)*0.5+o*0.5+m}})}(jQuery); +(function(b){b.effects.blind=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"vertical";b.effects.save(f,g);f.show();var d=b.effects.createWrapper(f).css({overflow:"hidden"}),h=a=="vertical"?"height":"width";a=a=="vertical"?d.height():d.width();e=="show"&&d.css(h,0);var i={};i[h]=e=="show"?a:0;d.animate(i,c.duration,c.options.easing,function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f); +c.callback&&c.callback.apply(f[0],arguments);f.dequeue()})})}})(jQuery); +(function(b){b.effects.bounce=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"effect"),a=c.options.direction||"up",d=c.options.distance||20,h=c.options.times||5,i=c.duration||250;/show|hide/.test(e)&&g.push("opacity");b.effects.save(f,g);f.show();b.effects.createWrapper(f);var j=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";d=c.options.distance||(j=="top"?f.outerHeight({margin:true})/3:f.outerWidth({margin:true})/ +3);if(e=="show")f.css("opacity",0).css(j,a=="pos"?-d:d);if(e=="hide")d/=h*2;e!="hide"&&h--;if(e=="show"){var n={opacity:1};n[j]=(a=="pos"?"+=":"-=")+d;f.animate(n,i/2,c.options.easing);d/=2;h--}for(n=0;n<h;n++){var q={},l={};q[j]=(a=="pos"?"-=":"+=")+d;l[j]=(a=="pos"?"+=":"-=")+d;f.animate(q,i/2,c.options.easing).animate(l,i/2,c.options.easing);d=e=="hide"?d*2:d/2}if(e=="hide"){n={opacity:0};n[j]=(a=="pos"?"-=":"+=")+d;f.animate(n,i/2,c.options.easing,function(){f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f); +c.callback&&c.callback.apply(this,arguments)})}else{q={};l={};q[j]=(a=="pos"?"-=":"+=")+d;l[j]=(a=="pos"?"+=":"-=")+d;f.animate(q,i/2,c.options.easing).animate(l,i/2,c.options.easing,function(){b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments)})}f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery); +(function(b){b.effects.clip=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","height","width"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"vertical";b.effects.save(f,g);f.show();var d=b.effects.createWrapper(f).css({overflow:"hidden"});d=f[0].tagName=="IMG"?d:f;var h={size:a=="vertical"?"height":"width",position:a=="vertical"?"top":"left"};a=a=="vertical"?d.height():d.width();if(e=="show"){d.css(h.size,0);d.css(h.position,a/2)}var i={};i[h.size]= +e=="show"?a:0;i[h.position]=e=="show"?0:a/2;d.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.drop=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","opacity"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.direction||"left";b.effects.save(f,g);f.show();b.effects.createWrapper(f);var d=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";var h=c.options.distance||(d=="top"?f.outerHeight({margin:true})/2:f.outerWidth({margin:true})/2);if(e=="show")f.css("opacity",0).css(d,a=="pos"?-h:h);var i={opacity:e=="show"?1: +0};i[d]=(e=="show"?a=="pos"?"+=":"-=":a=="pos"?"-=":"+=")+h;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.explode=function(c){return this.queue(function(){var f=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3,g=c.options.pieces?Math.round(Math.sqrt(c.options.pieces)):3;c.options.mode=c.options.mode=="toggle"?b(this).is(":visible")?"hide":"show":c.options.mode;var e=b(this).show().css("visibility","hidden"),a=e.offset();a.top-=parseInt(e.css("marginTop"),10)||0;a.left-=parseInt(e.css("marginLeft"),10)||0;for(var d=e.outerWidth(true),h=e.outerHeight(true),i=0;i<f;i++)for(var j= +0;j<g;j++)e.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-j*(d/g),top:-i*(h/f)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:d/g,height:h/f,left:a.left+j*(d/g)+(c.options.mode=="show"?(j-Math.floor(g/2))*(d/g):0),top:a.top+i*(h/f)+(c.options.mode=="show"?(i-Math.floor(f/2))*(h/f):0),opacity:c.options.mode=="show"?0:1}).animate({left:a.left+j*(d/g)+(c.options.mode=="show"?0:(j-Math.floor(g/2))*(d/g)),top:a.top+ +i*(h/f)+(c.options.mode=="show"?0:(i-Math.floor(f/2))*(h/f)),opacity:c.options.mode=="show"?1:0},c.duration||500);setTimeout(function(){c.options.mode=="show"?e.css({visibility:"visible"}):e.css({visibility:"visible"}).hide();c.callback&&c.callback.apply(e[0]);e.dequeue();b("div.ui-effects-explode").remove()},c.duration||500)})}})(jQuery); +(function(b){b.effects.fade=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"hide");f.animate({opacity:g},{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.fold=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"hide"),a=c.options.size||15,d=!!c.options.horizFirst,h=c.duration?c.duration/2:b.fx.speeds._default/2;b.effects.save(f,g);f.show();var i=b.effects.createWrapper(f).css({overflow:"hidden"}),j=e=="show"!=d,n=j?["width","height"]:["height","width"];j=j?[i.width(),i.height()]:[i.height(),i.width()];var q=/([0-9]+)%/.exec(a);if(q)a=parseInt(q[1],10)/100* +j[e=="hide"?0:1];if(e=="show")i.css(d?{height:0,width:a}:{height:a,width:0});d={};q={};d[n[0]]=e=="show"?j[0]:a;q[n[1]]=e=="show"?j[1]:0;i.animate(d,h,c.options.easing).animate(q,h,c.options.easing,function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(f[0],arguments);f.dequeue()})})}})(jQuery); +(function(b){b.effects.highlight=function(c){return this.queue(function(){var f=b(this),g=["backgroundImage","backgroundColor","opacity"],e=b.effects.setMode(f,c.options.mode||"show"),a={backgroundColor:f.css("backgroundColor")};if(e=="hide")a.opacity=0;b.effects.save(f,g);f.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(a,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);e=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.pulsate=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"show");times=(c.options.times||5)*2-1;duration=c.duration?c.duration/2:b.fx.speeds._default/2;isVisible=f.is(":visible");animateTo=0;if(!isVisible){f.css("opacity",0).show();animateTo=1}if(g=="hide"&&isVisible||g=="show"&&!isVisible)times--;for(g=0;g<times;g++){f.animate({opacity:animateTo},duration,c.options.easing);animateTo=(animateTo+1)%2}f.animate({opacity:animateTo},duration, +c.options.easing,function(){animateTo==0&&f.hide();c.callback&&c.callback.apply(this,arguments)});f.queue("fx",function(){f.dequeue()}).dequeue()})}})(jQuery); +(function(b){b.effects.puff=function(c){return this.queue(function(){var f=b(this),g=b.effects.setMode(f,c.options.mode||"hide"),e=parseInt(c.options.percent,10)||150,a=e/100,d={height:f.height(),width:f.width()};b.extend(c.options,{fade:true,mode:g,percent:g=="hide"?e:100,from:g=="hide"?d:{height:d.height*a,width:d.width*a}});f.effect("scale",c.options,c.duration,c.callback);f.dequeue()})};b.effects.scale=function(c){return this.queue(function(){var f=b(this),g=b.extend(true,{},c.options),e=b.effects.setMode(f, +c.options.mode||"effect"),a=parseInt(c.options.percent,10)||(parseInt(c.options.percent,10)==0?0:e=="hide"?0:100),d=c.options.direction||"both",h=c.options.origin;if(e!="effect"){g.origin=h||["middle","center"];g.restore=true}h={height:f.height(),width:f.width()};f.from=c.options.from||(e=="show"?{height:0,width:0}:h);a={y:d!="horizontal"?a/100:1,x:d!="vertical"?a/100:1};f.to={height:h.height*a.y,width:h.width*a.x};if(c.options.fade){if(e=="show"){f.from.opacity=0;f.to.opacity=1}if(e=="hide"){f.from.opacity= +1;f.to.opacity=0}}g.from=f.from;g.to=f.to;g.mode=e;f.effect("size",g,c.duration,c.callback);f.dequeue()})};b.effects.size=function(c){return this.queue(function(){var f=b(this),g=["position","top","left","width","height","overflow","opacity"],e=["position","top","left","overflow","opacity"],a=["width","height","overflow"],d=["fontSize"],h=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],i=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],j=b.effects.setMode(f, +c.options.mode||"effect"),n=c.options.restore||false,q=c.options.scale||"both",l=c.options.origin,k={height:f.height(),width:f.width()};f.from=c.options.from||k;f.to=c.options.to||k;if(l){l=b.effects.getBaseline(l,k);f.from.top=(k.height-f.from.height)*l.y;f.from.left=(k.width-f.from.width)*l.x;f.to.top=(k.height-f.to.height)*l.y;f.to.left=(k.width-f.to.width)*l.x}var m={from:{y:f.from.height/k.height,x:f.from.width/k.width},to:{y:f.to.height/k.height,x:f.to.width/k.width}};if(q=="box"||q=="both"){if(m.from.y!= +m.to.y){g=g.concat(h);f.from=b.effects.setTransition(f,h,m.from.y,f.from);f.to=b.effects.setTransition(f,h,m.to.y,f.to)}if(m.from.x!=m.to.x){g=g.concat(i);f.from=b.effects.setTransition(f,i,m.from.x,f.from);f.to=b.effects.setTransition(f,i,m.to.x,f.to)}}if(q=="content"||q=="both")if(m.from.y!=m.to.y){g=g.concat(d);f.from=b.effects.setTransition(f,d,m.from.y,f.from);f.to=b.effects.setTransition(f,d,m.to.y,f.to)}b.effects.save(f,n?g:e);f.show();b.effects.createWrapper(f);f.css("overflow","hidden").css(f.from); +if(q=="content"||q=="both"){h=h.concat(["marginTop","marginBottom"]).concat(d);i=i.concat(["marginLeft","marginRight"]);a=g.concat(h).concat(i);f.find("*[width]").each(function(){child=b(this);n&&b.effects.save(child,a);var o={height:child.height(),width:child.width()};child.from={height:o.height*m.from.y,width:o.width*m.from.x};child.to={height:o.height*m.to.y,width:o.width*m.to.x};if(m.from.y!=m.to.y){child.from=b.effects.setTransition(child,h,m.from.y,child.from);child.to=b.effects.setTransition(child, +h,m.to.y,child.to)}if(m.from.x!=m.to.x){child.from=b.effects.setTransition(child,i,m.from.x,child.from);child.to=b.effects.setTransition(child,i,m.to.x,child.to)}child.css(child.from);child.animate(child.to,c.duration,c.options.easing,function(){n&&b.effects.restore(child,a)})})}f.animate(f.to,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){f.to.opacity===0&&f.css("opacity",f.from.opacity);j=="hide"&&f.hide();b.effects.restore(f,n?g:e);b.effects.removeWrapper(f);c.callback&& +c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.shake=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"];b.effects.setMode(f,c.options.mode||"effect");var e=c.options.direction||"left",a=c.options.distance||20,d=c.options.times||3,h=c.duration||c.options.duration||140;b.effects.save(f,g);f.show();b.effects.createWrapper(f);var i=e=="up"||e=="down"?"top":"left",j=e=="up"||e=="left"?"pos":"neg";e={};var n={},q={};e[i]=(j=="pos"?"-=":"+=")+a;n[i]=(j=="pos"?"+=":"-=")+a*2;q[i]=(j=="pos"?"-=":"+=")+ +a*2;f.animate(e,h,c.options.easing);for(a=1;a<d;a++)f.animate(n,h,c.options.easing).animate(q,h,c.options.easing);f.animate(n,h,c.options.easing).animate(e,h/2,c.options.easing,function(){b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments)});f.queue("fx",function(){f.dequeue()});f.dequeue()})}})(jQuery); +(function(b){b.effects.slide=function(c){return this.queue(function(){var f=b(this),g=["position","top","left"],e=b.effects.setMode(f,c.options.mode||"show"),a=c.options.direction||"left";b.effects.save(f,g);f.show();b.effects.createWrapper(f).css({overflow:"hidden"});var d=a=="up"||a=="down"?"top":"left";a=a=="up"||a=="left"?"pos":"neg";var h=c.options.distance||(d=="top"?f.outerHeight({margin:true}):f.outerWidth({margin:true}));if(e=="show")f.css(d,a=="pos"?isNaN(h)?"-"+h:-h:h);var i={};i[d]=(e== +"show"?a=="pos"?"+=":"-=":a=="pos"?"-=":"+=")+h;f.animate(i,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){e=="hide"&&f.hide();b.effects.restore(f,g);b.effects.removeWrapper(f);c.callback&&c.callback.apply(this,arguments);f.dequeue()}})})}})(jQuery); +(function(b){b.effects.transfer=function(c){return this.queue(function(){var f=b(this),g=b(c.options.to),e=g.offset();g={top:e.top,left:e.left,height:g.innerHeight(),width:g.innerWidth()};e=f.offset();var a=b('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(c.options.className).css({top:e.top,left:e.left,height:f.innerHeight(),width:f.innerWidth(),position:"absolute"}).animate(g,c.duration,c.options.easing,function(){a.remove();c.callback&&c.callback.apply(f[0],arguments); +f.dequeue()})})}})(jQuery); +(function(b){b.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var c=this,f=c.options;c.running=0;c.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");c.headers= +c.element.find(f.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){f.disabled||b(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){f.disabled||b(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){f.disabled||b(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){f.disabled||b(this).removeClass("ui-state-focus")});c.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(f.navigation){var g=c.element.find("a").filter(f.navigationFilter).eq(0);if(g.length){var e=g.closest(".ui-accordion-header");c.active=e.length?e:g.closest(".ui-accordion-content").prev()}}c.active=c._findActive(c.active||f.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");c.active.next().addClass("ui-accordion-content-active");c._createIcons();c.resize();c.element.attr("role","tablist");c.headers.attr("role","tab").bind("keydown.accordion", +function(a){return c._keydown(a)}).next().attr("role","tabpanel");c.headers.not(c.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();c.active.length?c.active.attr({"aria-expanded":"true",tabIndex:0}):c.headers.eq(0).attr("tabIndex",0);b.browser.safari||c.headers.find("a").attr("tabIndex",-1);f.event&&c.headers.bind(f.event.split(" ").join(".accordion ")+".accordion",function(a){c._clickHandler.call(c,a,this);a.preventDefault()})},_createIcons:function(){var c=this.options;if(c.icons){b("<span></span>").addClass("ui-icon "+ +c.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(c.icons.header).toggleClass(c.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var f=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(c.autoHeight||c.fillHeight)f.css("height","");return b.Widget.prototype.destroy.call(this)},_setOption:function(c,f){b.Widget.prototype._setOption.apply(this,arguments);c=="active"&&this.activate(f);if(c=="icons"){this._destroyIcons(); +f&&this._createIcons()}if(c=="disabled")this.headers.add(this.headers.next())[f?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(c){if(!(this.options.disabled||c.altKey||c.ctrlKey)){var f=b.ui.keyCode,g=this.headers.length,e=this.headers.index(c.target),a=false;switch(c.keyCode){case f.RIGHT:case f.DOWN:a=this.headers[(e+1)%g];break;case f.LEFT:case f.UP:a=this.headers[(e-1+g)%g];break;case f.SPACE:case f.ENTER:this._clickHandler({target:c.target},c.target); +c.preventDefault()}if(a){b(c.target).attr("tabIndex",-1);b(a).attr("tabIndex",0);a.focus();return false}return true}},resize:function(){var c=this.options,f;if(c.fillSpace){if(b.browser.msie){var g=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}f=this.element.parent().height();b.browser.msie&&this.element.parent().css("overflow",g);this.headers.each(function(){f-=b(this).outerHeight(true)});this.headers.next().each(function(){b(this).height(Math.max(0,f-b(this).innerHeight()+ +b(this).height()))}).css("overflow","auto")}else if(c.autoHeight){f=0;this.headers.next().each(function(){f=Math.max(f,b(this).height("").height())}).height(f)}return this},activate:function(c){this.options.active=c;c=this._findActive(c)[0];this._clickHandler({target:c},c);return this},_findActive:function(c){return c?typeof c==="number"?this.headers.filter(":eq("+c+")"):this.headers.not(this.headers.not(c)):c===false?b([]):this.headers.filter(":eq(0)")},_clickHandler:function(c,f){var g=this.options; +if(!g.disabled)if(c.target){c=b(c.currentTarget||f);f=c[0]===this.active[0];g.active=g.collapsible&&f?false:this.headers.index(c);if(!(this.running||!g.collapsible&&f)){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(g.icons.headerSelected).addClass(g.icons.header);if(!f){c.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(g.icons.header).addClass(g.icons.headerSelected); +c.next().addClass("ui-accordion-content-active")}d=c.next();e=this.active.next();a={options:g,newHeader:f&&g.collapsible?b([]):c,oldHeader:this.active,newContent:f&&g.collapsible?b([]):d,oldContent:e};g=this.headers.index(this.active[0])>this.headers.index(c[0]);this.active=f?b([]):c;this._toggle(d,e,a,f,g)}}else if(g.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(g.icons.headerSelected).addClass(g.icons.header); +this.active.next().addClass("ui-accordion-content-active");var e=this.active.next(),a={options:g,newHeader:b([]),oldHeader:g.active,newContent:b([]),oldContent:e},d=this.active=b([]);this._toggle(d,e,a)}},_toggle:function(c,f,g,e,a){var d=this,h=d.options;d.toShow=c;d.toHide=f;d.data=g;var i=function(){if(d)return d._completed.apply(d,arguments)};d._trigger("changestart",null,d.data);d.running=f.size()===0?c.size():f.size();if(h.animated){g={};g=h.collapsible&&e?{toShow:b([]),toHide:f,complete:i, +down:a,autoHeight:h.autoHeight||h.fillSpace}:{toShow:c,toHide:f,complete:i,down:a,autoHeight:h.autoHeight||h.fillSpace};if(!h.proxied)h.proxied=h.animated;if(!h.proxiedDuration)h.proxiedDuration=h.duration;h.animated=b.isFunction(h.proxied)?h.proxied(g):h.proxied;h.duration=b.isFunction(h.proxiedDuration)?h.proxiedDuration(g):h.proxiedDuration;e=b.ui.accordion.animations;var j=h.duration,n=h.animated;if(n&&!e[n]&&!b.easing[n])n="slide";e[n]||(e[n]=function(q){this.slide(q,{easing:n,duration:j||700})}); +e[n](g)}else{if(h.collapsible&&e)c.toggle();else{f.hide();c.show()}i(true)}f.prev().attr({"aria-expanded":"false",tabIndex:-1}).blur();c.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(c){this.running=c?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");this._trigger("change",null,this.data)}}});b.extend(b.ui.accordion,{version:"1.8.7",animations:{slide:function(c, +f){c=b.extend({easing:"swing",duration:300},c,f);if(c.toHide.size())if(c.toShow.size()){var g=c.toShow.css("overflow"),e=0,a={},d={},h;f=c.toShow;h=f[0].style.width;f.width(parseInt(f.parent().width(),10)-parseInt(f.css("paddingLeft"),10)-parseInt(f.css("paddingRight"),10)-(parseInt(f.css("borderLeftWidth"),10)||0)-(parseInt(f.css("borderRightWidth"),10)||0));b.each(["height","paddingTop","paddingBottom"],function(i,j){d[j]="hide";i=(""+b.css(c.toShow[0],j)).match(/^([\d+-.]+)(.*)$/);a[j]={value:i[1], +unit:i[2]||"px"}});c.toShow.css({height:0,overflow:"hidden"}).show();c.toHide.filter(":hidden").each(c.complete).end().filter(":visible").animate(d,{step:function(i,j){if(j.prop=="height")e=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);c.toShow[0].style[j.prop]=e*a[j.prop].value+a[j.prop].unit},duration:c.duration,easing:c.easing,complete:function(){c.autoHeight||c.toShow.css("height","");c.toShow.css({width:h,overflow:g});c.complete()}})}else c.toHide.animate({height:"hide",paddingTop:"hide", +paddingBottom:"hide"},c);else c.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},c)},bounceslide:function(c){this.slide(c,{easing:c.down?"easeOutBounce":"swing",duration:c.down?1E3:200})}}})})(jQuery); +(function(b){b.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},_create:function(){var c=this,f=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(e){if(!(c.options.disabled||c.element.attr("readonly"))){g=false;var a=b.ui.keyCode;switch(e.keyCode){case a.PAGE_UP:c._move("previousPage", +e);break;case a.PAGE_DOWN:c._move("nextPage",e);break;case a.UP:c._move("previous",e);e.preventDefault();break;case a.DOWN:c._move("next",e);e.preventDefault();break;case a.ENTER:case a.NUMPAD_ENTER:if(c.menu.active){g=true;e.preventDefault()}case a.TAB:if(!c.menu.active)return;c.menu.select(e);break;case a.ESCAPE:c.element.val(c.term);c.close(e);break;default:clearTimeout(c.searching);c.searching=setTimeout(function(){if(c.term!=c.element.val()){c.selectedItem=null;c.search(null,e)}},c.options.delay); +break}}}).bind("keypress.autocomplete",function(e){if(g){g=false;e.preventDefault()}}).bind("focus.autocomplete",function(){if(!c.options.disabled){c.selectedItem=null;c.previous=c.element.val()}}).bind("blur.autocomplete",function(e){if(!c.options.disabled){clearTimeout(c.searching);c.closing=setTimeout(function(){c.close(e);c._change(e)},150)}});this._initSource();this.response=function(){return c._response.apply(c,arguments)};this.menu=b("<ul></ul>").addClass("ui-autocomplete").appendTo(b(this.options.appendTo|| +"body",f)[0]).mousedown(function(e){var a=c.menu.element[0];b(e.target).closest(".ui-menu-item").length||setTimeout(function(){b(document).one("mousedown",function(d){d.target!==c.element[0]&&d.target!==a&&!b.ui.contains(a,d.target)&&c.close()})},1);setTimeout(function(){clearTimeout(c.closing)},13)}).menu({focus:function(e,a){a=a.item.data("item.autocomplete");false!==c._trigger("focus",e,{item:a})&&/^key/.test(e.originalEvent.type)&&c.element.val(a.value)},selected:function(e,a){var d=a.item.data("item.autocomplete"), +h=c.previous;if(c.element[0]!==f.activeElement){c.element.focus();c.previous=h;setTimeout(function(){c.previous=h;c.selectedItem=d},1)}false!==c._trigger("select",e,{item:d})&&c.element.val(d.value);c.term=c.element.val();c.close(e);c.selectedItem=d},blur:function(){c.menu.element.is(":visible")&&c.element.val()!==c.term&&c.element.val(c.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");b.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"); +this.menu.element.remove();b.Widget.prototype.destroy.call(this)},_setOption:function(c,f){b.Widget.prototype._setOption.apply(this,arguments);c==="source"&&this._initSource();if(c==="appendTo")this.menu.element.appendTo(b(f||"body",this.element[0].ownerDocument)[0])},_initSource:function(){var c=this,f,g;if(b.isArray(this.options.source)){f=this.options.source;this.source=function(e,a){a(b.ui.autocomplete.filter(f,e.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source= +function(e,a){c.xhr&&c.xhr.abort();c.xhr=b.ajax({url:g,data:e,dataType:"json",success:function(d,h,i){i===c.xhr&&a(d);c.xhr=null},error:function(d){d===c.xhr&&a([]);c.xhr=null}})}}else this.source=this.options.source},search:function(c,f){c=c!=null?c:this.element.val();this.term=this.element.val();if(c.length<this.options.minLength)return this.close(f);clearTimeout(this.closing);if(this._trigger("search",f)!==false)return this._search(c)},_search:function(c){this.element.addClass("ui-autocomplete-loading"); +this.source({term:c},this.response)},_response:function(c){if(c&&c.length){c=this._normalize(c);this._suggest(c);this._trigger("open")}else this.close();this.element.removeClass("ui-autocomplete-loading")},close:function(c){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",c)}},_change:function(c){this.previous!==this.element.val()&&this._trigger("change",c,{item:this.selectedItem})},_normalize:function(c){if(c.length&& +c[0].label&&c[0].value)return c;return b.map(c,function(f){if(typeof f==="string")return{label:f,value:f};return b.extend({label:f.label||f.value,value:f.value||f.label},f)})},_suggest:function(c){var f=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(f,c);this.menu.deactivate();this.menu.refresh();f.show();this._resizeMenu();f.position(b.extend({of:this.element},this.options.position))},_resizeMenu:function(){var c=this.menu.element;c.outerWidth(Math.max(c.width("").outerWidth(), +this.element.outerWidth()))},_renderMenu:function(c,f){var g=this;b.each(f,function(e,a){g._renderItem(c,a)})},_renderItem:function(c,f){return b("<li></li>").data("item.autocomplete",f).append(b("<a></a>").text(f.label)).appendTo(c)},_move:function(c,f){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(c)||this.menu.last()&&/^next/.test(c)){this.element.val(this.term);this.menu.deactivate()}else this.menu[c](f);else this.search(null,f)},widget:function(){return this.menu.element}}); +b.extend(b.ui.autocomplete,{escapeRegex:function(c){return c.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(c,f){var g=new RegExp(b.ui.autocomplete.escapeRegex(f),"i");return b.grep(c,function(e){return g.test(e.label||e.value||e)})}})})(jQuery); +(function(b){b.widget("ui.menu",{_create:function(){var c=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(f){if(b(f.target).closest(".ui-menu-item a").length){f.preventDefault();c.select(f)}});this.refresh()},refresh:function(){var c=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(f){c.activate(f,b(this).parent())}).mouseleave(function(){c.deactivate()})},activate:function(c,f){this.deactivate();if(this.hasScroll()){var g=f.offset().top-this.element.offset().top,e=this.element.attr("scrollTop"),a=this.element.height();if(g<0)this.element.attr("scrollTop",e+g);else g>=a&&this.element.attr("scrollTop",e+g-a+f.height())}this.active=f.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",c,{item:f})}, +deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(c){this.move("next",".ui-menu-item:first",c)},previous:function(c){this.move("prev",".ui-menu-item:last",c)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(c,f,g){if(this.active){c=this.active[c+"All"](".ui-menu-item").eq(0); +c.length?this.activate(g,c):this.activate(g,this.element.children(f))}else this.activate(g,this.element.children(f))},nextPage:function(c){if(this.hasScroll())if(!this.active||this.last())this.activate(c,this.element.children(".ui-menu-item:first"));else{var f=this.active.offset().top,g=this.element.height(),e=this.element.children(".ui-menu-item").filter(function(){var a=b(this).offset().top-f-g+b(this).height();return a<10&&a>-10});e.length||(e=this.element.children(".ui-menu-item:last"));this.activate(c, +e)}else this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(c){if(this.hasScroll())if(!this.active||this.first())this.activate(c,this.element.children(".ui-menu-item:last"));else{var f=this.active.offset().top,g=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var e=b(this).offset().top-f+g-b(this).height();return e<10&&e>-10});result.length||(result=this.element.children(".ui-menu-item:first")); +this.activate(c,result)}else this.activate(c,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(c){this._trigger("selected",c,{item:this.active})}})})(jQuery); +(function(b){var c,f=function(e){b(":ui-button",e.target.form).each(function(){var a=b(this).data("button");setTimeout(function(){a.refresh()},1)})},g=function(e){var a=e.name,d=e.form,h=b([]);if(a)h=d?b(d).find("[name='"+a+"']"):b("[name='"+a+"']",e.ownerDocument).filter(function(){return!this.form});return h};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button", +f);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var e=this,a=this.options,d=this.type==="checkbox"||this.type==="radio",h="ui-state-hover"+(!d?" ui-state-active":"");if(a.label===null)a.label=this.buttonElement.html();if(this.element.is(":disabled"))a.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button", +function(){if(!a.disabled){b(this).addClass("ui-state-hover");this===c&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){a.disabled||b(this).removeClass(h)}).bind("focus.button",function(){b(this).addClass("ui-state-focus")}).bind("blur.button",function(){b(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){e.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(a.disabled)return false;b(this).toggleClass("ui-state-active"); +e.buttonElement.attr("aria-pressed",e.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(a.disabled)return false;b(this).addClass("ui-state-active");e.buttonElement.attr("aria-pressed",true);var i=e.element[0];g(i).not(i).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(a.disabled)return false;b(this).addClass("ui-state-active"); +c=this;b(document).one("mouseup",function(){c=null})}).bind("mouseup.button",function(){if(a.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(i){if(a.disabled)return false;if(i.keyCode==b.ui.keyCode.SPACE||i.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(i){i.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled", +a.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var e=this.element.is(":checked");e&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",e)}else this.buttonElement= +this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle|| +this.buttonElement.removeAttr("title");b.Widget.prototype.destroy.call(this)},_setOption:function(e,a){b.Widget.prototype._setOption.apply(this,arguments);if(e==="disabled")a?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var e=this.element.is(":disabled");e!==this.options.disabled&&this._setOption("disabled",e);if(this.type==="radio")g(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed", +true):b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var e=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), +a=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(e.empty()).text(),d=this.options.icons,h=d.primary&&d.secondary;if(d.primary||d.secondary){e.addClass("ui-button-text-icon"+(h?"s":d.primary?"-primary":"-secondary"));d.primary&&e.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&e.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.addClass(h?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary"); +this.hasTitle||e.attr("title",a)}}else e.addClass("ui-button-text-only")}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(e,a){e==="disabled"&&this.buttons.button("option",e,a);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()}, +destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");b.Widget.prototype.destroy.call(this)}})})(jQuery); +(function(b,c){function f(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};b.extend(this._defaults,this.regional[""]);this.dpDiv=b('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function g(a,d){b.extend(a,d);for(var h in d)if(d[h]== +null||d[h]==c)a[h]=d[h];return a}b.extend(b.ui,{datepicker:{version:"1.8.7"}});var e=(new Date).getTime();b.extend(f.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){g(this._defaults,a||{});return this},_attachDatepicker:function(a,d){var h=null;for(var i in this._defaults){var j=a.getAttribute("date:"+i);if(j){h=h||{};try{h[i]=eval(j)}catch(n){h[i]=j}}}i=a.nodeName.toLowerCase(); +j=i=="div"||i=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var q=this._newInst(b(a),j);q.settings=b.extend({},d||{},h||{});if(i=="input")this._connectDatepicker(a,q);else j&&this._inlineDatepicker(a,q)},_newInst:function(a,d){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:d,dpDiv:!d?this.dpDiv:b('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}}, +_connectDatepicker:function(a,d){var h=b(a);d.append=b([]);d.trigger=b([]);if(!h.hasClass(this.markerClassName)){this._attachments(h,d);h.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(i,j,n){d.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(d,j)});this._autoSize(d);b.data(a,"datepicker",d)}},_attachments:function(a,d){var h=this._get(d,"appendText"),i=this._get(d,"isRTL");d.append&& +d.append.remove();if(h){d.append=b('<span class="'+this._appendClass+'">'+h+"</span>");a[i?"before":"after"](d.append)}a.unbind("focus",this._showDatepicker);d.trigger&&d.trigger.remove();h=this._get(d,"showOn");if(h=="focus"||h=="both")a.focus(this._showDatepicker);if(h=="button"||h=="both"){h=this._get(d,"buttonText");var j=this._get(d,"buttonImage");d.trigger=b(this._get(d,"buttonImageOnly")?b("<img/>").addClass(this._triggerClass).attr({src:j,alt:h,title:h}):b('<button type="button"></button>').addClass(this._triggerClass).html(j== +""?h:b("<img/>").attr({src:j,alt:h,title:h})));a[i?"before":"after"](d.trigger);d.trigger.click(function(){b.datepicker._datepickerShowing&&b.datepicker._lastInput==a[0]?b.datepicker._hideDatepicker():b.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var d=new Date(2009,11,20),h=this._get(a,"dateFormat");if(h.match(/[DM]/)){var i=function(j){for(var n=0,q=0,l=0;l<j.length;l++)if(j[l].length>n){n=j[l].length;q=l}return q};d.setMonth(i(this._get(a, +h.match(/MM/)?"monthNames":"monthNamesShort")));d.setDate(i(this._get(a,h.match(/DD/)?"dayNames":"dayNamesShort"))+20-d.getDay())}a.input.attr("size",this._formatDate(a,d).length)}},_inlineDatepicker:function(a,d){var h=b(a);if(!h.hasClass(this.markerClassName)){h.addClass(this.markerClassName).append(d.dpDiv).bind("setData.datepicker",function(i,j,n){d.settings[j]=n}).bind("getData.datepicker",function(i,j){return this._get(d,j)});b.data(a,"datepicker",d);this._setDate(d,this._getDefaultDate(d), +true);this._updateDatepicker(d);this._updateAlternate(d);d.dpDiv.show()}},_dialogDatepicker:function(a,d,h,i,j){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=b('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);b("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};b.data(this._dialogInput[0],"datepicker",a)}g(a.settings,i||{}); +d=d&&d.constructor==Date?this._formatDate(a,d):d;this._dialogInput.val(d);this._pos=j?j.length?j:[j.pageX,j.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=h;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); +this._showDatepicker(this._dialogInput[0]);b.blockUI&&b.blockUI(this.dpDiv);b.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();b.removeData(a,"datepicker");if(i=="input"){h.append.remove();h.trigger.remove();d.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", +this._doKeyUp)}else if(i=="div"||i=="span")d.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=false;h.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(i=="div"||i=="span")d.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs, +function(j){return j==a?null:j})}},_disableDatepicker:function(a){var d=b(a),h=b.data(a,"datepicker");if(d.hasClass(this.markerClassName)){var i=a.nodeName.toLowerCase();if(i=="input"){a.disabled=true;h.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(i=="div"||i=="span")d.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=b.map(this._disabledInputs,function(j){return j==a?null: +j});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var d=0;d<this._disabledInputs.length;d++)if(this._disabledInputs[d]==a)return true;return false},_getInst:function(a){try{return b.data(a,"datepicker")}catch(d){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,d,h){var i=this._getInst(a);if(arguments.length==2&&typeof d=="string")return d=="defaults"?b.extend({},b.datepicker._defaults):i?d=="all"?b.extend({}, +i.settings):this._get(i,d):null;var j=d||{};if(typeof d=="string"){j={};j[d]=h}if(i){this._curInst==i&&this._hideDatepicker();var n=this._getDateDatepicker(a,true);g(i.settings,j);this._attachments(b(a),i);this._autoSize(i);this._setDateDatepicker(a,n);this._updateDatepicker(i)}},_changeDatepicker:function(a,d,h){this._optionDatepicker(a,d,h)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,d){if(a=this._getInst(a)){this._setDate(a,d); +this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,d){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,d);return a?this._getDate(a):null},_doKeyDown:function(a){var d=b.datepicker._getInst(a.target),h=true,i=d.dpDiv.is(".ui-datepicker-rtl");d._keyEvent=true;if(b.datepicker._datepickerShowing)switch(a.keyCode){case 9:b.datepicker._hideDatepicker();h=false;break;case 13:h=b("td."+b.datepicker._dayOverClass+":not(."+b.datepicker._currentClass+")",d.dpDiv);h[0]? +b.datepicker._selectDay(a.target,d.selectedMonth,d.selectedYear,h[0]):b.datepicker._hideDatepicker();return false;case 27:b.datepicker._hideDatepicker();break;case 33:b.datepicker._adjustDate(a.target,a.ctrlKey?-b.datepicker._get(d,"stepBigMonths"):-b.datepicker._get(d,"stepMonths"),"M");break;case 34:b.datepicker._adjustDate(a.target,a.ctrlKey?+b.datepicker._get(d,"stepBigMonths"):+b.datepicker._get(d,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)b.datepicker._clearDate(a.target);h=a.ctrlKey|| +a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)b.datepicker._gotoToday(a.target);h=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,i?+1:-1,"D");h=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)b.datepicker._adjustDate(a.target,a.ctrlKey?-b.datepicker._get(d,"stepBigMonths"):-b.datepicker._get(d,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,-7,"D");h=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target, +i?-1:+1,"D");h=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)b.datepicker._adjustDate(a.target,a.ctrlKey?+b.datepicker._get(d,"stepBigMonths"):+b.datepicker._get(d,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)b.datepicker._adjustDate(a.target,+7,"D");h=a.ctrlKey||a.metaKey;break;default:h=false}else if(a.keyCode==36&&a.ctrlKey)b.datepicker._showDatepicker(this);else h=false;if(h){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var d=b.datepicker._getInst(a.target);if(b.datepicker._get(d, +"constrainInput")){d=b.datepicker._possibleChars(b.datepicker._get(d,"dateFormat"));var h=String.fromCharCode(a.charCode==c?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||h<" "||!d||d.indexOf(h)>-1}},_doKeyUp:function(a){a=b.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,b.datepicker._getFormatConfig(a))){b.datepicker._setDateFromField(a);b.datepicker._updateAlternate(a);b.datepicker._updateDatepicker(a)}}catch(d){b.datepicker.log(d)}return true}, +_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=b("input",a.parentNode)[0];if(!(b.datepicker._isDisabledDatepicker(a)||b.datepicker._lastInput==a)){var d=b.datepicker._getInst(a);b.datepicker._curInst&&b.datepicker._curInst!=d&&b.datepicker._curInst.dpDiv.stop(true,true);var h=b.datepicker._get(d,"beforeShow");g(d.settings,h?h.apply(a,[a,d]):{});d.lastVal=null;b.datepicker._lastInput=a;b.datepicker._setDateFromField(d);if(b.datepicker._inDialog)a.value="";if(!b.datepicker._pos){b.datepicker._pos= +b.datepicker._findPos(a);b.datepicker._pos[1]+=a.offsetHeight}var i=false;b(a).parents().each(function(){i|=b(this).css("position")=="fixed";return!i});if(i&&b.browser.opera){b.datepicker._pos[0]-=document.documentElement.scrollLeft;b.datepicker._pos[1]-=document.documentElement.scrollTop}h={left:b.datepicker._pos[0],top:b.datepicker._pos[1]};b.datepicker._pos=null;d.dpDiv.empty();d.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});b.datepicker._updateDatepicker(d);h=b.datepicker._checkOffset(d, +h,i);d.dpDiv.css({position:b.datepicker._inDialog&&b.blockUI?"static":i?"fixed":"absolute",display:"none",left:h.left+"px",top:h.top+"px"});if(!d.inline){h=b.datepicker._get(d,"showAnim");var j=b.datepicker._get(d,"duration"),n=function(){b.datepicker._datepickerShowing=true;var q=d.dpDiv.find("iframe.ui-datepicker-cover");if(q.length){var l=b.datepicker._getBorders(d.dpDiv);q.css({left:-l[0],top:-l[1],width:d.dpDiv.outerWidth(),height:d.dpDiv.outerHeight()})}};d.dpDiv.zIndex(b(a).zIndex()+1);b.effects&& +b.effects[h]?d.dpDiv.show(h,b.datepicker._get(d,"showOptions"),j,n):d.dpDiv[h||"show"](h?j:null,n);if(!h||!j)n();d.input.is(":visible")&&!d.input.is(":disabled")&&d.input.focus();b.datepicker._curInst=d}}},_updateDatepicker:function(a){var d=this,h=b.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var i=a.dpDiv.find("iframe.ui-datepicker-cover");i.length&&i.css({left:-h[0],top:-h[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout", +function(){b(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&b(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!d._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){b(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");b(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!= +-1&&b(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&b(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();h=this._getNumberOfMonths(a);i=h[1];i>1?a.dpDiv.addClass("ui-datepicker-multi-"+i).css("width",17*i+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(h[0]!=1||h[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a, +"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==b.datepicker._curInst&&b.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus();if(a.yearshtml){var j=a.yearshtml;setTimeout(function(){j===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);j=a.yearshtml=null},0)}},_getBorders:function(a){var d=function(h){return{thin:1,medium:2,thick:3}[h]||h};return[parseFloat(d(a.css("border-left-width"))),parseFloat(d(a.css("border-top-width")))]}, +_checkOffset:function(a,d,h){var i=a.dpDiv.outerWidth(),j=a.dpDiv.outerHeight(),n=a.input?a.input.outerWidth():0,q=a.input?a.input.outerHeight():0,l=document.documentElement.clientWidth+b(document).scrollLeft(),k=document.documentElement.clientHeight+b(document).scrollTop();d.left-=this._get(a,"isRTL")?i-n:0;d.left-=h&&d.left==a.input.offset().left?b(document).scrollLeft():0;d.top-=h&&d.top==a.input.offset().top+q?b(document).scrollTop():0;d.left-=Math.min(d.left,d.left+i>l&&l>i?Math.abs(d.left+i- +l):0);d.top-=Math.min(d.top,d.top+j>k&&k>j?Math.abs(j+q):0);return d},_findPos:function(a){for(var d=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[d?"previousSibling":"nextSibling"];a=b(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var d=this._curInst;if(!(!d||a&&d!=b.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(d,"showAnim");var h=this._get(d,"duration"),i=function(){b.datepicker._tidyDialog(d);this._curInst=null};b.effects&&b.effects[a]? +d.dpDiv.hide(a,b.datepicker._get(d,"showOptions"),h,i):d.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?h:null,i);a||i();if(a=this._get(d,"onClose"))a.apply(d.input?d.input[0]:null,[d.input?d.input.val():"",d]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(b.blockUI){b.unblockUI();b("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(b.datepicker._curInst){a=b(a.target);a[0].id!=b.datepicker._mainDivId&&a.parents("#"+b.datepicker._mainDivId).length==0&&!a.hasClass(b.datepicker.markerClassName)&&!a.hasClass(b.datepicker._triggerClass)&&b.datepicker._datepickerShowing&&!(b.datepicker._inDialog&&b.blockUI)&&b.datepicker._hideDatepicker()}},_adjustDate:function(a,d,h){a=b(a);var i=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(i,d+(h=="M"?this._get(i,"showCurrentAtPos"): +0),h);this._updateDatepicker(i)}},_gotoToday:function(a){a=b(a);var d=this._getInst(a[0]);if(this._get(d,"gotoCurrent")&&d.currentDay){d.selectedDay=d.currentDay;d.drawMonth=d.selectedMonth=d.currentMonth;d.drawYear=d.selectedYear=d.currentYear}else{var h=new Date;d.selectedDay=h.getDate();d.drawMonth=d.selectedMonth=h.getMonth();d.drawYear=d.selectedYear=h.getFullYear()}this._notifyChange(d);this._adjustDate(a)},_selectMonthYear:function(a,d,h){a=b(a);var i=this._getInst(a[0]);i._selectingMonthYear= +false;i["selected"+(h=="M"?"Month":"Year")]=i["draw"+(h=="M"?"Month":"Year")]=parseInt(d.options[d.selectedIndex].value,10);this._notifyChange(i);this._adjustDate(a)},_clickMonthYear:function(a){var d=this._getInst(b(a)[0]);d.input&&d._selectingMonthYear&&setTimeout(function(){d.input.focus()},0);d._selectingMonthYear=!d._selectingMonthYear},_selectDay:function(a,d,h,i){var j=b(a);if(!(b(i).hasClass(this._unselectableClass)||this._isDisabledDatepicker(j[0]))){j=this._getInst(j[0]);j.selectedDay=j.currentDay= +b("a",i).html();j.selectedMonth=j.currentMonth=d;j.selectedYear=j.currentYear=h;this._selectDate(a,this._formatDate(j,j.currentDay,j.currentMonth,j.currentYear))}},_clearDate:function(a){a=b(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,d){a=this._getInst(b(a)[0]);d=d!=null?d:this._formatDate(a);a.input&&a.input.val(d);this._updateAlternate(a);var h=this._get(a,"onSelect");if(h)h.apply(a.input?a.input[0]:null,[d,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a); +else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var d=this._get(a,"altField");if(d){var h=this._get(a,"altFormat")||this._get(a,"dateFormat"),i=this._getDate(a),j=this.formatDate(h,i,this._getFormatConfig(a));b(d).each(function(){b(this).val(j)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var d= +a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((d-a)/864E5)/7)+1},parseDate:function(a,d,h){if(a==null||d==null)throw"Invalid arguments";d=typeof d=="object"?d.toString():d+"";if(d=="")return null;for(var i=(h?h.shortYearCutoff:null)||this._defaults.shortYearCutoff,j=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,n=(h?h.dayNames:null)||this._defaults.dayNames,q=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort,l=(h?h.monthNames:null)||this._defaults.monthNames, +k=h=-1,m=-1,o=-1,p=false,s=function(x){(x=y+1<a.length&&a.charAt(y+1)==x)&&y++;return x},r=function(x){var C=s(x);x=new RegExp("^\\d{1,"+(x=="@"?14:x=="!"?20:x=="y"&&C?4:x=="o"?3:2)+"}");x=d.substring(w).match(x);if(!x)throw"Missing number at position "+w;w+=x[0].length;return parseInt(x[0],10)},u=function(x,C,J){x=s(x)?J:C;for(C=0;C<x.length;C++)if(d.substr(w,x[C].length).toLowerCase()==x[C].toLowerCase()){w+=x[C].length;return C+1}throw"Unknown name at position "+w;},v=function(){if(d.charAt(w)!= +a.charAt(y))throw"Unexpected literal at position "+w;w++},w=0,y=0;y<a.length;y++)if(p)if(a.charAt(y)=="'"&&!s("'"))p=false;else v();else switch(a.charAt(y)){case "d":m=r("d");break;case "D":u("D",j,n);break;case "o":o=r("o");break;case "m":k=r("m");break;case "M":k=u("M",q,l);break;case "y":h=r("y");break;case "@":var B=new Date(r("@"));h=B.getFullYear();k=B.getMonth()+1;m=B.getDate();break;case "!":B=new Date((r("!")-this._ticksTo1970)/1E4);h=B.getFullYear();k=B.getMonth()+1;m=B.getDate();break; +case "'":if(s("'"))v();else p=true;break;default:v()}if(h==-1)h=(new Date).getFullYear();else if(h<100)h+=(new Date).getFullYear()-(new Date).getFullYear()%100+(h<=i?0:-100);if(o>-1){k=1;m=o;do{i=this._getDaysInMonth(h,k-1);if(m<=i)break;k++;m-=i}while(1)}B=this._daylightSavingAdjust(new Date(h,k-1,m));if(B.getFullYear()!=h||B.getMonth()+1!=k||B.getDate()!=m)throw"Invalid date";return B},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y", +RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,d,h){if(!d)return"";var i=(h?h.dayNamesShort:null)||this._defaults.dayNamesShort,j=(h?h.dayNames:null)||this._defaults.dayNames,n=(h?h.monthNamesShort:null)||this._defaults.monthNamesShort;h=(h?h.monthNames:null)||this._defaults.monthNames;var q=function(s){(s=p+1<a.length&&a.charAt(p+1)==s)&&p++; +return s},l=function(s,r,u){r=""+r;if(q(s))for(;r.length<u;)r="0"+r;return r},k=function(s,r,u,v){return q(s)?v[r]:u[r]},m="",o=false;if(d)for(var p=0;p<a.length;p++)if(o)if(a.charAt(p)=="'"&&!q("'"))o=false;else m+=a.charAt(p);else switch(a.charAt(p)){case "d":m+=l("d",d.getDate(),2);break;case "D":m+=k("D",d.getDay(),i,j);break;case "o":m+=l("o",(d.getTime()-(new Date(d.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":m+=l("m",d.getMonth()+1,2);break;case "M":m+=k("M",d.getMonth(),n,h);break; +case "y":m+=q("y")?d.getFullYear():(d.getYear()%100<10?"0":"")+d.getYear()%100;break;case "@":m+=d.getTime();break;case "!":m+=d.getTime()*1E4+this._ticksTo1970;break;case "'":if(q("'"))m+="'";else o=true;break;default:m+=a.charAt(p)}return m},_possibleChars:function(a){for(var d="",h=false,i=function(n){(n=j+1<a.length&&a.charAt(j+1)==n)&&j++;return n},j=0;j<a.length;j++)if(h)if(a.charAt(j)=="'"&&!i("'"))h=false;else d+=a.charAt(j);else switch(a.charAt(j)){case "d":case "m":case "y":case "@":d+= +"0123456789";break;case "D":case "M":return null;case "'":if(i("'"))d+="'";else h=true;break;default:d+=a.charAt(j)}return d},_get:function(a,d){return a.settings[d]!==c?a.settings[d]:this._defaults[d]},_setDateFromField:function(a,d){if(a.input.val()!=a.lastVal){var h=this._get(a,"dateFormat"),i=a.lastVal=a.input?a.input.val():null,j,n;j=n=this._getDefaultDate(a);var q=this._getFormatConfig(a);try{j=this.parseDate(h,i,q)||n}catch(l){this.log(l);i=d?"":i}a.selectedDay=j.getDate();a.drawMonth=a.selectedMonth= +j.getMonth();a.drawYear=a.selectedYear=j.getFullYear();a.currentDay=i?j.getDate():0;a.currentMonth=i?j.getMonth():0;a.currentYear=i?j.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,d,h){var i=function(n){var q=new Date;q.setDate(q.getDate()+n);return q},j=function(n){try{return b.datepicker.parseDate(b.datepicker._get(a,"dateFormat"),n,b.datepicker._getFormatConfig(a))}catch(q){}var l= +(n.toLowerCase().match(/^c/)?b.datepicker._getDate(a):null)||new Date,k=l.getFullYear(),m=l.getMonth();l=l.getDate();for(var o=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,p=o.exec(n);p;){switch(p[2]||"d"){case "d":case "D":l+=parseInt(p[1],10);break;case "w":case "W":l+=parseInt(p[1],10)*7;break;case "m":case "M":m+=parseInt(p[1],10);l=Math.min(l,b.datepicker._getDaysInMonth(k,m));break;case "y":case "Y":k+=parseInt(p[1],10);l=Math.min(l,b.datepicker._getDaysInMonth(k,m));break}p=o.exec(n)}return new Date(k, +m,l)};if(d=(d=d==null||d===""?h:typeof d=="string"?j(d):typeof d=="number"?isNaN(d)?h:i(d):new Date(d.getTime()))&&d.toString()=="Invalid Date"?h:d){d.setHours(0);d.setMinutes(0);d.setSeconds(0);d.setMilliseconds(0)}return this._daylightSavingAdjust(d)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,d,h){var i=!d,j=a.selectedMonth,n=a.selectedYear;d=this._restrictMinMax(a,this._determineDate(a,d,new Date));a.selectedDay= +a.currentDay=d.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=d.getMonth();a.drawYear=a.selectedYear=a.currentYear=d.getFullYear();if((j!=a.selectedMonth||n!=a.selectedYear)&&!h)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(i?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var d=new Date;d=this._daylightSavingAdjust(new Date(d.getFullYear(), +d.getMonth(),d.getDate()));var h=this._get(a,"isRTL"),i=this._get(a,"showButtonPanel"),j=this._get(a,"hideIfNoPrevNext"),n=this._get(a,"navigationAsDateFormat"),q=this._getNumberOfMonths(a),l=this._get(a,"showCurrentAtPos"),k=this._get(a,"stepMonths"),m=q[0]!=1||q[1]!=1,o=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),p=this._getMinMaxDate(a,"min"),s=this._getMinMaxDate(a,"max");l=a.drawMonth-l;var r=a.drawYear;if(l<0){l+=12;r--}if(s){var u= +this._daylightSavingAdjust(new Date(s.getFullYear(),s.getMonth()-q[0]*q[1]+1,s.getDate()));for(u=p&&u<p?p:u;this._daylightSavingAdjust(new Date(r,l,1))>u;){l--;if(l<0){l=11;r--}}}a.drawMonth=l;a.drawYear=r;u=this._get(a,"prevText");u=!n?u:this.formatDate(u,this._daylightSavingAdjust(new Date(r,l-k,1)),this._getFormatConfig(a));u=this._canAdjustMonth(a,-1,r,l)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+a.id+"', -"+k+", 'M');\" title=\""+u+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(h?"e":"w")+'">'+u+"</span></a>":j?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+u+'"><span class="ui-icon ui-icon-circle-triangle-'+(h?"e":"w")+'">'+u+"</span></a>";var v=this._get(a,"nextText");v=!n?v:this.formatDate(v,this._daylightSavingAdjust(new Date(r,l+k,1)),this._getFormatConfig(a));j=this._canAdjustMonth(a,+1,r,l)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+a.id+"', +"+k+", 'M');\" title=\""+v+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(h?"w":"e")+'">'+v+"</span></a>":j?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+v+'"><span class="ui-icon ui-icon-circle-triangle-'+(h?"w":"e")+'">'+v+"</span></a>";k=this._get(a,"currentText");v=this._get(a,"gotoCurrent")&&a.currentDay?o:d;k=!n?k:this.formatDate(k,v,this._getFormatConfig(a));n=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+e+'.datepicker._hideDatepicker();">'+this._get(a, +"closeText")+"</button>":"";i=i?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(h?n:"")+(this._isInRange(a,v)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._gotoToday('#"+a.id+"');\">"+k+"</button>":"")+(h?"":n)+"</div>":"";n=parseInt(this._get(a,"firstDay"),10);n=isNaN(n)?0:n;k=this._get(a,"showWeek");v=this._get(a,"dayNames");this._get(a,"dayNamesShort");var w=this._get(a,"dayNamesMin"),y= +this._get(a,"monthNames"),B=this._get(a,"monthNamesShort"),x=this._get(a,"beforeShowDay"),C=this._get(a,"showOtherMonths"),J=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var M=this._getDefaultDate(a),K="",G=0;G<q[0];G++){for(var N="",H=0;H<q[1];H++){var O=this._daylightSavingAdjust(new Date(r,l,a.selectedDay)),A=" ui-corner-all",D="";if(m){D+='<div class="ui-datepicker-group';if(q[1]>1)switch(H){case 0:D+=" ui-datepicker-group-first";A=" ui-corner-"+(h?"right":"left");break;case q[1]- +1:D+=" ui-datepicker-group-last";A=" ui-corner-"+(h?"left":"right");break;default:D+=" ui-datepicker-group-middle";A="";break}D+='">'}D+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+A+'">'+(/all|left/.test(A)&&G==0?h?j:u:"")+(/all|right/.test(A)&&G==0?h?u:j:"")+this._generateMonthYearHeader(a,l,r,p,s,G>0||H>0,y,B)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var E=k?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(A=0;A<7;A++){var z= +(A+n)%7;E+="<th"+((A+n+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+v[z]+'">'+w[z]+"</span></th>"}D+=E+"</tr></thead><tbody>";E=this._getDaysInMonth(r,l);if(r==a.selectedYear&&l==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,E);A=(this._getFirstDayOfMonth(r,l)-n+7)%7;E=m?6:Math.ceil((A+E)/7);z=this._daylightSavingAdjust(new Date(r,l,1-A));for(var P=0;P<E;P++){D+="<tr>";var Q=!k?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(z)+"</td>";for(A=0;A<7;A++){var I= +x?x.apply(a.input?a.input[0]:null,[z]):[true,""],F=z.getMonth()!=l,L=F&&!J||!I[0]||p&&z<p||s&&z>s;Q+='<td class="'+((A+n+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(z.getTime()==O.getTime()&&l==a.selectedMonth&&a._keyEvent||M.getTime()==z.getTime()&&M.getTime()==O.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!C?"":" "+I[1]+(z.getTime()==o.getTime()?" "+this._currentClass:"")+(z.getTime()==d.getTime()?" ui-datepicker-today": +""))+'"'+((!F||C)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+e+".datepicker._selectDay('#"+a.id+"',"+z.getMonth()+","+z.getFullYear()+', this);return false;"')+">"+(F&&!C?" ":L?'<span class="ui-state-default">'+z.getDate()+"</span>":'<a class="ui-state-default'+(z.getTime()==d.getTime()?" ui-state-highlight":"")+(z.getTime()==o.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+z.getDate()+"</a>")+"</td>";z.setDate(z.getDate()+1);z=this._daylightSavingAdjust(z)}D+= +Q+"</tr>"}l++;if(l>11){l=0;r++}D+="</tbody></table>"+(m?"</div>"+(q[0]>0&&H==q[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");N+=D}K+=N}K+=i+(b.browser.msie&&parseInt(b.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return K},_generateMonthYearHeader:function(a,d,h,i,j,n,q,l){var k=this._get(a,"changeMonth"),m=this._get(a,"changeYear"),o=this._get(a,"showMonthAfterYear"),p='<div class="ui-datepicker-title">', +s="";if(n||!k)s+='<span class="ui-datepicker-month">'+q[d]+"</span>";else{q=i&&i.getFullYear()==h;var r=j&&j.getFullYear()==h;s+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var u=0;u<12;u++)if((!q||u>=i.getMonth())&&(!r||u<=j.getMonth()))s+='<option value="'+u+'"'+(u==d?' selected="selected"':"")+">"+l[u]+"</option>";s+="</select>"}o||(p+=s+(n||!(k&& +m)?" ":""));a.yearshtml="";if(n||!m)p+='<span class="ui-datepicker-year">'+h+"</span>";else{l=this._get(a,"yearRange").split(":");var v=(new Date).getFullYear();q=function(w){w=w.match(/c[+-].*/)?h+parseInt(w.substring(1),10):w.match(/[+-].*/)?v+parseInt(w,10):parseInt(w,10);return isNaN(w)?v:w};d=q(l[0]);l=Math.max(d,q(l[1]||""));d=i?Math.max(d,i.getFullYear()):d;l=j?Math.min(l,j.getFullYear()):l;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+ +a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+a.id+"');\">";d<=l;d++)a.yearshtml+='<option value="'+d+'"'+(d==h?' selected="selected"':"")+">"+d+"</option>";a.yearshtml+="</select>";if(b.browser.mozilla)p+='<select class="ui-datepicker-year"><option value="'+h+'" selected="selected">'+h+"</option></select>";else{p+=a.yearshtml;a.yearshtml=null}}p+=this._get(a,"yearSuffix");if(o)p+=(n||!(k&&m)?" ":"")+s;p+="</div>";return p},_adjustInstDate:function(a,d,h){var i= +a.drawYear+(h=="Y"?d:0),j=a.drawMonth+(h=="M"?d:0);d=Math.min(a.selectedDay,this._getDaysInMonth(i,j))+(h=="D"?d:0);i=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(i,j,d)));a.selectedDay=i.getDate();a.drawMonth=a.selectedMonth=i.getMonth();a.drawYear=a.selectedYear=i.getFullYear();if(h=="M"||h=="Y")this._notifyChange(a)},_restrictMinMax:function(a,d){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");d=h&&d<h?h:d;return d=a&&d>a?a:d},_notifyChange:function(a){var d=this._get(a, +"onChangeMonthYear");if(d)d.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,d){return this._determineDate(a,this._get(a,d+"Date"),null)},_getDaysInMonth:function(a,d){return 32-(new Date(a,d,32)).getDate()},_getFirstDayOfMonth:function(a,d){return(new Date(a,d,1)).getDay()},_canAdjustMonth:function(a,d,h,i){var j=this._getNumberOfMonths(a); +h=this._daylightSavingAdjust(new Date(h,i+(d<0?d:j[0]*j[1]),1));d<0&&h.setDate(this._getDaysInMonth(h.getFullYear(),h.getMonth()));return this._isInRange(a,h)},_isInRange:function(a,d){var h=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!h||d.getTime()>=h.getTime())&&(!a||d.getTime()<=a.getTime())},_getFormatConfig:function(a){var d=this._get(a,"shortYearCutoff");d=typeof d!="string"?d:(new Date).getFullYear()%100+parseInt(d,10);return{shortYearCutoff:d,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,d,h,i){if(!d){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}d=d?typeof d=="object"?d:this._daylightSavingAdjust(new Date(i,h,d)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),d,this._getFormatConfig(a))}});b.fn.datepicker= +function(a){if(!b.datepicker.initialized){b(document).mousedown(b.datepicker._checkExternalClick).find("body").append(b.datepicker.dpDiv);b.datepicker.initialized=true}var d=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(d));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this[0]].concat(d)); +return this.each(function(){typeof a=="string"?b.datepicker["_"+a+"Datepicker"].apply(b.datepicker,[this].concat(d)):b.datepicker._attachDatepicker(this,a)})};b.datepicker=new f;b.datepicker.initialized=false;b.datepicker.uuid=(new Date).getTime();b.datepicker.version="1.8.7";window["DP_jQuery_"+e]=b})(jQuery); +(function(b,c){var f={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},g={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};b.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(e){var a=b(this).css(e).offset().top;a<0&& +b(this).css("top",e.top-a)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var e=this,a=e.options,d=a.title||" ",h=b.ui.dialog.getTitleId(e.element),i=(e.uiDialog=b("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+a.dialogClass).css({zIndex:a.zIndex}).attr("tabIndex", +-1).css("outline",0).keydown(function(q){if(a.closeOnEscape&&q.keyCode&&q.keyCode===b.ui.keyCode.ESCAPE){e.close(q);q.preventDefault()}}).attr({role:"dialog","aria-labelledby":h}).mousedown(function(q){e.moveToTop(false,q)});e.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(i);var j=(e.uiDialogTitlebar=b("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(i),n=b('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role", +"button").hover(function(){n.addClass("ui-state-hover")},function(){n.removeClass("ui-state-hover")}).focus(function(){n.addClass("ui-state-focus")}).blur(function(){n.removeClass("ui-state-focus")}).click(function(q){e.close(q);return false}).appendTo(j);(e.uiDialogTitlebarCloseText=b("<span></span>")).addClass("ui-icon ui-icon-closethick").text(a.closeText).appendTo(n);b("<span></span>").addClass("ui-dialog-title").attr("id",h).html(d).prependTo(j);if(b.isFunction(a.beforeclose)&&!b.isFunction(a.beforeClose))a.beforeClose= +a.beforeclose;j.find("*").add(j).disableSelection();a.draggable&&b.fn.draggable&&e._makeDraggable();a.resizable&&b.fn.resizable&&e._makeResizable();e._createButtons(a.buttons);e._isOpen=false;b.fn.bgiframe&&i.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var e=this;e.overlay&&e.overlay.destroy();e.uiDialog.hide();e.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");e.uiDialog.remove();e.originalTitle&& +e.element.attr("title",e.originalTitle);return e},widget:function(){return this.uiDialog},close:function(e){var a=this,d,h;if(false!==a._trigger("beforeClose",e)){a.overlay&&a.overlay.destroy();a.uiDialog.unbind("keypress.ui-dialog");a._isOpen=false;if(a.options.hide)a.uiDialog.hide(a.options.hide,function(){a._trigger("close",e)});else{a.uiDialog.hide();a._trigger("close",e)}b.ui.dialog.overlay.resize();if(a.options.modal){d=0;b(".ui-dialog").each(function(){if(this!==a.uiDialog[0]){h=b(this).css("z-index"); +isNaN(h)||(d=Math.max(d,h))}});b.ui.dialog.maxZ=d}return a}},isOpen:function(){return this._isOpen},moveToTop:function(e,a){var d=this,h=d.options;if(h.modal&&!e||!h.stack&&!h.modal)return d._trigger("focus",a);if(h.zIndex>b.ui.dialog.maxZ)b.ui.dialog.maxZ=h.zIndex;if(d.overlay){b.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",b.ui.dialog.overlay.maxZ=b.ui.dialog.maxZ)}e={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};b.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",b.ui.dialog.maxZ); +d.element.attr(e);d._trigger("focus",a);return d},open:function(){if(!this._isOpen){var e=this,a=e.options,d=e.uiDialog;e.overlay=a.modal?new b.ui.dialog.overlay(e):null;e._size();e._position(a.position);d.show(a.show);e.moveToTop(true);a.modal&&d.bind("keypress.ui-dialog",function(h){if(h.keyCode===b.ui.keyCode.TAB){var i=b(":tabbable",this),j=i.filter(":first");i=i.filter(":last");if(h.target===i[0]&&!h.shiftKey){j.focus(1);return false}else if(h.target===j[0]&&h.shiftKey){i.focus(1);return false}}}); +b(e.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();e._isOpen=true;e._trigger("open");return e}},_createButtons:function(e){var a=this,d=false,h=b("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),i=b("<div></div>").addClass("ui-dialog-buttonset").appendTo(h);a.uiDialog.find(".ui-dialog-buttonpane").remove();typeof e==="object"&&e!==null&&b.each(e,function(){return!(d=true)});if(d){b.each(e,function(j, +n){n=b.isFunction(n)?{click:n,text:j}:n;j=b('<button type="button"></button>').attr(n,true).unbind("click").click(function(){n.click.apply(a.element[0],arguments)}).appendTo(i);b.fn.button&&j.button()});h.appendTo(a.uiDialog)}},_makeDraggable:function(){function e(j){return{position:j.position,offset:j.offset}}var a=this,d=a.options,h=b(document),i;a.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(j,n){i= +d.height==="auto"?"auto":b(this).height();b(this).height(b(this).height()).addClass("ui-dialog-dragging");a._trigger("dragStart",j,e(n))},drag:function(j,n){a._trigger("drag",j,e(n))},stop:function(j,n){d.position=[n.position.left-h.scrollLeft(),n.position.top-h.scrollTop()];b(this).removeClass("ui-dialog-dragging").height(i);a._trigger("dragStop",j,e(n));b.ui.dialog.overlay.resize()}})},_makeResizable:function(e){function a(j){return{originalPosition:j.originalPosition,originalSize:j.originalSize, +position:j.position,size:j.size}}e=e===c?this.options.resizable:e;var d=this,h=d.options,i=d.uiDialog.css("position");e=typeof e==="string"?e:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:h.maxWidth,maxHeight:h.maxHeight,minWidth:h.minWidth,minHeight:d._minHeight(),handles:e,start:function(j,n){b(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",j,a(n))},resize:function(j,n){d._trigger("resize",j,a(n))},stop:function(j, +n){b(this).removeClass("ui-dialog-resizing");h.height=b(this).height();h.width=b(this).width();d._trigger("resizeStop",j,a(n));b.ui.dialog.overlay.resize()}}).css("position",i).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var e=this.options;return e.height==="auto"?e.minHeight:Math.min(e.minHeight,e.height)},_position:function(e){var a=[],d=[0,0],h;if(e){if(typeof e==="string"||typeof e==="object"&&"0"in e){a=e.split?e.split(" "):[e[0],e[1]];if(a.length=== +1)a[1]=a[0];b.each(["left","top"],function(i,j){if(+a[i]===a[i]){d[i]=a[i];a[i]=j}});e={my:a.join(" "),at:a.join(" "),offset:d.join(" ")}}e=b.extend({},b.ui.dialog.prototype.options.position,e)}else e=b.ui.dialog.prototype.options.position;(h=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(b.extend({of:window},e));h||this.uiDialog.hide()},_setOptions:function(e){var a=this,d={},h=false;b.each(e,function(i,j){a._setOption(i,j);if(i in f)h=true;if(i in +g)d[i]=j});h&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(e,a){var d=this,h=d.uiDialog;switch(e){case "beforeclose":e="beforeClose";break;case "buttons":d._createButtons(a);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+a);break;case "dialogClass":h.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+a);break;case "disabled":a?h.addClass("ui-dialog-disabled"):h.removeClass("ui-dialog-disabled"); +break;case "draggable":var i=h.is(":data(draggable)");i&&!a&&h.draggable("destroy");!i&&a&&d._makeDraggable();break;case "position":d._position(a);break;case "resizable":(i=h.is(":data(resizable)"))&&!a&&h.resizable("destroy");i&&typeof a==="string"&&h.resizable("option","handles",a);!i&&a!==false&&d._makeResizable(a);break;case "title":b(".ui-dialog-title",d.uiDialogTitlebar).html(""+(a||" "));break}b.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var e=this.options,a,d,h= +this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(e.minWidth>e.width)e.width=e.minWidth;a=this.uiDialog.css({height:"auto",width:e.width}).height();d=Math.max(0,e.minHeight-a);if(e.height==="auto")if(b.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();e=this.element.css("height","auto").height();h||this.uiDialog.hide();this.element.height(Math.max(e,d))}else this.element.height(Math.max(e.height-a,0));this.uiDialog.is(":data(resizable)")&& +this.uiDialog.resizable("option","minHeight",this._minHeight())}});b.extend(b.ui.dialog,{version:"1.8.7",uuid:0,maxZ:0,getTitleId:function(e){e=e.attr("id");if(!e){this.uuid+=1;e=this.uuid}return"ui-dialog-title-"+e},overlay:function(e){this.$el=b.ui.dialog.overlay.create(e)}});b.extend(b.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:b.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(e){return e+".dialog-overlay"}).join(" "),create:function(e){if(this.instances.length=== +0){setTimeout(function(){b.ui.dialog.overlay.instances.length&&b(document).bind(b.ui.dialog.overlay.events,function(d){if(b(d.target).zIndex()<b.ui.dialog.overlay.maxZ)return false})},1);b(document).bind("keydown.dialog-overlay",function(d){if(e.options.closeOnEscape&&d.keyCode&&d.keyCode===b.ui.keyCode.ESCAPE){e.close(d);d.preventDefault()}});b(window).bind("resize.dialog-overlay",b.ui.dialog.overlay.resize)}var a=(this.oldInstances.pop()||b("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});b.fn.bgiframe&&a.bgiframe();this.instances.push(a);return a},destroy:function(e){var a=b.inArray(e,this.instances);a!=-1&&this.oldInstances.push(this.instances.splice(a,1)[0]);this.instances.length===0&&b([document,window]).unbind(".dialog-overlay");e.remove();var d=0;b.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var e,a;if(b.browser.msie&&b.browser.version<7){e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +a=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return e<a?b(window).height()+"px":e+"px"}else return b(document).height()+"px"},width:function(){var e,a;if(b.browser.msie&&b.browser.version<7){e=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);a=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return e<a?b(window).width()+"px":e+"px"}else return b(document).width()+"px"},resize:function(){var e=b([]);b.each(b.ui.dialog.overlay.instances, +function(){e=e.add(this)});e.css({width:0,height:0}).css({width:b.ui.dialog.overlay.width(),height:b.ui.dialog.overlay.height()})}});b.extend(b.ui.dialog.overlay.prototype,{destroy:function(){b.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); +(function(b){b.ui=b.ui||{};var c=/left|center|right/,f=/top|center|bottom/,g=b.fn.position,e=b.fn.offset;b.fn.position=function(a){if(!a||!a.of)return g.apply(this,arguments);a=b.extend({},a);var d=b(a.of),h=d[0],i=(a.collision||"flip").split(" "),j=a.offset?a.offset.split(" "):[0,0],n,q,l;if(h.nodeType===9){n=d.width();q=d.height();l={top:0,left:0}}else if(h.setTimeout){n=d.width();q=d.height();l={top:d.scrollTop(),left:d.scrollLeft()}}else if(h.preventDefault){a.at="left top";n=q=0;l={top:a.of.pageY, +left:a.of.pageX}}else{n=d.outerWidth();q=d.outerHeight();l=d.offset()}b.each(["my","at"],function(){var k=(a[this]||"").split(" ");if(k.length===1)k=c.test(k[0])?k.concat(["center"]):f.test(k[0])?["center"].concat(k):["center","center"];k[0]=c.test(k[0])?k[0]:"center";k[1]=f.test(k[1])?k[1]:"center";a[this]=k});if(i.length===1)i[1]=i[0];j[0]=parseInt(j[0],10)||0;if(j.length===1)j[1]=j[0];j[1]=parseInt(j[1],10)||0;if(a.at[0]==="right")l.left+=n;else if(a.at[0]==="center")l.left+=n/2;if(a.at[1]==="bottom")l.top+= +q;else if(a.at[1]==="center")l.top+=q/2;l.left+=j[0];l.top+=j[1];return this.each(function(){var k=b(this),m=k.outerWidth(),o=k.outerHeight(),p=parseInt(b.curCSS(this,"marginLeft",true))||0,s=parseInt(b.curCSS(this,"marginTop",true))||0,r=m+p+parseInt(b.curCSS(this,"marginRight",true))||0,u=o+s+parseInt(b.curCSS(this,"marginBottom",true))||0,v=b.extend({},l),w;if(a.my[0]==="right")v.left-=m;else if(a.my[0]==="center")v.left-=m/2;if(a.my[1]==="bottom")v.top-=o;else if(a.my[1]==="center")v.top-=o/2; +v.left=Math.round(v.left);v.top=Math.round(v.top);w={left:v.left-p,top:v.top-s};b.each(["left","top"],function(y,B){b.ui.position[i[y]]&&b.ui.position[i[y]][B](v,{targetWidth:n,targetHeight:q,elemWidth:m,elemHeight:o,collisionPosition:w,collisionWidth:r,collisionHeight:u,offset:j,my:a.my,at:a.at})});b.fn.bgiframe&&k.bgiframe();k.offset(b.extend(v,{using:a.using}))})};b.ui.position={fit:{left:function(a,d){var h=b(window);h=d.collisionPosition.left+d.collisionWidth-h.width()-h.scrollLeft();a.left= +h>0?a.left-h:Math.max(a.left-d.collisionPosition.left,a.left)},top:function(a,d){var h=b(window);h=d.collisionPosition.top+d.collisionHeight-h.height()-h.scrollTop();a.top=h>0?a.top-h:Math.max(a.top-d.collisionPosition.top,a.top)}},flip:{left:function(a,d){if(d.at[0]!=="center"){var h=b(window);h=d.collisionPosition.left+d.collisionWidth-h.width()-h.scrollLeft();var i=d.my[0]==="left"?-d.elemWidth:d.my[0]==="right"?d.elemWidth:0,j=d.at[0]==="left"?d.targetWidth:-d.targetWidth,n=-2*d.offset[0];a.left+= +d.collisionPosition.left<0?i+j+n:h>0?i+j+n:0}},top:function(a,d){if(d.at[1]!=="center"){var h=b(window);h=d.collisionPosition.top+d.collisionHeight-h.height()-h.scrollTop();var i=d.my[1]==="top"?-d.elemHeight:d.my[1]==="bottom"?d.elemHeight:0,j=d.at[1]==="top"?d.targetHeight:-d.targetHeight,n=-2*d.offset[1];a.top+=d.collisionPosition.top<0?i+j+n:h>0?i+j+n:0}}}};if(!b.offset.setOffset){b.offset.setOffset=function(a,d){if(/static/.test(b.curCSS(a,"position")))a.style.position="relative";var h=b(a), +i=h.offset(),j=parseInt(b.curCSS(a,"top",true),10)||0,n=parseInt(b.curCSS(a,"left",true),10)||0;i={top:d.top-i.top+j,left:d.left-i.left+n};"using"in d?d.using.call(a,i):h.css(i)};b.fn.offset=function(a){var d=this[0];if(!d||!d.ownerDocument)return null;if(a)return this.each(function(){b.offset.setOffset(this,a)});return e.call(this)}}})(jQuery); +(function(b,c){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(f){if(f===c)return this._value();this._setOption("value",f);return this},_setOption:function(f,g){if(f==="value"){this.options.value=g;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var f=this.options.value;if(typeof f!=="number")f=0;return Math.min(this.options.max,Math.max(this.min,f))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var f=this.value(),g=this._percentage();if(this.oldValue!==f){this.oldValue=f;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",f===this.options.max).width(g.toFixed(0)+"%");this.element.attr("aria-valuenow",f)}});b.extend(b.ui.progressbar,{version:"1.8.7"})})(jQuery); +(function(b){b.widget("ui.slider",b.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var c=this,f=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");f.disabled&&this.element.addClass("ui-slider-disabled ui-disabled"); +this.range=b([]);if(f.range){if(f.range===true){this.range=b("<div></div>");if(!f.values)f.values=[this._valueMin(),this._valueMin()];if(f.values.length&&f.values.length!==2)f.values=[f.values[0],f.values[0]]}else this.range=b("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(f.range==="min"||f.range==="max")this.range.addClass("ui-slider-range-"+f.range);this.range.addClass("ui-widget-header")}b(".ui-slider-handle",this.element).length===0&&b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle"); +if(f.values&&f.values.length)for(;b(".ui-slider-handle",this.element).length<f.values.length;)b("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=b(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){f.disabled||b(this).addClass("ui-state-hover")},function(){b(this).removeClass("ui-state-hover")}).focus(function(){if(f.disabled)b(this).blur(); +else{b(".ui-slider .ui-state-focus").removeClass("ui-state-focus");b(this).addClass("ui-state-focus")}}).blur(function(){b(this).removeClass("ui-state-focus")});this.handles.each(function(g){b(this).data("index.ui-slider-handle",g)});this.handles.keydown(function(g){var e=true,a=b(this).data("index.ui-slider-handle"),d,h,i;if(!c.options.disabled){switch(g.keyCode){case b.ui.keyCode.HOME:case b.ui.keyCode.END:case b.ui.keyCode.PAGE_UP:case b.ui.keyCode.PAGE_DOWN:case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:e= +false;if(!c._keySliding){c._keySliding=true;b(this).addClass("ui-state-active");d=c._start(g,a);if(d===false)return}break}i=c.options.step;d=c.options.values&&c.options.values.length?(h=c.values(a)):(h=c.value());switch(g.keyCode){case b.ui.keyCode.HOME:h=c._valueMin();break;case b.ui.keyCode.END:h=c._valueMax();break;case b.ui.keyCode.PAGE_UP:h=c._trimAlignValue(d+(c._valueMax()-c._valueMin())/5);break;case b.ui.keyCode.PAGE_DOWN:h=c._trimAlignValue(d-(c._valueMax()-c._valueMin())/5);break;case b.ui.keyCode.UP:case b.ui.keyCode.RIGHT:if(d=== +c._valueMax())return;h=c._trimAlignValue(d+i);break;case b.ui.keyCode.DOWN:case b.ui.keyCode.LEFT:if(d===c._valueMin())return;h=c._trimAlignValue(d-i);break}c._slide(g,a,h);return e}}).keyup(function(g){var e=b(this).data("index.ui-slider-handle");if(c._keySliding){c._keySliding=false;c._stop(g,e);c._change(g,e);b(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); +this._mouseDestroy();return this},_mouseCapture:function(c){var f=this.options,g,e,a,d,h;if(f.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();g=this._normValueFromMouse({x:c.pageX,y:c.pageY});e=this._valueMax()-this._valueMin()+1;d=this;this.handles.each(function(i){var j=Math.abs(g-d.values(i));if(e>j){e=j;a=b(this);h=i}});if(f.range===true&&this.values(1)===f.min){h+=1;a=b(this.handles[h])}if(this._start(c, +h)===false)return false;this._mouseSliding=true;d._handleIndex=h;a.addClass("ui-state-active").focus();f=a.offset();this._clickOffset=!b(c.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:c.pageX-f.left-a.width()/2,top:c.pageY-f.top-a.height()/2-(parseInt(a.css("borderTopWidth"),10)||0)-(parseInt(a.css("borderBottomWidth"),10)||0)+(parseInt(a.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(c,h,g);return this._animateOff=true},_mouseStart:function(){return true}, +_mouseDrag:function(c){var f=this._normValueFromMouse({x:c.pageX,y:c.pageY});this._slide(c,this._handleIndex,f);return false},_mouseStop:function(c){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(c,this._handleIndex);this._change(c,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(c){var f; +if(this.orientation==="horizontal"){f=this.elementSize.width;c=c.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{f=this.elementSize.height;c=c.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}f=c/f;if(f>1)f=1;if(f<0)f=0;if(this.orientation==="vertical")f=1-f;c=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+f*c)},_start:function(c,f){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value= +this.values(f);g.values=this.values()}return this._trigger("start",c,g)},_slide:function(c,f,g){var e;if(this.options.values&&this.options.values.length){e=this.values(f?0:1);if(this.options.values.length===2&&this.options.range===true&&(f===0&&g>e||f===1&&g<e))g=e;if(g!==this.values(f)){e=this.values();e[f]=g;c=this._trigger("slide",c,{handle:this.handles[f],value:g,values:e});this.values(f?0:1);c!==false&&this.values(f,g,true)}}else if(g!==this.value()){c=this._trigger("slide",c,{handle:this.handles[f], +value:g});c!==false&&this.value(g)}},_stop:function(c,f){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=this.values(f);g.values=this.values()}this._trigger("stop",c,g)},_change:function(c,f){if(!this._keySliding&&!this._mouseSliding){var g={handle:this.handles[f],value:this.value()};if(this.options.values&&this.options.values.length){g.value=this.values(f);g.values=this.values()}this._trigger("change",c,g)}},value:function(c){if(arguments.length){this.options.value= +this._trimAlignValue(c);this._refreshValue();this._change(null,0)}return this._value()},values:function(c,f){var g,e,a;if(arguments.length>1){this.options.values[c]=this._trimAlignValue(f);this._refreshValue();this._change(null,c)}if(arguments.length)if(b.isArray(arguments[0])){g=this.options.values;e=arguments[0];for(a=0;a<g.length;a+=1){g[a]=this._trimAlignValue(e[a]);this._change(null,a)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(c):this.value(); +else return this._values()},_setOption:function(c,f){var g,e=0;if(b.isArray(this.options.values))e=this.options.values.length;b.Widget.prototype._setOption.apply(this,arguments);switch(c){case "disabled":if(f){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); +this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(g=0;g<e;g+=1)this._change(null,g);this._animateOff=false;break}},_value:function(){var c=this.options.value;return c=this._trimAlignValue(c)},_values:function(c){var f,g;if(arguments.length){f=this.options.values[c]; +return f=this._trimAlignValue(f)}else{f=this.options.values.slice();for(g=0;g<f.length;g+=1)f[g]=this._trimAlignValue(f[g]);return f}},_trimAlignValue:function(c){if(c<=this._valueMin())return this._valueMin();if(c>=this._valueMax())return this._valueMax();var f=this.options.step>0?this.options.step:1,g=(c-this._valueMin())%f;alignValue=c-g;if(Math.abs(g)*2>=f)alignValue+=g>0?f:-f;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var c=this.options.range,f=this.options,g=this,e=!this._animateOff?f.animate:false,a,d={},h,i,j,n;if(this.options.values&&this.options.values.length)this.handles.each(function(q){a=(g.values(q)-g._valueMin())/(g._valueMax()-g._valueMin())*100;d[g.orientation==="horizontal"?"left":"bottom"]=a+"%";b(this).stop(1,1)[e?"animate":"css"](d,f.animate);if(g.options.range===true)if(g.orientation==="horizontal"){if(q===0)g.range.stop(1,1)[e?"animate":"css"]({left:a+"%"},f.animate); +if(q===1)g.range[e?"animate":"css"]({width:a-h+"%"},{queue:false,duration:f.animate})}else{if(q===0)g.range.stop(1,1)[e?"animate":"css"]({bottom:a+"%"},f.animate);if(q===1)g.range[e?"animate":"css"]({height:a-h+"%"},{queue:false,duration:f.animate})}h=a});else{i=this.value();j=this._valueMin();n=this._valueMax();a=n!==j?(i-j)/(n-j)*100:0;d[g.orientation==="horizontal"?"left":"bottom"]=a+"%";this.handle.stop(1,1)[e?"animate":"css"](d,f.animate);if(c==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[e?"animate":"css"]({width:a+"%"},f.animate);if(c==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-a+"%"},{queue:false,duration:f.animate});if(c==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:a+"%"},f.animate);if(c==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-a+"%"},{queue:false,duration:f.animate})}}});b.extend(b.ui.slider,{version:"1.8.7"})})(jQuery); +(function(b,c){function f(){return++e}function g(){return++a}var e=0,a=0;b.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(d,h){if(d=="selected")this.options.collapsible&& +h==this.options.selected||this.select(h);else{this.options[d]=h;this._tabify()}},_tabId:function(d){return d.title&&d.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+f()},_sanitizeSelector:function(d){return d.replace(/:/g,"\\:")},_cookie:function(){var d=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+g());return b.cookie.apply(null,[d].concat(b.makeArray(arguments)))},_ui:function(d,h){return{tab:d,panel:h,index:this.anchors.index(d)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var d= +b(this);d.html(d.data("label.tabs")).removeData("label.tabs")})},_tabify:function(d){function h(r,u){r.css("display","");!b.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var i=this,j=this.options,n=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=b(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return b("a",this)[0]});this.panels=b([]);this.anchors.each(function(r,u){var v=b(u).attr("href"),w=v.split("#")[0],y;if(w&&(w===location.toString().split("#")[0]|| +(y=b("base")[0])&&w===y.href)){v=u.hash;u.href=v}if(n.test(v))i.panels=i.panels.add(i.element.find(i._sanitizeSelector(v)));else if(v&&v!=="#"){b.data(u,"href.tabs",v);b.data(u,"load.tabs",v.replace(/#.*$/,""));v=i._tabId(u);u.href="#"+v;u=i.element.find("#"+v);if(!u.length){u=b(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(i.panels[r-1]||i.list);u.data("destroy.tabs",true)}i.panels=i.panels.add(u)}else j.disabled.push(r)});if(d){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===c){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(i._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=b.unique(j.disabled.concat(b.map(this.lis.filter(".ui-state-disabled"),function(r){return i.lis.index(r)}))).sort();b.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(b.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(j.selected>=0&&this.anchors.length){i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");i.element.queue("tabs",function(){i._trigger("show",null,i._ui(i.anchors[j.selected],i.element.find(i._sanitizeSelector(i.anchors[j.selected].hash))))});this.load(j.selected)}b(window).bind("unload",function(){i.lis.add(i.anchors).unbind(".tabs");i.lis=i.anchors=i.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);d=0;for(var q;q=this.lis[d];d++)b(q)[b.inArray(d,j.disabled)!=-1&&!b(q).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var l=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+ +r)};this.lis.bind("mouseover.tabs",function(){l("hover",b(this))});this.lis.bind("mouseout.tabs",function(){k("hover",b(this))});this.anchors.bind("focus.tabs",function(){l("focus",b(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",b(this).closest("li"))})}var m,o;if(j.fx)if(b.isArray(j.fx)){m=j.fx[0];o=j.fx[1]}else m=o=j.fx;var p=o?function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){h(u,o);i._trigger("show",null,i._ui(r,u[0]))})}:function(r,u){b(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");i._trigger("show",null,i._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");h(u,m);i.element.dequeue("tabs")})}:function(r,u){i.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");i.element.dequeue("tabs")}; +this.anchors.bind(j.event+".tabs",function(){var r=this,u=b(r).closest("li"),v=i.panels.filter(":not(.ui-tabs-hide)"),w=i.element.find(i._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||i.panels.filter(":animated").length||i._trigger("select",null,i._ui(this,w[0]))===false){this.blur();return false}j.selected=i.anchors.index(this);i.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected= +-1;j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&i._cookie(j.selected,j.cookie);i.element.queue("tabs",function(){p(r,w)});i.load(i.anchors.index(this));this.blur();return false}j.cookie&&i._cookie(j.selected,j.cookie);if(w.length){v.length&&i.element.queue("tabs",function(){s(r,v)});i.element.queue("tabs",function(){p(r,w)});i.load(i.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +b.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(d){if(typeof d=="string")d=this.anchors.index(this.anchors.filter("[href$="+d+"]"));return d},destroy:function(){var d=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var h= +b.data(this,"href.tabs");if(h)this.href=h;var i=b(this).unbind(".tabs");b.each(["href","load","cache"],function(j,n){i.removeData(n+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){b.data(this,"destroy.tabs")?b(this).remove():b(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});d.cookie&&this._cookie(null,d.cookie);return this},add:function(d, +h,i){if(i===c)i=this.anchors.length;var j=this,n=this.options;h=b(n.tabTemplate.replace(/#\{href\}/g,d).replace(/#\{label\}/g,h));d=!d.indexOf("#")?d.replace("#",""):this._tabId(b("a",h)[0]);h.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var q=j.element.find("#"+d);q.length||(q=b(n.panelTemplate).attr("id",d).data("destroy.tabs",true));q.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(i>=this.lis.length){h.appendTo(this.list);q.appendTo(this.list[0].parentNode)}else{h.insertBefore(this.lis[i]); +q.insertBefore(this.panels[i])}n.disabled=b.map(n.disabled,function(l){return l>=i?++l:l});this._tabify();if(this.anchors.length==1){n.selected=0;h.addClass("ui-tabs-selected ui-state-active");q.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[i],this.panels[i]));return this},remove:function(d){d=this._getIndex(d);var h=this.options,i=this.lis.eq(d).remove(),j=this.panels.eq(d).remove(); +if(i.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(d+(d+1<this.anchors.length?1:-1));h.disabled=b.map(b.grep(h.disabled,function(n){return n!=d}),function(n){return n>=d?--n:n});this._tabify();this._trigger("remove",null,this._ui(i.find("a")[0],j[0]));return this},enable:function(d){d=this._getIndex(d);var h=this.options;if(b.inArray(d,h.disabled)!=-1){this.lis.eq(d).removeClass("ui-state-disabled");h.disabled=b.grep(h.disabled,function(i){return i!=d});this._trigger("enable",null, +this._ui(this.anchors[d],this.panels[d]));return this}},disable:function(d){d=this._getIndex(d);var h=this.options;if(d!=h.selected){this.lis.eq(d).addClass("ui-state-disabled");h.disabled.push(d);h.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[d],this.panels[d]))}return this},select:function(d){d=this._getIndex(d);if(d==-1)if(this.options.collapsible&&this.options.selected!=-1)d=this.options.selected;else return this;this.anchors.eq(d).trigger(this.options.event+".tabs");return this}, +load:function(d){d=this._getIndex(d);var h=this,i=this.options,j=this.anchors.eq(d)[0],n=b.data(j,"load.tabs");this.abort();if(!n||this.element.queue("tabs").length!==0&&b.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(d).addClass("ui-state-processing");if(i.spinner){var q=b("span",j);q.data("label.tabs",q.html()).html(i.spinner)}this.xhr=b.ajax(b.extend({},i.ajaxOptions,{url:n,success:function(l,k){h.element.find(h._sanitizeSelector(j.hash)).html(l);h._cleanup();i.cache&&b.data(j, +"cache.tabs",true);h._trigger("load",null,h._ui(h.anchors[d],h.panels[d]));try{i.ajaxOptions.success(l,k)}catch(m){}},error:function(l,k){h._cleanup();h._trigger("load",null,h._ui(h.anchors[d],h.panels[d]));try{i.ajaxOptions.error(l,k,d,j)}catch(m){}}}));h.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(d,h){this.anchors.eq(d).removeData("cache.tabs").data("load.tabs",h);return this},length:function(){return this.anchors.length}});b.extend(b.ui.tabs,{version:"1.8.7"});b.extend(b.ui.tabs.prototype,{rotation:null,rotate:function(d,h){var i=this,j=this.options,n=i._rotate||(i._rotate=function(q){clearTimeout(i.rotation);i.rotation=setTimeout(function(){var l=j.selected;i.select(++l<i.anchors.length?l:0)},d);q&&q.stopPropagation()});h=i._unrotate||(i._unrotate=!h?function(q){q.clientX&& +i.rotate(null)}:function(){t=j.selected;n()});if(d){this.element.bind("tabsshow",n);this.anchors.bind(j.event+".tabs",h);n()}else{clearTimeout(i.rotation);this.element.unbind("tabsshow",n);this.anchors.unbind(j.event+".tabs",h);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery.unobtrusive-ajax.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,165 @@ +/// <reference path="jquery-1.4.4.js" /> + +/*! +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global window: false, jQuery: false */ + +(function ($) { + var data_click = "unobtrusiveAjaxClick", + data_validation = "unobtrusiveValidation"; + + function getFunction(code, argNames) { + var fn = window, parts = (code || "").split("."); + while (fn && parts.length) { + fn = fn[parts.shift()]; + } + if (typeof (fn) === "function") { + return fn; + } + argNames.push(code); + return Function.constructor.apply(null, argNames); + } + + function isMethodProxySafe(method) { + return method === "GET" || method === "POST"; + } + + function asyncOnBeforeSend(xhr, method) { + if (!isMethodProxySafe(method)) { + xhr.setRequestHeader("X-HTTP-Method-Override", method); + } + } + + function asyncOnSuccess(element, data, contentType) { + var mode; + + if (contentType.indexOf("application/x-javascript") !== -1) { // jQuery already executes JavaScript for us + return; + } + + mode = (element.getAttribute("data-ajax-mode") || "").toUpperCase(); + $(element.getAttribute("data-ajax-update")).each(function (i, update) { + var top; + + switch (mode) { + case "BEFORE": + top = update.firstChild; + $("<div />").html(data).contents().each(function () { + update.insertBefore(this, top); + }); + break; + case "AFTER": + $("<div />").html(data).contents().each(function () { + update.appendChild(this); + }); + break; + default: + $(update).html(data); + break; + } + }); + } + + function asyncRequest(element, options) { + var confirm, loading, method, duration; + + confirm = element.getAttribute("data-ajax-confirm"); + if (confirm && !window.confirm(confirm)) { + return; + } + + loading = $(element.getAttribute("data-ajax-loading")); + duration = element.getAttribute("data-ajax-loading-duration") || 0; + + $.extend(options, { + type: element.getAttribute("data-ajax-method") || undefined, + url: element.getAttribute("data-ajax-url") || undefined, + beforeSend: function (xhr) { + var result; + asyncOnBeforeSend(xhr, method); + result = getFunction(element.getAttribute("data-ajax-begin"), ["xhr"]).apply(this, arguments); + if (result !== false) { + loading.show(duration); + } + return result; + }, + complete: function () { + loading.hide(duration); + getFunction(element.getAttribute("data-ajax-complete"), ["xhr", "status"]).apply(this, arguments); + }, + success: function (data, status, xhr) { + asyncOnSuccess(element, data, xhr.getResponseHeader("Content-Type") || "text/html"); + getFunction(element.getAttribute("data-ajax-success"), ["data", "status", "xhr"]).apply(this, arguments); + }, + error: getFunction(element.getAttribute("data-ajax-failure"), ["xhr", "status", "error"]) + }); + + options.data.push({ name: "X-Requested-With", value: "XMLHttpRequest" }); + + method = options.type.toUpperCase(); + if (!isMethodProxySafe(method)) { + options.type = "POST"; + options.data.push({ name: "X-HTTP-Method-Override", value: method }); + } + + $.ajax(options); + } + + function validate(form) { + var validationInfo = $(form).data(data_validation); + return !validationInfo || !validationInfo.validate || validationInfo.validate(); + } + + $("a[data-ajax=true]").live("click", function (evt) { + evt.preventDefault(); + asyncRequest(this, { + url: this.href, + type: "GET", + data: [] + }); + }); + + $("form[data-ajax=true] input[type=image]").live("click", function (evt) { + var name = evt.target.name, + $target = $(evt.target), + form = $target.parents("form")[0], + offset = $target.offset(); + + $(form).data(data_click, [ + { name: name + ".x", value: Math.round(evt.pageX - offset.left) }, + { name: name + ".y", value: Math.round(evt.pageY - offset.top) } + ]); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $("form[data-ajax=true] :submit").live("click", function (evt) { + var name = evt.target.name, + form = $(evt.target).parents("form")[0]; + + $(form).data(data_click, name ? [{ name: name, value: evt.target.value }] : []); + + setTimeout(function () { + $(form).removeData(data_click); + }, 0); + }); + + $("form[data-ajax=true]").live("submit", function (evt) { + var clickInfo = $(this).data(data_click) || []; + evt.preventDefault(); + if (!validate(this)) { + return; + } + asyncRequest(this, { + url: this.action, + type: this.method || "GET", + data: clickInfo.concat($(this).serializeArray()) + }); + }); +}(jQuery)); \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery.unobtrusive-ajax.min.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,5 @@ +/* +** Unobtrusive Ajax support library for jQuery +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var b="unobtrusiveAjaxClick",g="unobtrusiveValidation";function c(d,b){var a=window,c=(d||"").split(".");while(a&&c.length)a=a[c.shift()];if(typeof a==="function")return a;b.push(d);return Function.constructor.apply(null,b)}function d(a){return a==="GET"||a==="POST"}function f(b,a){!d(a)&&b.setRequestHeader("X-HTTP-Method-Override",a)}function h(c,b,e){var d;if(e.indexOf("application/x-javascript")!==-1)return;d=(c.getAttribute("data-ajax-mode")||"").toUpperCase();a(c.getAttribute("data-ajax-update")).each(function(f,c){var e;switch(d){case"BEFORE":e=c.firstChild;a("<div />").html(b).contents().each(function(){c.insertBefore(this,e)});break;case"AFTER":a("<div />").html(b).contents().each(function(){c.appendChild(this)});break;default:a(c).html(b)}})}function e(b,e){var j,k,g,i;j=b.getAttribute("data-ajax-confirm");if(j&&!window.confirm(j))return;k=a(b.getAttribute("data-ajax-loading"));i=b.getAttribute("data-ajax-loading-duration")||0;a.extend(e,{type:b.getAttribute("data-ajax-method")||undefined,url:b.getAttribute("data-ajax-url")||undefined,beforeSend:function(d){var a;f(d,g);a=c(b.getAttribute("data-ajax-begin"),["xhr"]).apply(this,arguments);a!==false&&k.show(i);return a},complete:function(){k.hide(i);c(b.getAttribute("data-ajax-complete"),["xhr","status"]).apply(this,arguments)},success:function(a,e,d){h(b,a,d.getResponseHeader("Content-Type")||"text/html");c(b.getAttribute("data-ajax-success"),["data","status","xhr"]).apply(this,arguments)},error:c(b.getAttribute("data-ajax-failure"),["xhr","status","error"])});e.data.push({name:"X-Requested-With",value:"XMLHttpRequest"});g=e.type.toUpperCase();if(!d(g)){e.type="POST";e.data.push({name:"X-HTTP-Method-Override",value:g})}a.ajax(e)}function i(c){var b=a(c).data(g);return!b||!b.validate||b.validate()}a("a[data-ajax=true]").live("click",function(a){a.preventDefault();e(this,{url:this.href,type:"GET",data:[]})});a("form[data-ajax=true] input[type=image]").live("click",function(c){var g=c.target.name,d=a(c.target),f=d.parents("form")[0],e=d.offset();a(f).data(b,[{name:g+".x",value:Math.round(c.pageX-e.left)},{name:g+".y",value:Math.round(c.pageY-e.top)}]);setTimeout(function(){a(f).removeData(b)},0)});a("form[data-ajax=true] :submit").live("click",function(c){var e=c.target.name,d=a(c.target).parents("form")[0];a(d).data(b,e?[{name:e,value:c.target.value}]:[]);setTimeout(function(){a(d).removeData(b)},0)});a("form[data-ajax=true]").live("submit",function(d){var c=a(this).data(b)||[];d.preventDefault();if(!i(this))return;e(this,{url:this.action,type:this.method||"GET",data:c.concat(a(this).serializeArray())})})})(jQuery); \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery.validate-vsdoc.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,1286 @@ +/* +* This file has been commented to support Visual Studio Intellisense. +* You should not use this file at runtime inside the browser--it is only +* intended to be used only for design-time IntelliSense. Please use the +* standard jQuery library for all production use. +* +* Comment version: 1.7 +*/ + +/* +* Note: While Microsoft is not the author of this file, Microsoft is +* offering you a license subject to the terms of the Microsoft Software +* License Terms for Microsoft ASP.NET Model View Controller 3. +* Microsoft reserves all other rights. The notices below are provided +* for informational purposes only and are not the license terms under +* which Microsoft distributed this file. +* +* jQuery validation plug-in 1.7 +* +* http://bassistance.de/jquery-plugins/jquery-plugin-validation/ +* http://docs.jquery.com/Plugins/Validation +* +* Copyright (c) 2006 - 2008 Jörn Zaefferer +* +* $Id: jquery.validate.js 6403 2009-06-17 14:27:16Z joern.zaefferer $ +* +*/ + +(function($) { + +$.extend($.fn, { + // http://docs.jquery.com/Plugins/Validation/validate + validate: function( options ) { + /// <summary> + /// Validates the selected form. This method sets up event handlers for submit, focus, + /// keyup, blur and click to trigger validation of the entire form or individual + /// elements. Each one can be disabled, see the onxxx options (onsubmit, onfocusout, + /// onkeyup, onclick). focusInvalid focuses elements when submitting a invalid form. + /// </summary> + /// <param name="options" type="Options"> + /// A set of key/value pairs that configure the validate. All options are optional. + /// </param> + /// <returns type="Validator" /> + + // if nothing is selected, return nothing; can't chain anyway + if (!this.length) { + options && options.debug && window.console && console.warn( "nothing selected, can't validate, returning nothing" ); + return; + } + + // check if a validator for this form was already created + var validator = $.data(this[0], 'validator'); + if ( validator ) { + return validator; + } + + validator = new $.validator( options, this[0] ); + $.data(this[0], 'validator', validator); + + if ( validator.settings.onsubmit ) { + + // allow suppresing validation by adding a cancel class to the submit button + this.find("input, button").filter(".cancel").click(function() { + validator.cancelSubmit = true; + }); + + // when a submitHandler is used, capture the submitting button + if (validator.settings.submitHandler) { + this.find("input, button").filter(":submit").click(function() { + validator.submitButton = this; + }); + } + + // validate the form on submit + this.submit( function( event ) { + if ( validator.settings.debug ) + // prevent form submit to be able to see console output + event.preventDefault(); + + function handle() { + if ( validator.settings.submitHandler ) { + if (validator.submitButton) { + // insert a hidden input as a replacement for the missing submit button + var hidden = $("<input type='hidden'/>").attr("name", validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm); + } + validator.settings.submitHandler.call( validator, validator.currentForm ); + if (validator.submitButton) { + // and clean up afterwards; thanks to no-block-scope, hidden can be referenced + hidden.remove(); + } + return false; + } + return true; + } + + // prevent submit for invalid forms or custom submit handlers + if ( validator.cancelSubmit ) { + validator.cancelSubmit = false; + return handle(); + } + if ( validator.form() ) { + if ( validator.pendingRequest ) { + validator.formSubmitted = true; + return false; + } + return handle(); + } else { + validator.focusInvalid(); + return false; + } + }); + } + + return validator; + }, + // http://docs.jquery.com/Plugins/Validation/valid + valid: function() { + /// <summary> + /// Checks if the selected form is valid or if all selected elements are valid. + /// validate() needs to be called on the form before checking it using this method. + /// </summary> + /// <returns type="Boolean" /> + + if ( $(this[0]).is('form')) { + return this.validate().form(); + } else { + var valid = true; + var validator = $(this[0].form).validate(); + this.each(function() { + valid &= validator.element(this); + }); + return valid; + } + }, + // attributes: space seperated list of attributes to retrieve and remove + removeAttrs: function(attributes) { + /// <summary> + /// Remove the specified attributes from the first matched element and return them. + /// </summary> + /// <param name="attributes" type="String"> + /// A space-seperated list of attribute names to remove. + /// </param> + /// <returns type="" /> + + var result = {}, + $element = this; + $.each(attributes.split(/\s/), function(index, value) { + result[value] = $element.attr(value); + $element.removeAttr(value); + }); + return result; + }, + // http://docs.jquery.com/Plugins/Validation/rules + rules: function(command, argument) { + /// <summary> + /// Return the validations rules for the first selected element. + /// </summary> + /// <param name="command" type="String"> + /// Can be either "add" or "remove". + /// </param> + /// <param name="argument" type=""> + /// A list of rules to add or remove. + /// </param> + /// <returns type="" /> + + var element = this[0]; + + if (command) { + var settings = $.data(element.form, 'validator').settings; + var staticRules = settings.rules; + var existingRules = $.validator.staticRules(element); + switch(command) { + case "add": + $.extend(existingRules, $.validator.normalizeRule(argument)); + staticRules[element.name] = existingRules; + if (argument.messages) + settings.messages[element.name] = $.extend( settings.messages[element.name], argument.messages ); + break; + case "remove": + if (!argument) { + delete staticRules[element.name]; + return existingRules; + } + var filtered = {}; + $.each(argument.split(/\s/), function(index, method) { + filtered[method] = existingRules[method]; + delete existingRules[method]; + }); + return filtered; + } + } + + var data = $.validator.normalizeRules( + $.extend( + {}, + $.validator.metadataRules(element), + $.validator.classRules(element), + $.validator.attributeRules(element), + $.validator.staticRules(element) + ), element); + + // make sure required is at front + if (data.required) { + var param = data.required; + delete data.required; + data = $.extend({required: param}, data); + } + + return data; + } +}); + +// Custom selectors +$.extend($.expr[":"], { + // http://docs.jquery.com/Plugins/Validation/blank + blank: function(a) {return !$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/filled + filled: function(a) {return !!$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/unchecked + unchecked: function(a) {return !a.checked;} +}); + +// constructor for validator +$.validator = function( options, form ) { + this.settings = $.extend( true, {}, $.validator.defaults, options ); + this.currentForm = form; + this.init(); +}; + +$.validator.format = function(source, params) { + /// <summary> + /// Replaces {n} placeholders with arguments. + /// One or more arguments can be passed, in addition to the string template itself, to insert + /// into the string. + /// </summary> + /// <param name="source" type="String"> + /// The string to format. + /// </param> + /// <param name="params" type="String"> + /// The first argument to insert, or an array of Strings to insert + /// </param> + /// <returns type="String" /> + + if ( arguments.length == 1 ) + return function() { + var args = $.makeArray(arguments); + args.unshift(source); + return $.validator.format.apply( this, args ); + }; + if ( arguments.length > 2 && params.constructor != Array ) { + params = $.makeArray(arguments).slice(1); + } + if ( params.constructor != Array ) { + params = [ params ]; + } + $.each(params, function(i, n) { + source = source.replace(new RegExp("\\{" + i + "\\}", "g"), n); + }); + return source; +}; + +$.extend($.validator, { + + defaults: { + messages: {}, + groups: {}, + rules: {}, + errorClass: "error", + validClass: "valid", + errorElement: "label", + focusInvalid: true, + errorContainer: $( [] ), + errorLabelContainer: $( [] ), + onsubmit: true, + ignore: [], + ignoreTitle: false, + onfocusin: function(element) { + this.lastActive = element; + + // hide error label and remove error class on focus if enabled + if ( this.settings.focusCleanup && !this.blockFocusCleanup ) { + this.settings.unhighlight && this.settings.unhighlight.call( this, element, this.settings.errorClass, this.settings.validClass ); + this.errorsFor(element).hide(); + } + }, + onfocusout: function(element) { + if ( !this.checkable(element) && (element.name in this.submitted || !this.optional(element)) ) { + this.element(element); + } + }, + onkeyup: function(element) { + if ( element.name in this.submitted || element == this.lastElement ) { + this.element(element); + } + }, + onclick: function(element) { + // click on selects, radiobuttons and checkboxes + if ( element.name in this.submitted ) + this.element(element); + // or option elements, check parent select in that case + else if (element.parentNode.name in this.submitted) + this.element(element.parentNode); + }, + highlight: function( element, errorClass, validClass ) { + $(element).addClass(errorClass).removeClass(validClass); + }, + unhighlight: function( element, errorClass, validClass ) { + $(element).removeClass(errorClass).addClass(validClass); + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/setDefaults + setDefaults: function(settings) { + /// <summary> + /// Modify default settings for validation. + /// Accepts everything that Plugins/Validation/validate accepts. + /// </summary> + /// <param name="settings" type="Options"> + /// Options to set as default. + /// </param> + /// <returns type="undefined" /> + + $.extend( $.validator.defaults, settings ); + }, + + messages: { + required: "This field is required.", + remote: "Please fix this field.", + email: "Please enter a valid email address.", + url: "Please enter a valid URL.", + date: "Please enter a valid date.", + dateISO: "Please enter a valid date (ISO).", + number: "Please enter a valid number.", + digits: "Please enter only digits.", + creditcard: "Please enter a valid credit card number.", + equalTo: "Please enter the same value again.", + accept: "Please enter a value with a valid extension.", + maxlength: $.validator.format("Please enter no more than {0} characters."), + minlength: $.validator.format("Please enter at least {0} characters."), + rangelength: $.validator.format("Please enter a value between {0} and {1} characters long."), + range: $.validator.format("Please enter a value between {0} and {1}."), + max: $.validator.format("Please enter a value less than or equal to {0}."), + min: $.validator.format("Please enter a value greater than or equal to {0}.") + }, + + autoCreateRanges: false, + + prototype: { + + init: function() { + this.labelContainer = $(this.settings.errorLabelContainer); + this.errorContext = this.labelContainer.length && this.labelContainer || $(this.currentForm); + this.containers = $(this.settings.errorContainer).add( this.settings.errorLabelContainer ); + this.submitted = {}; + this.valueCache = {}; + this.pendingRequest = 0; + this.pending = {}; + this.invalid = {}; + this.reset(); + + var groups = (this.groups = {}); + $.each(this.settings.groups, function(key, value) { + $.each(value.split(/\s/), function(index, name) { + groups[name] = key; + }); + }); + var rules = this.settings.rules; + $.each(rules, function(key, value) { + rules[key] = $.validator.normalizeRule(value); + }); + + function delegate(event) { + var validator = $.data(this[0].form, "validator"), + eventType = "on" + event.type.replace(/^validate/, ""); + validator.settings[eventType] && validator.settings[eventType].call(validator, this[0] ); + } + $(this.currentForm) + .validateDelegate(":text, :password, :file, select, textarea", "focusin focusout keyup", delegate) + .validateDelegate(":radio, :checkbox, select, option", "click", delegate); + + if (this.settings.invalidHandler) + $(this.currentForm).bind("invalid-form.validate", this.settings.invalidHandler); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/form + form: function() { + /// <summary> + /// Validates the form, returns true if it is valid, false otherwise. + /// This behaves as a normal submit event, but returns the result. + /// </summary> + /// <returns type="Boolean" /> + + this.checkForm(); + $.extend(this.submitted, this.errorMap); + this.invalid = $.extend({}, this.errorMap); + if (!this.valid()) + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.showErrors(); + return this.valid(); + }, + + checkForm: function() { + this.prepareForm(); + for ( var i = 0, elements = (this.currentElements = this.elements()); elements[i]; i++ ) { + this.check( elements[i] ); + } + return this.valid(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/element + element: function( element ) { + /// <summary> + /// Validates a single element, returns true if it is valid, false otherwise. + /// This behaves as validation on blur or keyup, but returns the result. + /// </summary> + /// <param name="element" type="Selector"> + /// An element to validate, must be inside the validated form. + /// </param> + /// <returns type="Boolean" /> + + element = this.clean( element ); + this.lastElement = element; + this.prepareElement( element ); + this.currentElements = $(element); + var result = this.check( element ); + if ( result ) { + delete this.invalid[element.name]; + } else { + this.invalid[element.name] = true; + } + if ( !this.numberOfInvalids() ) { + // Hide error containers on last error + this.toHide = this.toHide.add( this.containers ); + } + this.showErrors(); + return result; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/showErrors + showErrors: function(errors) { + /// <summary> + /// Show the specified messages. + /// Keys have to refer to the names of elements, values are displayed for those elements, using the configured error placement. + /// </summary> + /// <param name="errors" type="Object"> + /// One or more key/value pairs of input names and messages. + /// </param> + /// <returns type="undefined" /> + + if(errors) { + // add items to error list and map + $.extend( this.errorMap, errors ); + this.errorList = []; + for ( var name in errors ) { + this.errorList.push({ + message: errors[name], + element: this.findByName(name)[0] + }); + } + // remove items from success list + this.successList = $.grep( this.successList, function(element) { + return !(element.name in errors); + }); + } + this.settings.showErrors + ? this.settings.showErrors.call( this, this.errorMap, this.errorList ) + : this.defaultShowErrors(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/resetForm + resetForm: function() { + /// <summary> + /// Resets the controlled form. + /// Resets input fields to their original value (requires form plugin), removes classes + /// indicating invalid elements and hides error messages. + /// </summary> + /// <returns type="undefined" /> + + if ( $.fn.resetForm ) + $( this.currentForm ).resetForm(); + this.submitted = {}; + this.prepareForm(); + this.hideErrors(); + this.elements().removeClass( this.settings.errorClass ); + }, + + numberOfInvalids: function() { + /// <summary> + /// Returns the number of invalid fields. + /// This depends on the internal validator state. It covers all fields only after + /// validating the complete form (on submit or via $("form").valid()). After validating + /// a single element, only that element is counted. Most useful in combination with the + /// invalidHandler-option. + /// </summary> + /// <returns type="Number" /> + + return this.objectLength(this.invalid); + }, + + objectLength: function( obj ) { + var count = 0; + for ( var i in obj ) + count++; + return count; + }, + + hideErrors: function() { + this.addWrapper( this.toHide ).hide(); + }, + + valid: function() { + return this.size() == 0; + }, + + size: function() { + return this.errorList.length; + }, + + focusInvalid: function() { + if( this.settings.focusInvalid ) { + try { + $(this.findLastActive() || this.errorList.length && this.errorList[0].element || []) + .filter(":visible") + .focus() + // manually trigger focusin event; without it, focusin handler isn't called, findLastActive won't have anything to find + .trigger("focusin"); + } catch(e) { + // ignore IE throwing errors when focusing hidden elements + } + } + }, + + findLastActive: function() { + var lastActive = this.lastActive; + return lastActive && $.grep(this.errorList, function(n) { + return n.element.name == lastActive.name; + }).length == 1 && lastActive; + }, + + elements: function() { + var validator = this, + rulesCache = {}; + + // select all valid inputs inside the form (no submit or reset buttons) + // workaround $Query([]).add until http://dev.jquery.com/ticket/2114 is solved + return $([]).add(this.currentForm.elements) + .filter(":input") + .not(":submit, :reset, :image, [disabled]") + .not( this.settings.ignore ) + .filter(function() { + !this.name && validator.settings.debug && window.console && console.error( "%o has no name assigned", this); + + // select only the first element for each name, and only those with rules specified + if ( this.name in rulesCache || !validator.objectLength($(this).rules()) ) + return false; + + rulesCache[this.name] = true; + return true; + }); + }, + + clean: function( selector ) { + return $( selector )[0]; + }, + + errors: function() { + return $( this.settings.errorElement + "." + this.settings.errorClass, this.errorContext ); + }, + + reset: function() { + this.successList = []; + this.errorList = []; + this.errorMap = {}; + this.toShow = $([]); + this.toHide = $([]); + this.currentElements = $([]); + }, + + prepareForm: function() { + this.reset(); + this.toHide = this.errors().add( this.containers ); + }, + + prepareElement: function( element ) { + this.reset(); + this.toHide = this.errorsFor(element); + }, + + check: function( element ) { + element = this.clean( element ); + + // if radio/checkbox, validate first element in group instead + if (this.checkable(element)) { + element = this.findByName( element.name )[0]; + } + + var rules = $(element).rules(); + var dependencyMismatch = false; + for( method in rules ) { + var rule = { method: method, parameters: rules[method] }; + try { + var result = $.validator.methods[method].call( this, element.value.replace(/\r/g, ""), element, rule.parameters ); + + // if a method indicates that the field is optional and therefore valid, + // don't mark it as valid when there are no other rules + if ( result == "dependency-mismatch" ) { + dependencyMismatch = true; + continue; + } + dependencyMismatch = false; + + if ( result == "pending" ) { + this.toHide = this.toHide.not( this.errorsFor(element) ); + return; + } + + if( !result ) { + this.formatAndAdd( element, rule ); + return false; + } + } catch(e) { + this.settings.debug && window.console && console.log("exception occured when checking element " + element.id + + ", check the '" + rule.method + "' method", e); + throw e; + } + } + if (dependencyMismatch) + return; + if ( this.objectLength(rules) ) + this.successList.push(element); + return true; + }, + + // return the custom message for the given element and validation method + // specified in the element's "messages" metadata + customMetaMessage: function(element, method) { + if (!$.metadata) + return; + + var meta = this.settings.meta + ? $(element).metadata()[this.settings.meta] + : $(element).metadata(); + + return meta && meta.messages && meta.messages[method]; + }, + + // return the custom message for the given element name and validation method + customMessage: function( name, method ) { + var m = this.settings.messages[name]; + return m && (m.constructor == String + ? m + : m[method]); + }, + + // return the first defined argument, allowing empty strings + findDefined: function() { + for(var i = 0; i < arguments.length; i++) { + if (arguments[i] !== undefined) + return arguments[i]; + } + return undefined; + }, + + defaultMessage: function( element, method) { + return this.findDefined( + this.customMessage( element.name, method ), + this.customMetaMessage( element, method ), + // title is never undefined, so handle empty string as undefined + !this.settings.ignoreTitle && element.title || undefined, + $.validator.messages[method], + "<strong>Warning: No message defined for " + element.name + "</strong>" + ); + }, + + formatAndAdd: function( element, rule ) { + var message = this.defaultMessage( element, rule.method ), + theregex = /\$?\{(\d+)\}/g; + if ( typeof message == "function" ) { + message = message.call(this, rule.parameters, element); + } else if (theregex.test(message)) { + message = jQuery.format(message.replace(theregex, '{$1}'), rule.parameters); + } + this.errorList.push({ + message: message, + element: element + }); + + this.errorMap[element.name] = message; + this.submitted[element.name] = message; + }, + + addWrapper: function(toToggle) { + if ( this.settings.wrapper ) + toToggle = toToggle.add( toToggle.parent( this.settings.wrapper ) ); + return toToggle; + }, + + defaultShowErrors: function() { + for ( var i = 0; this.errorList[i]; i++ ) { + var error = this.errorList[i]; + this.settings.highlight && this.settings.highlight.call( this, error.element, this.settings.errorClass, this.settings.validClass ); + this.showLabel( error.element, error.message ); + } + if( this.errorList.length ) { + this.toShow = this.toShow.add( this.containers ); + } + if (this.settings.success) { + for ( var i = 0; this.successList[i]; i++ ) { + this.showLabel( this.successList[i] ); + } + } + if (this.settings.unhighlight) { + for ( var i = 0, elements = this.validElements(); elements[i]; i++ ) { + this.settings.unhighlight.call( this, elements[i], this.settings.errorClass, this.settings.validClass ); + } + } + this.toHide = this.toHide.not( this.toShow ); + this.hideErrors(); + this.addWrapper( this.toShow ).show(); + }, + + validElements: function() { + return this.currentElements.not(this.invalidElements()); + }, + + invalidElements: function() { + return $(this.errorList).map(function() { + return this.element; + }); + }, + + showLabel: function(element, message) { + var label = this.errorsFor( element ); + if ( label.length ) { + // refresh error/success class + label.removeClass().addClass( this.settings.errorClass ); + + // check if we have a generated label, replace the message then + label.attr("generated") && label.html(message); + } else { + // create label + label = $("<" + this.settings.errorElement + "/>") + .attr({"for": this.idOrName(element), generated: true}) + .addClass(this.settings.errorClass) + .html(message || ""); + if ( this.settings.wrapper ) { + // make sure the element is visible, even in IE + // actually showing the wrapped element is handled elsewhere + label = label.hide().show().wrap("<" + this.settings.wrapper + "/>").parent(); + } + if ( !this.labelContainer.append(label).length ) + this.settings.errorPlacement + ? this.settings.errorPlacement(label, $(element) ) + : label.insertAfter(element); + } + if ( !message && this.settings.success ) { + label.text(""); + typeof this.settings.success == "string" + ? label.addClass( this.settings.success ) + : this.settings.success( label ); + } + this.toShow = this.toShow.add(label); + }, + + errorsFor: function(element) { + var name = this.idOrName(element); + return this.errors().filter(function() { + return $(this).attr('for') == name; + }); + }, + + idOrName: function(element) { + return this.groups[element.name] || (this.checkable(element) ? element.name : element.id || element.name); + }, + + checkable: function( element ) { + return /radio|checkbox/i.test(element.type); + }, + + findByName: function( name ) { + // select by name and filter by form for performance over form.find("[name=...]") + var form = this.currentForm; + return $(document.getElementsByName(name)).map(function(index, element) { + return element.form == form && element.name == name && element || null; + }); + }, + + getLength: function(value, element) { + switch( element.nodeName.toLowerCase() ) { + case 'select': + return $("option:selected", element).length; + case 'input': + if( this.checkable( element) ) + return this.findByName(element.name).filter(':checked').length; + } + return value.length; + }, + + depend: function(param, element) { + return this.dependTypes[typeof param] + ? this.dependTypes[typeof param](param, element) + : true; + }, + + dependTypes: { + "boolean": function(param, element) { + return param; + }, + "string": function(param, element) { + return !!$(param, element.form).length; + }, + "function": function(param, element) { + return param(element); + } + }, + + optional: function(element) { + return !$.validator.methods.required.call(this, $.trim(element.value), element) && "dependency-mismatch"; + }, + + startRequest: function(element) { + if (!this.pending[element.name]) { + this.pendingRequest++; + this.pending[element.name] = true; + } + }, + + stopRequest: function(element, valid) { + this.pendingRequest--; + // sometimes synchronization fails, make sure pendingRequest is never < 0 + if (this.pendingRequest < 0) + this.pendingRequest = 0; + delete this.pending[element.name]; + if ( valid && this.pendingRequest == 0 && this.formSubmitted && this.form() ) { + $(this.currentForm).submit(); + this.formSubmitted = false; + } else if (!valid && this.pendingRequest == 0 && this.formSubmitted) { + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.formSubmitted = false; + } + }, + + previousValue: function(element) { + return $.data(element, "previousValue") || $.data(element, "previousValue", { + old: null, + valid: true, + message: this.defaultMessage( element, "remote" ) + }); + } + + }, + + classRuleSettings: { + required: {required: true}, + email: {email: true}, + url: {url: true}, + date: {date: true}, + dateISO: {dateISO: true}, + dateDE: {dateDE: true}, + number: {number: true}, + numberDE: {numberDE: true}, + digits: {digits: true}, + creditcard: {creditcard: true} + }, + + addClassRules: function(className, rules) { + /// <summary> + /// Add a compound class method - useful to refactor common combinations of rules into a single + /// class. + /// </summary> + /// <param name="name" type="String"> + /// The name of the class rule to add + /// </param> + /// <param name="rules" type="Options"> + /// The compound rules + /// </param> + /// <returns type="undefined" /> + + className.constructor == String ? + this.classRuleSettings[className] = rules : + $.extend(this.classRuleSettings, className); + }, + + classRules: function(element) { + var rules = {}; + var classes = $(element).attr('class'); + classes && $.each(classes.split(' '), function() { + if (this in $.validator.classRuleSettings) { + $.extend(rules, $.validator.classRuleSettings[this]); + } + }); + return rules; + }, + + attributeRules: function(element) { + var rules = {}; + var $element = $(element); + + for (method in $.validator.methods) { + var value = $element.attr(method); + if (value) { + rules[method] = value; + } + } + + // maxlength may be returned as -1, 2147483647 (IE) and 524288 (safari) for text inputs + if (rules.maxlength && /-1|2147483647|524288/.test(rules.maxlength)) { + delete rules.maxlength; + } + + return rules; + }, + + metadataRules: function(element) { + if (!$.metadata) return {}; + + var meta = $.data(element.form, 'validator').settings.meta; + return meta ? + $(element).metadata()[meta] : + $(element).metadata(); + }, + + staticRules: function(element) { + var rules = {}; + var validator = $.data(element.form, 'validator'); + if (validator.settings.rules) { + rules = $.validator.normalizeRule(validator.settings.rules[element.name]) || {}; + } + return rules; + }, + + normalizeRules: function(rules, element) { + // handle dependency check + $.each(rules, function(prop, val) { + // ignore rule when param is explicitly false, eg. required:false + if (val === false) { + delete rules[prop]; + return; + } + if (val.param || val.depends) { + var keepRule = true; + switch (typeof val.depends) { + case "string": + keepRule = !!$(val.depends, element.form).length; + break; + case "function": + keepRule = val.depends.call(element, element); + break; + } + if (keepRule) { + rules[prop] = val.param !== undefined ? val.param : true; + } else { + delete rules[prop]; + } + } + }); + + // evaluate parameters + $.each(rules, function(rule, parameter) { + rules[rule] = $.isFunction(parameter) ? parameter(element) : parameter; + }); + + // clean number parameters + $.each(['minlength', 'maxlength', 'min', 'max'], function() { + if (rules[this]) { + rules[this] = Number(rules[this]); + } + }); + $.each(['rangelength', 'range'], function() { + if (rules[this]) { + rules[this] = [Number(rules[this][0]), Number(rules[this][1])]; + } + }); + + if ($.validator.autoCreateRanges) { + // auto-create ranges + if (rules.min && rules.max) { + rules.range = [rules.min, rules.max]; + delete rules.min; + delete rules.max; + } + if (rules.minlength && rules.maxlength) { + rules.rangelength = [rules.minlength, rules.maxlength]; + delete rules.minlength; + delete rules.maxlength; + } + } + + // To support custom messages in metadata ignore rule methods titled "messages" + if (rules.messages) { + delete rules.messages; + } + + return rules; + }, + + // Converts a simple string to a {string: true} rule, e.g., "required" to {required:true} + normalizeRule: function(data) { + if( typeof data == "string" ) { + var transformed = {}; + $.each(data.split(/\s/), function() { + transformed[this] = true; + }); + data = transformed; + } + return data; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/addMethod + addMethod: function(name, method, message) { + /// <summary> + /// Add a custom validation method. It must consist of a name (must be a legal javascript + /// identifier), a javascript based function and a default string message. + /// </summary> + /// <param name="name" type="String"> + /// The name of the method, used to identify and referencing it, must be a valid javascript + /// identifier + /// </param> + /// <param name="method" type="Function"> + /// The actual method implementation, returning true if an element is valid + /// </param> + /// <param name="message" type="String" optional="true"> + /// (Optional) The default message to display for this method. Can be a function created by + /// jQuery.validator.format(value). When undefined, an already existing message is used + /// (handy for localization), otherwise the field-specific messages have to be defined. + /// </param> + /// <returns type="undefined" /> + + $.validator.methods[name] = method; + $.validator.messages[name] = message != undefined ? message : $.validator.messages[name]; + if (method.length < 3) { + $.validator.addClassRules(name, $.validator.normalizeRule(name)); + } + }, + + methods: { + + // http://docs.jquery.com/Plugins/Validation/Methods/required + required: function(value, element, param) { + // check if dependency is met + if ( !this.depend(param, element) ) + return "dependency-mismatch"; + switch( element.nodeName.toLowerCase() ) { + case 'select': + // could be an array for select-multiple or a string, both are fine this way + var val = $(element).val(); + return val && val.length > 0; + case 'input': + if ( this.checkable(element) ) + return this.getLength(value, element) > 0; + default: + return $.trim(value).length > 0; + } + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/remote + remote: function(value, element, param) { + if ( this.optional(element) ) + return "dependency-mismatch"; + + var previous = this.previousValue(element); + if (!this.settings.messages[element.name] ) + this.settings.messages[element.name] = {}; + previous.originalMessage = this.settings.messages[element.name].remote; + this.settings.messages[element.name].remote = previous.message; + + param = typeof param == "string" && {url:param} || param; + + if ( previous.old !== value ) { + previous.old = value; + var validator = this; + this.startRequest(element); + var data = {}; + data[element.name] = value; + $.ajax($.extend(true, { + url: param, + mode: "abort", + port: "validate" + element.name, + dataType: "json", + data: data, + success: function(response) { + validator.settings.messages[element.name].remote = previous.originalMessage; + var valid = response === true; + if ( valid ) { + var submitted = validator.formSubmitted; + validator.prepareElement(element); + validator.formSubmitted = submitted; + validator.successList.push(element); + validator.showErrors(); + } else { + var errors = {}; + var message = (previous.message = response || validator.defaultMessage( element, "remote" )); + errors[element.name] = $.isFunction(message) ? message(value) : message; + validator.showErrors(errors); + } + previous.valid = valid; + validator.stopRequest(element, valid); + } + }, param)); + return "pending"; + } else if( this.pending[element.name] ) { + return "pending"; + } + return previous.valid; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/minlength + minlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/maxlength + maxlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/rangelength + rangelength: function(value, element, param) { + var length = this.getLength($.trim(value), element); + return this.optional(element) || ( length >= param[0] && length <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/min + min: function( value, element, param ) { + return this.optional(element) || value >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/max + max: function( value, element, param ) { + return this.optional(element) || value <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/range + range: function( value, element, param ) { + return this.optional(element) || ( value >= param[0] && value <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/email + email: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/ + return this.optional(element) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/url + url: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/iri/ + return this.optional(element) || /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/date + date: function(value, element) { + return this.optional(element) || !/Invalid|NaN/.test(new Date(value)); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/dateISO + dateISO: function(value, element) { + return this.optional(element) || /^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/number + number: function(value, element) { + return this.optional(element) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/digits + digits: function(value, element) { + return this.optional(element) || /^\d+$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/creditcard + // based on http://en.wikipedia.org/wiki/Luhn + creditcard: function(value, element) { + if ( this.optional(element) ) + return "dependency-mismatch"; + // accept only digits and dashes + if (/[^0-9-]+/.test(value)) + return false; + var nCheck = 0, + nDigit = 0, + bEven = false; + + value = value.replace(/\D/g, ""); + + for (var n = value.length - 1; n >= 0; n--) { + var cDigit = value.charAt(n); + var nDigit = parseInt(cDigit, 10); + if (bEven) { + if ((nDigit *= 2) > 9) + nDigit -= 9; + } + nCheck += nDigit; + bEven = !bEven; + } + + return (nCheck % 10) == 0; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/accept + accept: function(value, element, param) { + param = typeof param == "string" ? param.replace(/,/g, '|') : "png|jpe?g|gif"; + return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i")); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/equalTo + equalTo: function(value, element, param) { + // bind to the blur event of the target in order to revalidate whenever the target field is updated + // TODO find a way to bind the event just once, avoiding the unbind-rebind overhead + var target = $(param).unbind(".validate-equalTo").bind("blur.validate-equalTo", function() { + $(element).valid(); + }); + return value == target.val(); + } + + } + +}); + +// deprecated, use $.validator.format instead +$.format = $.validator.format; + +})(jQuery); + +// ajax mode: abort +// usage: $.ajax({ mode: "abort"[, port: "uniqueport"]}); +// if mode:"abort" is used, the previous request on that port (port can be undefined) is aborted via XMLHttpRequest.abort() +;(function($) { + var ajax = $.ajax; + var pendingRequests = {}; + $.ajax = function(settings) { + // create settings for compatibility with ajaxSetup + settings = $.extend(settings, $.extend({}, $.ajaxSettings, settings)); + var port = settings.port; + if (settings.mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + return (pendingRequests[port] = ajax.apply(this, arguments)); + } + return ajax.apply(this, arguments); + }; +})(jQuery); + +// provides cross-browser focusin and focusout events +// IE has native support, in other browsers, use event caputuring (neither bubbles) + +// provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation +// handler is only called when $(event.target).is(delegate), in the scope of the jquery-object for event.target +;(function($) { + // only implement if not provided by jQuery core (since 1.4) + // TODO verify if jQuery 1.4's implementation is compatible with older jQuery special-event APIs + if (!jQuery.event.special.focusin && !jQuery.event.special.focusout && document.addEventListener) { + $.each({ + focus: 'focusin', + blur: 'focusout' + }, function( original, fix ){ + $.event.special[fix] = { + setup:function() { + this.addEventListener( original, handler, true ); + }, + teardown:function() { + this.removeEventListener( original, handler, true ); + }, + handler: function(e) { + arguments[0] = $.event.fix(e); + arguments[0].type = fix; + return $.event.handle.apply(this, arguments); + } + }; + function handler(e) { + e = $.event.fix(e); + e.type = fix; + return $.event.handle.call(this, e); + } + }); + }; + $.extend($.fn, { + validateDelegate: function(delegate, type, handler) { + return this.bind(type, function(event) { + var target = $(event.target); + if (target.is(delegate)) { + return handler.apply(target, arguments); + } + }); + } + }); +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery.validate.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,1150 @@ +/* +* Note: While Microsoft is not the author of this file, Microsoft is +* offering you a license subject to the terms of the Microsoft Software +* License Terms for Microsoft ASP.NET Model View Controller 3. +* Microsoft reserves all other rights. The notices below are provided +* for informational purposes only and are not the license terms under +* which Microsoft distributed this file. +* +* jQuery validation plug-in 1.7 +* +* http://bassistance.de/jquery-plugins/jquery-plugin-validation/ +* http://docs.jquery.com/Plugins/Validation +* +* Copyright (c) 2006 - 2008 Jörn Zaefferer +* +* $Id: jquery.validate.js 6403 2009-06-17 14:27:16Z joern.zaefferer $ +* +*/ + +(function($) { + +$.extend($.fn, { + // http://docs.jquery.com/Plugins/Validation/validate + validate: function( options ) { + + // if nothing is selected, return nothing; can't chain anyway + if (!this.length) { + options && options.debug && window.console && console.warn( "nothing selected, can't validate, returning nothing" ); + return; + } + + // check if a validator for this form was already created + var validator = $.data(this[0], 'validator'); + if ( validator ) { + return validator; + } + + validator = new $.validator( options, this[0] ); + $.data(this[0], 'validator', validator); + + if ( validator.settings.onsubmit ) { + + // allow suppresing validation by adding a cancel class to the submit button + this.find("input, button").filter(".cancel").click(function() { + validator.cancelSubmit = true; + }); + + // when a submitHandler is used, capture the submitting button + if (validator.settings.submitHandler) { + this.find("input, button").filter(":submit").click(function() { + validator.submitButton = this; + }); + } + + // validate the form on submit + this.submit( function( event ) { + if ( validator.settings.debug ) + // prevent form submit to be able to see console output + event.preventDefault(); + + function handle() { + if ( validator.settings.submitHandler ) { + if (validator.submitButton) { + // insert a hidden input as a replacement for the missing submit button + var hidden = $("<input type='hidden'/>").attr("name", validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm); + } + validator.settings.submitHandler.call( validator, validator.currentForm ); + if (validator.submitButton) { + // and clean up afterwards; thanks to no-block-scope, hidden can be referenced + hidden.remove(); + } + return false; + } + return true; + } + + // prevent submit for invalid forms or custom submit handlers + if ( validator.cancelSubmit ) { + validator.cancelSubmit = false; + return handle(); + } + if ( validator.form() ) { + if ( validator.pendingRequest ) { + validator.formSubmitted = true; + return false; + } + return handle(); + } else { + validator.focusInvalid(); + return false; + } + }); + } + + return validator; + }, + // http://docs.jquery.com/Plugins/Validation/valid + valid: function() { + if ( $(this[0]).is('form')) { + return this.validate().form(); + } else { + var valid = true; + var validator = $(this[0].form).validate(); + this.each(function() { + valid &= validator.element(this); + }); + return valid; + } + }, + // attributes: space seperated list of attributes to retrieve and remove + removeAttrs: function(attributes) { + var result = {}, + $element = this; + $.each(attributes.split(/\s/), function(index, value) { + result[value] = $element.attr(value); + $element.removeAttr(value); + }); + return result; + }, + // http://docs.jquery.com/Plugins/Validation/rules + rules: function(command, argument) { + var element = this[0]; + + if (command) { + var settings = $.data(element.form, 'validator').settings; + var staticRules = settings.rules; + var existingRules = $.validator.staticRules(element); + switch(command) { + case "add": + $.extend(existingRules, $.validator.normalizeRule(argument)); + staticRules[element.name] = existingRules; + if (argument.messages) + settings.messages[element.name] = $.extend( settings.messages[element.name], argument.messages ); + break; + case "remove": + if (!argument) { + delete staticRules[element.name]; + return existingRules; + } + var filtered = {}; + $.each(argument.split(/\s/), function(index, method) { + filtered[method] = existingRules[method]; + delete existingRules[method]; + }); + return filtered; + } + } + + var data = $.validator.normalizeRules( + $.extend( + {}, + $.validator.metadataRules(element), + $.validator.classRules(element), + $.validator.attributeRules(element), + $.validator.staticRules(element) + ), element); + + // make sure required is at front + if (data.required) { + var param = data.required; + delete data.required; + data = $.extend({required: param}, data); + } + + return data; + } +}); + +// Custom selectors +$.extend($.expr[":"], { + // http://docs.jquery.com/Plugins/Validation/blank + blank: function(a) {return !$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/filled + filled: function(a) {return !!$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/unchecked + unchecked: function(a) {return !a.checked;} +}); + +// constructor for validator +$.validator = function( options, form ) { + this.settings = $.extend( true, {}, $.validator.defaults, options ); + this.currentForm = form; + this.init(); +}; + +$.validator.format = function(source, params) { + if ( arguments.length == 1 ) + return function() { + var args = $.makeArray(arguments); + args.unshift(source); + return $.validator.format.apply( this, args ); + }; + if ( arguments.length > 2 && params.constructor != Array ) { + params = $.makeArray(arguments).slice(1); + } + if ( params.constructor != Array ) { + params = [ params ]; + } + $.each(params, function(i, n) { + source = source.replace(new RegExp("\\{" + i + "\\}", "g"), n); + }); + return source; +}; + +$.extend($.validator, { + + defaults: { + messages: {}, + groups: {}, + rules: {}, + errorClass: "error", + validClass: "valid", + errorElement: "label", + focusInvalid: true, + errorContainer: $( [] ), + errorLabelContainer: $( [] ), + onsubmit: true, + ignore: [], + ignoreTitle: false, + onfocusin: function(element) { + this.lastActive = element; + + // hide error label and remove error class on focus if enabled + if ( this.settings.focusCleanup && !this.blockFocusCleanup ) { + this.settings.unhighlight && this.settings.unhighlight.call( this, element, this.settings.errorClass, this.settings.validClass ); + this.errorsFor(element).hide(); + } + }, + onfocusout: function(element) { + if ( !this.checkable(element) && (element.name in this.submitted || !this.optional(element)) ) { + this.element(element); + } + }, + onkeyup: function(element) { + if ( element.name in this.submitted || element == this.lastElement ) { + this.element(element); + } + }, + onclick: function(element) { + // click on selects, radiobuttons and checkboxes + if ( element.name in this.submitted ) + this.element(element); + // or option elements, check parent select in that case + else if (element.parentNode.name in this.submitted) + this.element(element.parentNode); + }, + highlight: function( element, errorClass, validClass ) { + $(element).addClass(errorClass).removeClass(validClass); + }, + unhighlight: function( element, errorClass, validClass ) { + $(element).removeClass(errorClass).addClass(validClass); + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/setDefaults + setDefaults: function(settings) { + $.extend( $.validator.defaults, settings ); + }, + + messages: { + required: "This field is required.", + remote: "Please fix this field.", + email: "Please enter a valid email address.", + url: "Please enter a valid URL.", + date: "Please enter a valid date.", + dateISO: "Please enter a valid date (ISO).", + number: "Please enter a valid number.", + digits: "Please enter only digits.", + creditcard: "Please enter a valid credit card number.", + equalTo: "Please enter the same value again.", + accept: "Please enter a value with a valid extension.", + maxlength: $.validator.format("Please enter no more than {0} characters."), + minlength: $.validator.format("Please enter at least {0} characters."), + rangelength: $.validator.format("Please enter a value between {0} and {1} characters long."), + range: $.validator.format("Please enter a value between {0} and {1}."), + max: $.validator.format("Please enter a value less than or equal to {0}."), + min: $.validator.format("Please enter a value greater than or equal to {0}.") + }, + + autoCreateRanges: false, + + prototype: { + + init: function() { + this.labelContainer = $(this.settings.errorLabelContainer); + this.errorContext = this.labelContainer.length && this.labelContainer || $(this.currentForm); + this.containers = $(this.settings.errorContainer).add( this.settings.errorLabelContainer ); + this.submitted = {}; + this.valueCache = {}; + this.pendingRequest = 0; + this.pending = {}; + this.invalid = {}; + this.reset(); + + var groups = (this.groups = {}); + $.each(this.settings.groups, function(key, value) { + $.each(value.split(/\s/), function(index, name) { + groups[name] = key; + }); + }); + var rules = this.settings.rules; + $.each(rules, function(key, value) { + rules[key] = $.validator.normalizeRule(value); + }); + + function delegate(event) { + var validator = $.data(this[0].form, "validator"), + eventType = "on" + event.type.replace(/^validate/, ""); + validator.settings[eventType] && validator.settings[eventType].call(validator, this[0] ); + } + $(this.currentForm) + .validateDelegate(":text, :password, :file, select, textarea", "focusin focusout keyup", delegate) + .validateDelegate(":radio, :checkbox, select, option", "click", delegate); + + if (this.settings.invalidHandler) + $(this.currentForm).bind("invalid-form.validate", this.settings.invalidHandler); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/form + form: function() { + this.checkForm(); + $.extend(this.submitted, this.errorMap); + this.invalid = $.extend({}, this.errorMap); + if (!this.valid()) + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.showErrors(); + return this.valid(); + }, + + checkForm: function() { + this.prepareForm(); + for ( var i = 0, elements = (this.currentElements = this.elements()); elements[i]; i++ ) { + this.check( elements[i] ); + } + return this.valid(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/element + element: function( element ) { + element = this.clean( element ); + this.lastElement = element; + this.prepareElement( element ); + this.currentElements = $(element); + var result = this.check( element ); + if ( result ) { + delete this.invalid[element.name]; + } else { + this.invalid[element.name] = true; + } + if ( !this.numberOfInvalids() ) { + // Hide error containers on last error + this.toHide = this.toHide.add( this.containers ); + } + this.showErrors(); + return result; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/showErrors + showErrors: function(errors) { + if(errors) { + // add items to error list and map + $.extend( this.errorMap, errors ); + this.errorList = []; + for ( var name in errors ) { + this.errorList.push({ + message: errors[name], + element: this.findByName(name)[0] + }); + } + // remove items from success list + this.successList = $.grep( this.successList, function(element) { + return !(element.name in errors); + }); + } + this.settings.showErrors + ? this.settings.showErrors.call( this, this.errorMap, this.errorList ) + : this.defaultShowErrors(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/resetForm + resetForm: function() { + if ( $.fn.resetForm ) + $( this.currentForm ).resetForm(); + this.submitted = {}; + this.prepareForm(); + this.hideErrors(); + this.elements().removeClass( this.settings.errorClass ); + }, + + numberOfInvalids: function() { + return this.objectLength(this.invalid); + }, + + objectLength: function( obj ) { + var count = 0; + for ( var i in obj ) + count++; + return count; + }, + + hideErrors: function() { + this.addWrapper( this.toHide ).hide(); + }, + + valid: function() { + return this.size() == 0; + }, + + size: function() { + return this.errorList.length; + }, + + focusInvalid: function() { + if( this.settings.focusInvalid ) { + try { + $(this.findLastActive() || this.errorList.length && this.errorList[0].element || []) + .filter(":visible") + .focus() + // manually trigger focusin event; without it, focusin handler isn't called, findLastActive won't have anything to find + .trigger("focusin"); + } catch(e) { + // ignore IE throwing errors when focusing hidden elements + } + } + }, + + findLastActive: function() { + var lastActive = this.lastActive; + return lastActive && $.grep(this.errorList, function(n) { + return n.element.name == lastActive.name; + }).length == 1 && lastActive; + }, + + elements: function() { + var validator = this, + rulesCache = {}; + + // select all valid inputs inside the form (no submit or reset buttons) + // workaround $Query([]).add until http://dev.jquery.com/ticket/2114 is solved + return $([]).add(this.currentForm.elements) + .filter(":input") + .not(":submit, :reset, :image, [disabled]") + .not( this.settings.ignore ) + .filter(function() { + !this.name && validator.settings.debug && window.console && console.error( "%o has no name assigned", this); + + // select only the first element for each name, and only those with rules specified + if ( this.name in rulesCache || !validator.objectLength($(this).rules()) ) + return false; + + rulesCache[this.name] = true; + return true; + }); + }, + + clean: function( selector ) { + return $( selector )[0]; + }, + + errors: function() { + return $( this.settings.errorElement + "." + this.settings.errorClass, this.errorContext ); + }, + + reset: function() { + this.successList = []; + this.errorList = []; + this.errorMap = {}; + this.toShow = $([]); + this.toHide = $([]); + this.currentElements = $([]); + }, + + prepareForm: function() { + this.reset(); + this.toHide = this.errors().add( this.containers ); + }, + + prepareElement: function( element ) { + this.reset(); + this.toHide = this.errorsFor(element); + }, + + check: function( element ) { + element = this.clean( element ); + + // if radio/checkbox, validate first element in group instead + if (this.checkable(element)) { + element = this.findByName( element.name )[0]; + } + + var rules = $(element).rules(); + var dependencyMismatch = false; + for( method in rules ) { + var rule = { method: method, parameters: rules[method] }; + try { + var result = $.validator.methods[method].call( this, element.value.replace(/\r/g, ""), element, rule.parameters ); + + // if a method indicates that the field is optional and therefore valid, + // don't mark it as valid when there are no other rules + if ( result == "dependency-mismatch" ) { + dependencyMismatch = true; + continue; + } + dependencyMismatch = false; + + if ( result == "pending" ) { + this.toHide = this.toHide.not( this.errorsFor(element) ); + return; + } + + if( !result ) { + this.formatAndAdd( element, rule ); + return false; + } + } catch(e) { + this.settings.debug && window.console && console.log("exception occured when checking element " + element.id + + ", check the '" + rule.method + "' method", e); + throw e; + } + } + if (dependencyMismatch) + return; + if ( this.objectLength(rules) ) + this.successList.push(element); + return true; + }, + + // return the custom message for the given element and validation method + // specified in the element's "messages" metadata + customMetaMessage: function(element, method) { + if (!$.metadata) + return; + + var meta = this.settings.meta + ? $(element).metadata()[this.settings.meta] + : $(element).metadata(); + + return meta && meta.messages && meta.messages[method]; + }, + + // return the custom message for the given element name and validation method + customMessage: function( name, method ) { + var m = this.settings.messages[name]; + return m && (m.constructor == String + ? m + : m[method]); + }, + + // return the first defined argument, allowing empty strings + findDefined: function() { + for(var i = 0; i < arguments.length; i++) { + if (arguments[i] !== undefined) + return arguments[i]; + } + return undefined; + }, + + defaultMessage: function( element, method) { + return this.findDefined( + this.customMessage( element.name, method ), + this.customMetaMessage( element, method ), + // title is never undefined, so handle empty string as undefined + !this.settings.ignoreTitle && element.title || undefined, + $.validator.messages[method], + "<strong>Warning: No message defined for " + element.name + "</strong>" + ); + }, + + formatAndAdd: function( element, rule ) { + var message = this.defaultMessage( element, rule.method ), + theregex = /\$?\{(\d+)\}/g; + if ( typeof message == "function" ) { + message = message.call(this, rule.parameters, element); + } else if (theregex.test(message)) { + message = jQuery.format(message.replace(theregex, '{$1}'), rule.parameters); + } + this.errorList.push({ + message: message, + element: element + }); + + this.errorMap[element.name] = message; + this.submitted[element.name] = message; + }, + + addWrapper: function(toToggle) { + if ( this.settings.wrapper ) + toToggle = toToggle.add( toToggle.parent( this.settings.wrapper ) ); + return toToggle; + }, + + defaultShowErrors: function() { + for ( var i = 0; this.errorList[i]; i++ ) { + var error = this.errorList[i]; + this.settings.highlight && this.settings.highlight.call( this, error.element, this.settings.errorClass, this.settings.validClass ); + this.showLabel( error.element, error.message ); + } + if( this.errorList.length ) { + this.toShow = this.toShow.add( this.containers ); + } + if (this.settings.success) { + for ( var i = 0; this.successList[i]; i++ ) { + this.showLabel( this.successList[i] ); + } + } + if (this.settings.unhighlight) { + for ( var i = 0, elements = this.validElements(); elements[i]; i++ ) { + this.settings.unhighlight.call( this, elements[i], this.settings.errorClass, this.settings.validClass ); + } + } + this.toHide = this.toHide.not( this.toShow ); + this.hideErrors(); + this.addWrapper( this.toShow ).show(); + }, + + validElements: function() { + return this.currentElements.not(this.invalidElements()); + }, + + invalidElements: function() { + return $(this.errorList).map(function() { + return this.element; + }); + }, + + showLabel: function(element, message) { + var label = this.errorsFor( element ); + if ( label.length ) { + // refresh error/success class + label.removeClass().addClass( this.settings.errorClass ); + + // check if we have a generated label, replace the message then + label.attr("generated") && label.html(message); + } else { + // create label + label = $("<" + this.settings.errorElement + "/>") + .attr({"for": this.idOrName(element), generated: true}) + .addClass(this.settings.errorClass) + .html(message || ""); + if ( this.settings.wrapper ) { + // make sure the element is visible, even in IE + // actually showing the wrapped element is handled elsewhere + label = label.hide().show().wrap("<" + this.settings.wrapper + "/>").parent(); + } + if ( !this.labelContainer.append(label).length ) + this.settings.errorPlacement + ? this.settings.errorPlacement(label, $(element) ) + : label.insertAfter(element); + } + if ( !message && this.settings.success ) { + label.text(""); + typeof this.settings.success == "string" + ? label.addClass( this.settings.success ) + : this.settings.success( label ); + } + this.toShow = this.toShow.add(label); + }, + + errorsFor: function(element) { + var name = this.idOrName(element); + return this.errors().filter(function() { + return $(this).attr('for') == name; + }); + }, + + idOrName: function(element) { + return this.groups[element.name] || (this.checkable(element) ? element.name : element.id || element.name); + }, + + checkable: function( element ) { + return /radio|checkbox/i.test(element.type); + }, + + findByName: function( name ) { + // select by name and filter by form for performance over form.find("[name=...]") + var form = this.currentForm; + return $(document.getElementsByName(name)).map(function(index, element) { + return element.form == form && element.name == name && element || null; + }); + }, + + getLength: function(value, element) { + switch( element.nodeName.toLowerCase() ) { + case 'select': + return $("option:selected", element).length; + case 'input': + if( this.checkable( element) ) + return this.findByName(element.name).filter(':checked').length; + } + return value.length; + }, + + depend: function(param, element) { + return this.dependTypes[typeof param] + ? this.dependTypes[typeof param](param, element) + : true; + }, + + dependTypes: { + "boolean": function(param, element) { + return param; + }, + "string": function(param, element) { + return !!$(param, element.form).length; + }, + "function": function(param, element) { + return param(element); + } + }, + + optional: function(element) { + return !$.validator.methods.required.call(this, $.trim(element.value), element) && "dependency-mismatch"; + }, + + startRequest: function(element) { + if (!this.pending[element.name]) { + this.pendingRequest++; + this.pending[element.name] = true; + } + }, + + stopRequest: function(element, valid) { + this.pendingRequest--; + // sometimes synchronization fails, make sure pendingRequest is never < 0 + if (this.pendingRequest < 0) + this.pendingRequest = 0; + delete this.pending[element.name]; + if ( valid && this.pendingRequest == 0 && this.formSubmitted && this.form() ) { + $(this.currentForm).submit(); + this.formSubmitted = false; + } else if (!valid && this.pendingRequest == 0 && this.formSubmitted) { + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.formSubmitted = false; + } + }, + + previousValue: function(element) { + return $.data(element, "previousValue") || $.data(element, "previousValue", { + old: null, + valid: true, + message: this.defaultMessage( element, "remote" ) + }); + } + + }, + + classRuleSettings: { + required: {required: true}, + email: {email: true}, + url: {url: true}, + date: {date: true}, + dateISO: {dateISO: true}, + dateDE: {dateDE: true}, + number: {number: true}, + numberDE: {numberDE: true}, + digits: {digits: true}, + creditcard: {creditcard: true} + }, + + addClassRules: function(className, rules) { + className.constructor == String ? + this.classRuleSettings[className] = rules : + $.extend(this.classRuleSettings, className); + }, + + classRules: function(element) { + var rules = {}; + var classes = $(element).attr('class'); + classes && $.each(classes.split(' '), function() { + if (this in $.validator.classRuleSettings) { + $.extend(rules, $.validator.classRuleSettings[this]); + } + }); + return rules; + }, + + attributeRules: function(element) { + var rules = {}; + var $element = $(element); + + for (method in $.validator.methods) { + var value = $element.attr(method); + if (value) { + rules[method] = value; + } + } + + // maxlength may be returned as -1, 2147483647 (IE) and 524288 (safari) for text inputs + if (rules.maxlength && /-1|2147483647|524288/.test(rules.maxlength)) { + delete rules.maxlength; + } + + return rules; + }, + + metadataRules: function(element) { + if (!$.metadata) return {}; + + var meta = $.data(element.form, 'validator').settings.meta; + return meta ? + $(element).metadata()[meta] : + $(element).metadata(); + }, + + staticRules: function(element) { + var rules = {}; + var validator = $.data(element.form, 'validator'); + if (validator.settings.rules) { + rules = $.validator.normalizeRule(validator.settings.rules[element.name]) || {}; + } + return rules; + }, + + normalizeRules: function(rules, element) { + // handle dependency check + $.each(rules, function(prop, val) { + // ignore rule when param is explicitly false, eg. required:false + if (val === false) { + delete rules[prop]; + return; + } + if (val.param || val.depends) { + var keepRule = true; + switch (typeof val.depends) { + case "string": + keepRule = !!$(val.depends, element.form).length; + break; + case "function": + keepRule = val.depends.call(element, element); + break; + } + if (keepRule) { + rules[prop] = val.param !== undefined ? val.param : true; + } else { + delete rules[prop]; + } + } + }); + + // evaluate parameters + $.each(rules, function(rule, parameter) { + rules[rule] = $.isFunction(parameter) ? parameter(element) : parameter; + }); + + // clean number parameters + $.each(['minlength', 'maxlength', 'min', 'max'], function() { + if (rules[this]) { + rules[this] = Number(rules[this]); + } + }); + $.each(['rangelength', 'range'], function() { + if (rules[this]) { + rules[this] = [Number(rules[this][0]), Number(rules[this][1])]; + } + }); + + if ($.validator.autoCreateRanges) { + // auto-create ranges + if (rules.min && rules.max) { + rules.range = [rules.min, rules.max]; + delete rules.min; + delete rules.max; + } + if (rules.minlength && rules.maxlength) { + rules.rangelength = [rules.minlength, rules.maxlength]; + delete rules.minlength; + delete rules.maxlength; + } + } + + // To support custom messages in metadata ignore rule methods titled "messages" + if (rules.messages) { + delete rules.messages; + } + + return rules; + }, + + // Converts a simple string to a {string: true} rule, e.g., "required" to {required:true} + normalizeRule: function(data) { + if( typeof data == "string" ) { + var transformed = {}; + $.each(data.split(/\s/), function() { + transformed[this] = true; + }); + data = transformed; + } + return data; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/addMethod + addMethod: function(name, method, message) { + $.validator.methods[name] = method; + $.validator.messages[name] = message != undefined ? message : $.validator.messages[name]; + if (method.length < 3) { + $.validator.addClassRules(name, $.validator.normalizeRule(name)); + } + }, + + methods: { + + // http://docs.jquery.com/Plugins/Validation/Methods/required + required: function(value, element, param) { + // check if dependency is met + if ( !this.depend(param, element) ) + return "dependency-mismatch"; + switch( element.nodeName.toLowerCase() ) { + case 'select': + // could be an array for select-multiple or a string, both are fine this way + var val = $(element).val(); + return val && val.length > 0; + case 'input': + if ( this.checkable(element) ) + return this.getLength(value, element) > 0; + default: + return $.trim(value).length > 0; + } + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/remote + remote: function(value, element, param) { + if ( this.optional(element) ) + return "dependency-mismatch"; + + var previous = this.previousValue(element); + if (!this.settings.messages[element.name] ) + this.settings.messages[element.name] = {}; + previous.originalMessage = this.settings.messages[element.name].remote; + this.settings.messages[element.name].remote = previous.message; + + param = typeof param == "string" && {url:param} || param; + + if ( previous.old !== value ) { + previous.old = value; + var validator = this; + this.startRequest(element); + var data = {}; + data[element.name] = value; + $.ajax($.extend(true, { + url: param, + mode: "abort", + port: "validate" + element.name, + dataType: "json", + data: data, + success: function(response) { + validator.settings.messages[element.name].remote = previous.originalMessage; + var valid = response === true; + if ( valid ) { + var submitted = validator.formSubmitted; + validator.prepareElement(element); + validator.formSubmitted = submitted; + validator.successList.push(element); + validator.showErrors(); + } else { + var errors = {}; + var message = (previous.message = response || validator.defaultMessage( element, "remote" )); + errors[element.name] = $.isFunction(message) ? message(value) : message; + validator.showErrors(errors); + } + previous.valid = valid; + validator.stopRequest(element, valid); + } + }, param)); + return "pending"; + } else if( this.pending[element.name] ) { + return "pending"; + } + return previous.valid; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/minlength + minlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/maxlength + maxlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/rangelength + rangelength: function(value, element, param) { + var length = this.getLength($.trim(value), element); + return this.optional(element) || ( length >= param[0] && length <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/min + min: function( value, element, param ) { + return this.optional(element) || value >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/max + max: function( value, element, param ) { + return this.optional(element) || value <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/range + range: function( value, element, param ) { + return this.optional(element) || ( value >= param[0] && value <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/email + email: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/ + return this.optional(element) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/url + url: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/iri/ + return this.optional(element) || /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/date + date: function(value, element) { + return this.optional(element) || !/Invalid|NaN/.test(new Date(value)); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/dateISO + dateISO: function(value, element) { + return this.optional(element) || /^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/number + number: function(value, element) { + return this.optional(element) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/digits + digits: function(value, element) { + return this.optional(element) || /^\d+$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/creditcard + // based on http://en.wikipedia.org/wiki/Luhn + creditcard: function(value, element) { + if ( this.optional(element) ) + return "dependency-mismatch"; + // accept only digits and dashes + if (/[^0-9-]+/.test(value)) + return false; + var nCheck = 0, + nDigit = 0, + bEven = false; + + value = value.replace(/\D/g, ""); + + for (var n = value.length - 1; n >= 0; n--) { + var cDigit = value.charAt(n); + var nDigit = parseInt(cDigit, 10); + if (bEven) { + if ((nDigit *= 2) > 9) + nDigit -= 9; + } + nCheck += nDigit; + bEven = !bEven; + } + + return (nCheck % 10) == 0; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/accept + accept: function(value, element, param) { + param = typeof param == "string" ? param.replace(/,/g, '|') : "png|jpe?g|gif"; + return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i")); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/equalTo + equalTo: function(value, element, param) { + // bind to the blur event of the target in order to revalidate whenever the target field is updated + // TODO find a way to bind the event just once, avoiding the unbind-rebind overhead + var target = $(param).unbind(".validate-equalTo").bind("blur.validate-equalTo", function() { + $(element).valid(); + }); + return value == target.val(); + } + + } + +}); + +// deprecated, use $.validator.format instead +$.format = $.validator.format; + +})(jQuery); + +// ajax mode: abort +// usage: $.ajax({ mode: "abort"[, port: "uniqueport"]}); +// if mode:"abort" is used, the previous request on that port (port can be undefined) is aborted via XMLHttpRequest.abort() +;(function($) { + var ajax = $.ajax; + var pendingRequests = {}; + $.ajax = function(settings) { + // create settings for compatibility with ajaxSetup + settings = $.extend(settings, $.extend({}, $.ajaxSettings, settings)); + var port = settings.port; + if (settings.mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + return (pendingRequests[port] = ajax.apply(this, arguments)); + } + return ajax.apply(this, arguments); + }; +})(jQuery); + +// provides cross-browser focusin and focusout events +// IE has native support, in other browsers, use event caputuring (neither bubbles) + +// provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation +// handler is only called when $(event.target).is(delegate), in the scope of the jquery-object for event.target +;(function($) { + // only implement if not provided by jQuery core (since 1.4) + // TODO verify if jQuery 1.4's implementation is compatible with older jQuery special-event APIs + if (!jQuery.event.special.focusin && !jQuery.event.special.focusout && document.addEventListener) { + $.each({ + focus: 'focusin', + blur: 'focusout' + }, function( original, fix ){ + $.event.special[fix] = { + setup:function() { + this.addEventListener( original, handler, true ); + }, + teardown:function() { + this.removeEventListener( original, handler, true ); + }, + handler: function(e) { + arguments[0] = $.event.fix(e); + arguments[0].type = fix; + return $.event.handle.apply(this, arguments); + } + }; + function handler(e) { + e = $.event.fix(e); + e.type = fix; + return $.event.handle.call(this, e); + } + }); + }; + $.extend($.fn, { + validateDelegate: function(delegate, type, handler) { + return this.bind(type, function(event) { + var target = $(event.target); + if (target.is(delegate)) { + return handler.apply(target, arguments); + } + }); + } + }); +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery.validate.min.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,20 @@ +/* + * Note: While Microsoft is not the author of this file, Microsoft is + * offering you a license subject to the terms of the Microsoft Software + * License Terms for Microsoft ASP.NET Model View Controller 3. + * Microsoft reserves all other rights. The notices below are provided + * for informational purposes only and are not the license terms under + * which Microsoft distributed this file. + * + * jQuery validation plug-in 1.7 + * + * http://bassistance.de/jquery-plugins/jquery-plugin-validation/ + * http://docs.jquery.com/Plugins/Validation + * + * Copyright (c) 2006 - 2008 Jörn Zaefferer + * + * $Id: jquery.validate.js 6403 2009-06-17 14:27:16Z joern.zaefferer $ + * + */ +(function($){$.extend($.fn,{validate:function(options){if(!this.length){options&&options.debug&&window.console&&console.warn("nothing selected, can't validate, returning nothing");return;}var validator=$.data(this[0],'validator');if(validator){return validator;}validator=new $.validator(options,this[0]);$.data(this[0],'validator',validator);if(validator.settings.onsubmit){this.find("input, button").filter(".cancel").click(function(){validator.cancelSubmit=true;});if(validator.settings.submitHandler){this.find("input, button").filter(":submit").click(function(){validator.submitButton=this;});}this.submit(function(event){if(validator.settings.debug)event.preventDefault();function handle(){if(validator.settings.submitHandler){if(validator.submitButton){var hidden=$("<input type='hidden'/>").attr("name",validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm);}validator.settings.submitHandler.call(validator,validator.currentForm);if(validator.submitButton){hidden.remove();}return false;}return true;}if(validator.cancelSubmit){validator.cancelSubmit=false;return handle();}if(validator.form()){if(validator.pendingRequest){validator.formSubmitted=true;return false;}return handle();}else{validator.focusInvalid();return false;}});}return validator;},valid:function(){if($(this[0]).is('form')){return this.validate().form();}else{var valid=true;var validator=$(this[0].form).validate();this.each(function(){valid&=validator.element(this);});return valid;}},removeAttrs:function(attributes){var result={},$element=this;$.each(attributes.split(/\s/),function(index,value){result[value]=$element.attr(value);$element.removeAttr(value);});return result;},rules:function(command,argument){var element=this[0];if(command){var settings=$.data(element.form,'validator').settings;var staticRules=settings.rules;var existingRules=$.validator.staticRules(element);switch(command){case"add":$.extend(existingRules,$.validator.normalizeRule(argument));staticRules[element.name]=existingRules;if(argument.messages)settings.messages[element.name]=$.extend(settings.messages[element.name],argument.messages);break;case"remove":if(!argument){delete staticRules[element.name];return existingRules;}var filtered={};$.each(argument.split(/\s/),function(index,method){filtered[method]=existingRules[method];delete existingRules[method];});return filtered;}}var data=$.validator.normalizeRules($.extend({},$.validator.metadataRules(element),$.validator.classRules(element),$.validator.attributeRules(element),$.validator.staticRules(element)),element);if(data.required){var param=data.required;delete data.required;data=$.extend({required:param},data);}return data;}});$.extend($.expr[":"],{blank:function(a){return!$.trim(""+a.value);},filled:function(a){return!!$.trim(""+a.value);},unchecked:function(a){return!a.checked;}});$.validator=function(options,form){this.settings=$.extend(true,{},$.validator.defaults,options);this.currentForm=form;this.init();};$.validator.format=function(source,params){if(arguments.length==1)return function(){var args=$.makeArray(arguments);args.unshift(source);return $.validator.format.apply(this,args);};if(arguments.length>2&¶ms.constructor!=Array){params=$.makeArray(arguments).slice(1);}if(params.constructor!=Array){params=[params];}$.each(params,function(i,n){source=source.replace(new RegExp("\\{"+i+"\\}","g"),n);});return source;};$.extend($.validator,{defaults:{messages:{},groups:{},rules:{},errorClass:"error",validClass:"valid",errorElement:"label",focusInvalid:true,errorContainer:$([]),errorLabelContainer:$([]),onsubmit:true,ignore:[],ignoreTitle:false,onfocusin:function(element){this.lastActive=element;if(this.settings.focusCleanup&&!this.blockFocusCleanup){this.settings.unhighlight&&this.settings.unhighlight.call(this,element,this.settings.errorClass,this.settings.validClass);this.errorsFor(element).hide();}},onfocusout:function(element){if(!this.checkable(element)&&(element.name in this.submitted||!this.optional(element))){this.element(element);}},onkeyup:function(element){if(element.name in this.submitted||element==this.lastElement){this.element(element);}},onclick:function(element){if(element.name in this.submitted)this.element(element);else if(element.parentNode.name in this.submitted)this.element(element.parentNode);},highlight:function(element,errorClass,validClass){$(element).addClass(errorClass).removeClass(validClass);},unhighlight:function(element,errorClass,validClass){$(element).removeClass(errorClass).addClass(validClass);}},setDefaults:function(settings){$.extend($.validator.defaults,settings);},messages:{required:"This field is required.",remote:"Please fix this field.",email:"Please enter a valid email address.",url:"Please enter a valid URL.",date:"Please enter a valid date.",dateISO:"Please enter a valid date (ISO).",number:"Please enter a valid number.",digits:"Please enter only digits.",creditcard:"Please enter a valid credit card number.",equalTo:"Please enter the same value again.",accept:"Please enter a value with a valid extension.",maxlength:$.validator.format("Please enter no more than {0} characters."),minlength:$.validator.format("Please enter at least {0} characters."),rangelength:$.validator.format("Please enter a value between {0} and {1} characters long."),range:$.validator.format("Please enter a value between {0} and {1}."),max:$.validator.format("Please enter a value less than or equal to {0}."),min:$.validator.format("Please enter a value greater than or equal to {0}.")},autoCreateRanges:false,prototype:{init:function(){this.labelContainer=$(this.settings.errorLabelContainer);this.errorContext=this.labelContainer.length&&this.labelContainer||$(this.currentForm);this.containers=$(this.settings.errorContainer).add(this.settings.errorLabelContainer);this.submitted={};this.valueCache={};this.pendingRequest=0;this.pending={};this.invalid={};this.reset();var groups=(this.groups={});$.each(this.settings.groups,function(key,value){$.each(value.split(/\s/),function(index,name){groups[name]=key;});});var rules=this.settings.rules;$.each(rules,function(key,value){rules[key]=$.validator.normalizeRule(value);});function delegate(event){var validator=$.data(this[0].form,"validator"),eventType="on"+event.type.replace(/^validate/,"");validator.settings[eventType]&&validator.settings[eventType].call(validator,this[0]);}$(this.currentForm).validateDelegate(":text, :password, :file, select, textarea","focusin focusout keyup",delegate).validateDelegate(":radio, :checkbox, select, option","click",delegate);if(this.settings.invalidHandler)$(this.currentForm).bind("invalid-form.validate",this.settings.invalidHandler);},form:function(){this.checkForm();$.extend(this.submitted,this.errorMap);this.invalid=$.extend({},this.errorMap);if(!this.valid())$(this.currentForm).triggerHandler("invalid-form",[this]);this.showErrors();return this.valid();},checkForm:function(){this.prepareForm();for(var i=0,elements=(this.currentElements=this.elements());elements[i];i++){this.check(elements[i]);}return this.valid();},element:function(element){element=this.clean(element);this.lastElement=element;this.prepareElement(element);this.currentElements=$(element);var result=this.check(element);if(result){delete this.invalid[element.name];}else{this.invalid[element.name]=true;}if(!this.numberOfInvalids()){this.toHide=this.toHide.add(this.containers);}this.showErrors();return result;},showErrors:function(errors){if(errors){$.extend(this.errorMap,errors);this.errorList=[];for(var name in errors){this.errorList.push({message:errors[name],element:this.findByName(name)[0]});}this.successList=$.grep(this.successList,function(element){return!(element.name in errors);});}this.settings.showErrors?this.settings.showErrors.call(this,this.errorMap,this.errorList):this.defaultShowErrors();},resetForm:function(){if($.fn.resetForm)$(this.currentForm).resetForm();this.submitted={};this.prepareForm();this.hideErrors();this.elements().removeClass(this.settings.errorClass);},numberOfInvalids:function(){return this.objectLength(this.invalid);},objectLength:function(obj){var count=0;for(var i in obj)count++;return count;},hideErrors:function(){this.addWrapper(this.toHide).hide();},valid:function(){return this.size()==0;},size:function(){return this.errorList.length;},focusInvalid:function(){if(this.settings.focusInvalid){try{$(this.findLastActive()||this.errorList.length&&this.errorList[0].element||[]).filter(":visible").focus().trigger("focusin");}catch(e){}}},findLastActive:function(){var lastActive=this.lastActive;return lastActive&&$.grep(this.errorList,function(n){return n.element.name==lastActive.name;}).length==1&&lastActive;},elements:function(){var validator=this,rulesCache={};return $([]).add(this.currentForm.elements).filter(":input").not(":submit, :reset, :image, [disabled]").not(this.settings.ignore).filter(function(){!this.name&&validator.settings.debug&&window.console&&console.error("%o has no name assigned",this);if(this.name in rulesCache||!validator.objectLength($(this).rules()))return false;rulesCache[this.name]=true;return true;});},clean:function(selector){return $(selector)[0];},errors:function(){return $(this.settings.errorElement+"."+this.settings.errorClass,this.errorContext);},reset:function(){this.successList=[];this.errorList=[];this.errorMap={};this.toShow=$([]);this.toHide=$([]);this.currentElements=$([]);},prepareForm:function(){this.reset();this.toHide=this.errors().add(this.containers);},prepareElement:function(element){this.reset();this.toHide=this.errorsFor(element);},check:function(element){element=this.clean(element);if(this.checkable(element)){element=this.findByName(element.name)[0];}var rules=$(element).rules();var dependencyMismatch=false;for(method in rules){var rule={method:method,parameters:rules[method]};try{var result=$.validator.methods[method].call(this,element.value.replace(/\r/g,""),element,rule.parameters);if(result=="dependency-mismatch"){dependencyMismatch=true;continue;}dependencyMismatch=false;if(result=="pending"){this.toHide=this.toHide.not(this.errorsFor(element));return;}if(!result){this.formatAndAdd(element,rule);return false;}}catch(e){this.settings.debug&&window.console&&console.log("exception occured when checking element "+element.id ++", check the '"+rule.method+"' method",e);throw e;}}if(dependencyMismatch)return;if(this.objectLength(rules))this.successList.push(element);return true;},customMetaMessage:function(element,method){if(!$.metadata)return;var meta=this.settings.meta?$(element).metadata()[this.settings.meta]:$(element).metadata();return meta&&meta.messages&&meta.messages[method];},customMessage:function(name,method){var m=this.settings.messages[name];return m&&(m.constructor==String?m:m[method]);},findDefined:function(){for(var i=0;i<arguments.length;i++){if(arguments[i]!==undefined)return arguments[i];}return undefined;},defaultMessage:function(element,method){return this.findDefined(this.customMessage(element.name,method),this.customMetaMessage(element,method),!this.settings.ignoreTitle&&element.title||undefined,$.validator.messages[method],"<strong>Warning: No message defined for "+element.name+"</strong>");},formatAndAdd:function(element,rule){var message=this.defaultMessage(element,rule.method),theregex=/\$?\{(\d+)\}/g;if(typeof message=="function"){message=message.call(this,rule.parameters,element);}else if(theregex.test(message)){message=jQuery.format(message.replace(theregex,'{$1}'),rule.parameters);}this.errorList.push({message:message,element:element});this.errorMap[element.name]=message;this.submitted[element.name]=message;},addWrapper:function(toToggle){if(this.settings.wrapper)toToggle=toToggle.add(toToggle.parent(this.settings.wrapper));return toToggle;},defaultShowErrors:function(){for(var i=0;this.errorList[i];i++){var error=this.errorList[i];this.settings.highlight&&this.settings.highlight.call(this,error.element,this.settings.errorClass,this.settings.validClass);this.showLabel(error.element,error.message);}if(this.errorList.length){this.toShow=this.toShow.add(this.containers);}if(this.settings.success){for(var i=0;this.successList[i];i++){this.showLabel(this.successList[i]);}}if(this.settings.unhighlight){for(var i=0,elements=this.validElements();elements[i];i++){this.settings.unhighlight.call(this,elements[i],this.settings.errorClass,this.settings.validClass);}}this.toHide=this.toHide.not(this.toShow);this.hideErrors();this.addWrapper(this.toShow).show();},validElements:function(){return this.currentElements.not(this.invalidElements());},invalidElements:function(){return $(this.errorList).map(function(){return this.element;});},showLabel:function(element,message){var label=this.errorsFor(element);if(label.length){label.removeClass().addClass(this.settings.errorClass);label.attr("generated")&&label.html(message);}else{label=$("<"+this.settings.errorElement+"/>").attr({"for":this.idOrName(element),generated:true}).addClass(this.settings.errorClass).html(message||"");if(this.settings.wrapper){label=label.hide().show().wrap("<"+this.settings.wrapper+"/>").parent();}if(!this.labelContainer.append(label).length)this.settings.errorPlacement?this.settings.errorPlacement(label,$(element)):label.insertAfter(element);}if(!message&&this.settings.success){label.text("");typeof this.settings.success=="string"?label.addClass(this.settings.success):this.settings.success(label);}this.toShow=this.toShow.add(label);},errorsFor:function(element){var name=this.idOrName(element);return this.errors().filter(function(){return $(this).attr('for')==name;});},idOrName:function(element){return this.groups[element.name]||(this.checkable(element)?element.name:element.id||element.name);},checkable:function(element){return/radio|checkbox/i.test(element.type);},findByName:function(name){var form=this.currentForm;return $(document.getElementsByName(name)).map(function(index,element){return element.form==form&&element.name==name&&element||null;});},getLength:function(value,element){switch(element.nodeName.toLowerCase()){case'select':return $("option:selected",element).length;case'input':if(this.checkable(element))return this.findByName(element.name).filter(':checked').length;}return value.length;},depend:function(param,element){return this.dependTypes[typeof param]?this.dependTypes[typeof param](param,element):true;},dependTypes:{"boolean":function(param,element){return param;},"string":function(param,element){return!!$(param,element.form).length;},"function":function(param,element){return param(element);}},optional:function(element){return!$.validator.methods.required.call(this,$.trim(element.value),element)&&"dependency-mismatch";},startRequest:function(element){if(!this.pending[element.name]){this.pendingRequest++;this.pending[element.name]=true;}},stopRequest:function(element,valid){this.pendingRequest--;if(this.pendingRequest<0)this.pendingRequest=0;delete this.pending[element.name];if(valid&&this.pendingRequest==0&&this.formSubmitted&&this.form()){$(this.currentForm).submit();this.formSubmitted=false;}else if(!valid&&this.pendingRequest==0&&this.formSubmitted){$(this.currentForm).triggerHandler("invalid-form",[this]);this.formSubmitted=false;}},previousValue:function(element){return $.data(element,"previousValue")||$.data(element,"previousValue",{old:null,valid:true,message:this.defaultMessage(element,"remote")});}},classRuleSettings:{required:{required:true},email:{email:true},url:{url:true},date:{date:true},dateISO:{dateISO:true},dateDE:{dateDE:true},number:{number:true},numberDE:{numberDE:true},digits:{digits:true},creditcard:{creditcard:true}},addClassRules:function(className,rules){className.constructor==String?this.classRuleSettings[className]=rules:$.extend(this.classRuleSettings,className);},classRules:function(element){var rules={};var classes=$(element).attr('class');classes&&$.each(classes.split(' '),function(){if(this in $.validator.classRuleSettings){$.extend(rules,$.validator.classRuleSettings[this]);}});return rules;},attributeRules:function(element){var rules={};var $element=$(element);for(method in $.validator.methods){var value=$element.attr(method);if(value){rules[method]=value;}}if(rules.maxlength&&/-1|2147483647|524288/.test(rules.maxlength)){delete rules.maxlength;}return rules;},metadataRules:function(element){if(!$.metadata)return{};var meta=$.data(element.form,'validator').settings.meta;return meta?$(element).metadata()[meta]:$(element).metadata();},staticRules:function(element){var rules={};var validator=$.data(element.form,'validator');if(validator.settings.rules){rules=$.validator.normalizeRule(validator.settings.rules[element.name])||{};}return rules;},normalizeRules:function(rules,element){$.each(rules,function(prop,val){if(val===false){delete rules[prop];return;}if(val.param||val.depends){var keepRule=true;switch(typeof val.depends){case"string":keepRule=!!$(val.depends,element.form).length;break;case"function":keepRule=val.depends.call(element,element);break;}if(keepRule){rules[prop]=val.param!==undefined?val.param:true;}else{delete rules[prop];}}});$.each(rules,function(rule,parameter){rules[rule]=$.isFunction(parameter)?parameter(element):parameter;});$.each(['minlength','maxlength','min','max'],function(){if(rules[this]){rules[this]=Number(rules[this]);}});$.each(['rangelength','range'],function(){if(rules[this]){rules[this]=[Number(rules[this][0]),Number(rules[this][1])];}});if($.validator.autoCreateRanges){if(rules.min&&rules.max){rules.range=[rules.min,rules.max];delete rules.min;delete rules.max;}if(rules.minlength&&rules.maxlength){rules.rangelength=[rules.minlength,rules.maxlength];delete rules.minlength;delete rules.maxlength;}}if(rules.messages){delete rules.messages;}return rules;},normalizeRule:function(data){if(typeof data=="string"){var transformed={};$.each(data.split(/\s/),function(){transformed[this]=true;});data=transformed;}return data;},addMethod:function(name,method,message){$.validator.methods[name]=method;$.validator.messages[name]=message!=undefined?message:$.validator.messages[name];if(method.length<3){$.validator.addClassRules(name,$.validator.normalizeRule(name));}},methods:{required:function(value,element,param){if(!this.depend(param,element))return"dependency-mismatch";switch(element.nodeName.toLowerCase()){case'select':var val=$(element).val();return val&&val.length>0;case'input':if(this.checkable(element))return this.getLength(value,element)>0;default:return $.trim(value).length>0;}},remote:function(value,element,param){if(this.optional(element))return"dependency-mismatch";var previous=this.previousValue(element);if(!this.settings.messages[element.name])this.settings.messages[element.name]={};previous.originalMessage=this.settings.messages[element.name].remote;this.settings.messages[element.name].remote=previous.message;param=typeof param=="string"&&{url:param}||param;if(previous.old!==value){previous.old=value;var validator=this;this.startRequest(element);var data={};data[element.name]=value;$.ajax($.extend(true,{url:param,mode:"abort",port:"validate"+element.name,dataType:"json",data:data,success:function(response){validator.settings.messages[element.name].remote=previous.originalMessage;var valid=response===true;if(valid){var submitted=validator.formSubmitted;validator.prepareElement(element);validator.formSubmitted=submitted;validator.successList.push(element);validator.showErrors();}else{var errors={};var message=(previous.message=response||validator.defaultMessage(element,"remote"));errors[element.name]=$.isFunction(message)?message(value):message;validator.showErrors(errors);}previous.valid=valid;validator.stopRequest(element,valid);}},param));return"pending";}else if(this.pending[element.name]){return"pending";}return previous.valid;},minlength:function(value,element,param){return this.optional(element)||this.getLength($.trim(value),element)>=param;},maxlength:function(value,element,param){return this.optional(element)||this.getLength($.trim(value),element)<=param;},rangelength:function(value,element,param){var length=this.getLength($.trim(value),element);return this.optional(element)||(length>=param[0]&&length<=param[1]);},min:function(value,element,param){return this.optional(element)||value>=param;},max:function(value,element,param){return this.optional(element)||value<=param;},range:function(value,element,param){return this.optional(element)||(value>=param[0]&&value<=param[1]);},email:function(value,element){return this.optional(element)||/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(value);},url:function(value,element){return this.optional(element)||/^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value);},date:function(value,element){return this.optional(element)||!/Invalid|NaN/.test(new Date(value));},dateISO:function(value,element){return this.optional(element)||/^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value);},number:function(value,element){return this.optional(element)||/^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value);},digits:function(value,element){return this.optional(element)||/^\d+$/.test(value);},creditcard:function(value,element){if(this.optional(element))return"dependency-mismatch";if(/[^0-9-]+/.test(value))return false;var nCheck=0,nDigit=0,bEven=false;value=value.replace(/\D/g,"");for(var n=value.length-1;n>=0;n--){var cDigit=value.charAt(n);var nDigit=parseInt(cDigit,10);if(bEven){if((nDigit*=2)>9)nDigit-=9;}nCheck+=nDigit;bEven=!bEven;}return(nCheck%10)==0;},accept:function(value,element,param){param=typeof param=="string"?param.replace(/,/g,'|'):"png|jpe?g|gif";return this.optional(element)||value.match(new RegExp(".("+param+")$","i"));},equalTo:function(value,element,param){var target=$(param).unbind(".validate-equalTo").bind("blur.validate-equalTo",function(){$(element).valid();});return value==target.val();}}});$.format=$.validator.format;})(jQuery);;(function($){var ajax=$.ajax;var pendingRequests={};$.ajax=function(settings){settings=$.extend(settings,$.extend({},$.ajaxSettings,settings));var port=settings.port;if(settings.mode=="abort"){if(pendingRequests[port]){pendingRequests[port].abort();}return(pendingRequests[port]=ajax.apply(this,arguments));}return ajax.apply(this,arguments);};})(jQuery);;(function($){if(!jQuery.event.special.focusin&&!jQuery.event.special.focusout&&document.addEventListener){$.each({focus:'focusin',blur:'focusout'},function(original,fix){$.event.special[fix]={setup:function(){this.addEventListener(original,handler,true);},teardown:function(){this.removeEventListener(original,handler,true);},handler:function(e){arguments[0]=$.event.fix(e);arguments[0].type=fix;return $.event.handle.apply(this,arguments);}};function handler(e){e=$.event.fix(e);e.type=fix;return $.event.handle.call(this,e);}});};$.extend($.fn,{validateDelegate:function(delegate,type,handler){return this.bind(type,function(event){var target=$(event.target);if(target.is(delegate)){return handler.apply(target,arguments);}});}});})(jQuery); \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery.validate.unobtrusive.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,319 @@ +/// <reference path="jquery-1.4.4.js" /> +/// <reference path="jquery.validate.js" /> + +/*! +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ + +/*jslint white: true, browser: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: true, newcap: true, immed: true, strict: false */ +/*global document: false, jQuery: false */ + +(function ($) { + var $jQval = $.validator, + adapters, + data_validation = "unobtrusiveValidation"; + + function setValidationValues(options, ruleName, value) { + options.rules[ruleName] = value; + if (options.message) { + options.messages[ruleName] = options.message; + } + } + + function splitAndTrim(value) { + return value.replace(/^\s+|\s+$/g, "").split(/\s*,\s*/g); + } + + function getModelPrefix(fieldName) { + return fieldName.substr(0, fieldName.lastIndexOf(".") + 1); + } + + function appendModelPrefix(value, prefix) { + if (value.indexOf("*.") === 0) { + value = value.replace("*.", prefix); + } + return value; + } + + function onError(error, inputElement) { // 'this' is the form element + var container = $(this).find("[data-valmsg-for='" + inputElement[0].name + "']"), + replace = $.parseJSON(container.attr("data-valmsg-replace")) !== false; + + container.removeClass("field-validation-valid").addClass("field-validation-error"); + error.data("unobtrusiveContainer", container); + + if (replace) { + container.empty(); + error.removeClass("input-validation-error").appendTo(container); + } + else { + error.hide(); + } + } + + function onErrors(form, validator) { // 'this' is the form element + var container = $(this).find("[data-valmsg-summary=true]"), + list = container.find("ul"); + + if (list && list.length && validator.errorList.length) { + list.empty(); + container.addClass("validation-summary-errors").removeClass("validation-summary-valid"); + + $.each(validator.errorList, function () { + $("<li />").html(this.message).appendTo(list); + }); + } + } + + function onSuccess(error) { // 'this' is the form element + var container = error.data("unobtrusiveContainer"), + replace = $.parseJSON(container.attr("data-valmsg-replace")); + + if (container) { + container.addClass("field-validation-valid").removeClass("field-validation-error"); + error.removeData("unobtrusiveContainer"); + + if (replace) { + container.empty(); + } + } + } + + function validationInfo(form) { + var $form = $(form), + result = $form.data(data_validation); + + if (!result) { + result = { + options: { // options structure passed to jQuery Validate's validate() method + errorClass: "input-validation-error", + errorElement: "span", + errorPlacement: $.proxy(onError, form), + invalidHandler: $.proxy(onErrors, form), + messages: {}, + rules: {}, + success: $.proxy(onSuccess, form) + }, + attachValidation: function () { + $form.validate(this.options); + }, + validate: function () { // a validation function that is called by unobtrusive Ajax + $form.validate(); + return $form.valid(); + } + }; + $form.data(data_validation, result); + } + + return result; + } + + $jQval.unobtrusive = { + adapters: [], + + parseElement: function (element, skipAttach) { + /// <summary> + /// Parses a single HTML element for unobtrusive validation attributes. + /// </summary> + /// <param name="element" domElement="true">The HTML element to be parsed.</param> + /// <param name="skipAttach" type="Boolean">[Optional] true to skip attaching the + /// validation to the form. If parsing just this single element, you should specify true. + /// If parsing several elements, you should specify false, and manually attach the validation + /// to the form when you are finished. The default is false.</param> + var $element = $(element), + form = $element.parents("form")[0], + valInfo, rules, messages; + + if (!form) { // Cannot do client-side validation without a form + return; + } + + valInfo = validationInfo(form); + valInfo.options.rules[element.name] = rules = {}; + valInfo.options.messages[element.name] = messages = {}; + + $.each(this.adapters, function () { + var prefix = "data-val-" + this.name, + message = $element.attr(prefix), + paramValues = {}; + + if (message !== undefined) { // Compare against undefined, because an empty message is legal (and falsy) + prefix += "-"; + + $.each(this.params, function () { + paramValues[this] = $element.attr(prefix + this); + }); + + this.adapt({ + element: element, + form: form, + message: message, + params: paramValues, + rules: rules, + messages: messages + }); + } + }); + + jQuery.extend(rules, { "__dummy__": true }); + + if (!skipAttach) { + valInfo.attachValidation(); + } + }, + + parse: function (selector) { + /// <summary> + /// Parses all the HTML elements in the specified selector. It looks for input elements decorated + /// with the [data-val=true] attribute value and enables validation according to the data-val-* + /// attribute values. + /// </summary> + /// <param name="selector" type="String">Any valid jQuery selector.</param> + $(selector).find(":input[data-val=true]").each(function () { + $jQval.unobtrusive.parseElement(this, true); + }); + + $("form").each(function () { + var info = validationInfo(this); + if (info) { + info.attachValidation(); + } + }); + } + }; + + adapters = $jQval.unobtrusive.adapters; + + adapters.add = function (adapterName, params, fn) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="params" type="Array" optional="true">[Optional] An array of parameter names (strings) that will + /// be extracted from the data-val-nnnn-mmmm HTML attributes (where nnnn is the adapter name, and + /// mmmm is the parameter name).</param> + /// <param name="fn" type="Function">The function to call, which adapts the values from the HTML + /// attributes into jQuery Validate rules and/or messages.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + if (!fn) { // Called with no params, just a function + fn = params; + params = []; + } + this.push({ name: adapterName, params: params, adapt: fn }); + return this; + }; + + adapters.addBool = function (adapterName, ruleName) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has no parameter values.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="ruleName" type="String" optional="true">[Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, function (options) { + setValidationValues(options, ruleName || adapterName, true); + }); + }; + + adapters.addMinMax = function (adapterName, minRuleName, maxRuleName, minMaxRuleName, minAttribute, maxAttribute) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation has three potential rules (one for min-only, one for max-only, and + /// one for min-and-max). The HTML parameters are expected to be named -min and -max.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute (where nnnn is the adapter name).</param> + /// <param name="minRuleName" type="String">The name of the jQuery Validate rule to be used when you only + /// have a minimum value.</param> + /// <param name="maxRuleName" type="String">The name of the jQuery Validate rule to be used when you only + /// have a maximum value.</param> + /// <param name="minMaxRuleName" type="String">The name of the jQuery Validate rule to be used when you + /// have both a minimum and maximum value.</param> + /// <param name="minAttribute" type="String" optional="true">[Optional] The name of the HTML attribute that + /// contains the minimum value. The default is "min".</param> + /// <param name="maxAttribute" type="String" optional="true">[Optional] The name of the HTML attribute that + /// contains the maximum value. The default is "max".</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, [minAttribute || "min", maxAttribute || "max"], function (options) { + var min = options.params.min, + max = options.params.max; + + if (min && max) { + setValidationValues(options, minMaxRuleName, [min, max]); + } + else if (min) { + setValidationValues(options, minRuleName, min); + } + else if (max) { + setValidationValues(options, maxRuleName, max); + } + }); + }; + + adapters.addSingleVal = function (adapterName, attribute, ruleName) { + /// <summary>Adds a new adapter to convert unobtrusive HTML into a jQuery Validate validation, where + /// the jQuery Validate validation rule has a single value.</summary> + /// <param name="adapterName" type="String">The name of the adapter to be added. This matches the name used + /// in the data-val-nnnn HTML attribute(where nnnn is the adapter name).</param> + /// <param name="attribute" type="String">[Optional] The name of the HTML attribute that contains the value. + /// The default is "val".</param> + /// <param name="ruleName" type="String" optional="true">[Optional] The name of the jQuery Validate rule. If not provided, the value + /// of adapterName will be used instead.</param> + /// <returns type="jQuery.validator.unobtrusive.adapters" /> + return this.add(adapterName, [attribute || "val"], function (options) { + setValidationValues(options, ruleName || adapterName, options.params[attribute]); + }); + }; + + $jQval.addMethod("__dummy__", function (value, element, params) { + return true; + }); + + $jQval.addMethod("regex", function (value, element, params) { + var match; + if (this.optional(element)) { + return true; + } + + match = new RegExp(params).exec(value); + return (match && (match.index === 0) && (match[0].length === value.length)); + }); + + adapters.addSingleVal("accept", "exts").addSingleVal("regex", "pattern"); + adapters.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url"); + adapters.addMinMax("length", "minlength", "maxlength", "rangelength").addMinMax("range", "min", "max", "range"); + adapters.add("equalto", ["other"], function (options) { + var prefix = getModelPrefix(options.element.name), + other = options.params.other, + fullOtherName = appendModelPrefix(other, prefix), + element = $(options.form).find(":input[name=" + fullOtherName + "]")[0]; + + setValidationValues(options, "equalTo", element); + }); + adapters.add("required", function (options) { + // jQuery Validate equates "required" with "mandatory" for checkbox elements + if (options.element.tagName.toUpperCase() !== "INPUT" || options.element.type.toUpperCase() !== "CHECKBOX") { + setValidationValues(options, "required", true); + } + }); + adapters.add("remote", ["url", "type", "additionalfields"], function (options) { + var value = { + url: options.params.url, + type: options.params.type || "GET", + data: {} + }, + prefix = getModelPrefix(options.element.name); + + $.each(splitAndTrim(options.params.additionalfields || options.element.name), function (i, fieldName) { + var paramName = appendModelPrefix(fieldName, prefix); + value.data[paramName] = function () { + return $(options.form).find(":input[name='" + paramName + "']").val(); + }; + }); + + setValidationValues(options, "remote", value); + }); + + $(function () { + $jQval.unobtrusive.parse(document); + }); +}(jQuery)); \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Scripts/jquery.validate.unobtrusive.min.js Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,5 @@ +/* +** Unobtrusive validation support library for jQuery and jQuery Validate +** Copyright (C) Microsoft Corporation. All rights reserved. +*/ +(function(a){var d=a.validator,b,f="unobtrusiveValidation";function c(a,b,c){a.rules[b]=c;if(a.message)a.messages[b]=a.message}function i(a){return a.replace(/^\s+|\s+$/g,"").split(/\s*,\s*/g)}function g(a){return a.substr(0,a.lastIndexOf(".")+1)}function e(a,b){if(a.indexOf("*.")===0)a=a.replace("*.",b);return a}function l(c,d){var b=a(this).find("[data-valmsg-for='"+d[0].name+"']"),e=a.parseJSON(b.attr("data-valmsg-replace"))!==false;b.removeClass("field-validation-valid").addClass("field-validation-error");c.data("unobtrusiveContainer",b);if(e){b.empty();c.removeClass("input-validation-error").appendTo(b)}else c.hide()}function k(e,d){var c=a(this).find("[data-valmsg-summary=true]"),b=c.find("ul");if(b&&b.length&&d.errorList.length){b.empty();c.addClass("validation-summary-errors").removeClass("validation-summary-valid");a.each(d.errorList,function(){a("<li />").html(this.message).appendTo(b)})}}function j(c){var b=c.data("unobtrusiveContainer"),d=a.parseJSON(b.attr("data-valmsg-replace"));if(b){b.addClass("field-validation-valid").removeClass("field-validation-error");c.removeData("unobtrusiveContainer");d&&b.empty()}}function h(d){var b=a(d),c=b.data(f);if(!c){c={options:{errorClass:"input-validation-error",errorElement:"span",errorPlacement:a.proxy(l,d),invalidHandler:a.proxy(k,d),messages:{},rules:{},success:a.proxy(j,d)},attachValidation:function(){b.validate(this.options)},validate:function(){b.validate();return b.valid()}};b.data(f,c)}return c}d.unobtrusive={adapters:[],parseElement:function(b,i){var d=a(b),f=d.parents("form")[0],c,e,g;if(!f)return;c=h(f);c.options.rules[b.name]=e={};c.options.messages[b.name]=g={};a.each(this.adapters,function(){var c="data-val-"+this.name,i=d.attr(c),h={};if(i!==undefined){c+="-";a.each(this.params,function(){h[this]=d.attr(c+this)});this.adapt({element:b,form:f,message:i,params:h,rules:e,messages:g})}});jQuery.extend(e,{__dummy__:true});!i&&c.attachValidation()},parse:function(b){a(b).find(":input[data-val=true]").each(function(){d.unobtrusive.parseElement(this,true)});a("form").each(function(){var a=h(this);a&&a.attachValidation()})}};b=d.unobtrusive.adapters;b.add=function(c,a,b){if(!b){b=a;a=[]}this.push({name:c,params:a,adapt:b});return this};b.addBool=function(a,b){return this.add(a,function(d){c(d,b||a,true)})};b.addMinMax=function(e,g,f,a,d,b){return this.add(e,[d||"min",b||"max"],function(b){var e=b.params.min,d=b.params.max;if(e&&d)c(b,a,[e,d]);else if(e)c(b,g,e);else d&&c(b,f,d)})};b.addSingleVal=function(a,b,d){return this.add(a,[b||"val"],function(e){c(e,d||a,e.params[b])})};d.addMethod("__dummy__",function(){return true});d.addMethod("regex",function(b,c,d){var a;if(this.optional(c))return true;a=(new RegExp(d)).exec(b);return a&&a.index===0&&a[0].length===b.length});b.addSingleVal("accept","exts").addSingleVal("regex","pattern");b.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url");b.addMinMax("length","minlength","maxlength","rangelength").addMinMax("range","min","max","range");b.add("equalto",["other"],function(b){var h=g(b.element.name),i=b.params.other,d=e(i,h),f=a(b.form).find(":input[name="+d+"]")[0];c(b,"equalTo",f)});b.add("required",function(a){(a.element.tagName.toUpperCase()!=="INPUT"||a.element.type.toUpperCase()!=="CHECKBOX")&&c(a,"required",true)});b.add("remote",["url","type","additionalfields"],function(b){var d={url:b.params.url,type:b.params.type||"GET",data:{}},f=g(b.element.name);a.each(i(b.params.additionalfields||b.element.name),function(h,g){var c=e(g,f);d.data[c]=function(){return a(b.form).find(":input[name='"+c+"']").val()}});c(b,"remote",d)});a(function(){d.unobtrusive.parse(document)})})(jQuery); \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Account/ChangePassword.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,53 @@ +@model Agendas.Web.Models.ChangePasswordModel + +@{ + ViewBag.Title = "Change Password"; +} + +<h2>Change Password</h2> +<p> + Use the form below to change your password. +</p> +<p> + New passwords are required to be a minimum of @ViewBag.PasswordLength characters in length. +</p> + +<script src="@Url.Content("~/Scripts/jquery.validate.min.js")" type="text/javascript"></script> +<script src="@Url.Content("~/Scripts/jquery.validate.unobtrusive.min.js")" type="text/javascript"></script> + +@using (Html.BeginForm()) { + @Html.ValidationSummary(true, "Password change was unsuccessful. Please correct the errors and try again.") + <div> + <fieldset> + <legend>Account Information</legend> + + <div class="editor-label"> + @Html.LabelFor(m => m.OldPassword) + </div> + <div class="editor-field"> + @Html.PasswordFor(m => m.OldPassword) + @Html.ValidationMessageFor(m => m.OldPassword) + </div> + + <div class="editor-label"> + @Html.LabelFor(m => m.NewPassword) + </div> + <div class="editor-field"> + @Html.PasswordFor(m => m.NewPassword) + @Html.ValidationMessageFor(m => m.NewPassword) + </div> + + <div class="editor-label"> + @Html.LabelFor(m => m.ConfirmPassword) + </div> + <div class="editor-field"> + @Html.PasswordFor(m => m.ConfirmPassword) + @Html.ValidationMessageFor(m => m.ConfirmPassword) + </div> + + <p> + <input type="submit" value="Change Password" /> + </p> + </fieldset> + </div> +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Account/ChangePasswordSuccess.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,8 @@ +@{ + ViewBag.Title = "Change Password"; +} + +<h2>Change Password</h2> +<p> + Your password has been changed successfully. +</p>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Account/LogOn.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,48 @@ +@model Agendas.Web.Models.LogOnModel + +@{ + ViewBag.Title = "Log On"; +} + +<h2>Log On</h2> +<p> + Please enter your username and password. @Html.ActionLink("Register", "Register") if you don't have an account. +</p> + +<script src="@Url.Content("~/Scripts/jquery.validate.min.js")" type="text/javascript"></script> +<script src="@Url.Content("~/Scripts/jquery.validate.unobtrusive.min.js")" type="text/javascript"></script> + +@Html.ValidationSummary(true, "Login was unsuccessful. Please correct the errors and try again.") + +@using (Html.BeginForm()) { + <div> + <fieldset> + <legend>Account Information</legend> + + <div class="editor-label"> + @Html.LabelFor(m => m.UserName) + </div> + <div class="editor-field"> + @Html.TextBoxFor(m => m.UserName) + @Html.ValidationMessageFor(m => m.UserName) + </div> + + <div class="editor-label"> + @Html.LabelFor(m => m.Password) + </div> + <div class="editor-field"> + @Html.PasswordFor(m => m.Password) + @Html.ValidationMessageFor(m => m.Password) + </div> + + <div class="editor-label"> + @Html.CheckBoxFor(m => m.RememberMe) + @Html.LabelFor(m => m.RememberMe) + </div> + + <p> + <input type="submit" value="Log On" /> + </p> + </fieldset> + </div> +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Account/Register.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,61 @@ +@model Agendas.Web.Models.RegisterModel + +@{ + ViewBag.Title = "Register"; +} + +<h2>Create a New Account</h2> +<p> + Use the form below to create a new account. +</p> +<p> + Passwords are required to be a minimum of @ViewBag.PasswordLength characters in length. +</p> + +<script src="@Url.Content("~/Scripts/jquery.validate.min.js")" type="text/javascript"></script> +<script src="@Url.Content("~/Scripts/jquery.validate.unobtrusive.min.js")" type="text/javascript"></script> + +@using (Html.BeginForm()) { + @Html.ValidationSummary(true, "Account creation was unsuccessful. Please correct the errors and try again.") + <div> + <fieldset> + <legend>Account Information</legend> + + <div class="editor-label"> + @Html.LabelFor(m => m.UserName) + </div> + <div class="editor-field"> + @Html.TextBoxFor(m => m.UserName) + @Html.ValidationMessageFor(m => m.UserName) + </div> + + <div class="editor-label"> + @Html.LabelFor(m => m.Email) + </div> + <div class="editor-field"> + @Html.TextBoxFor(m => m.Email) + @Html.ValidationMessageFor(m => m.Email) + </div> + + <div class="editor-label"> + @Html.LabelFor(m => m.Password) + </div> + <div class="editor-field"> + @Html.PasswordFor(m => m.Password) + @Html.ValidationMessageFor(m => m.Password) + </div> + + <div class="editor-label"> + @Html.LabelFor(m => m.ConfirmPassword) + </div> + <div class="editor-field"> + @Html.PasswordFor(m => m.ConfirmPassword) + @Html.ValidationMessageFor(m => m.ConfirmPassword) + </div> + + <p> + <input type="submit" value="Register" /> + </p> + </fieldset> + </div> +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Agenda/Index.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,29 @@ +@model Agendas.Web.Models.AgendaIndexModel +@{ + ViewBag.Title = "Agenda"; +} + +<p> + Los próximos eventos son: +</p> +<table> + <thead> + <tr> + <th>Evento</th> + <th>Acciones</th> + </tr> + </thead> + <tbody> + @foreach (var item in Model.ProximosEventos) + { + <tr> + <td>@item.Titulo</td> + <td>@Html.ActionLink("Modificar", "Edit", new { id = item.Id })</td> + </tr> + } + </tbody> +</table> + +<p> +@Html.ActionLink("Nuevo", "New") +</p>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Agenda/New.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,34 @@ +@model Agendas.Web.Models.AgendaNewModel +@{ + ViewBag.Title = "Agenda"; +} + +<p> + Complete los siguiente datos para agendar un nuevo evento +</p> + +<link href="@Url.Content("~/Content/themes/base/jquery-ui.css")" rel="stylesheet" type="text/css" /> +<script src="@Url.Content("~/Scripts/jquery-ui.js")" type="text/javascript"></script> + +<script src="@Url.Content("~/Scripts/jquery.validate.min.js")" type="text/javascript"></script> +<script src="@Url.Content("~/Scripts/jquery.validate.unobtrusive.min.js")" type="text/javascript"></script> + +<script type="text/javascript"> + $(document).ready(function () { + $("#Fecha").datepicker(); + }); +</script> + +@using (Html.BeginForm()) +{ + @Html.ValidationSummary(true, "Los datos ingresados no son validos, por favor verifíquelos") + <div> + <fieldset> + <legend>Datos del evento:</legend> + @Html.EditorForModel() + <p> + <input type="submit" value="Guardar" /> + </p> + </fieldset> + </div> +} \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Home/About.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,12 @@ +@{ + ViewBag.Title = "About Us"; +} + +<p> + Desarrollado por colaboradores de la comunidad + <ul> + <li>Juan José Montes de Oca</li> + <li>Nelo Pauselli</li> + <li>¿quién mas?</li> + </ul> +</p>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Home/Index.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,11 @@ +@{ + ViewBag.Title = "Home Page"; +} + +<p> + Bienvenido al módulo de gestión de VANs de <a href='http://www.altnethispano.org/'>alt.net-hispano</a>, desde aquí podrá: + <ul> + <li>Proponer y/o agendar nuevas VANs</li> + <li>Ver el histórico de VANs ya publicadas</li> + </ul> +</p>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Shared/Error.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,9 @@ +@model System.Web.Mvc.HandleErrorInfo + +@{ + ViewBag.Title = "Error"; +} + +<h2> + Sorry, an error occurred while processing your request. +</h2>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Shared/_Layout.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,40 @@ +<!DOCTYPE html> +<html> +<head> + <title>Gestión de VANs</title> + <link href="@Url.Content("~/Content/Site.css")" rel="stylesheet" type="text/css" /> + <script src="@Url.Content("~/Scripts/jquery-1.4.4.min.js")" type="text/javascript"></script> +</head> + +<body> + <div class="page"> + <div id="header"> + <div id="title"> + <h1>Gestión de VANs</h1> + </div> + + <div id="logindisplay"> + @Html.Partial("_LogOnPartial") + </div> + + <div id="menucontainer"> + + <ul id="menu"> + <li>@Html.ActionLink("Home", "Index", "Home")</li> + <li>@Html.ActionLink("Agenda", "Index", "Agenda")</li> + <li>@Html.ActionLink("Histórico", "Index", "Histórico")</li> + <li>@Html.ActionLink("About", "About", "Home")</li> + </ul> + + </div> + </div> + + <div id="main"> + <h2>@ViewBag.Title</h2> + @RenderBody() + <div id="footer"> + </div> + </div> + </div> +</body> +</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Shared/_LogOnPartial.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,7 @@ +@if(Request.IsAuthenticated) { + <text>Welcome <b>@Context.User.Identity.Name</b>! + [ @Html.ActionLink("Log Off", "LogOff", "Account") ]</text> +} +else { + @:[ @Html.ActionLink("Log On", "LogOn", "Account") ] +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/Web.config Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,58 @@ +<?xml version="1.0"?> + +<configuration> + <configSections> + <sectionGroup name="system.web.webPages.razor" type="System.Web.WebPages.Razor.Configuration.RazorWebSectionGroup, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <section name="host" type="System.Web.WebPages.Razor.Configuration.HostSection, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" /> + <section name="pages" type="System.Web.WebPages.Razor.Configuration.RazorPagesSection, System.Web.WebPages.Razor, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" requirePermission="false" /> + </sectionGroup> + </configSections> + + <system.web.webPages.razor> + <host factoryType="System.Web.Mvc.MvcWebRazorHostFactory, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <pages pageBaseType="System.Web.Mvc.WebViewPage"> + <namespaces> + <add namespace="System.Web.Mvc" /> + <add namespace="System.Web.Mvc.Ajax" /> + <add namespace="System.Web.Mvc.Html" /> + <add namespace="System.Web.Routing" /> + </namespaces> + </pages> + </system.web.webPages.razor> + + <appSettings> + <add key="webpages:Enabled" value="false" /> + </appSettings> + + <system.web> + <httpHandlers> + <add path="*" verb="*" type="System.Web.HttpNotFoundHandler"/> + </httpHandlers> + + <!-- + Enabling request validation in view pages would cause validation to occur + after the input has already been processed by the controller. By default + MVC performs request validation before a controller processes the input. + To change this behavior apply the ValidateInputAttribute to a + controller or action. + --> + <pages + validateRequest="false" + pageParserFilterType="System.Web.Mvc.ViewTypeParserFilter, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" + pageBaseType="System.Web.Mvc.ViewPage, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" + userControlBaseType="System.Web.Mvc.ViewUserControl, System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35"> + <controls> + <add assembly="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" namespace="System.Web.Mvc" tagPrefix="mvc" /> + </controls> + </pages> + </system.web> + + <system.webServer> + <validation validateIntegratedModeConfiguration="false" /> + + <handlers> + <remove name="BlockViewHandler"/> + <add name="BlockViewHandler" path="*" verb="*" preCondition="integratedMode" type="System.Web.HttpNotFoundHandler" /> + </handlers> + </system.webServer> +</configuration>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Views/_ViewStart.cshtml Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,3 @@ +@{ + Layout = "~/Views/Shared/_Layout.cshtml"; +} \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Web.Debug.config Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,30 @@ +<?xml version="1.0"?> + +<!-- For more information on using web.config transformation visit http://go.microsoft.com/fwlink/?LinkId=125889 --> + +<configuration xmlns:xdt="http://schemas.microsoft.com/XML-Document-Transform"> + <!-- + In the example below, the "SetAttributes" transform will change the value of + "connectionString" to use "ReleaseSQLServer" only when the "Match" locator + finds an atrribute "name" that has a value of "MyDB". + + <connectionStrings> + <add name="MyDB" + connectionString="Data Source=ReleaseSQLServer;Initial Catalog=MyReleaseDB;Integrated Security=True" + xdt:Transform="SetAttributes" xdt:Locator="Match(name)"/> + </connectionStrings> + --> + <system.web> + <!-- + In the example below, the "Replace" transform will replace the entire + <customErrors> section of your web.config file. + Note that because there is only one customErrors section under the + <system.web> node, there is no need to use the "xdt:Locator" attribute. + + <customErrors defaultRedirect="GenericError.htm" + mode="RemoteOnly" xdt:Transform="Replace"> + <error statusCode="500" redirect="InternalError.htm"/> + </customErrors> + --> + </system.web> +</configuration> \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Web.Release.config Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,31 @@ +<?xml version="1.0"?> + +<!-- For more information on using web.config transformation visit http://go.microsoft.com/fwlink/?LinkId=125889 --> + +<configuration xmlns:xdt="http://schemas.microsoft.com/XML-Document-Transform"> + <!-- + In the example below, the "SetAttributes" transform will change the value of + "connectionString" to use "ReleaseSQLServer" only when the "Match" locator + finds an atrribute "name" that has a value of "MyDB". + + <connectionStrings> + <add name="MyDB" + connectionString="Data Source=ReleaseSQLServer;Initial Catalog=MyReleaseDB;Integrated Security=True" + xdt:Transform="SetAttributes" xdt:Locator="Match(name)"/> + </connectionStrings> + --> + <system.web> + <compilation xdt:Transform="RemoveAttributes(debug)" /> + <!-- + In the example below, the "Replace" transform will replace the entire + <customErrors> section of your web.config file. + Note that because there is only one customErrors section under the + <system.web> node, there is no need to use the "xdt:Locator" attribute. + + <customErrors defaultRedirect="GenericError.htm" + mode="RemoteOnly" xdt:Transform="Replace"> + <error statusCode="500" redirect="InternalError.htm"/> + </customErrors> + --> + </system.web> +</configuration> \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Agendas/trunk/src/Agendas.Web/Web.config Sun Mar 13 18:51:06 2011 -0300 @@ -0,0 +1,84 @@ +<?xml version="1.0"?> +<!-- + For more information on how to configure your ASP.NET application, please visit + http://go.microsoft.com/fwlink/?LinkId=152368 + --> + +<configuration> + <connectionStrings> + <add name="ApplicationServices" + connectionString="data source=.\SQLEXPRESS;Integrated Security=SSPI;AttachDBFilename=|DataDirectory|aspnetdb.mdf;User Instance=true" + providerName="System.Data.SqlClient" /> + </connectionStrings> + + <appSettings> + <add key="ClientValidationEnabled" value="true"/> + <add key="UnobtrusiveJavaScriptEnabled" value="true"/> + </appSettings> + + <system.web> + <compilation debug="true" targetFramework="4.0"> + <assemblies> + <add assembly="System.Web.Abstractions, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add assembly="System.Web.Helpers, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add assembly="System.Web.Routing, Version=4.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add assembly="System.Web.Mvc, Version=3.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + <add assembly="System.Web.WebPages, Version=1.0.0.0, Culture=neutral, PublicKeyToken=31BF3856AD364E35" /> + </assemblies> + </compilation> + + <authentication mode="Forms"> + <forms loginUrl="~/Account/LogOn" timeout="2880" /> + </authentication> + + <membership> + <providers> + <clear/> + <add name="AspNetSqlMembershipProvider" type="System.Web.Security.SqlMembershipProvider" connectionStringName="ApplicationServices" + enablePasswordRetrieval="false" enablePasswordReset="true" requiresQuestionAndAnswer="false" requiresUniqueEmail="false" + maxInvalidPasswordAttempts="5" minRequiredPasswordLength="6" minRequiredNonalphanumericCharacters="0" passwordAttemptWindow="10" + applicationName="/" /> + </providers> + </membership> + + <profile> + <providers> + <clear/> + <add name="AspNetSqlProfileProvider" type="System.Web.Profile.SqlProfileProvider" connectionStringName="ApplicationServices" applicationName="/" /> + </providers> + </profile> + + <roleManager enabled="false"> + <providers> + <clear/> + <add name="AspNetSqlRoleProvider" type="System.Web.Security.SqlRoleProvider" connectionStringName="ApplicationServices" applicationName="/" /> + <add name="AspNetWindowsTokenRoleProvider" type="System.Web.Security.WindowsTokenRoleProvider" applicationName="/" /> + </providers> + </roleManager> + + <pages> + <namespaces> + <add namespace="System.Web.Helpers" /> + <add namespace="System.Web.Mvc" /> + <add namespace="System.Web.Mvc.Ajax" /> + <add namespace="System.Web.Mvc.Html" /> + <add namespace="System.Web.Routing" /> + <add namespace="System.Web.WebPages"/> + </namespaces> + </pages> + </system.web> + + <system.webServer> + <validation validateIntegratedModeConfiguration="false"/> + <modules runAllManagedModulesForAllRequests="true"/> + </system.webServer> + + <runtime> + <assemblyBinding xmlns="urn:schemas-microsoft-com:asm.v1"> + <dependentAssembly> + <assemblyIdentity name="System.Web.Mvc" publicKeyToken="31bf3856ad364e35" /> + <bindingRedirect oldVersion="1.0.0.0-2.0.0.0" newVersion="3.0.0.0" /> + </dependentAssembly> + </assemblyBinding> + </runtime> +</configuration>
--- a/Agendas/trunk/src/Agendas.sln Sat Feb 12 12:22:36 2011 -0300 +++ b/Agendas/trunk/src/Agendas.sln Sun Mar 13 18:51:06 2011 -0300 @@ -11,6 +11,8 @@ EndProject Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "Agendas.Repositories.Memory", "Agendas.Repositories.Memory\Agendas.Repositories.Memory.csproj", "{28C5EBFB-EE69-4765-A880-D4DE0BC89F48}" EndProject +Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "Agendas.Web", "Agendas.Web\Agendas.Web.csproj", "{319A8E3D-C61E-455F-A1BF-A6B1B1636BAB}" +EndProject Global GlobalSection(SolutionConfigurationPlatforms) = preSolution Debug|Any CPU = Debug|Any CPU @@ -37,6 +39,10 @@ {28C5EBFB-EE69-4765-A880-D4DE0BC89F48}.Debug|Any CPU.Build.0 = Debug|Any CPU {28C5EBFB-EE69-4765-A880-D4DE0BC89F48}.Release|Any CPU.ActiveCfg = Release|Any CPU {28C5EBFB-EE69-4765-A880-D4DE0BC89F48}.Release|Any CPU.Build.0 = Release|Any CPU + {319A8E3D-C61E-455F-A1BF-A6B1B1636BAB}.Debug|Any CPU.ActiveCfg = Debug|Any CPU + {319A8E3D-C61E-455F-A1BF-A6B1B1636BAB}.Debug|Any CPU.Build.0 = Debug|Any CPU + {319A8E3D-C61E-455F-A1BF-A6B1B1636BAB}.Release|Any CPU.ActiveCfg = Release|Any CPU + {319A8E3D-C61E-455F-A1BF-A6B1B1636BAB}.Release|Any CPU.Build.0 = Release|Any CPU EndGlobalSection GlobalSection(SolutionProperties) = preSolution HideSolutionNode = FALSE